diff -Nru firefox-54.0~b1+build1/browser/app/blocklist.xml firefox-54.0~b2+build1/browser/app/blocklist.xml --- firefox-54.0~b1+build1/browser/app/blocklist.xml 2017-04-20 12:54:32.000000000 +0000 +++ firefox-54.0~b2+build1/browser/app/blocklist.xml 2017-04-25 05:28:18.000000000 +0000 @@ -1,801 +1,808 @@ - + - + - + - + - + - + - + - - - - - browser.startup.homepage - browser.search.defaultenginename - - + - - - - - + - + - + + + + + - + - + - - - app.update.auto - app.update.enabled - app.update.interval - app.update.url - + + - + - + - + - + - + - + - + - + - + - + + - + browser.startup.homepage browser.search.defaultenginename - + - + - - + - + - + - + + + + + - + - + - + - + - + - + - + + + + + - + - + - + - + - + - + - + + + + + + browser.startup.homepage + browser.search.defaultenginename + - + - + - + - + - + - + - - - - - + - - - - - + - - + + + browser.startup.homepage + browser.search.defaultenginename + - + - + - + - + - + - + - + - + - - - - - browser.search.defaultenginename - - + - - - - - + - + - + - + - + - - - - - + - + - + - + - + browser.startup.homepage browser.search.defaultenginename - + - - - browser.startup.homepage - browser.search.defaultenginename - + + - + - - - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - - - - - + - + + + - + - + - - + + + security.csp.enable + security.fileuri.strict_origin_policy + security.mixed_content.block_active_content + - - - - - + - + - + - - - - - + - + - + - + - + - - - - - + - + - - - - - - - - - - + - + - + - + + + + + - + - + - + - + - + - + - + - + - + - + - + - - - - - + - + - + - + - + - + - + + + + + - + - + - + - + - + - + - + - - + + + app.update.auto + app.update.enabled + app.update.interval + app.update.url + - - - - - - - - - + - + - - + + + browser.startup.homepage + browser.search.defaultenginename + - + - + - + - + browser.startup.homepage browser.search.defaultenginename - + - + - + - + - - - - - - + - + - - - + - + - + - - - - - browser.startup.homepage - browser.search.defaultenginename - - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - - - browser.startup.homepage - browser.search.defaultenginename - + + - + - + - + - + - + - + browser.startup.homepage - + + + + + + + + + + + + + + + + + + + + + - security.csp.enable - security.fileuri.strict_origin_policy - security.mixed_content.block_active_content + browser.startup.homepage + browser.search.defaultenginename - + - + - + + + + + + + + + + + + + browser.startup.homepage + browser.search.defaultenginename + + + + + + + + + + + browser.startup.homepage + browser.search.defaultenginename + + + + + + + + + + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + + + + + - + - - - - - + - + - + - + + + + + + + + + + + + + + + + + + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - - - + + + browser.startup.homepage + + - + - + - + - + - + - + - - - - - + - + - + - + - + - - - - - + - + - + - + - + - + - - - - - - + - + - + @@ -803,1311 +810,1330 @@ - + + + + + + + browser.startup.homepage browser.search.defaultenginename - + - + - + - + - + - + - + - + - + - + - + + browser.startup.homepage browser.search.defaultenginename - - - browser.startup.homepage - browser.search.defaultenginename - - - - - - browser.startup.homepage - - + + + - + - + - + - + - + - + - + - - + - + - + + + + + - + - - - - - + - + - + + + + + - + - + - + - - - browser.startup.homepage - browser.search.defaultenginename - + + - + + + + + - + - + - + + + + + + - + - + - + - + - + - + - + - + - + + + + + - + + + + + - + - + - + - + - + - + - + + + + + - + - + - + - + + - + - + - + - + - + - + - + + + + + + + + + - + - + - + + + browser.startup.homepage + browser.search.defaultenginename + + + + - + - + + + + + - + - + + + + + - + - + - + - + - + - + + + + + browser.startup.homepage browser.search.defaultenginename - + - + - + + - + - + - + - + - - - browser.startup.homepage - browser.search.defaultenginename - - - - + - + browser.startup.homepage - browser.search.defaultenginename - - - browser.startup.homepage - browser.search.defaultenginename - + + - + - - - - - - + - + - + - + - + - + + + + + - + - + - + - + - + + + + + - + - + - + - - - browser.startup.homepage - browser.search.defaultenginename - - - - + - + - + - + - + - - - - - - - - - + - + - + - - - browser.startup.homepage - browser.search.defaultenginename - - - - + - + - + - + - + browser.startup.homepage browser.search.defaultenginename - - - - - + - + - + - + - + - + - + - + - + - + - + - + - + - + + + + + + + + + - browser.startup.homepage browser.search.defaultenginename - + - + - + + + + + + + + + - + - + - - - + + + browser.startup.homepage + browser.search.defaultenginename + + - + + + browser.startup.homepage + browser.search.defaultenginename + + + + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + + + + + - + - + - + - + - + - + - + - - - + + + browser.startup.homepage + browser.search.defaultenginename + + - + - + - + - + - + - - - - - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + + + + + - + - + - + - + - + - + - + - + - + - + + + + + browser.startup.homepage + browser.search.defaultenginename - - - - - + - + - + - + + + + + - + - + - + - + + + + + - + - + - + - + - + - + - + - + - + - - - - - - - - - + - + - - + + + browser.startup.homepage + browser.search.defaultenginename + - + - - - - - + - + - + - + - + - + - + - + - + - + - + - + - + + + + + - + - + + + + + + + + + + - + - + - - - - - + - + - + - + - + - - - - - browser.startup.homepage - browser.search.defaultenginename - - + + + + + - + - + - - - browser.startup.homepage - browser.search.defaultenginename - - - - + - + - - + - + - + - + - + - + - + - + - + - + + + + + - + - - - + + + browser.search.defaultenginename + + - + - + - + - + - + - + - + - + - + - + + + + + - + - + browser.startup.homepage + browser.search.defaultenginename - + - - - - - + - + - - - - - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + + + + + - + - - - - - + - + - + - - - - - + - + - + - + + + + + - + - + - + + + + + - + - + - + - + - + - + - + - + - - + + + browser.startup.homepage + - + - - - - - - - - - + - + - + - + - + - + - + - + - - - - - + - + - + - + - + - + - + - + - - + + + browser.startup.homepage + browser.search.defaultenginename + - + - + - + - + - + - - - - - browser.startup.homepage - browser.search.defaultenginename - - + - + - + - + - - - - - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - + - - - - - - - - - - - - - - - - - - - - - - - + + + browser.startup.homepage + browser.search.defaultenginename + + - + - - - - - - - - - - - - - + - + - + - + - + - + - - - - - + - + - + - + - + - + - + - - - - - browser.startup.homepage - browser.search.defaultenginename - - + - + - + - + - + - + + + + + + + + + + + + + + + + + + https://get.adobe.com/flashplayer/ - + + + + + https://get.adobe.com/flashplayer/ + https://get.adobe.com/flashplayer/ - - - - - - - - + + + - - - https://get.adobe.com/shockwave/ - + + + - - - + + + + + + + https://get.adobe.com/flashplayer/ + + + + + https://java.com/ + @@ -2117,299 +2143,300 @@ - + + + https://java.com/ + + + + + + + + + https://get.adobe.com/flashplayer/ + + + https://get.adobe.com/flashplayer/ - + + + + + https://get.adobe.com/flashplayer/ + https://get.adobe.com/flashplayer/ - - - - - - - + + + - - - + + + - + https://get.adobe.com/flashplayer/ - + - - + + https://get.adobe.com/flashplayer/ - + - + https://get.adobe.com/flashplayer/ - + - - - - - - - - + + + https://get.adobe.com/flashplayer/ + - - - https://get.adobe.com/shockwave/ - + + + - - - - + + + https://java.com/ + + + + + https://real.com/ + + + + + https://get.adobe.com/flashplayer/ + - + - - + + + + + https://get.adobe.com/flashplayer/ - + - + https://get.adobe.com/flashplayer/ - + - - - https://java.com/ - - - - - https://get.adobe.com/flashplayer/ - + + + + https://java.com/ + - - - https://get.adobe.com/flashplayer/ - + + + + + + + - - - https://get.adobe.com/flashplayer/ - + + + - + https://get.adobe.com/flashplayer/ - - - - - - - - + - - - https://get.adobe.com/flashplayer/ - + + + + + - + https://get.adobe.com/flashplayer/ - - - - - https://java.com/ - - - - - + - - + + - + - + - - + + + https://get.adobe.com/flashplayer/ - - - - - - + - + - - - https://get.adobe.com/flashplayer/ - - - - + + + https://get.adobe.com/flashplayer/ - - - - - - - - - - https://java.com/ - - - - - - - - - https://java.com/ - - - - - - - - - - + - - - https://real.com/ - - - + https://get.adobe.com/flashplayer/ - - - - - - - - - - https://java.com/ - - - - - + - - + + https://get.adobe.com/flashplayer/ - - - - - + - + - - - + + https://get.adobe.com/flashplayer/ - + - + - + + + https://get.adobe.com/reader/ + + + + + https://get.adobe.com/reader/ + + + + + + + - https://get.adobe.com/flashplayer/ - + + + + + - + - - - https://www.microsoft.com/getsilverlight - + + + - - - + + https://java.com/ - + - - + + + + + + + https://get.adobe.com/reader + + + + + + + + https://get.adobe.com/flashplayer/ - + - - + + https://get.adobe.com/flashplayer/ - + - - + + + + + + + + + + + + + + + + + + + + + + + https://get.adobe.com/reader/ + + - - - + + + + + + + - - + + @@ -2417,50 +2444,51 @@ - - - https://get.adobe.com/flashplayer/ - + + + + - + - - + + + https://get.adobe.com/shockwave/ + + + + https://get.adobe.com/flashplayer/ - + + + + + - + - - - - https://java.com/ - - - + - https://java.com/ - - - - - + + + + + - - + + https://get.adobe.com/flashplayer/ - + - - - https://get.adobe.com/flashplayer/ - + + + - + @@ -2469,93 +2497,138 @@ https://java.com/ - - - + + + + + + + https://get.adobe.com/flashplayer/ + + + + + https://java.com/ - - - + + + + + - + - + - https://get.adobe.com/flashplayer/ - - - - - + - - - + + https://get.adobe.com/flashplayer/ - + + + + + https://get.adobe.com/flashplayer/ + + + + + - + - - + + + + https://java.com/ + + + + + https://java.com/ + + + + + https://get.adobe.com/flashplayer/ + + + + - + - + - - + + + https://java.com/ + + + + https://java.com/ - + https://get.adobe.com/flashplayer/ - - - - + - - + + https://get.adobe.com/flashplayer/ - + - - + + + + + + https://get.adobe.com/flashplayer/ - + - + https://get.adobe.com/flashplayer/ - + - - - + + + + - + - - - https://get.adobe.com/flashplayer/ - + + + - - + + + + + + + + + + + @@ -2563,152 +2636,142 @@ - - - https://get.adobe.com/flashplayer/ - - - - - - + + - + - - + + https://get.adobe.com/flashplayer/ - - - - - - - + - - + + https://get.adobe.com/flashplayer/ - + - + + + + + + + + https://java.com/ + + + - + - - - + + + https://java.com/ + - - - + + + https://get.adobe.com/flashplayer/ + + + + + - - - - https://java.com/ - - - + https://get.adobe.com/flashplayer/ - - - - - https://get.adobe.com/reader/ - + - - + + https://java.com/ - - - - - - - - - - + + https://get.adobe.com/flashplayer/ - + - + https://get.adobe.com/flashplayer/ - + - - - - + + + https://get.adobe.com/flashplayer/ + - - - https://java.com/ - + + + https://get.adobe.com/flashplayer/ + - + - - - - - - - https://get.adobe.com/flashplayer/ - + + + - - - https://get.adobe.com/flashplayer/ - + + + + + + + + - + + https://get.adobe.com/flashplayer/ - - - - - + - + - - + + + https://get.adobe.com/flashplayer/ - + - + - + + + + + + + https://get.adobe.com/flashplayer/ + + + https://java.com/ - + @@ -2728,67 +2791,156 @@ - - - - - - - + + + + - - + + + + https://java.com/ + + + + + + https://java.com/ + + + + + + + + + https://get.adobe.com/reader + + + + + https://support.apple.com/en-us/HT205771 + + + + + + + + + + + https://java.com/ + + + + https://get.adobe.com/flashplayer/ - + - + + + + https://java.com/ + + + + + + https://java.com/ + + + https://get.adobe.com/flashplayer/ - + - + + + + + + + https://java.com/ + + + + + https://get.adobe.com/flashplayer/ + + + + + https://get.adobe.com/flashplayer/ + + + + + https://get.adobe.com/flashplayer/ + + + https://get.adobe.com/flashplayer/ - + - + + + + + + + + https://get.adobe.com/flashplayer/ - + - + + + + + + + + + + https://get.adobe.com/flashplayer/ - + - + - + https://get.adobe.com/flashplayer/ - + - - - https://get.adobe.com/flashplayer/ - + + + + + + + - + - + - - + + @@ -2796,35 +2948,43 @@ - - + + - https://java.com/ - + + + + + - + https://get.adobe.com/flashplayer/ - + - - + + + + + + + https://java.com/ - + - + https://get.adobe.com/flashplayer/ - + - - + + https://java.com/ - - + + @@ -2832,72 +2992,34 @@ - - - https://get.adobe.com/flashplayer/ - - - - - - - - - - - - - - - - - - - - - - https://get.adobe.com/flashplayer/ - + + + - + https://get.adobe.com/flashplayer/ - + - - - - https://java.com/ - + + + https://get.adobe.com/shockwave/ + - + https://get.adobe.com/flashplayer/ - - - - - - - - - - + https://get.adobe.com/flashplayer/ - - - - - https://get.adobe.com/flashplayer/ - - - - - https://get.adobe.com/reader/ - + + + + + https://get.adobe.com/flashplayer/ + @@ -2915,157 +3037,105 @@ - - - https://java.com/ - - - - + + https://get.adobe.com/flashplayer/ - - - - - - - - - https://support.apple.com/en-us/HT205771 - + - - - + + + - - - https://get.adobe.com/reader - - - - - - - - - https://get.adobe.com/flashplayer/ - - - - - https://java.com/ - - - - + + https://get.adobe.com/flashplayer/ - - - - - + + + + + - - + + https://get.adobe.com/flashplayer/ - - - - - + - + + + + https://get.adobe.com/flashplayer/ + + + + + https://get.adobe.com/flashplayer/ + + https://get.adobe.com/flashplayer/ - + https://get.adobe.com/flashplayer/ - + - - - + + + - + + + https://get.adobe.com/reader + + + https://get.adobe.com/flashplayer/ - + - - + + - https://java.com/ - - - - - - - - - - - - - - - + + https://get.adobe.com/flashplayer/ - - - - - + - - + + https://java.com/ - - - - - - - - - - - - - + + + https://www.microsoft.com/getsilverlight + - - - - - - - + + + - - - + + + https://get.adobe.com/flashplayer/ + @@ -3073,111 +3143,76 @@ https://java.com/ - - - https://get.adobe.com/reader/ - - - - - https://get.adobe.com/flashplayer/ - - - - - - - - - https://get.adobe.com/flashplayer/ - - - - - - - - - + + + https://java.com/ - - - https://get.adobe.com/reader - - - - - https://get.adobe.com/reader - - - + https://get.adobe.com/flashplayer/ - + - + https://get.adobe.com/flashplayer/ - - - - - - - - - https://get.adobe.com/flashplayer/ - + - + https://get.adobe.com/flashplayer/ - - - - - https://get.adobe.com/flashplayer/ - - - - - - https://java.com/ - + - + https://get.adobe.com/flashplayer/ - - - - - - - - - - + - - - - - - - + + + https://get.adobe.com/flashplayer/ + + + + + https://get.adobe.com/flashplayer/ + - - WINNT 5.1 + + WINNT 6.1 0x10de - DIRECT3D_9_LAYERS + DIRECT2D BLOCKED_DRIVER_VERSION - 7.0.0.0 - GREATER_THAN_OR_EQUAL + 8.17.12.5896 + LESS_THAN_OR_EQUAL + + 0x0a6c + + + + WINNT 6.2 + 0x1022 + DIRECT2D + BLOCKED_DRIVER_VERSION + 9.10.8.0 + LESS_THAN_OR_EQUAL + + + All + 0x8086 + BLOCKED_DRIVER_VERSION + 8.15.10.1872 + EQUAL + + 0x2a42 + 0x2e22 + 0x2e12 + 0x2e32 + 0x0046 + All @@ -3193,68 +3228,71 @@ 0x0046 - + + WINNT 5.2 + 0x8086 + HARDWARE_VIDEO_DECODING + BLOCKED_DRIVER_VERSION + 10.18.10.3947 + EQUAL + + + WINNT 6.3 + 0x8086 + HARDWARE_VIDEO_DECODING + BLOCKED_DRIVER_VERSION + 10.18.10.3947 + EQUAL + + + Darwin 12 + 0x1002 + WEBGL_MSAA + BLOCKED_DEVICE + + Darwin 10 - 0x10de + 0x8086 WEBGL_MSAA BLOCKED_DEVICE - + All - 0x1022 - DIRECT3D_9_LAYERS + 0x1002 + DIRECT2D BLOCKED_DRIVER_VERSION 8.982.0.0 EQUAL - - WINNT 6.1 - 0x1002 - DIRECT2D - BLOCKED_DEVICE - - 0x9802 - 0x9803 - 0x9803 - 0x9804 - 0x9805 - 0x9806 - 0x9807 - - - - All + + WINNT 5.1 0x8086 + DIRECT3D_9_LAYERS BLOCKED_DRIVER_VERSION - 8.15.10.2086 - EQUAL - - 0x2a42 - 0x2e22 - 0x2e12 - 0x2e32 - 0x0046 - + 6.14.10.5218 + LESS_THAN - - Darwin 11 - 0x10de + + Darwin 10 + 0x1002 WEBGL_MSAA BLOCKED_DEVICE - - All + + WINNT 5.1 0x8086 + HARDWARE_VIDEO_DECODING BLOCKED_DRIVER_VERSION - 8.15.10.1855 + 10.18.10.3947 EQUAL - - 0x2a42 - 0x2e22 - 0x2e12 - 0x2e32 - 0x0046 - + + + WINNT 6.2 + 0x1002 + DIRECT2D + BLOCKED_DRIVER_VERSION + 9.10.8.0 + LESS_THAN_OR_EQUAL WINNT 10.0 @@ -3264,6 +3302,14 @@ 10.18.10.3947 EQUAL + + All + 0x1002 + DIRECT3D_9_LAYERS + BLOCKED_DRIVER_VERSION + 8.982.0.0 + EQUAL + WINNT 6.1 0x10de @@ -3275,33 +3321,13 @@ 0x0a6c - - All - 0x8086 - BLOCKED_DRIVER_VERSION - 8.15.10.1872 - EQUAL - - 0x2a42 - 0x2e22 - 0x2e12 - 0x2e32 - 0x0046 - - - - All + + WINNT 6.2 0x8086 + HARDWARE_VIDEO_DECODING BLOCKED_DRIVER_VERSION - 8.15.10.1883 + 10.18.10.3947 EQUAL - - 0x2a42 - 0x2e22 - 0x2e12 - 0x2e32 - 0x0046 - WINNT 8.1 @@ -3333,31 +3359,19 @@ 0x9877 - - Darwin 12 - 0x1002 - WEBGL_MSAA - BLOCKED_DEVICE - - - Darwin 12 - 0x8086 - WEBGL_MSAA - BLOCKED_DEVICE - - - WINNT 5.1 + + WINNT 6.1 0x8086 HARDWARE_VIDEO_DECODING BLOCKED_DRIVER_VERSION 10.18.10.3947 EQUAL - + All 0x8086 BLOCKED_DRIVER_VERSION - 8.15.10.1851 + 8.15.10.2086 EQUAL 0x2a42 @@ -3367,19 +3381,39 @@ 0x0046 - - Darwin 10 + + All + 0x1022 + DIRECT3D_9_LAYERS + BLOCKED_DRIVER_VERSION + 8.982.0.0 + EQUAL + + + Darwin 11 0x1002 WEBGL_MSAA BLOCKED_DEVICE - + + Darwin 11 + 0x8086 + WEBGL_MSAA + BLOCKED_DEVICE + + All - 0x1022 - DIRECT2D + 0x8086 BLOCKED_DRIVER_VERSION - 8.982.0.0 + 8.15.10.1855 EQUAL + + 0x2a42 + 0x2e22 + 0x2e12 + 0x2e32 + 0x0046 + WINNT 6.1 @@ -3393,75 +3427,40 @@ 0x9804 0x9805 0x9806 - 0x9807 - - - - WINNT 6.2 - 0x1002 - DIRECT2D - BLOCKED_DRIVER_VERSION - 9.10.8.0 - LESS_THAN_OR_EQUAL - - - WINNT 6.0 - 0x8086 - HARDWARE_VIDEO_DECODING - BLOCKED_DRIVER_VERSION - 10.18.10.3947 - EQUAL - - - WINNT 5.1 - 0x8086 - DIRECT3D_9_LAYERS - BLOCKED_DRIVER_VERSION - 6.14.10.5218 - LESS_THAN + 0x9807 + - - All - 0x1002 - DIRECT2D + + WINNT 6.0 + 0x8086 + HARDWARE_VIDEO_DECODING BLOCKED_DRIVER_VERSION - 8.982.0.0 + 10.18.10.3947 EQUAL - - Darwin 11 - 0x1002 + + Darwin 12 + 0x10de WEBGL_MSAA BLOCKED_DEVICE - - Darwin 11 + + Darwin 12 0x8086 WEBGL_MSAA BLOCKED_DEVICE - - WINNT 5.1 - 0x8086 - WEBGL_ANGLE - BLOCKED_DRIVER_VERSION - 6.14.10.5218 - LESS_THAN - - - - WINNT 6.3 - 0x8086 - HARDWARE_VIDEO_DECODING - BLOCKED_DRIVER_VERSION - 10.18.10.3947 - EQUAL + + Darwin 11 + 0x10de + WEBGL_MSAA + BLOCKED_DEVICE - + All 0x8086 BLOCKED_DRIVER_VERSION - 8.15.10.1892 + 8.15.10.1851 EQUAL 0x2a42 @@ -3471,68 +3470,71 @@ 0x0046 - - Darwin 10 - 0x8086 - WEBGL_MSAA - BLOCKED_DEVICE - - + WINNT 6.1 - 0x10de + 0x1002 DIRECT2D - BLOCKED_DRIVER_VERSION - 8.17.12.5896 - LESS_THAN_OR_EQUAL + BLOCKED_DEVICE - 0x0a6c + 0x9802 + 0x9803 + 0x9803 + 0x9804 + 0x9805 + 0x9806 + 0x9807 - - Darwin 12 + + Darwin 10 0x10de WEBGL_MSAA BLOCKED_DEVICE - + All - 0x1002 - DIRECT3D_9_LAYERS + 0x8086 BLOCKED_DRIVER_VERSION - 8.982.0.0 + 8.15.10.1883 EQUAL + + 0x2a42 + 0x2e22 + 0x2e12 + 0x2e32 + 0x0046 + - + All 0x8086 - DIRECT2D - BLOCKED_DRIVER_VERSION - 8.15.10.2413 - LESS_THAN_OR_EQUAL - - - WINNT 6.2 - 0x8086 - HARDWARE_VIDEO_DECODING BLOCKED_DRIVER_VERSION - 10.18.10.3947 + 8.15.10.1892 EQUAL + + 0x2a42 + 0x2e22 + 0x2e12 + 0x2e32 + 0x0046 + - - WINNT 6.1 - 0x8086 - HARDWARE_VIDEO_DECODING + + All + 0x1022 + DIRECT2D BLOCKED_DRIVER_VERSION - 10.18.10.3947 + 8.982.0.0 EQUAL - - WINNT 6.2 - 0x1022 - DIRECT2D + + WINNT 5.1 + 0x8086 + WEBGL_ANGLE BLOCKED_DRIVER_VERSION - 9.10.8.0 - LESS_THAN_OR_EQUAL + 6.14.10.5218 + LESS_THAN + WINNT 10.0 @@ -3564,1104 +3566,1112 @@ 0x9877 - - WINNT 5.2 + + All 0x8086 - HARDWARE_VIDEO_DECODING + DIRECT2D BLOCKED_DRIVER_VERSION - 10.18.10.3947 - EQUAL + 8.15.10.2413 + LESS_THAN_OR_EQUAL + + + WINNT 5.1 + 0x10de + DIRECT3D_9_LAYERS + BLOCKED_DRIVER_VERSION + 7.0.0.0 + GREATER_THAN_OR_EQUAL - - L79XLVO2ZmtAu7FAG8Wmzw== + + RH7WhshwXRK6f0VfOfjXgQ== - - Ermw0Q== + + BAAAAAABElatX7I= - - fWK0j/Vi8vNWg3VAGjc02w== + + d8AtKymQwkOPDBj+hjPzFg== - - ESCLRVuhcUZaluIgIVlRJx+O + + ByfNeA== - - ESDDtMgFFiaUfKo7HD9qImM7 + + SurdtfsuPcXXDpY2LkBpYO6BT7o= - - TurPPI6eivtNeGYdM0ZWXQ== + + BAAAAAABHkSHlSo= - - Hwexgn/ZCJicZPcsIyI8zxQ= + + VLm3Xe60+1YgPpXCGtXLng== - - Aw== + + ESBrHE7sFC7CQ8EM681xA3CY - - YNOos6YJoPC77qwSGCpb7w== + + ESBqoILo90ntDW7OTK43MS2F - - Bydrxg== + + BAAAAAABIBnBjWg= - - DHmmaw== + + e0bEFhI16xx9U1yvlI56rA== - - STMAFQ== + + cDggUYfwJ3A1YcdoeT6s4A== - - Nbc68Q8EHza72P/hSWcddw== + + AUa47POQ1dN5 - - Bw== + + RnQ3dg5KdDZs0nyFZk4= - - a9/VeyVWrzFD7rM2PEHwQA== + + BAAAAAABK84ykc0= - - dItWlz2V62Philqj9m6Pbg== + + BAAAAAABL07hTcY= - - AN9bfYOvlR1t + + BAAAAAABKUXDqxw= - - EA== + + D9UltDPl4XVfSSqQOvdiwQ== - - BAAAAAABJ/v3ZwA= + + BAAAAAABMYnGRuw= - - STMAjg== + + DHmmaw== - frj5jTuqBnQ4fljPvVU3KA== - - - BAAAAAABFqoAZoI= + RFlmmjulj6Ve7PfBi44nnw== - - GN2Hrh9LtnM= + + Aw== - ByembA== - - - 45KI4WIxyXfNrdtdj7C6 + Bydp0g== - - BAAAAAABI54PryQ= + + Ermwxw== - - CeFU2w== + + BAAAAAABL07hUBg= - - ATFEdg== + + Pgyeh2mqlVzqI9hFntRbUQ== - - KjoVfZ3by6+pL8fssyfM6A== + + CrTHPEE6AZSfI3jysin2bA== - - RnQ3dg5KdDZs0nyFZk4= + + Gg== - - BwImeaRkSZQLYwFREwKo3R1Jn+8= + + AJiWmg== - - ESCis569omrbb20yySF39+aE + + TA5iEg== - - CLc= + + AN9bfYOvlR1t - - eLumDUO40KwnecZLJxFM2A== + + BAAAAAABJZbEU4I= - - XhcFm2g619rt8Sro+a4rHA== + + CqL7CA== - - fbsHfUkagQtznc3rtY1uDg== + + BAAAAAABHhw1vwc= - ESBqoILo90ntDW7OTK43MS2F + ESJJweWBPhoXAaB9c8SHwI4O - - BYyEX2b5+K+myAIR7eXaRQ== + + GN2Hrh9Ltm4= - - BAAAAAABLF5/Gog= + + e9JTGBe45yw= - - TA6BjA== + + P6G7IYSL2RZxtzTh8I6qPA== - - CqnbFQ== + + Bydrxg== - BAAAAAABMYnGRuw= + BAAAAAABJQcQRNU= - - WD1AyQAAAAAAJQ== + + RurwlgVMxeP6Zepun0LGZA== - - AJBQSPqrEvDE2Hz8xH39Low= + + AQAAAAU= - - IyIVazG4RE9AERkb+ekH8w== + + BAAAAAABAJmPjfQ= - - EM8bDLBnnoYe4LnWpLIhS4esr3I= + + UUFV3S2cUidOOv7ESN65Ng== - BydeGg== + Byc85g== - - Bg== + + AQAAAAQ= - Cfk9oA== - - - BAAAAAABHJRKMpA= + CcHC1w== - - Sx51x7V8pYe8rp7PMP/3qg== + + Ajp/ - - FQ== + + O2S99lVUxErLSk56GvWRv+E= - - BAAAAAABAJmPjfQ= + + ARQ= - - Er0moq4zwH8ke2pYafIKdg== + + CjM= - - BAAAAAABHkSl7L4= + + F5BhE0zbgQ== - - BydiAg== + + K1ftto7Xcb0YKwQ6uMvOIA== - - Eg== + + UW3oKZKTDsrPy/rfwmGNaQ== - - Cj0= + + TA6BjA== - - Bydxog== + + H08= - - BAAAAAABHkSl5ao= + + ESISuBo/wdW2tBztKmHdFCFz - - MABJSw== + + BAAAAAABFqoAZoI= - ESCVop+Q4/OBgtf4WJkr01Gh + ESCEUbthDurBjJw0/h/FfuNY - - Pgyeh2mqlVzqI9hFntRbUQ== + + U3t2Vk8pfxTcaUPpIq0seQ== Gd/pPu+qLnXUdvP9sW73CQ== - - F5Bg6C237Q== - - - ESByYNtAIfizf2L3NMzCH8zZ - - - Ai7cBJYqBE0I9NdyoZfRrw== + + Byc68g== - - AImQERVYPoeb + + BAAAAAABGMG0Gmw= - - GpO48aJ8GngtwECqZhm/xA== + + By7fBTreouRwX/qrpgSUsg== - - CdYL9vSQCEKzBwjO10ud2w== + + ATFpsA== - - BYOGvG32ukb1Yxj2oKoFyw== + + QZCrvA== a12RvBNhznU= - - AKrMYlJmUUin8FOM/0TJrmk= - - - RUT1Gehd1KKYPfqOlgspoQ== - - - KuzHPJLdK5hNgJRo3R47Ag== - - - WJ2qHzWUqTk= - - AQAAAAQ= + GN2Hrh9LtnI= - - OE4/d+p3YRzzcSl+kmZ8Mw== + + OhrtngFwotLcm4i+z00SjA== - - Byc85g== + + Eg== - - BAAAAAABRE7wRk4= + + fwAAAQAAAUrz/HmrAAAAAg== - ByeQ9g== - - - OYBKgxEHpW/8XGAGAlvJyMA= - - - bzTw0uq05TUYEGS98bh0Ww== - - - EEpERSryZFMagbsNw/WoWQ== - - - Aw== + Bydxog== - - CSU= + + GdXz4L1b6FKNCMG9Jz2tjA== - - BAAAAAABHkSHlSo= + + EA== - - QDi5sA== + + CqZgEvHAsnzkT//QV9KjXw== - - Bydp0g== + + ESCyHU+xOECnh9Rf2IvgR8zS - - BAAAAAABM6d3Z0s= + + CqnbFQ== - - Iw== + + Jq6jgeApiT9O4W2Tx/NTRQ== - - ANygrItIJ2rcKlyS3Lue07U= + + YRJNfMoc12IpmW+Enpv3Pdo= - - CjM= + + YNOos6YJoPC77qwSGCpb7w== - - BAAAAAABGMG0Gmw= + + F7PAjw2k0dTX5escPnyVOBo= - - ATFpsA== + + BAAAAAABHkSl6mw= - - BAAAAAABHkSl6Co= + + CcL+EA== - - CWhp + + Cd/dug== - - cpqpXVWPk5AXzGw+zNIcBw== + + Sx51x7V8pYe8rp7PMP/3qg== - - ESCEUbthDurBjJw0/h/FfuNY + + MABJSw== - - cDggUYfwJ3A1YcdoeT6s4A== + + BAAAAAABMrS7t2g= - - VUtahOwvvmJFwlvmGDZP5w== + + Ajp+ - - BAAAAAABFUtaxac= + + YR0zGQAAAAAAAw== - - CrTHPEE6AZSfI3jysin2bA== + + F5Bg/C8eXg== - - ATE3ew== + + AKrMYlJmUUin8FOM/0TJrmk= - - BAAAAAABL07hTcY= + + VOcIuNbTqkpOMUyI108FOg== - - E5I2y6sIonl4a+TmlXc7fw== + + fMTRbGCp280pnyE/u53zbA== - - VBSf+IncsTB3RZS4KFCJPQ== + + HZyLf+K70FKc+jomm8DiDw== DA== - - YR0zGQAAAAAAAw== + + GN2Hrh9Ltms= - - AygWP2Fgd2T+iLbmAlKT6g== + + ZECgRdZEsns= - - UVKsEezpGWOVQ4W9esstng== + + HxT1XSjIpzjMprp9Qu1gYQ== - - Ikdj3zYXXGsC/Afm9Tvx+g== + + CdYL9vSQCEKzBwjO10ud2w== - - BAAAAAABHkSl6mw= + + CMNfzETd7XxesS9FOUj9Mg== + + + CLc= + + + ATFEdg== + + + BAAAAAABIg08D3U= QDi5sQ== - - BAAAAAABCUVQ9No= + + Aa8e+91erglSMgsk/mtVaA== - - BydSYg== + + A9GPKQ8jv9oIxfwiOy7qxQ== - - U4P1tUoxl/XkztlVHdtdgw== + + AjqL - - ByfHkw== + + LnfcUaXG/pxV2CpXM5+YSg== - - TqfXw+FkhxfVgE9GVMgjWQ== + + AImQERVYPoeb - - CMNfzETd7XxesS9FOUj9Mg== + + BGU= + + + Hwexgn/ZCJicZPcsIyI8zxQ= + + + Fw== - YRJNfMoc12IpmW+Enpv3Pdo= + UU3AP1SMxmyhBFq7MRFZmf0= - - VfTSum25nb65YPlpuhJAvg== + + BHk= + + + ESByNJZ5TPjg9iZyL6a/h5Zx - UW3oKZKTDsrPy/rfwmGNaQ== + XLhHIg7vP+tWfRqvuKeAxw== - - AjpW + + BAAAAAABJpQ0AbA= - - E77H6yvyFQjO0PcN3x0H+Q== + + BAAAAAAA+X/GIyk= + + + Iw== - B+U= + NTgf4iwIfeyJPIomw2dwSXEwtxQ= - - OUvvVscW0/NltofkmV9qmg== + + Xbevr3ut3Z9m1GuXC9SonA== - - EDQMI0tR4kSntv1O37N10g== + + Mq0P6o03FDk0B2bnJ+mYPGo= - - Cbssdw== + + Hnms0W0OxHSYE2F0XE97sw== - - WX89jn8yGZVvoKTD9jDfRQ== + + JLiDzgpL7oFNgJN+jIjt7w== - - JV/LVzSKI/wsDgg3UuZHlA== + + F5Bg6C237Q== - - U+1Y1QpJc0FOR5JdCJ01gQ== + + cJ+vg4742XhNgJW2ot9eIg== - - ESISuBo/wdW2tBztKmHdFCFz + + DYifRdP6aQQ8MLbXZY2f5g== - - NMpMcEnex3eXx4ohk9glcQ== + + e7wSpVxmgAS5/ioLi2iBIA== - F6QlB/yX+A== - - - CgFBQgAAAUFcf/EVAAAAAg== - - - LizeWXFWP5pZPI/dLc+PVQ== + Cfk9lw== - - TrKEMhb2PKktH8lHg0AV5A== + + DA== - - GN2Hrh9LtnA= + + EqthLKdUgwI= - - AuhvPsYZfVP6UDsuyjeZ4Q== + + BAAAAAABCFiEp9s= BAAAAAABJ/ufRdg= - - FJl6tXgNpSg= + + M64Z5ufZzDRVTHkJR1uXzw== - - BAAAAAABIBnBjWg= + + BAAAAAABGMGjftY= - - Fw== + + AJiU+bpWh2Uc4xFRf8GM9yA= - - F5BhE0zbgQ== + + TqfXw+FkhxfVgE9GVMgjWQ== - - VLm3Xe60+1YgPpXCGtXLng== + + ESC8DawWRiAyEMd38UXbfgPR - - e/fIfg2Dj2tkYIWVu2r82Cc= + + EAdmaA== - - Qh/O5w== + + BAAAAAABJ/ufQg8= - - UMUwXwT1Z4juyQ/CNTf4mw== + + BAAAAAABLM/7qjk= - - QAAnEQ== + + BAAAAAABHkSl7L4= - - d8AtKymQwkOPDBj+hjPzFg== + + F5Bg+EziQQ== - - BAAAAAABJZbEU4I= + + Aw== IIxFSyNM6mWtCgTG0IL3Og== - - Ajp/ + + DjIvBkX+ECVbB/C3i6w2Gg== - - Ew1ee9Jq7Q/Dig3ACF4V6Q== + + Cbssdw== - - ORFgmCj072NjcJnrxOMfQA== + + HA== - - HxT1XSjIpzjMprp9Qu1gYQ== + + ESAyW/JX3+hZIp44EAMlXU2b - - BAAAAAABL07hUBg= + + BAAAAAABKB/OGqI= - - UoRGnb96CUDTxIqVry6LBg== + + bzTw0uq05TUYEGS98bh0Ww== - - ESDYXNBhF+dePFjojs7u2vj1 + + BydKkg== - - F5Bg+EziQQ== + + BAAAAAABIg08FMU= - - Cfk9qg== + + QZCrvQ== - - ATE0vw== + + Qh/QbQ== - - BydInw== + + BAAAAAABHkSl6Co= - F7PAjw2k0dTX5escPnyVOBo= - - - Aa8e+91erglSMgsk/mtVaA== + Iqpyf/YoGgvHc8HiDAxAI8o= - - TXxtAQ== + + MABJTA== - CskruA== - - - Ig== + F5BhENPfVw== U3SgRR3J+D6575WuCxuXeQ== - - Cd/dug== + + Qh/SnQ== - - BAAAAAABAPpuVh0= + + ZgwfEqZnBsUNvNuZ77FbQA== - Byc68g== + ByfHkw== - - SdegFrLaFTCsoMAW5ED+zA== + + Qh/O5w== - - EAdmaA== + + Cw== + + + ESCVop+Q4/OBgtf4WJkr01Gh - EQ== + BA== - - BAAAAAABGMGjftY= + + CSU= + + + OqQ2rV0ISTc308Z/oQgzFw== + + + U+1Y1QpJc0FOR5JdCJ01gQ== APdCebq8ZyZr/T0luxlicNw= - - OfJBIhFwAdQ= + + FJl6tXgNpSk= - - BAAAAAABHkSHjz8= + + TA6EVg== - - BAAAAAABF2Tb8Bc= + + BQ== - - BUrYjru5px1ym4QUN33TOQ== + + 45KI4WIxyXfNrdtdj7C6 - - IA== + + BAAAAAABHkSl5ao= - - RurwlgVMxeP6Zepun0LGZA== + + L79XLVO2ZmtAu7FAG8Wmzw== - - SurdtfsuPcXXDpY2LkBpYO6BT7o= + + bAOrKSMsmA0MLJyAJ5BRsUM= - - ALxyZmb/WL/wAuUiPK5oK/g= + + QDi5rw== - - P6G7IYSL2RZxtzTh8I6qPA== + + BAAAAAABF2Tb8Bc= - - YR3YYQAAAAAABA== + + VBSf+IncsTB3RZS4KFCJPQ== - - BHk= + + BAAAAAABK84yjs8= - - ByfNeA== + + TurPPI6eivtNeGYdM0ZWXQ== - - EqthLKdUgwI= + + BAAAAAABHJRKNmk= - - J8mznxvTvOR5p4Br3a3sm5j5iM0= + + Rvm2CEw2IC2Mu/ax0A46QQ== - - M64Z5ufZzDRVTHkJR1uXzw== + + ATE3ew== - - BydKkg== + + ESByYNtAIfizf2L3NMzCH8zZ + + + frj5jTuqBnQ4fljPvVU3KA== + + + Er0moq4zwH8ke2pYafIKdg== - LdbnCbsA9sOgI4mkUpWXPw== + J2La+q+JOURNWkX60OP2lQ== - - e7wSpVxmgAS5/ioLi2iBIA== + + LTRcDHabRHU= - - FNISyWWTGi5Yco6fGh58/A== + + B+U= - - cXXMzbWDHMIdCotb3h64yw== + + Ig== - BAAAAAABA/A35EU= + BAAAAAABHkSHjz8= - - QZCrvA== + + RUT1Gehd1KKYPfqOlgspoQ== - - BAAAAAABEAuMoRs= + + ESCC9oPNcRdPOox+SjWm9dTX - - Bye2Cg== + + FQ== - - AJiWmg== + + QDi5sA== - - BQ== + + TrKEMhb2PKktH8lHg0AV5A== - - BAAAAAABJpQ0AbA= + + WD1AyQAAAAAAJQ== - - NTgf4iwIfeyJPIomw2dwSXEwtxQ= + + BAAAAAABFUtaxac= - - AjqL + + NMpMcEnex3eXx4ohk9glcQ== - - acI1CFIgmwSFBoU5+ahDgg== + + UoRGnb96CUDTxIqVry6LBg== - - ESDu2nhlLPzfx+LYgjlYFP/k + + VfTSum25nb65YPlpuhJAvg== - - buROL/l2GuXISv+/JVLkdA== + + STMAFQ== - - CqZgEvHAsnzkT//QV9KjXw== + + BydiAg== - - HZyLf+K70FKc+jomm8DiDw== + + KuzHPJLdK5hNgJRo3R47Ag== - - Ew== + + BAAAAAABMxvC9bk= - - BAAAAAABKUXDqA8= + + JpUvYJyWjdGmeoH7YcYunw== - - Qh/SnQ== + + OnvXX72mvUI2Id/NMzegmg== - - Xrr31RF0DoIzMKXS6XtD+g== + + Bw== - - BAAAAAABCFiEp9s= + + acI1CFIgmwSFBoU5+ahDgg== - - PAdKZPiaac2CvPxbOrsHOw== + + GtXUVojhwOTkaQ4bTKblEQ== - - a9rf7/BmG9JkKvRuy7J5QA== + + buROL/l2GuXISv+/JVLkdA== - - M0VSOewW3WI= + + BAAAAAABA/A35EU= - - CcHC/g== + + ORFgmCj072NjcJnrxOMfQA== - - Xbevr3ut3Z9m1GuXC9SonA== + + BYyEX2b5+K+myAIR7eXaRQ== - - BAAAAAABKUXDqxw= + + VUtahOwvvmJFwlvmGDZP5w== - - AQAAAAU= + + Ermwtg== - Cfk9lw== + Cfk9qg== - - AIChpbGNqu4XKp9J70syKEs= + + e/fIfg2Dj2tkYIWVu2r82Cc= - - cJ+vg4742XhNgJW2ot9eIg== + + BAAAAAABJ/v3ZwA= - - QZBvapTZFvmYktEPsBYLQQ== + + SdegFrLaFTCsoMAW5ED+zA== - - fMTRbGCp280pnyE/u53zbA== + + XhcFm2g619rt8Sro+a4rHA== + + + AuhvPsYZfVP6UDsuyjeZ4Q== ANX8SnNRxCmsE/GCl5hw+8A= - - RFlmmjulj6Ve7PfBi44nnw== - - - XJ8pGvGNM9RIcLUG9YQjLQ== - - - Cyr1PA== + + bx/XHJqcwxDOptxJ2lh5vw== - Gg== + Ew== - - DYifRdP6aQQ8MLbXZY2f5g== + + WX89jn8yGZVvoKTD9jDfRQ== - - CqL7CA== + + BAAAAAABCUVQ9No= - - UKKK5ol/rKBZchAAOnZjaA== + + AQAAAAA= - - BAAAAAABLM/7qjk= + + fWK0j/Vi8vNWg3VAGjc02w== - - H08= + + BXA= - - BAAAAAABKB/OGqI= + + STMAeg== - - HNo1DR4XCe4mS1iUMsY6Wg== + + EEpERSryZFMagbsNw/WoWQ== - - Rvm2CEw2IC2Mu/ax0A46QQ== + + OUvvVscW0/NltofkmV9qmg== - - ByfFnw== + + ESCLRVuhcUZaluIgIVlRJx+O + + + BAAAAAABJQdAjik= - F5BhENPfVw== + F6QlB/yX+A== - - GN2Hrh9Ltm4= + + Bydr0Q== - - Os2rnHWYhryvdOXfgan06A== + + cXXMzbWDHMIdCotb3h64yw== - ESJJweWBPhoXAaB9c8SHwI4O + ESCis569omrbb20yySF39+aE - - OhrtngFwotLcm4i+z00SjA== + + dItWlz2V62Philqj9m6Pbg== - - BGU= + + cpqpXVWPk5AXzGw+zNIcBw== - - CcL+EA== + + BAAAAAABRE7wRk4= - - BAAAAAABJQcQRNU= + + Qh/SqA== - - VOcIuNbTqkpOMUyI108FOg== + + YR3YYQAAAAAABA== - - RnQ3dYovwvB0D5q2YGY= + + BYOGvG32ukb1Yxj2oKoFyw== - - TA5iEg== + + NvEJoRYL2yvAZrAjbDIipQ== - - e0bEFhI16xx9U1yvlI56rA== + + fbsHfUkagQtznc3rtY1uDg== - - L1fHogsVxmfMBka5q4uzaQ== + + GN2Hrh9LtnA= - - ezdAeCxKH7BFs7vn3byYaw== + + DAk9hy8DhHSo+aQetvPB/fY= - - HA== + + CSY= - - AJiU+bpWh2Uc4xFRf8GM9yA= + + QZBvapTZFvmYktEPsBYLQQ== - - CcHC1w== + + PAdKZPiaac2CvPxbOrsHOw== - - UV9aaDeNRNtQuXjRYk4Skhg= + + BydeGg== - - AQw= + + AjpW - - BAAAAAABK84yjs8= + + Bg== - - FJl6tXgNpSk= + + OfJBIhFwAdQ= - - DjIvBkX+ECVbB/C3i6w2Gg== + + Byeaqw== + + + BA== - BAAAAAAA+X/GIyk= + BAAAAAABM6d3Z0s= - - ESCC9oPNcRdPOox+SjWm9dTX + + JV/LVzSKI/wsDgg3UuZHlA== - - UU3AP1SMxmyhBFq7MRFZmf0= + + FNISyWWTGi5Yco6fGh58/A== - - ESDItX4ruWiLnrlz0rk4/bmz + + FJl6tXgNpSg= - - BAAAAAABHhw1vwc= + + ByeQ9g== - - BAAAAAABIg08D3U= + + QAAnEQ== - - GN2Hrh9LtnI= + + VN2yeFexyXjPf34fHGmbhg== - - BAAAAAABJ/ufQg8= + + BAAAAAABLF5/Gog= - - QZCrvQ== + + GpO48aJ8GngtwECqZhm/xA== - - BAAAAAABMrS7t2g= + + EM8bDLBnnoYe4LnWpLIhS4esr3I= - - D9UltDPl4XVfSSqQOvdiwQ== + + IyIVazG4RE9AERkb+ekH8w== - - LTRcDHabRHU= + + E77H6yvyFQjO0PcN3x0H+Q== - - AUa47POQ1dN5 + + AQAAAAI= - - JLiDzgpL7oFNgJN+jIjt7w== + + Ew1ee9Jq7Q/Dig3ACF4V6Q== + + + a9/VeyVWrzFD7rM2PEHwQA== + + + Xrr31RF0DoIzMKXS6XtD+g== - Mq0P6o03FDk0B2bnJ+mYPGo= + UV9aaDeNRNtQuXjRYk4Skhg= - ESAyW/JX3+hZIp44EAMlXU2b + ESDItX4ruWiLnrlz0rk4/bmz - - Aw== + + AJBQSPqrEvDE2Hz8xH39Low= - - GN2Hrh9Ltms= + + eLumDUO40KwnecZLJxFM2A== - - Qh/QbQ== + + BwImeaRkSZQLYwFREwKo3R1Jn+8= - - DA== + + Aw1SPC56593ZCZ9vCNHKwQ== - - ZECgRdZEsns= + + UVKsEezpGWOVQ4W9esstng== - - AQAAAAM= + + Cj0= - - UUFV3S2cUidOOv7ESN65Ng== + + UMUwXwT1Z4juyQ/CNTf4mw== - - Bydr0Q== + + XJ8pGvGNM9RIcLUG9YQjLQ== - - GdXz4L1b6FKNCMG9Jz2tjA== + + STMAjg== + + + UKKK5ol/rKBZchAAOnZjaA== - BAAAAAABMxvC9bk= + BAAAAAABLF5/HXY= - - TAA2G+UIK6mqznQKBT77NA== + + LizeWXFWP5pZPI/dLc+PVQ== - - ESCyHU+xOECnh9Rf2IvgR8zS + + CcHC/g== - - ESByNJZ5TPjg9iZyL6a/h5Zx + + COwoDFvz7GD8R2K7Lo0rYQ== - - fwAAAQAAAUrz/HmrAAAAAg== + + Nbc68Q8EHza72P/hSWcddw== + + + ByfFnw== + + + L1fHogsVxmfMBka5q4uzaQ== + + + J8mznxvTvOR5p4Br3a3sm5j5iM0= - - BAAAAAABHkSl5AQ= + + TAA2G+UIK6mqznQKBT77NA== - - K1ftto7Xcb0YKwQ6uMvOIA== + + ANygrItIJ2rcKlyS3Lue07U= - - BA== + + CgFBQgAAAUFcf/EVAAAAAg== - - L7tgs/W85vnhV7I7qJ6N/g== + + ESD9YhzIEOwiOT7Nwip+E1KI - - Qh/SqA== + + CeagHQ== - - A9GPKQ8jv9oIxfwiOy7qxQ== + + ALxyZmb/WL/wAuUiPK5oK/g= - - GtXUVojhwOTkaQ4bTKblEQ== + + OYBKgxEHpW/8XGAGAlvJyMA= - - BAAAAAABIg08FMU= + + AjqK - - ARQ= + + RnQ3dYovwvB0D5q2YGY= - - AQAAAAA= + + D/wZ7+m1Mv8SONSEFcs73w== - BA== + IA== - COwoDFvz7GD8R2K7Lo0rYQ== + LdbnCbsA9sOgI4mkUpWXPw== - - VN2yeFexyXjPf34fHGmbhg== + + GN2Hrh9LtnM= - - R4af5A== + + Os2rnHWYhryvdOXfgan06A== - - BAAAAAABLF5/HXY= + + ESDu2nhlLPzfx+LYgjlYFP/k - - Hnms0W0OxHSYE2F0XE97sw== + + EQ== + + + BAAAAAABHkSl5AQ= - BAAAAAABBHYoIFs= + BAAAAAABHkSHki0= - - D/wZ7+m1Mv8SONSEFcs73w== + + BAAAAAABCfhiO+s= - Byeaqw== - - - Ermwxw== - - - ESBrHE7sFC7CQ8EM681xA3CY - - - eR1nUEz8k+nDSBD+bb5uIQ== + BydInw== - - Ermwtg== + + Bye2Cg== - - STMAeg== + + AygWP2Fgd2T+iLbmAlKT6g== - - Byd5cg== + + L7tgs/W85vnhV7I7qJ6N/g== - - NvEJoRYL2yvAZrAjbDIipQ== + + BAAAAAABI54PryQ= - - QDi5rw== + + BAAAAAABKUXDqA8= - - bAOrKSMsmA0MLJyAJ5BRsUM= + + AQAAAAM= - MABJTA== - - - Cw== + R4af5A== - - XLhHIg7vP+tWfRqvuKeAxw== + + BAAAAAABJQcQQN0= - - BAAAAAABJQdAjik= + + EDQMI0tR4kSntv1O37N10g== - - JpUvYJyWjdGmeoH7YcYunw== + + Cfk9oA== - - TA6EVg== + + Ikdj3zYXXGsC/Afm9Tvx+g== - - BAAAAAABHJRKNmk= + + CeFU2w== - CeagHQ== + CskruA== - - RH7WhshwXRK6f0VfOfjXgQ== + + BUrYjru5px1ym4QUN33TOQ== - - BAAAAAABJQcQQN0= + + TXxtAQ== - - OnvXX72mvUI2Id/NMzegmg== + + ESDDtMgFFiaUfKo7HD9qImM7 - - AjqK + + BydSYg== - - DAk9hy8DhHSo+aQetvPB/fY= + + Aw== - - ESD9YhzIEOwiOT7Nwip+E1KI + + Cyr1PA== - - BXA= + + U4P1tUoxl/XkztlVHdtdgw== - - By7fBTreouRwX/qrpgSUsg== + + sPNcCSE9Nkg3jy5IN1xe2Q== - - CSY= + + E5I2y6sIonl4a+TmlXc7fw== - - F5Bg/C8eXg== + + LU4d0t7PAsZNgJGZcb+o/w== - - J2La+q+JOURNWkX60OP2lQ== + + Byd5cg== CdWFNw== - - BAAAAAABElatX7I= + + AIChpbGNqu4XKp9J70syKEs= - - ESC8DawWRiAyEMd38UXbfgPR + + M0VSOewW3WI= - - BAAAAAABK84ykc0= + + KjoVfZ3by6+pL8fssyfM6A== - BAAAAAABHkSHki0= - - - e9JTGBe45yw= - - - AQAAAAI= + BAAAAAABBHYoIFs= - - O2S99lVUxErLSk56GvWRv+E= + + JD1wxDd8IgmiqX7MyPPg1g== - - OqQ2rV0ISTc308Z/oQgzFw== + + BAAAAAABHJRKMpA= - Aw1SPC56593ZCZ9vCNHKwQ== + eR1nUEz8k+nDSBD+bb5uIQ== - - JD1wxDd8IgmiqX7MyPPg1g== + + Ai7cBJYqBE0I9NdyoZfRrw== - - U3t2Vk8pfxTcaUPpIq0seQ== + + ESDYXNBhF+dePFjojs7u2vj1 - - bx/XHJqcwxDOptxJ2lh5vw== + + AQw= - - LU4d0t7PAsZNgJGZcb+o/w== + + WJ2qHzWUqTk= - LnfcUaXG/pxV2CpXM5+YSg== + ezdAeCxKH7BFs7vn3byYaw== - - sPNcCSE9Nkg3jy5IN1xe2Q== + + ATE0vw== - - BAAAAAABCfhiO+s= + + ByembA== - - Ajp+ + + BAAAAAABAPpuVh0= + + + a9rf7/BmG9JkKvRuy7J5QA== - ZgwfEqZnBsUNvNuZ77FbQA== + OE4/d+p3YRzzcSl+kmZ8Mw== - - Iqpyf/YoGgvHc8HiDAxAI8o= + + HNo1DR4XCe4mS1iUMsY6Wg== - - Jq6jgeApiT9O4W2Tx/NTRQ== + + BAAAAAABEAuMoRs= + + + CWhp + + + Ermw0Q== diff -Nru firefox-54.0~b1+build1/browser/app/profile/firefox.js firefox-54.0~b2+build1/browser/app/profile/firefox.js --- firefox-54.0~b1+build1/browser/app/profile/firefox.js 2017-04-20 12:54:04.000000000 +0000 +++ firefox-54.0~b2+build1/browser/app/profile/firefox.js 2017-04-25 05:28:19.000000000 +0000 @@ -61,6 +61,9 @@ // Check AUS for system add-on updates. pref("extensions.systemAddon.update.url", "https://aus5.mozilla.org/update/3/SystemAddons/%VERSION%/%BUILD_ID%/%BUILD_TARGET%/%LOCALE%/%CHANNEL%/%OS_VERSION%/%DISTRIBUTION%/%DISTRIBUTION_VERSION%/update.xml"); +// Disable screenshots for now, Shield will enable this. +pref("extensions.screenshots.system-disabled", true); + // Disable add-ons that are not installed by the user in all scopes by default. // See the SCOPE constants in AddonManager.jsm for values to use here. pref("extensions.autoDisableScopes", 15); diff -Nru firefox-54.0~b1+build1/browser/base/content/tabbrowser.xml firefox-54.0~b2+build1/browser/base/content/tabbrowser.xml --- firefox-54.0~b1+build1/browser/base/content/tabbrowser.xml 2017-04-20 12:54:04.000000000 +0000 +++ firefox-54.0~b2+build1/browser/base/content/tabbrowser.xml 2017-04-25 05:28:19.000000000 +0000 @@ -577,11 +577,20 @@ return true; }, - _isForInitialAboutBlank(aWebProgress, aLocation) { + _isForInitialAboutBlank(aWebProgress, aStateFlags, aLocation) { if (!this.mBlank || !aWebProgress.isTopLevel) { return false; } + // If the state has STATE_STOP, and no requests were in flight, then this + // must be the initial "stop" for the initial about:blank document. + const nsIWebProgressListener = Components.interfaces.nsIWebProgressListener; + if (aStateFlags & nsIWebProgressListener.STATE_STOP && + this.mRequestCount == 0 && + !aLocation) { + return true; + } + let location = aLocation ? aLocation.spec : ""; return location == "about:blank"; }, @@ -624,7 +633,9 @@ originalLocation = aRequest.originalURI; } catch (ex) {} - let ignoreBlank = this._isForInitialAboutBlank(aWebProgress, location); + let ignoreBlank = this._isForInitialAboutBlank(aWebProgress, aStateFlags, + location); + // If we were ignoring some messages about the initial about:blank, and we // got the STATE_STOP for it, we'll want to pay attention to those messages // from here forward. Similarly, if we conclude that this state change diff -Nru firefox-54.0~b1+build1/browser/config/version_display.txt firefox-54.0~b2+build1/browser/config/version_display.txt --- firefox-54.0~b1+build1/browser/config/version_display.txt 2017-04-20 12:54:04.000000000 +0000 +++ firefox-54.0~b2+build1/browser/config/version_display.txt 2017-04-25 05:28:19.000000000 +0000 @@ -1 +1 @@ -54.0b1 +54.0b2 diff -Nru firefox-54.0~b1+build1/browser/extensions/e10srollout/bootstrap.js firefox-54.0~b2+build1/browser/extensions/e10srollout/bootstrap.js --- firefox-54.0~b1+build1/browser/extensions/e10srollout/bootstrap.js 2017-04-20 12:54:04.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/e10srollout/bootstrap.js 2017-04-25 05:28:19.000000000 +0000 @@ -127,6 +127,7 @@ setCohort("optedOut"); } else if (userOptedIn.e10s) { setCohort("optedIn"); + inMultiExperiment = true; } else if (temporaryDisqualification != "") { // Users who are disqualified by the backend (from multiprocessBlockPolicy) // can be put into either the test or control groups, because e10s will @@ -185,7 +186,7 @@ let multiUserSample = getUserSample(true); for (let sampleName of Object.getOwnPropertyNames(BUCKETS)) { if (multiUserSample < BUCKETS[sampleName]) { - setCohort(`${cohortPrefix}multiBucket${sampleName}`); + setCohort(`multiBucket${sampleName}`); Preferences.set(PREF_E10S_PROCESSCOUNT + ".web", sampleName); break; } diff -Nru firefox-54.0~b1+build1/browser/extensions/moz.build firefox-54.0~b2+build1/browser/extensions/moz.build --- firefox-54.0~b1+build1/browser/extensions/moz.build 2017-04-20 12:54:04.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/moz.build 2017-04-25 05:28:19.000000000 +0000 @@ -9,6 +9,7 @@ 'e10srollout', 'pdfjs', 'pocket', + 'screenshots', 'webcompat', ] diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/bootstrap.js firefox-54.0~b2+build1/browser/extensions/screenshots/bootstrap.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/bootstrap.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/bootstrap.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,145 @@ +/* globals AddonManager, Components, LegacyExtensionsUtils, Services, + XPCOMUtils */ + +const OLD_ADDON_PREF_NAME = "extensions.jid1-NeEaf3sAHdKHPA@jetpack.deviceIdInfo"; +const OLD_ADDON_ID = "jid1-NeEaf3sAHdKHPA@jetpack"; +const ADDON_ID = "screenshots@mozilla.org"; +const TELEMETRY_ENABLED_PREF = "toolkit.telemetry.enabled"; +const PREF_BRANCH = "extensions.screenshots."; +const USER_DISABLE_PREF = "extensions.screenshots.disabled"; +const SYSTEM_DISABLE_PREF = "extensions.screenshots.system-disabled"; + +const { interfaces: Ci, utils: Cu } = Components; +Cu.import("resource://gre/modules/XPCOMUtils.jsm"); +XPCOMUtils.defineLazyModuleGetter(this, "AddonManager", + "resource://gre/modules/AddonManager.jsm"); +XPCOMUtils.defineLazyModuleGetter(this, "Console", + "resource://gre/modules/Console.jsm"); +XPCOMUtils.defineLazyModuleGetter(this, "Services", + "resource://gre/modules/Services.jsm"); +XPCOMUtils.defineLazyModuleGetter(this, "LegacyExtensionsUtils", + "resource://gre/modules/LegacyExtensionsUtils.jsm"); + +let addonResourceURI; +let appStartupDone; +const appStartupPromise = new Promise((resolve,reject) => { + appStartupDone = resolve; +}); + +const prefs = Services.prefs; +const prefObserver = { + register: function() { + prefs.addObserver(PREF_BRANCH, this, false); + }, + + unregister: function() { + prefs.removeObserver(PREF_BRANCH, this); + }, + + observe: function(aSubject, aTopic, aData) { + // aSubject is the nsIPrefBranch we're observing (after appropriate QI) + // aData is the name of the pref that's been changed (relative to aSubject) + if (aData == USER_DISABLE_PREF || aData == SYSTEM_DISABLE_PREF) { + // eslint-disable-next-line promise/catch-or-return + appStartupPromise.then(handleStartup); + } + } +}; + +const appStartupObserver = { + register: function() { + Services.obs.addObserver(this, "sessionstore-windows-restored", false); + }, + + unregister: function() { + Services.obs.removeObserver(this, "sessionstore-windows-restored", false); + }, + + observe: function() { + appStartupDone(); + this.unregister(); + } +} + +const APP_STARTUP = 1; +function startup(data, reason) { // eslint-disable-line no-unused-vars + if (reason === APP_STARTUP) { + appStartupObserver.register(); + } else { + appStartupDone(); + } + prefObserver.register(); + addonResourceURI = data.resourceURI; + // eslint-disable-next-line promise/catch-or-return + appStartupPromise.then(handleStartup); +} + +function shutdown(data, reason) { // eslint-disable-line no-unused-vars + prefObserver.unregister(); +} + +function install(data, reason) {} // eslint-disable-line no-unused-vars + +function uninstall(data, reason) {} // eslint-disable-line no-unused-vars + +function getBoolPref(pref) { + return prefs.getPrefType(pref) && prefs.getBoolPref(pref); +} + +function shouldDisable() { + return getBoolPref(USER_DISABLE_PREF) || getBoolPref(SYSTEM_DISABLE_PREF); +} + +function handleStartup() { + const webExtension = LegacyExtensionsUtils.getEmbeddedExtensionFor({ + id: ADDON_ID, + resourceURI: addonResourceURI + }); + + if (!shouldDisable() && !webExtension.started) { + start(webExtension); + } else if (shouldDisable()) { + stop(webExtension); + } +} + +function start(webExtension) { + webExtension.startup().then((api) => { + api.browser.runtime.onMessage.addListener(handleMessage); + }).catch((err) => { + // The startup() promise will be rejected if the webExtension was + // already started (a harmless error), or if initializing the + // WebExtension failed and threw (an important error). + console.error(err); + if (err.message !== "This embedded extension has already been started") { + // TODO: Should we send these errors to Sentry? #2420 + } + }); +} + +function stop(webExtension) { + webExtension.shutdown(); +} + +function handleMessage(msg, sender, sendReply) { + if (!msg) { + return; + } + + if (msg.funcName === "getTelemetryPref") { + let telemetryEnabled = getBoolPref(TELEMETRY_ENABLED_PREF); + sendReply({type: "success", value: telemetryEnabled}); + } else if (msg.funcName === "getOldDeviceInfo") { + let oldDeviceInfo = prefs.prefHasUserValue(OLD_ADDON_PREF_NAME) && prefs.getCharPref(OLD_ADDON_PREF_NAME); + sendReply({type: "success", value: oldDeviceInfo || null}); + } else if (msg.funcName === "removeOldAddon") { + AddonManager.getAddonByID(OLD_ADDON_ID, (addon) => { + prefs.clearUserPref(OLD_ADDON_PREF_NAME); + if (addon) { + addon.uninstall(); + } + sendReply({type: "success", value: !!addon}); + }); + return true; + } +} diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/install.rdf firefox-54.0~b2+build1/browser/extensions/screenshots/install.rdf --- firefox-54.0~b1+build1/browser/extensions/screenshots/install.rdf 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/install.rdf 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,20 @@ + + + + screenshots@mozilla.org + Firefox Screenshots + + + {ec8030f7-c20a-464f-9b0e-13a3a9e97384} + 51.0a1 + * + + + 2 + 6.3.0 + true + https://pageshot.net/ + true + + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/moz.build firefox-54.0~b2+build1/browser/extensions/screenshots/moz.build --- firefox-54.0~b1+build1/browser/extensions/screenshots/moz.build 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/moz.build 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,309 @@ +# -*- Mode: python; indent-tabs-mode: nil; tab-width: 40 -*- +# vim: set filetype=python: +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +FINAL_TARGET_FILES.features['screenshots@mozilla.org'] += [ + 'bootstrap.js', + 'install.rdf' +] + +# This file list is automatically generated by Screenshots' export scripts. +# AUTOMATIC INSERTION START +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"] += [ + 'webextension/assertIsTrusted.js', + 'webextension/blank.html', + 'webextension/buildSettings.js.template', + 'webextension/catcher.js', + 'webextension/clipboard.js', + 'webextension/domainFromUrl.js', + 'webextension/log.js', + 'webextension/makeUuid.js', + 'webextension/manifest.json', + 'webextension/randomString.js', + 'webextension/sitehelper.js' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["ach"] += [ + 'webextension/_locales/ach/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["be"] += [ + 'webextension/_locales/be/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["bg"] += [ + 'webextension/_locales/bg/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["bn_BD"] += [ + 'webextension/_locales/bn_BD/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["cs"] += [ + 'webextension/_locales/cs/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["de"] += [ + 'webextension/_locales/de/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["dsb"] += [ + 'webextension/_locales/dsb/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["el"] += [ + 'webextension/_locales/el/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["en_GB"] += [ + 'webextension/_locales/en_GB/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["en_US"] += [ + 'webextension/_locales/en_US/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["es_AR"] += [ + 'webextension/_locales/es_AR/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["es_CL"] += [ + 'webextension/_locales/es_CL/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["es_ES"] += [ + 'webextension/_locales/es_ES/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["es_MX"] += [ + 'webextension/_locales/es_MX/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["et"] += [ + 'webextension/_locales/et/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["fa"] += [ + 'webextension/_locales/fa/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["fr"] += [ + 'webextension/_locales/fr/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["fy_NL"] += [ + 'webextension/_locales/fy_NL/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["gu_IN"] += [ + 'webextension/_locales/gu_IN/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["he"] += [ + 'webextension/_locales/he/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["hsb"] += [ + 'webextension/_locales/hsb/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["hu"] += [ + 'webextension/_locales/hu/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["hy_AM"] += [ + 'webextension/_locales/hy_AM/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["id"] += [ + 'webextension/_locales/id/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["it"] += [ + 'webextension/_locales/it/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["ja"] += [ + 'webextension/_locales/ja/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["kab"] += [ + 'webextension/_locales/kab/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["kk"] += [ + 'webextension/_locales/kk/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["ko"] += [ + 'webextension/_locales/ko/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["lij"] += [ + 'webextension/_locales/lij/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["lo"] += [ + 'webextension/_locales/lo/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["lt"] += [ + 'webextension/_locales/lt/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["ms"] += [ + 'webextension/_locales/ms/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["nb_NO"] += [ + 'webextension/_locales/nb_NO/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["nl"] += [ + 'webextension/_locales/nl/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["nn_NO"] += [ + 'webextension/_locales/nn_NO/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["pa_IN"] += [ + 'webextension/_locales/pa_IN/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["pl"] += [ + 'webextension/_locales/pl/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["pt_BR"] += [ + 'webextension/_locales/pt_BR/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["pt_PT"] += [ + 'webextension/_locales/pt_PT/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["rm"] += [ + 'webextension/_locales/rm/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["ru"] += [ + 'webextension/_locales/ru/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["sk"] += [ + 'webextension/_locales/sk/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["sl"] += [ + 'webextension/_locales/sl/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["sq"] += [ + 'webextension/_locales/sq/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["sr"] += [ + 'webextension/_locales/sr/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["sv_SE"] += [ + 'webextension/_locales/sv_SE/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["th"] += [ + 'webextension/_locales/th/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["tl"] += [ + 'webextension/_locales/tl/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["tr"] += [ + 'webextension/_locales/tr/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["uk"] += [ + 'webextension/_locales/uk/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["ur"] += [ + 'webextension/_locales/ur/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["zh_CN"] += [ + 'webextension/_locales/zh_CN/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["_locales"]["zh_TW"] += [ + 'webextension/_locales/zh_TW/messages.json' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["background"] += [ + 'webextension/background/analytics.js', + 'webextension/background/auth.js', + 'webextension/background/communication.js', + 'webextension/background/deviceInfo.js', + 'webextension/background/main.js', + 'webextension/background/selectorLoader.js', + 'webextension/background/senderror.js', + 'webextension/background/takeshot.js' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["build"] += [ + 'webextension/build/buildSettings.js', + 'webextension/build/inlineSelectionCss.js', + 'webextension/build/onboardingCss.js', + 'webextension/build/onboardingHtml.js', + 'webextension/build/raven.js', + 'webextension/build/shot.js' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["icons"] += [ + 'webextension/icons/back.svg', + 'webextension/icons/cancel.svg', + 'webextension/icons/copy.png', + 'webextension/icons/done.svg', + 'webextension/icons/download.svg', + 'webextension/icons/icon-128.png', + 'webextension/icons/icon-16.png', + 'webextension/icons/icon-19.png', + 'webextension/icons/icon-256.png', + 'webextension/icons/icon-32.png', + 'webextension/icons/icon-38.png', + 'webextension/icons/icon-48.png', + 'webextension/icons/icon-64.png', + 'webextension/icons/icon-highlight-19.png', + 'webextension/icons/icon-highlight-38.png', + 'webextension/icons/icon-starred-19.png', + 'webextension/icons/icon-starred-38.png', + 'webextension/icons/menu-fullpage.svg', + 'webextension/icons/menu-myshot.svg', + 'webextension/icons/menu-visible.svg', + 'webextension/icons/onboarding-1.png', + 'webextension/icons/onboarding-2.png', + 'webextension/icons/onboarding-3.png', + 'webextension/icons/onboarding-4.png' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["onboarding"] += [ + 'webextension/onboarding/slides.html', + 'webextension/onboarding/slides.js' +] + +FINAL_TARGET_FILES.features['screenshots@mozilla.org']["webextension"]["selector"] += [ + 'webextension/selector/callBackground.js', + 'webextension/selector/documentMetadata.js', + 'webextension/selector/shooter.js', + 'webextension/selector/ui.js', + 'webextension/selector/uicontrol.js', + 'webextension/selector/util.js' +] + +# AUTOMATIC INSERTION END + +BROWSER_CHROME_MANIFESTS += [ + 'test/browser/browser.ini' +] diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/test/browser/browser.ini firefox-54.0~b2+build1/browser/extensions/screenshots/test/browser/browser.ini --- firefox-54.0~b1+build1/browser/extensions/screenshots/test/browser/browser.ini 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/test/browser/browser.ini 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,5 @@ +[DEFAULT] +support-files = + head.js + +[browser_screenshots_ui_check.js] diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/test/browser/browser_screenshots_ui_check.js firefox-54.0~b2+build1/browser/extensions/screenshots/test/browser/browser_screenshots_ui_check.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/test/browser/browser_screenshots_ui_check.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/test/browser/browser_screenshots_ui_check.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,20 @@ +"use strict"; + +/* global add_task, is, promiseScreenshotsEnabled, promiseScreenshotsReset, + registerCleanupFunction */ + +function checkElements(expectPresent, l) { + for (let id of l) { + is(!!document.getElementById(id), expectPresent, "element " + id + (expectPresent ? " is" : " is not") + " present"); + } +} + +add_task(function*() { + yield promiseScreenshotsEnabled(); + + registerCleanupFunction(function* () { + yield promiseScreenshotsReset(); + }); + + checkElements(true, ["screenshots_mozilla_org-browser-action"]); +}); diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/test/browser/head.js firefox-54.0~b2+build1/browser/extensions/screenshots/test/browser/head.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/test/browser/head.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/test/browser/head.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,61 @@ +/* global CustomizableUI, info, Services */ + +// Currently Screenshots is disabled in tests. We want these tests to work under +// either case that Screenshots is disabled or enabled on startup of the browser, +// and that at the end we're reset to the correct state. +let enabledOnStartup = false; + +// ScreenshotsEnabled/Disabled promises return true if it was already +// Enabled/Disabled, and false if it need to Enable/Disable. +function promiseScreenshotsEnabled() { + if (!Services.prefs.getBoolPref("extensions.screenshots.system-disabled", false)) { + info("Screenshots was already enabled, assuming enabled by default for tests"); + enabledOnStartup = true; + return Promise.resolve(true); + } + info("Screenshots is not enabled"); + return new Promise((resolve, reject) => { + let listener = { + onWidgetAfterCreation(widgetid) { + if (widgetid == "screenshots_mozilla_org-browser-action") { + info("screenshots_mozilla_org-browser-action button created"); + CustomizableUI.removeListener(listener); + resolve(false); + } + } + } + CustomizableUI.addListener(listener); + info("Set Screenshots disabled pref to false."); + Services.prefs.setBoolPref("extensions.screenshots.system-disabled", false); + }); +} + +function promiseScreenshotsDisabled() { + if (Services.prefs.getBoolPref("extensions.screenshots.system-disabled", false)) { + info("Screenshots already disabled"); + return Promise.resolve(true); + } + return new Promise((resolve, reject) => { + let listener = { + onWidgetDestroyed(widgetid) { + if (widgetid == "screenshots_mozilla_org-browser-action") { + CustomizableUI.removeListener(listener); + info("screenshots_mozilla_org-browser-action destroyed"); + resolve(false); + } + } + } + CustomizableUI.addListener(listener); + info("Set Screenshots disabled pref to true."); + Services.prefs.setBoolPref("extensions.screenshots.system-disabled", true); + }); +} + +function promiseScreenshotsReset() { // eslint-disable-line no-unused-vars + if (enabledOnStartup) { + info("Reset is enabling Screenshots addon"); + return promiseScreenshotsEnabled(); + } + info("Reset is disabling Screenshots addon"); + return promiseScreenshotsDisabled(); +} diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/assertIsTrusted.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/assertIsTrusted.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/assertIsTrusted.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/assertIsTrusted.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,20 @@ +/** For use with addEventListener, assures that any events have event.isTrusted set to true + https://developer.mozilla.org/en-US/docs/Web/API/Event/isTrusted + Should be applied *inside* catcher.watchFunction +*/ +this.assertIsTrusted = function assertIsTrusted(handlerFunction) { + return function (event) { + if (! event) { + let exc = new Error("assertIsTrusted did not get an event"); + exc.noPopup = true; + throw exc; + } + if (! event.isTrusted) { + let exc = new Error(`Received untrusted event (type: ${event.type})`); + exc.noPopup = true; + throw exc; + } + return handlerFunction.call(this, event); + }; +} +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/analytics.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/analytics.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/analytics.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/analytics.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,81 @@ +/* globals main, auth, catcher, deviceInfo, communication, log */ + +"use strict"; + +this.analytics = (function () { + let exports = {}; + + let telemetryPrefKnown = false; + let telemetryPref; + + exports.sendEvent = function (action, label, options) { + let eventCategory = "addon"; + if (! telemetryPrefKnown) { + log.warn("sendEvent called before we were able to refresh"); + return Promise.resolve(); + } + if (! telemetryPref) { + log.info(`Cancelled sendEvent ${eventCategory}/${action}/${label || 'none'} ${JSON.stringify(options)}`); + return Promise.resolve(); + } + if (typeof label == "object" && (! options)) { + options = label; + label = undefined; + } + options = options || {}; + let di = deviceInfo(); + return new Promise((resolve, reject) => { + let url = main.getBackend() + "/event"; + let req = new XMLHttpRequest(); + req.open("POST", url); + req.setRequestHeader("content-type", "application/json"); + req.onload = catcher.watchFunction(() => { + if (req.status >= 300) { + let exc = new Error("Bad response from POST /event"); + exc.status = req.status; + exc.statusText = req.statusText; + reject(exc); + } else { + resolve(); + } + }); + options.applicationName = di.appName; + options.applicationVersion = di.addonVersion; + let abTests = auth.getAbTests(); + for (let [gaField, value] of Object.entries(abTests)) { + options[gaField] = value; + } + log.info(`sendEvent ${eventCategory}/${action}/${label || 'none'} ${JSON.stringify(options)}`); + req.send(JSON.stringify({ + deviceId: auth.getDeviceId(), + event: eventCategory, + action, + label, + options + })); + }); + }; + + exports.refreshTelemetryPref = function () { + return communication.sendToBootstrap("getTelemetryPref").then((result) => { + telemetryPrefKnown = true; + if (result === communication.NO_BOOTSTRAP) { + telemetryPref = true; + } else { + telemetryPref = result; + } + }, (error) => { + // If there's an error reading the pref, we should assume that we shouldn't send data + telemetryPrefKnown = true; + telemetryPref = false; + throw error; + }); + }; + + exports.getTelemetryPrefSync = function() { + catcher.watchPromise(exports.refreshTelemetryPref()); + return !!telemetryPref; + }; + + return exports; +})(); diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/auth.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/auth.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/auth.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/auth.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,216 @@ +/* globals browser, log */ +/* globals main, makeUuid, deviceInfo, analytics, catcher, buildSettings, communication */ + +"use strict"; + +this.auth = (function () { + let exports = {}; + + let registrationInfo; + let initialized = false; + let authHeader = null; + let sentryPublicDSN = null; + let abTests = {}; + + catcher.watchPromise(browser.storage.local.get(["registrationInfo", "abTests"]).then((result) => { + if (result.abTests) { + abTests = result.abTests; + } + if (result.registrationInfo) { + registrationInfo = result.registrationInfo; + } else { + registrationInfo = generateRegistrationInfo(); + log.info("Generating new device authentication ID", registrationInfo); + return browser.storage.local.set({registrationInfo}); + } + })); + + exports.getDeviceId = function () { + return registrationInfo && registrationInfo.deviceId; + }; + + function generateRegistrationInfo() { + let info = { + deviceId: `anon${makeUuid()}`, + secret: makeUuid(), + registered: false + }; + return info; + } + + function register() { + return new Promise((resolve, reject) => { + let registerUrl = main.getBackend() + "/api/register"; + // TODO: replace xhr with Fetch #2261 + let req = new XMLHttpRequest(); + req.open("POST", registerUrl); + req.setRequestHeader("content-type", "application/json"); + req.onload = catcher.watchFunction(() => { + if (req.status == 200) { + log.info("Registered login"); + initialized = true; + saveAuthInfo(JSON.parse(req.responseText)); + resolve(true); + analytics.sendEvent("registered"); + } else { + analytics.sendEvent("register-failed", `bad-response-${req.status}`); + log.warn("Error in response:", req.responseText); + let exc = new Error("Bad response: " + req.status); + exc.popupMessage = "LOGIN_ERROR"; + reject(exc); + } + }); + req.onerror = catcher.watchFunction(() => { + analytics.sendEvent("register-failed", "connection-error"); + let exc = new Error("Error contacting server"); + exc.popupMessage = "LOGIN_CONNECTION_ERROR"; + reject(exc); + }); + req.send(JSON.stringify({ + deviceId: registrationInfo.deviceId, + secret: registrationInfo.secret, + deviceInfo: JSON.stringify(deviceInfo()) + })); + }); + } + + function login(options) { + let { ownershipCheck, noRegister } = options || {}; + return new Promise((resolve, reject) => { + let loginUrl = main.getBackend() + "/api/login"; + // TODO: replace xhr with Fetch #2261 + let req = new XMLHttpRequest(); + req.open("POST", loginUrl); + req.onload = catcher.watchFunction(() => { + if (req.status == 404) { + if (noRegister) { + resolve(false); + } else { + resolve(register()); + } + } else if (req.status >= 300) { + log.warn("Error in response:", req.responseText); + let exc = new Error("Could not log in: " + req.status); + exc.popupMessage = "LOGIN_ERROR"; + analytics.sendEvent("login-failed", `bad-response-${req.status}`); + reject(exc); + } else if (req.status === 0) { + let error = new Error("Could not log in, server unavailable"); + error.popupMessage = "LOGIN_CONNECTION_ERROR"; + analytics.sendEvent("login-failed", "connection-error"); + reject(error); + } else { + initialized = true; + let jsonResponse = JSON.parse(req.responseText); + log.info("Screenshots logged in"); + analytics.sendEvent("login"); + saveAuthInfo(jsonResponse); + if (ownershipCheck) { + resolve({isOwner: jsonResponse.isOwner}); + } else { + resolve(true); + } + } + }); + req.onerror = catcher.watchFunction(() => { + analytics.sendEvent("login-failed", "connection-error"); + let exc = new Error("Connection failed"); + exc.url = loginUrl; + exc.popupMessage = "CONNECTION_ERROR"; + reject(exc); + }); + req.setRequestHeader("content-type", "application/json"); + req.send(JSON.stringify({ + deviceId: registrationInfo.deviceId, + secret: registrationInfo.secret, + deviceInfo: JSON.stringify(deviceInfo()), + ownershipCheck + })); + }); + } + + function saveAuthInfo(responseJson) { + if (responseJson.sentryPublicDSN) { + sentryPublicDSN = responseJson.sentryPublicDSN; + } + if (responseJson.authHeader) { + authHeader = responseJson.authHeader; + if (!registrationInfo.registered) { + registrationInfo.registered = true; + catcher.watchPromise(browser.storage.local.set({registrationInfo})); + } + } + if (responseJson.abTests) { + abTests = responseJson.abTests; + catcher.watchPromise(browser.storage.local.set({abTests})); + } + } + + exports.getDeviceId = function () { + return registrationInfo.deviceId; + }; + + exports.authHeaders = function () { + let initPromise = Promise.resolve(); + if (! initialized) { + initPromise = login(); + } + return initPromise.then(() => { + if (authHeader) { + return {"x-screenshots-auth": authHeader}; + } else { + log.warn("No auth header available"); + return {}; + } + }); + }; + + exports.getSentryPublicDSN = function () { + return sentryPublicDSN || buildSettings.defaultSentryDsn; + }; + + exports.getAbTests = function () { + return abTests; + }; + + exports.isRegistered = function () { + return registrationInfo.registered; + }; + + exports.setDeviceInfoFromOldAddon = function (newDeviceInfo) { + if (! (newDeviceInfo.deviceId && newDeviceInfo.secret)) { + throw new Error("Bad deviceInfo"); + } + if (registrationInfo.deviceId === newDeviceInfo.deviceId && + registrationInfo.secret === newDeviceInfo.secret) { + // Probably we already imported the information + return Promise.resolve(false); + } + registrationInfo = { + deviceId: newDeviceInfo.deviceId, + secret: newDeviceInfo.secret, + registered: true + }; + initialized = false; + return browser.storage.local.set({registrationInfo}).then(() => { + return true; + }); + }; + + communication.register("getAuthInfo", (sender, ownershipCheck) => { + let info = registrationInfo; + let done = Promise.resolve(); + if (info.registered) { + done = login({ownershipCheck}).then((result) => { + if (result && result.isOwner) { + info.isOwner = true; + } + }); + } + return done.then(() => { + return info; + }); + }); + + return exports; +})(); diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/communication.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/communication.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/communication.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/communication.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,80 @@ +/* globals browser, catcher, log */ + +"use strict"; + +this.communication = (function () { + let exports = {}; + + let registeredFunctions = {}; + + browser.runtime.onMessage.addListener(catcher.watchFunction((req, sender, sendResponse) => { + if (! (req.funcName in registeredFunctions)) { + log.error(`Received unknown internal message type ${req.funcName}`); + sendResponse({type: "error", name: "Unknown message type"}); + return; + } + if (! Array.isArray(req.args)) { + log.error("Received message with no .args list"); + sendResponse({type: "error", name: "No .args"}); + return; + } + let func = registeredFunctions[req.funcName]; + let result; + try { + req.args.unshift(sender); + result = func.apply(null, req.args); + } catch (e) { + log.error(`Error in ${req.funcName}:`, e, e.stack); + // FIXME: should consider using makeError from catcher here: + sendResponse({type: "error", message: e+""}); + return; + } + if (result && result.then) { + result.then((concreteResult) => { + sendResponse({type: "success", value: concreteResult}); + }).catch((errorResult) => { + log.error(`Promise error in ${req.funcName}:`, errorResult, errorResult && errorResult.stack); + sendResponse({type: "error", message: errorResult+""}); + }); + return true; + } else { + sendResponse({type: "success", value: result}); + } + })); + + exports.register = function (name, func) { + registeredFunctions[name] = func; + }; + + /** Send a message to bootstrap.js + Technically any worker can listen to this. If the bootstrap wrapper is not in place, then this + will *not* fail, and will return a value of exports.NO_BOOTSTRAP */ + exports.sendToBootstrap = function (funcName, ...args) { + return browser.runtime.sendMessage({funcName, args}).then((result) => { + if (result.type === "success") { + return result.value; + } else { + throw new Error(`Error in ${funcName}: ${result.name || 'unknown'}`); + } + }, (error) => { + if (isBootstrapMissingError(error)) { + return exports.NO_BOOTSTRAP; + } + throw error; + }); + }; + + function isBootstrapMissingError(error) { + if (! error) { + return false; + } + return error.errorCode === "NO_RECEIVING_END" || + (! error.errorCode && error.message === "Could not establish connection. Receiving end does not exist."); + } + + + // A singleton/sentinal (with a name): + exports.NO_BOOTSTRAP = {name: "communication.NO_BOOTSTRAP"}; + + return exports; +})(); diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/deviceInfo.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/deviceInfo.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/deviceInfo.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/deviceInfo.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,34 @@ +/* globals browser, catcher */ + +"use strict"; + +this.deviceInfo = (function () { + let manifest = browser.runtime.getManifest(); + + let platformInfo = {}; + catcher.watchPromise(browser.runtime.getPlatformInfo().then((info) => { + platformInfo = info; + })); + + return function deviceInfo() { + let match = navigator.userAgent.match(/Chrom(?:e|ium)\/([0-9\.]+)/); + let chromeVersion = match ? match[1] : null; + match = navigator.userAgent.match(/Firefox\/([0-9\.]+)/); + let firefoxVersion = match ? match[1] : null; + let appName = chromeVersion ? "chrome" : "firefox"; + + return { + addonVersion: manifest.version, + platform: platformInfo.os, + architecture: platformInfo.arch, + version: firefoxVersion || chromeVersion, + // These don't seem to apply to Chrome: + //build: system.build, + //platformVersion: system.platformVersion, + userAgent: navigator.userAgent, + appVendor: appName, + appName + }; + }; + +})(); diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/main.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/main.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/main.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/main.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,276 @@ +/* globals browser, console, XMLHttpRequest, Image, document, setTimeout, navigator */ +/* globals selectorLoader, analytics, communication, catcher, makeUuid, auth, senderror */ + +"use strict"; + +this.main = (function () { + let exports = {}; + + const pasteSymbol = (window.navigator.platform.match(/Mac/i)) ? "\u2318" : "Ctrl"; + const { sendEvent } = analytics; + + let manifest = browser.runtime.getManifest(); + let backend; + + let hasSeenOnboarding; + + browser.storage.local.get(["hasSeenOnboarding"]).then((result) => { + hasSeenOnboarding = !! result.hasSeenOnboarding; + if (! hasSeenOnboarding) { + setIconActive(false, null); + // Note that the branded name 'Firefox Screenshots' is not localized: + browser.browserAction.setTitle({ + title: "Firefox Screenshots" + }); + } + }).catch((error) => { + log.error("Error getting hasSeenOnboarding:", error); + }); + + exports.setBackend = function (newBackend) { + backend = newBackend; + backend = backend.replace(/\/*$/, ""); + }; + + exports.getBackend = function () { + return backend; + }; + + communication.register("getBackend", () => { + return backend; + }); + + function getOnboardingUrl() { + return backend + "/#hello"; + } + + for (let permission of manifest.permissions) { + if (/^https?:\/\//.test(permission)) { + exports.setBackend(permission); + break; + } + } + + function setIconActive(active, tabId) { + let path = active ? "icons/icon-highlight-38.png" : "icons/icon-38.png"; + if ((! hasSeenOnboarding) && ! active) { + path = "icons/icon-starred-38.png"; + } + browser.browserAction.setIcon({path, tabId}); + } + + function toggleSelector(tab) { + return analytics.refreshTelemetryPref() + .then(() => selectorLoader.toggle(tab.id, hasSeenOnboarding)) + .then(active => { + setIconActive(active, tab.id); + return active; + }) + .catch((error) => { + error.popupMessage = "UNSHOOTABLE_PAGE"; + throw error; + }); + } + + function shouldOpenMyShots(url) { + return /^about:(?:newtab|blank)/i.test(url) || /^resource:\/\/activity-streams\//i.test(url); + } + + browser.browserAction.onClicked.addListener(catcher.watchFunction((tab) => { + if (shouldOpenMyShots(tab.url)) { + if (! hasSeenOnboarding) { + catcher.watchPromise(analytics.refreshTelemetryPref().then(() => { + sendEvent("goto-onboarding", "selection-button"); + return forceOnboarding(); + })); + return; + } + catcher.watchPromise(analytics.refreshTelemetryPref().then(() => { + sendEvent("goto-myshots", "about-newtab"); + })); + catcher.watchPromise( + auth.authHeaders() + .then(() => browser.tabs.update({url: backend + "/shots"}))); + } else { + catcher.watchPromise( + toggleSelector(tab) + .then(active => { + const event = active ? "start-shot" : "cancel-shot"; + sendEvent(event, "toolbar-button"); + }, (error) => { + if ((! hasSeenOnboarding) && error.popupMessage == "UNSHOOTABLE_PAGE") { + sendEvent("goto-onboarding", "selection-button"); + return forceOnboarding(); + } + throw error; + })); + } + })); + + function forceOnboarding() { + return browser.tabs.create({url: getOnboardingUrl()}).then((tab) => { + return toggleSelector(tab); + }); + } + + browser.contextMenus.create({ + id: "create-screenshot", + title: browser.i18n.getMessage("contextMenuLabel"), + contexts: ["page"], + documentUrlPatterns: [""] + }, () => { + // Note: unlike most browser.* functions this one does not return a promise + if (browser.runtime.lastError) { + catcher.unhandled(new Error(browser.runtime.lastError.message)); + } + }); + + browser.contextMenus.onClicked.addListener(catcher.watchFunction((info, tab) => { + if (! tab) { + // Not in a page/tab context, ignore + return; + } + catcher.watchPromise( + toggleSelector(tab) + .then(() => sendEvent("start-shot", "context-menu"))); + })); + + function urlEnabled(url) { + if (shouldOpenMyShots(url)) { + return true; + } + if (isShotOrMyShotPage(url) || /^(?:about|data|moz-extension):/i.test(url) || isBlacklistedUrl(url)) { + return false; + } + return true; + } + + function isShotOrMyShotPage(url) { + // It's okay to take a shot of any pages except shot pages and My Shots + if (! url.startsWith(backend)) { + return false; + } + let path = url.substr(backend.length).replace(/^\/*/, "").replace(/#.*/, "").replace(/\?.*/, ""); + if (path == "shots") { + return true; + } + if (/^[^/]+\/[^/]+$/.test(url)) { + // Blocks {:id}/{:domain}, but not /, /privacy, etc + return true; + } + return false; + } + + function isBlacklistedUrl(url) { + // These specific domains are not allowed for general WebExtension permission reasons + // Discussion: https://bugzilla.mozilla.org/show_bug.cgi?id=1310082 + // List of domains copied from: https://dxr.mozilla.org/mozilla-central/source/browser/app/permissions#18-19 + // Note we disable it here to be informative, the security check is done in WebExtension code + const badDomains = ["addons.mozilla.org", "testpilot.firefox.com"]; + let domain = url.replace(/^https?:\/\//i, ""); + domain = domain.replace(/\/.*/, "").replace(/:.*/, ""); + domain = domain.toLowerCase(); + return badDomains.includes(domain); + } + + browser.tabs.onUpdated.addListener(catcher.watchFunction((id, info, tab) => { + if (info.url && tab.active) { + if (urlEnabled(info.url)) { + browser.browserAction.enable(tab.id); + } else if (hasSeenOnboarding) { + browser.browserAction.disable(tab.id); + } + } + })); + + browser.tabs.onActivated.addListener(catcher.watchFunction(({tabId, windowId}) => { + catcher.watchPromise(browser.tabs.get(tabId).then((tab) => { + // onActivated may fire before the url is set + if (!tab.url) { + return; + } + if (urlEnabled(tab.url)) { + browser.browserAction.enable(tabId); + } else if (hasSeenOnboarding) { + browser.browserAction.disable(tabId); + } + })); + })); + + communication.register("sendEvent", (sender, ...args) => { + catcher.watchPromise(sendEvent(...args)); + // We don't wait for it to complete: + return null; + }); + + communication.register("openMyShots", (sender) => { + return catcher.watchPromise( + auth.authHeaders() + .then(() => browser.tabs.create({url: backend + "/shots"}))); + }); + + communication.register("openShot", (sender, {url, copied}) => { + if (copied) { + const id = makeUuid(); + return browser.notifications.create(id, { + type: "basic", + iconUrl: "../icons/copy.png", + title: browser.i18n.getMessage("notificationLinkCopiedTitle"), + message: browser.i18n.getMessage("notificationLinkCopiedDetails", pasteSymbol) + }); + } + }); + + communication.register("downloadShot", (sender, info) => { + // 'data:' urls don't work directly, let's use a Blob + // see http://stackoverflow.com/questions/40269862/save-data-uri-as-file-using-downloads-download-api + const binary = atob(info.url.split(',')[1]); // just the base64 data + const data = Uint8Array.from(binary, char => char.charCodeAt(0)) + const blob = new Blob([data], {type: "image/png"}) + return browser.downloads.download({ + url: URL.createObjectURL(blob), + filename: info.filename + }); + }); + + communication.register("closeSelector", (sender) => { + setIconActive(false, sender.tab.id) + }); + + catcher.watchPromise(communication.sendToBootstrap("getOldDeviceInfo").then((deviceInfo) => { + if (deviceInfo === communication.NO_BOOTSTRAP || ! deviceInfo) { + return; + } + deviceInfo = JSON.parse(deviceInfo); + if (deviceInfo && typeof deviceInfo == "object") { + return auth.setDeviceInfoFromOldAddon(deviceInfo).then((updated) => { + if (updated === communication.NO_BOOTSTRAP) { + throw new Error("bootstrap.js disappeared unexpectedly"); + } + if (updated) { + return communication.sendToBootstrap("removeOldAddon"); + } + }); + } + })); + + communication.register("hasSeenOnboarding", () => { + hasSeenOnboarding = true; + catcher.watchPromise(browser.storage.local.set({hasSeenOnboarding})); + setIconActive(false, null); + browser.browserAction.setTitle({ + title: browser.i18n.getMessage("contextMenuLabel") + }); + }); + + communication.register("abortFrameset", () => { + sendEvent("abort-start-shot", "frame-page"); + // Note, we only show the error but don't report it, as we know that we can't + // take shots of these pages: + senderror.showError({ + popupMessage: "UNSHOOTABLE_PAGE" + }); + }); + + return exports; +})(); diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/selectorLoader.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/selectorLoader.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/selectorLoader.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/selectorLoader.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,114 @@ +/* globals browser, catcher, log */ + +"use strict"; + +this.selectorLoader = (function () { + const exports = {}; + + // These modules are loaded in order, first standardScripts, then optionally onboardingScripts, and then selectorScripts + // The order is important due to dependencies + const standardScripts = [ + "build/buildSettings.js", + "log.js", + "catcher.js", + "assertIsTrusted.js", + "background/selectorLoader.js", + "selector/callBackground.js", + "selector/util.js" + ]; + + const selectorScripts = [ + "clipboard.js", + "makeUuid.js", + "build/shot.js", + "randomString.js", + "domainFromUrl.js", + "build/inlineSelectionCss.js", + "selector/documentMetadata.js", + "selector/ui.js", + "selector/shooter.js", + "selector/uicontrol.js" + ]; + + // These are loaded on request (by the selector worker) to activate the onboarding: + const onboardingScripts = [ + "build/onboardingCss.js", + "build/onboardingHtml.js", + "onboarding/slides.js" + ]; + + exports.unloadIfLoaded = function (tabId) { + return browser.tabs.executeScript(tabId, { + code: "this.selectorLoader && this.selectorLoader.unloadModules()", + runAt: "document_start" + }).then(result => { + return result && result[0]; + }); + }; + + exports.loadModules = function (tabId, hasSeenOnboarding) { + if (hasSeenOnboarding) { + return executeModules(tabId, standardScripts.concat(selectorScripts)); + } else { + return executeModules(tabId, standardScripts.concat(onboardingScripts).concat(selectorScripts)); + } + }; + + function executeModules(tabId, scripts) { + let lastPromise = Promise.resolve(null); + scripts.forEach((file) => { + lastPromise = lastPromise.then(() => { + return browser.tabs.executeScript(tabId, { + file, + runAt: "document_end" + }) + .catch((error) => { + log.error("error in script:", file, error); + error.scriptName = file; + throw error; + }) + }) + }); + return lastPromise.then(() => { + log.debug("finished loading scripts:", scripts.join(" ")); + }, + (error) => { + exports.unloadIfLoaded(tabId); + catcher.unhandled(error); + throw error; + }); + } + + exports.unloadModules = function () { + const watchFunction = catcher.watchFunction; + let allScripts = standardScripts.concat(onboardingScripts).concat(selectorScripts); + const moduleNames = allScripts.map((filename) => + filename.replace(/^.*\//, "").replace(/\.js$/, "")); + moduleNames.reverse(); + for (let moduleName of moduleNames) { + let moduleObj = global[moduleName]; + if (moduleObj && moduleObj.unload) { + try { + watchFunction(moduleObj.unload)(); + } catch (e) { + // ignore (watchFunction handles it) + } + } + delete global[moduleName]; + } + return true; + }; + + exports.toggle = function (tabId, hasSeenOnboarding) { + return exports.unloadIfLoaded(tabId) + .then(wasLoaded => { + if (!wasLoaded) { + exports.loadModules(tabId, hasSeenOnboarding); + } + return !wasLoaded; + }) + }; + + return exports; +})(); +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/senderror.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/senderror.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/senderror.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/senderror.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,117 @@ +/* globals analytics, browser, communication, makeUuid, Raven, catcher, auth, log */ + +"use strict"; + +this.senderror = (function () { + let exports = {}; + + // Do not show an error more than every ERROR_TIME_LIMIT milliseconds: + const ERROR_TIME_LIMIT = 3000; + + let messages = { + REQUEST_ERROR: { + title: browser.i18n.getMessage("requestErrorTitle"), + info: browser.i18n.getMessage("requestErrorDetails") + }, + CONNECTION_ERROR: { + title: browser.i18n.getMessage("connectionErrorTitle"), + info: browser.i18n.getMessage("connectionErrorDetails") + }, + LOGIN_ERROR: { + title: browser.i18n.getMessage("requestErrorTitle"), + info: browser.i18n.getMessage("loginErrorDetails") + }, + LOGIN_CONNECTION_ERROR: { + title: browser.i18n.getMessage("connectionErrorTitle"), + info: browser.i18n.getMessage("connectionErrorDetails") + }, + UNSHOOTABLE_PAGE: { + title: browser.i18n.getMessage("unshootablePageErrorTitle"), + info: browser.i18n.getMessage("unshootablePageErrorDetails") + }, + SHOT_PAGE: { + title: browser.i18n.getMessage("selfScreenshotErrorTitle") + }, + MY_SHOTS: { + title: browser.i18n.getMessage("selfScreenshotErrorTitle") + }, + generic: { + title: browser.i18n.getMessage("genericErrorTitle"), + info: browser.i18n.getMessage("genericErrorDetails"), + showMessage: true + } + }; + + communication.register("reportError", (sender, error) => { + catcher.unhandled(error); + }); + + let lastErrorTime; + + exports.showError = function (error) { + if (lastErrorTime && (Date.now() - lastErrorTime) < ERROR_TIME_LIMIT) { + return; + } + lastErrorTime = Date.now(); + let id = makeUuid(); + let popupMessage = error.popupMessage || "generic"; + if (! messages[popupMessage]) { + popupMessage = "generic"; + } + let title = messages[popupMessage].title; + let message = messages[popupMessage].info || ''; + let showMessage = messages[popupMessage].showMessage; + if (error.message && showMessage) { + if (message) { + message += "\n" + error.message; + } else { + message = error.message; + } + } + browser.notifications.create(id, { + type: "basic", + // FIXME: need iconUrl for an image, see #2239 + title, + message + }); + }; + + exports.reportError = function (e) { + if (!analytics.getTelemetryPrefSync()) { + log.error("Telemetry disabled. Not sending critical error:", e); + return; + } + let dsn = auth.getSentryPublicDSN(); + if (! dsn) { + log.warn("Error:", e); + return; + } + if (! Raven.isSetup()) { + Raven.config(dsn).install(); + } + let exception = new Error(e.message); + exception.stack = e.multilineStack || e.stack || undefined; + let rest = {}; + for (let attr in e) { + if (! ["name", "message", "stack", "multilineStack", "popupMessage", "version", "sentryPublicDSN", "help"].includes(attr)) { + rest[attr] = e[attr]; + } + } + rest.stack = e.multilineStack || e.stack; + Raven.captureException(exception, { + logger: 'addon', + tags: {version: e.version, category: e.popupMessage}, + message: exception.message, + extra: rest + }); + }; + + catcher.registerHandler((errorObj) => { + if (! errorObj.noPopup) { + exports.showError(errorObj); + } + exports.reportError(errorObj); + }); + + return exports; +})(); diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/takeshot.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/takeshot.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/background/takeshot.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/background/takeshot.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,128 @@ +/* globals communication, shot, main, auth, catcher, analytics, browser */ + +"use strict"; + +this.takeshot = (function () { + let exports = {}; + const Shot = shot.AbstractShot; + const { sendEvent } = analytics; + + communication.register("takeShot", catcher.watchFunction((sender, options) => { + let { captureType, captureText, scroll, selectedPos, shotId, shot } = options; + shot = new Shot(main.getBackend(), shotId, shot); + let capturePromise = Promise.resolve(); + let openedTab; + if (! shot.clipNames().length) { + // canvas.drawWindow isn't available, so we fall back to captureVisibleTab + capturePromise = screenshotPage(selectedPos, scroll).then((dataUrl) => { + shot.addClip({ + createdDate: Date.now(), + image: { + url: dataUrl, + captureType, + text: captureText, + location: selectedPos, + dimensions: { + x: selectedPos.right - selectedPos.left, + y: selectedPos.bottom - selectedPos.top + } + } + }); + }); + } + let shotAbTests = {}; + let abTests = auth.getAbTests(); + for (let testName of Object.keys(abTests)) { + if (abTests[testName].shotField) { + shotAbTests[testName] = abTests[testName].value; + } + } + if (Object.keys(shotAbTests).length) { + shot.abTests = shotAbTests; + } + return catcher.watchPromise(capturePromise.then(() => { + return browser.tabs.create({url: shot.creatingUrl}) + }).then((tab) => { + openedTab = tab; + return uploadShot(shot); + }).then(() => { + return browser.tabs.update(openedTab.id, {url: shot.viewUrl}); + }).then(() => { + return shot.viewUrl; + }).catch((error) => { + browser.tabs.remove(openedTab.id); + throw error; + })); + })); + + communication.register("screenshotPage", (sender, selectedPos, scroll) => { + return screenshotPage(selectedPos, scroll); + }); + + function screenshotPage(pos, scroll) { + pos = { + top: pos.top - scroll.scrollY, + left: pos.left - scroll.scrollX, + bottom: pos.bottom - scroll.scrollY, + right: pos.right - scroll.scrollX + }; + pos.width = pos.right - pos.left; + pos.height = pos.bottom - pos.top; + return catcher.watchPromise(browser.tabs.captureVisibleTab( + null, + {format: "png"} + ).then((dataUrl) => { + let image = new Image(); + image.src = dataUrl; + return new Promise((resolve, reject) => { + image.onload = catcher.watchFunction(() => { + let xScale = image.width / scroll.innerWidth; + let yScale = image.height / scroll.innerHeight; + let canvas = document.createElement("canvas"); + canvas.height = pos.height * yScale; + canvas.width = pos.width * xScale; + let context = canvas.getContext("2d"); + context.drawImage( + image, + pos.left * xScale, pos.top * yScale, + pos.width * xScale, pos.height * yScale, + 0, 0, + pos.width * xScale, pos.height * yScale + ); + let result = canvas.toDataURL(); + resolve(result); + }); + }); + })); + } + + function uploadShot(shot) { + return auth.authHeaders().then((headers) => { + headers["content-type"] = "application/json"; + let body = JSON.stringify(shot.asJson()); + let req = new Request(shot.jsonUrl, { + method: "PUT", + mode: "cors", + headers, + body + }); + sendEvent("upload", "started", {eventValue: Math.floor(body.length / 1000)}); + return fetch(req); + }).then((resp) => { + if (! resp.ok) { + sendEvent("upload-failed", `status-${resp.status}`); + let exc = new Error(`Response failed with status ${resp.status}`); + exc.popupMessage = "REQUEST_ERROR"; + throw exc; + } else { + sendEvent("upload", "success"); + } + }, (error) => { + // FIXME: I'm not sure what exceptions we can expect + sendEvent("upload-failed", "connection"); + throw error; + }); + } + + return exports; +})(); diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/blank.html firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/blank.html --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/blank.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/blank.html 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1 @@ + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/buildSettings.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/buildSettings.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/buildSettings.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/buildSettings.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,6 @@ +window.buildSettings = { + defaultSentryDsn: "", + logLevel: "" || "warn" +}; +null; + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/inlineSelectionCss.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/inlineSelectionCss.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/inlineSelectionCss.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/inlineSelectionCss.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,438 @@ +/* Created from build/server/static/css/inline-selection.css */ +window.inlineSelectionCss = ` +.button, .highlight-button-cancel, .highlight-button-save, .highlight-button-download { + display: flex; + align-items: center; + justify-content: center; + border: 0; + border-radius: 1px; + cursor: pointer; + font-size: 16px; + font-weight: 400; + height: 40px; + min-width: 40px; + outline: none; + padding: 0 10px; + position: relative; + text-align: center; + text-decoration: none; + transition: background 150ms; + user-select: none; + white-space: nowrap; } + .button.small, .small.highlight-button-cancel, .small.highlight-button-save, .small.highlight-button-download { + height: 32px; + line-height: 32px; + padding: 0 8px; } + .button.tiny, .tiny.highlight-button-cancel, .tiny.highlight-button-save, .tiny.highlight-button-download { + font-size: 12px; + height: 22px; + line-height: 12px; + padding: 2px 6px; } + .button.set-width--medium, .set-width--medium.highlight-button-cancel, .set-width--medium.highlight-button-save, .set-width--medium.highlight-button-download { + max-width: 200px; } + .button.inline, .inline.highlight-button-cancel, .inline.highlight-button-save, .inline.highlight-button-download { + display: inline-block; } + .button.block-button, .block-button.highlight-button-cancel, .block-button.highlight-button-save, .block-button.highlight-button-download { + display: flex; + align-items: center; + justify-content: center; + border: none; + border-right: 1px solid rgba(0, 0, 0, 0.1); + box-shadow: none; + border-radius: 0; + height: 100%; + line-height: 100%; + padding: 0 20px; + margin-right: 20px; + flex: 0 0 155px; } + .button .arrow-icon, .highlight-button-cancel .arrow-icon, .highlight-button-save .arrow-icon, .highlight-button-download .arrow-icon { + display: inline-block; + position: relative; + top: 1px; + flex: 0 0 18px; + height: 16px; + opacity: .6; + background-image: url(../img/arrow-page-right-16.svg); + background-position: right center; + background-repeat: no-repeat; } + +.inverse-color-scheme { + background: #383E49; + color: #FFF; } + .inverse-color-scheme a { + color: #0996F8; } + .inverse-color-scheme .large-icon { + filter: invert(100%); } + +.default-color-scheme { + background: #f2f2f2; + color: #000; } + .default-color-scheme a { + color: #0996F8; } + +.button.primary, .primary.highlight-button-cancel, .highlight-button-save, .primary.highlight-button-download { + background-color: #0996F8; + color: #FFF; } + .button.primary:hover, .primary.highlight-button-cancel:hover, .highlight-button-save:hover, .primary.highlight-button-download:hover, .button.primary:focus, .primary.highlight-button-cancel:focus, .highlight-button-save:focus, .primary.highlight-button-download:focus { + background-color: #0681d7; } + .button.primary:active, .primary.highlight-button-cancel:active, .highlight-button-save:active, .primary.highlight-button-download:active { + background-color: #0573be; } + +.button.secondary, .highlight-button-cancel, .secondary.highlight-button-save, .highlight-button-download { + background: #EDEDED; + color: #000; } + .button.secondary:hover, .highlight-button-cancel:hover, .secondary.highlight-button-save:hover, .highlight-button-download:hover, .button.secondary:focus, .highlight-button-cancel:focus, .secondary.highlight-button-save:focus, .highlight-button-download:focus { + background-color: #dbdbdb; } + .button.secondary:active, .highlight-button-cancel:active, .secondary.highlight-button-save:active, .highlight-button-download:active { + background-color: #cecece; } + +.button.warning, .warning.highlight-button-cancel, .warning.highlight-button-save, .warning.highlight-button-download { + color: #FFF; + background: #d92215; } + .button.warning:hover, .warning.highlight-button-cancel:hover, .warning.highlight-button-save:hover, .warning.highlight-button-download:hover, .button.warning:focus, .warning.highlight-button-cancel:focus, .warning.highlight-button-save:focus, .warning.highlight-button-download:focus { + background: #b81d12; } + .button.warning:active, .warning.highlight-button-cancel:active, .warning.highlight-button-save:active, .warning.highlight-button-download:active { + background: #a11910; } + +.subtitle-link { + color: #0996F8; } + +@keyframes fade-in { + 0% { + opacity: 0; } + 100% { + opacity: 1; } } + +@keyframes pop { + 0% { + transform: scale(1); } + 97% { + transform: scale(1.04); } + 100% { + transform: scale(1); } } + +@keyframes pulse { + 0% { + opacity: .3; + transform: scale(1); } + 70% { + opacity: .25; + transform: scale(1.04); } + 100% { + opacity: .3; + transform: scale(1); } } + +@keyframes slide-left { + 0% { + opacity: 0; + transform: translate3d(160px, 0, 0); } + 100% { + opacity: 1; + transform: translate3d(0, 0, 0); } } + +.mover-target { + display: flex; + align-items: center; + justify-content: center; + pointer-events: auto; + position: absolute; + z-index: 5; } + +.highlight, +.mover-target { + background-color: transparent; + background-image: none; } + +.mover-target, +.bghighlight { + border: 0; } + +.hover-highlight { + animation: fade-in 125ms forwards cubic-bezier(0.07, 0.95, 0, 1); + background: rgba(255, 255, 255, 0.1); + border-radius: 1px; + pointer-events: none; + position: absolute; + z-index: 10000000000; } + +.mover-target.direction-topLeft { + cursor: nwse-resize; + height: 60px; + left: -30px; + top: -30px; + width: 60px; } + +.mover-target.direction-top { + cursor: ns-resize; + height: 60px; + left: 0; + top: -30px; + width: 100%; + z-index: 4; } + +.mover-target.direction-topRight { + cursor: nesw-resize; + height: 60px; + right: -30px; + top: -30px; + width: 60px; } + +.mover-target.direction-left { + cursor: ew-resize; + height: 100%; + left: -30px; + top: 0; + width: 60px; + z-index: 4; } + +.mover-target.direction-right { + cursor: ew-resize; + height: 100%; + right: -30px; + top: 0; + width: 60px; + z-index: 4; } + +.mover-target.direction-bottomLeft { + bottom: -30px; + cursor: nesw-resize; + height: 60px; + left: -30px; + width: 60px; } + +.mover-target.direction-bottom { + bottom: -30px; + cursor: ns-resize; + height: 60px; + left: 0; + width: 100%; + z-index: 4; } + +.mover-target.direction-bottomRight { + bottom: -30px; + cursor: nwse-resize; + height: 60px; + right: -30px; + width: 60px; } + +.mover-target:hover .mover { + transform: scale(1.05); } + +.mover { + background-color: #FFF; + border-radius: 50%; + box-shadow: 0 0 4px rgba(0, 0, 0, 0.5); + height: 16px; + opacity: 1; + position: relative; + transition: transform 125ms cubic-bezier(0.07, 0.95, 0, 1); + width: 16px; } + .small-selection .mover { + height: 10px; + width: 10px; } + +.direction-topLeft .mover, +.direction-left .mover, +.direction-bottomLeft .mover { + left: -1px; } + +.direction-topLeft .mover, +.direction-top .mover, +.direction-topRight .mover { + top: -1px; } + +.direction-topRight .mover, +.direction-right .mover, +.direction-bottomRight .mover { + right: -1px; } + +.direction-bottomRight .mover, +.direction-bottom .mover, +.direction-bottomLeft .mover { + bottom: -1px; } + +.bghighlight { + background-color: rgba(0, 0, 0, 0.7); + position: absolute; + z-index: 9999999999; } + +.preview-overlay { + align-items: center; + background-color: rgba(0, 0, 0, 0.7); + display: flex; + height: 100%; + justify-content: center; + left: 0; + margin: 0; + padding: 0; + position: fixed; + top: 0; + width: 100%; + z-index: 9999999999; } + +.highlight { + border-radius: 2px; + border: 2px dashed rgba(255, 255, 255, 0.8); + box-sizing: border-box; + cursor: move; + position: absolute; + z-index: 9999999999; } + +.highlight-buttons { + display: flex; + align-items: center; + justify-content: center; + bottom: -55px; + position: absolute; + right: 5px; + z-index: 6; } + .bottom-selection .highlight-buttons { + bottom: 5px; } + +.highlight-button-cancel { + background-color: #ededed; + background-image: url("MOZ_EXTENSION/icons/cancel.svg"); + background-position: center center; + background-repeat: no-repeat; + background-size: 18px 18px; + margin: 5px; + width: 40px; } + +.highlight-button-save { + font-size: 18px; + margin: 5px; + min-width: 80px; } + +.highlight-button-download { + background-color: #ededed; + background-image: url("MOZ_EXTENSION/icons/download.svg"); + background-position: center center; + background-repeat: no-repeat; + background-size: 18px 18px; + display: block; + margin: 5px; + width: 40px; } + +.highlight-button-cancel, +.highlight-button-download { + transition: background-color cubic-bezier(0.07, 0.95, 0, 1) 250ms; } + .highlight-button-cancel:hover, .highlight-button-cancel:focus, .highlight-button-cancel:active, + .highlight-button-download:hover, + .highlight-button-download:focus, + .highlight-button-download:active { + background-color: #dbdbdb; } + +.pixel-dimensions { + position: absolute; + pointer-events: none; + font-weight: bold; + font-family: sans-serif; + font-size: 70%; + color: #000; + text-shadow: -1px -1px 0 #fff, 1px -1px 0 #fff, -1px 1px 0 #fff, 1px 1px 0 #fff; } + +.fixed-container { + align-items: center; + display: flex; + height: 100%; + justify-content: center; + left: 0; + margin: 0; + padding: 0; + pointer-events: none; + position: absolute; + top: 0; + width: 100%; } + +.preview-instructions { + display: flex; + align-items: center; + justify-content: center; + animation: pulse 125mm cubic-bezier(0.07, 0.95, 0, 1); + color: #fff; + font-family: -apple-system, BlinkMacSystemFont, sans-serif; + font-size: 24px; + line-height: 32px; + text-align: center; + width: 400px; } + +.myshots-all-buttons-container { + display: flex; + flex-direction: row-reverse; + background: #f5f5f5; + border-radius: 1px; + box-sizing: border-box; + height: 80px; + padding: 8px; + position: absolute; + right: 5px; + top: 5px; } + .myshots-all-buttons-container .spacer { + background-color: #c9c9c9; + flex: 0 0 1px; + height: 80px; + margin: 0 10px; + position: relative; + top: -8px; } + .myshots-all-buttons-container button { + display: flex; + align-items: center; + flex-direction: column; + justify-content: flex-end; + background-color: #f5f5f5; + background-position: center top; + background-repeat: no-repeat; + background-size: 46px 46px; + border: 1px solid transparent; + cursor: pointer; + height: 100%; + min-width: 90px; + padding: 46px 5px 5px; + pointer-events: all; + transition: border 150ms cubic-bezier(0.07, 0.95, 0, 1), background-color 150ms cubic-bezier(0.07, 0.95, 0, 1); + white-space: nowrap; } + .myshots-all-buttons-container button:hover { + background-color: #ebebeb; + border: 1px solid #c7c7c7; } + .myshots-all-buttons-container button:active { + background-color: #dedede; + border: 1px solid #989898; } + .myshots-all-buttons-container .myshots-button { + background-image: url("MOZ_EXTENSION/icons/menu-myshot.svg"); } + .myshots-all-buttons-container .full-page { + background-image: url("MOZ_EXTENSION/icons/menu-fullpage.svg"); } + .myshots-all-buttons-container .visible { + background-image: url("MOZ_EXTENSION/icons/menu-visible.svg"); } + +.myshots-button-container { + display: flex; + align-items: center; + justify-content: center; } + +/* styleMyShotsButton test: */ +.styleMyShotsButton-bright .myshots-button { + color: #fff; + background: #0996F8; } + +.styleMyShotsButton-bright .myshots-text-pre, +.styleMyShotsButton-bright .myshots-text-post { + filter: brightness(20); } + +/* end styleMyShotsButton test */ +@keyframes pulse { + 0% { + transform: scale(1); } + 50% { + transform: scale(1.06); } + 100% { + transform: scale(1); } } + +@keyframes fade-in { + 0% { + opacity: 0; } + 100% { + opacity: 1; } } + +`; +null; + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/onboardingCss.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/onboardingCss.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/onboardingCss.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/onboardingCss.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,244 @@ +/* Created from build/server/static/css/onboarding.css */ +window.onboardingCss = ` +@keyframes fade-in { + 0% { + opacity: 0; } + 100% { + opacity: 1; } } + +@keyframes pop { + 0% { + transform: scale(1); } + 97% { + transform: scale(1.04); } + 100% { + transform: scale(1); } } + +@keyframes pulse { + 0% { + opacity: .3; + transform: scale(1); } + 70% { + opacity: .25; + transform: scale(1.04); } + 100% { + opacity: .3; + transform: scale(1); } } + +@keyframes slide-left { + 0% { + opacity: 0; + transform: translate3d(160px, 0, 0); } + 100% { + opacity: 1; + transform: translate3d(0, 0, 0); } } + +html, +body { + box-sizing: border-box; + font-family: -apple-system, BlinkMacSystemFont, sans-serif; + height: 100%; + margin: 0; + width: 100%; } + +#slide-overlay { + display: flex; + align-items: center; + flex-direction: column; + justify-content: center; + animation: fade-in 250ms forwards cubic-bezier(0.07, 0.95, 0, 1); + background: rgba(0, 0, 0, 0.8); + height: 100%; + opacity: 0; + width: 100%; } + +#slide-container { + animation-delay: 50ms; + animation: fade-in 250ms forwards cubic-bezier(0.07, 0.95, 0, 1); + opacity: 0; } + +.slide { + display: flex; + align-items: center; + flex-direction: column; + justify-content: center; + background-color: #f2f2f2; + border-radius: 5px; + height: 520px; + overflow: hidden; + width: 700px; } + .slide .slide-image { + background-size: 700px 378px; + flex: 0 0 360px; + font-size: 16px; + width: 100%; } + .slide .slide-content { + display: flex; + align-items: center; + flex-direction: column; + justify-content: center; + box-sizing: border-box; + flex: 0 0 160px; + padding: 5px; + text-align: center; } + .slide h1 { + font-size: 30px; + font-weight: 400; + margin: 0 0 10px; } + .slide h1 sup { + background: #00d1e6; + border-radius: 2px; + color: #fff; + font-size: 16px; + margin-left: 5px; + padding: 2px; + text-transform: uppercase; } + .slide p { + animation-duration: 350ms; + font-size: 16px; + line-height: 23px; + margin: 0; + width: 75%; } + .slide .slide-content-aligner h1 { + font-size: 34px; } + .slide .slide-content-aligner p { + margin: 0 auto; } + .slide .onboarding-legal-notice { + font-size: 12px; + color: #858585; } + .slide .onboarding-legal-notice a { + color: #009ec0; + text-decoration: none; } + .slide:not(.slide-1) h1 { + opacity: 0; + transform: translate3d(160px, 0, 0); + animation: slide-left 500ms forwards cubic-bezier(0.07, 0.95, 0, 1); } + .slide:not(.slide-1) p { + opacity: 0; + transform: translate3d(160px, 0, 0); + animation: slide-left 600ms forwards cubic-bezier(0.07, 0.95, 0, 1); } + .slide:not(.slide-1) .slide-image { + background-color: #00d1e6; } + .slide.slide-1 { + background: #fff; } + .slide.slide-1 .slide-content { + justify-content: space-between; + width: 100%; } + +.slide-1, +.slide-2, +.slide-3, +.slide-4, +.slide-5 { + display: none; } + +.active-slide-1 .slide-1, +.active-slide-2 .slide-2, +.active-slide-3 .slide-3, +.active-slide-4 .slide-4 { + display: flex; } + +#slide-status-container { + display: flex; + align-items: center; + justify-content: center; + padding-top: 15px; } + +.goto-slide { + background: transparent; + background-color: #f2f2f2; + border-radius: 50%; + border: 0; + flex: 0 0 9px; + height: 9px; + margin: 0 4px; + opacity: 0.7; + padding: 0; + transition: height 100ms cubic-bezier(0.07, 0.95, 0, 1), opacity 100ms cubic-bezier(0.07, 0.95, 0, 1); } + +.goto-slide:hover { + opacity: 1; } + +.active-slide-1 .goto-slide-1, +.active-slide-2 .goto-slide-2, +.active-slide-3 .goto-slide-3, +.active-slide-4 .goto-slide-4 { + opacity: 1; + transform: scale(1.1); } + +#prev, #next, +#done { + background-color: #f0f0f0; + border-radius: 50%; + border: 0; + box-shadow: 0 0 12px rgba(0, 0, 0, 0.2); + display: inline-block; + height: 70px; + margin-top: -70px; + position: absolute; + text-align: center; + top: 50%; + transition: background-color 150ms cubic-bezier(0.07, 0.95, 0, 1), background-size 250ms cubic-bezier(0.07, 0.95, 0, 1); + width: 70px; } + +#prev { + left: 50%; + margin-left: -385px; } + +#next, +#done { + left: 50%; + margin-left: 315px; } + +#prev, +#next, +#done { + background-position: center center; + background-repeat: no-repeat; + background-size: 20px 20px; } + +#next { + transform: rotate(180deg); } + +#skip { + background: none; + border: 0; + color: #fff; + font-size: 16px; + left: 50%; + margin-left: -330px; + margin-top: 257px; + opacity: 0.7; + position: absolute; + top: 50%; + transition: opacity 100ms cubic-bezier(0.07, 0.95, 0, 1); + z-index: 10; } + +#prev:hover, +#next:hover, +#done:hover { + background-color: #fff; + background-size: 22px 22px; } + +#prev:active, +#next:active, +#done:active { + background-color: #fff; + background-size: 24px 24px; } + +#skip:hover { + opacity: 1; } + +.active-slide-1 #prev, +.active-slide-4 #next { + display: none; } + +#done { + display: none; } + +.active-slide-4 #done { + display: inline-block; } + +`; +null; + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/onboardingHtml.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/onboardingHtml.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/onboardingHtml.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/onboardingHtml.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,66 @@ +/* Created from addon/webextension/onboarding/slides.html */ +window.onboardingHtml = ` + + + + + + + + +
+ +
+
+ +
+
+
+

Firefox ScreenshotsBeta

+

+
+ +
+
+
+
+
+

+

+
+
+
+
+
+

+

+
+
+
+
+
+

+

+
+
+ + + + + + +
+ + + + +
+ +
+
+ + + +`; +null; + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/raven.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/raven.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/raven.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/raven.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,2833 @@ +/*! Raven.js 3.14.0 (6b817d7) | github.com/getsentry/raven-js */ + +/* + * Includes TraceKit + * https://github.com/getsentry/TraceKit + * + * Copyright 2017 Matt Robenolt and other contributors + * Released under the BSD license + * https://github.com/getsentry/raven-js/blob/master/LICENSE + * + */ + +(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.Raven = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o this._globalOptions.maxBreadcrumbs) { + this._breadcrumbs.shift(); + } + return this; + }, + + addPlugin: function(plugin /*arg1, arg2, ... argN*/) { + var pluginArgs = [].slice.call(arguments, 1); + + this._plugins.push([plugin, pluginArgs]); + if (this._isRavenInstalled) { + this._drainPlugins(); + } + + return this; + }, + + /* + * Set/clear a user to be sent along with the payload. + * + * @param {object} user An object representing user data [optional] + * @return {Raven} + */ + setUserContext: function(user) { + // Intentionally do not merge here since that's an unexpected behavior. + this._globalContext.user = user; + + return this; + }, + + /* + * Merge extra attributes to be sent along with the payload. + * + * @param {object} extra An object representing extra data [optional] + * @return {Raven} + */ + setExtraContext: function(extra) { + this._mergeContext('extra', extra); + + return this; + }, + + /* + * Merge tags to be sent along with the payload. + * + * @param {object} tags An object representing tags [optional] + * @return {Raven} + */ + setTagsContext: function(tags) { + this._mergeContext('tags', tags); + + return this; + }, + + /* + * Clear all of the context. + * + * @return {Raven} + */ + clearContext: function() { + this._globalContext = {}; + + return this; + }, + + /* + * Get a copy of the current context. This cannot be mutated. + * + * @return {object} copy of context + */ + getContext: function() { + // lol javascript + return JSON.parse(stringify(this._globalContext)); + }, + + + /* + * Set environment of application + * + * @param {string} environment Typically something like 'production'. + * @return {Raven} + */ + setEnvironment: function(environment) { + this._globalOptions.environment = environment; + + return this; + }, + + /* + * Set release version of application + * + * @param {string} release Typically something like a git SHA to identify version + * @return {Raven} + */ + setRelease: function(release) { + this._globalOptions.release = release; + + return this; + }, + + /* + * Set the dataCallback option + * + * @param {function} callback The callback to run which allows the + * data blob to be mutated before sending + * @return {Raven} + */ + setDataCallback: function(callback) { + var original = this._globalOptions.dataCallback; + this._globalOptions.dataCallback = isFunction(callback) + ? function (data) { return callback(data, original); } + : callback; + + return this; + }, + + /* + * Set the breadcrumbCallback option + * + * @param {function} callback The callback to run which allows filtering + * or mutating breadcrumbs + * @return {Raven} + */ + setBreadcrumbCallback: function(callback) { + var original = this._globalOptions.breadcrumbCallback; + this._globalOptions.breadcrumbCallback = isFunction(callback) + ? function (data) { return callback(data, original); } + : callback; + + return this; + }, + + /* + * Set the shouldSendCallback option + * + * @param {function} callback The callback to run which allows + * introspecting the blob before sending + * @return {Raven} + */ + setShouldSendCallback: function(callback) { + var original = this._globalOptions.shouldSendCallback; + this._globalOptions.shouldSendCallback = isFunction(callback) + ? function (data) { return callback(data, original); } + : callback; + + return this; + }, + + /** + * Override the default HTTP transport mechanism that transmits data + * to the Sentry server. + * + * @param {function} transport Function invoked instead of the default + * `makeRequest` handler. + * + * @return {Raven} + */ + setTransport: function(transport) { + this._globalOptions.transport = transport; + + return this; + }, + + /* + * Get the latest raw exception that was captured by Raven. + * + * @return {error} + */ + lastException: function() { + return this._lastCapturedException; + }, + + /* + * Get the last event id + * + * @return {string} + */ + lastEventId: function() { + return this._lastEventId; + }, + + /* + * Determine if Raven is setup and ready to go. + * + * @return {boolean} + */ + isSetup: function() { + if (!this._hasJSON) return false; // needs JSON support + if (!this._globalServer) { + if (!this.ravenNotConfiguredError) { + this.ravenNotConfiguredError = true; + this._logDebug('error', 'Error: Raven has not been configured.'); + } + return false; + } + return true; + }, + + afterLoad: function () { + // TODO: remove window dependence? + + // Attempt to initialize Raven on load + var RavenConfig = _window.RavenConfig; + if (RavenConfig) { + this.config(RavenConfig.dsn, RavenConfig.config).install(); + } + }, + + showReportDialog: function (options) { + if (!_document) // doesn't work without a document (React native) + return; + + options = options || {}; + + var lastEventId = options.eventId || this.lastEventId(); + if (!lastEventId) { + throw new RavenConfigError('Missing eventId'); + } + + var dsn = options.dsn || this._dsn; + if (!dsn) { + throw new RavenConfigError('Missing DSN'); + } + + var encode = encodeURIComponent; + var qs = ''; + qs += '?eventId=' + encode(lastEventId); + qs += '&dsn=' + encode(dsn); + + var user = options.user || this._globalContext.user; + if (user) { + if (user.name) qs += '&name=' + encode(user.name); + if (user.email) qs += '&email=' + encode(user.email); + } + + var globalServer = this._getGlobalServer(this._parseDSN(dsn)); + + var script = _document.createElement('script'); + script.async = true; + script.src = globalServer + '/api/embed/error-page/' + qs; + (_document.head || _document.body).appendChild(script); + }, + + /**** Private functions ****/ + _ignoreNextOnError: function () { + var self = this; + this._ignoreOnError += 1; + setTimeout(function () { + // onerror should trigger before setTimeout + self._ignoreOnError -= 1; + }); + }, + + _triggerEvent: function(eventType, options) { + // NOTE: `event` is a native browser thing, so let's avoid conflicting wiht it + var evt, key; + + if (!this._hasDocument) + return; + + options = options || {}; + + eventType = 'raven' + eventType.substr(0,1).toUpperCase() + eventType.substr(1); + + if (_document.createEvent) { + evt = _document.createEvent('HTMLEvents'); + evt.initEvent(eventType, true, true); + } else { + evt = _document.createEventObject(); + evt.eventType = eventType; + } + + for (key in options) if (hasKey(options, key)) { + evt[key] = options[key]; + } + + if (_document.createEvent) { + // IE9 if standards + _document.dispatchEvent(evt); + } else { + // IE8 regardless of Quirks or Standards + // IE9 if quirks + try { + _document.fireEvent('on' + evt.eventType.toLowerCase(), evt); + } catch(e) { + // Do nothing + } + } + }, + + /** + * Wraps addEventListener to capture UI breadcrumbs + * @param evtName the event name (e.g. "click") + * @returns {Function} + * @private + */ + _breadcrumbEventHandler: function(evtName) { + var self = this; + return function (evt) { + // reset keypress timeout; e.g. triggering a 'click' after + // a 'keypress' will reset the keypress debounce so that a new + // set of keypresses can be recorded + self._keypressTimeout = null; + + // It's possible this handler might trigger multiple times for the same + // event (e.g. event propagation through node ancestors). Ignore if we've + // already captured the event. + if (self._lastCapturedEvent === evt) + return; + + self._lastCapturedEvent = evt; + + // try/catch both: + // - accessing evt.target (see getsentry/raven-js#838, #768) + // - `htmlTreeAsString` because it's complex, and just accessing the DOM incorrectly + // can throw an exception in some circumstances. + var target; + try { + target = htmlTreeAsString(evt.target); + } catch (e) { + target = ''; + } + + self.captureBreadcrumb({ + category: 'ui.' + evtName, // e.g. ui.click, ui.input + message: target + }); + }; + }, + + /** + * Wraps addEventListener to capture keypress UI events + * @returns {Function} + * @private + */ + _keypressEventHandler: function() { + var self = this, + debounceDuration = 1000; // milliseconds + + // TODO: if somehow user switches keypress target before + // debounce timeout is triggered, we will only capture + // a single breadcrumb from the FIRST target (acceptable?) + return function (evt) { + var target; + try { + target = evt.target; + } catch (e) { + // just accessing event properties can throw an exception in some rare circumstances + // see: https://github.com/getsentry/raven-js/issues/838 + return; + } + var tagName = target && target.tagName; + + // only consider keypress events on actual input elements + // this will disregard keypresses targeting body (e.g. tabbing + // through elements, hotkeys, etc) + if (!tagName || tagName !== 'INPUT' && tagName !== 'TEXTAREA' && !target.isContentEditable) + return; + + // record first keypress in a series, but ignore subsequent + // keypresses until debounce clears + var timeout = self._keypressTimeout; + if (!timeout) { + self._breadcrumbEventHandler('input')(evt); + } + clearTimeout(timeout); + self._keypressTimeout = setTimeout(function () { + self._keypressTimeout = null; + }, debounceDuration); + }; + }, + + /** + * Captures a breadcrumb of type "navigation", normalizing input URLs + * @param to the originating URL + * @param from the target URL + * @private + */ + _captureUrlChange: function(from, to) { + var parsedLoc = parseUrl(this._location.href); + var parsedTo = parseUrl(to); + var parsedFrom = parseUrl(from); + + // because onpopstate only tells you the "new" (to) value of location.href, and + // not the previous (from) value, we need to track the value of the current URL + // state ourselves + this._lastHref = to; + + // Use only the path component of the URL if the URL matches the current + // document (almost all the time when using pushState) + if (parsedLoc.protocol === parsedTo.protocol && parsedLoc.host === parsedTo.host) + to = parsedTo.relative; + if (parsedLoc.protocol === parsedFrom.protocol && parsedLoc.host === parsedFrom.host) + from = parsedFrom.relative; + + this.captureBreadcrumb({ + category: 'navigation', + data: { + to: to, + from: from + } + }); + }, + + /** + * Install any queued plugins + */ + _instrumentTryCatch: function() { + var self = this; + + var wrappedBuiltIns = self._wrappedBuiltIns; + + function wrapTimeFn(orig) { + return function (fn, t) { // preserve arity + // Make a copy of the arguments to prevent deoptimization + // https://github.com/petkaantonov/bluebird/wiki/Optimization-killers#32-leaking-arguments + var args = new Array(arguments.length); + for(var i = 0; i < args.length; ++i) { + args[i] = arguments[i]; + } + var originalCallback = args[0]; + if (isFunction(originalCallback)) { + args[0] = self.wrap(originalCallback); + } + + // IE < 9 doesn't support .call/.apply on setInterval/setTimeout, but it + // also supports only two arguments and doesn't care what this is, so we + // can just call the original function directly. + if (orig.apply) { + return orig.apply(this, args); + } else { + return orig(args[0], args[1]); + } + }; + } + + var autoBreadcrumbs = this._globalOptions.autoBreadcrumbs; + + function wrapEventTarget(global) { + var proto = _window[global] && _window[global].prototype; + if (proto && proto.hasOwnProperty && proto.hasOwnProperty('addEventListener')) { + fill(proto, 'addEventListener', function(orig) { + return function (evtName, fn, capture, secure) { // preserve arity + try { + if (fn && fn.handleEvent) { + fn.handleEvent = self.wrap(fn.handleEvent); + } + } catch (err) { + // can sometimes get 'Permission denied to access property "handle Event' + } + + // More breadcrumb DOM capture ... done here and not in `_instrumentBreadcrumbs` + // so that we don't have more than one wrapper function + var before, + clickHandler, + keypressHandler; + + if (autoBreadcrumbs && autoBreadcrumbs.dom && (global === 'EventTarget' || global === 'Node')) { + // NOTE: generating multiple handlers per addEventListener invocation, should + // revisit and verify we can just use one (almost certainly) + clickHandler = self._breadcrumbEventHandler('click'); + keypressHandler = self._keypressEventHandler(); + before = function (evt) { + // need to intercept every DOM event in `before` argument, in case that + // same wrapped method is re-used for different events (e.g. mousemove THEN click) + // see #724 + if (!evt) return; + + var eventType; + try { + eventType = evt.type + } catch (e) { + // just accessing event properties can throw an exception in some rare circumstances + // see: https://github.com/getsentry/raven-js/issues/838 + return; + } + if (eventType === 'click') + return clickHandler(evt); + else if (eventType === 'keypress') + return keypressHandler(evt); + }; + } + return orig.call(this, evtName, self.wrap(fn, undefined, before), capture, secure); + }; + }, wrappedBuiltIns); + fill(proto, 'removeEventListener', function (orig) { + return function (evt, fn, capture, secure) { + try { + fn = fn && (fn.__raven_wrapper__ ? fn.__raven_wrapper__ : fn); + } catch (e) { + // ignore, accessing __raven_wrapper__ will throw in some Selenium environments + } + return orig.call(this, evt, fn, capture, secure); + }; + }, wrappedBuiltIns); + } + } + + fill(_window, 'setTimeout', wrapTimeFn, wrappedBuiltIns); + fill(_window, 'setInterval', wrapTimeFn, wrappedBuiltIns); + if (_window.requestAnimationFrame) { + fill(_window, 'requestAnimationFrame', function (orig) { + return function (cb) { + return orig(self.wrap(cb)); + }; + }, wrappedBuiltIns); + } + + // event targets borrowed from bugsnag-js: + // https://github.com/bugsnag/bugsnag-js/blob/master/src/bugsnag.js#L666 + var eventTargets = ['EventTarget', 'Window', 'Node', 'ApplicationCache', 'AudioTrackList', 'ChannelMergerNode', 'CryptoOperation', 'EventSource', 'FileReader', 'HTMLUnknownElement', 'IDBDatabase', 'IDBRequest', 'IDBTransaction', 'KeyOperation', 'MediaController', 'MessagePort', 'ModalWindow', 'Notification', 'SVGElementInstance', 'Screen', 'TextTrack', 'TextTrackCue', 'TextTrackList', 'WebSocket', 'WebSocketWorker', 'Worker', 'XMLHttpRequest', 'XMLHttpRequestEventTarget', 'XMLHttpRequestUpload']; + for (var i = 0; i < eventTargets.length; i++) { + wrapEventTarget(eventTargets[i]); + } + }, + + + /** + * Instrument browser built-ins w/ breadcrumb capturing + * - XMLHttpRequests + * - DOM interactions (click/typing) + * - window.location changes + * - console + * + * Can be disabled or individually configured via the `autoBreadcrumbs` config option + */ + _instrumentBreadcrumbs: function () { + var self = this; + var autoBreadcrumbs = this._globalOptions.autoBreadcrumbs; + + var wrappedBuiltIns = self._wrappedBuiltIns; + + function wrapProp(prop, xhr) { + if (prop in xhr && isFunction(xhr[prop])) { + fill(xhr, prop, function (orig) { + return self.wrap(orig); + }); // intentionally don't track filled methods on XHR instances + } + } + + if (autoBreadcrumbs.xhr && 'XMLHttpRequest' in _window) { + var xhrproto = XMLHttpRequest.prototype; + fill(xhrproto, 'open', function(origOpen) { + return function (method, url) { // preserve arity + + // if Sentry key appears in URL, don't capture + if (isString(url) && url.indexOf(self._globalKey) === -1) { + this.__raven_xhr = { + method: method, + url: url, + status_code: null + }; + } + + return origOpen.apply(this, arguments); + }; + }, wrappedBuiltIns); + + fill(xhrproto, 'send', function(origSend) { + return function (data) { // preserve arity + var xhr = this; + + function onreadystatechangeHandler() { + if (xhr.__raven_xhr && (xhr.readyState === 1 || xhr.readyState === 4)) { + try { + // touching statusCode in some platforms throws + // an exception + xhr.__raven_xhr.status_code = xhr.status; + } catch (e) { /* do nothing */ } + self.captureBreadcrumb({ + type: 'http', + category: 'xhr', + data: xhr.__raven_xhr + }); + } + } + + var props = ['onload', 'onerror', 'onprogress']; + for (var j = 0; j < props.length; j++) { + wrapProp(props[j], xhr); + } + + if ('onreadystatechange' in xhr && isFunction(xhr.onreadystatechange)) { + fill(xhr, 'onreadystatechange', function (orig) { + return self.wrap(orig, undefined, onreadystatechangeHandler); + } /* intentionally don't track this instrumentation */); + } else { + // if onreadystatechange wasn't actually set by the page on this xhr, we + // are free to set our own and capture the breadcrumb + xhr.onreadystatechange = onreadystatechangeHandler; + } + + return origSend.apply(this, arguments); + }; + }, wrappedBuiltIns); + } + + if (autoBreadcrumbs.xhr && 'fetch' in _window) { + fill(_window, 'fetch', function(origFetch) { + return function (fn, t) { // preserve arity + // Make a copy of the arguments to prevent deoptimization + // https://github.com/petkaantonov/bluebird/wiki/Optimization-killers#32-leaking-arguments + var args = new Array(arguments.length); + for(var i = 0; i < args.length; ++i) { + args[i] = arguments[i]; + } + + var method = 'GET'; + + if (args[1] && args[1].method) { + method = args[1].method; + } + + var fetchData = { + method: method, + url: args[0], + status_code: null + }; + + self.captureBreadcrumb({ + type: 'http', + category: 'fetch', + data: fetchData + }); + + return origFetch.apply(this, args).then(function (response) { + fetchData.status_code = response.status; + + return response; + }); + }; + }, wrappedBuiltIns); + } + + // Capture breadcrumbs from any click that is unhandled / bubbled up all the way + // to the document. Do this before we instrument addEventListener. + if (autoBreadcrumbs.dom && this._hasDocument) { + if (_document.addEventListener) { + _document.addEventListener('click', self._breadcrumbEventHandler('click'), false); + _document.addEventListener('keypress', self._keypressEventHandler(), false); + } + else { + // IE8 Compatibility + _document.attachEvent('onclick', self._breadcrumbEventHandler('click')); + _document.attachEvent('onkeypress', self._keypressEventHandler()); + } + } + + // record navigation (URL) changes + // NOTE: in Chrome App environment, touching history.pushState, *even inside + // a try/catch block*, will cause Chrome to output an error to console.error + // borrowed from: https://github.com/angular/angular.js/pull/13945/files + var chrome = _window.chrome; + var isChromePackagedApp = chrome && chrome.app && chrome.app.runtime; + var hasPushState = !isChromePackagedApp && _window.history && history.pushState; + if (autoBreadcrumbs.location && hasPushState) { + // TODO: remove onpopstate handler on uninstall() + var oldOnPopState = _window.onpopstate; + _window.onpopstate = function () { + var currentHref = self._location.href; + self._captureUrlChange(self._lastHref, currentHref); + + if (oldOnPopState) { + return oldOnPopState.apply(this, arguments); + } + }; + + fill(history, 'pushState', function (origPushState) { + // note history.pushState.length is 0; intentionally not declaring + // params to preserve 0 arity + return function (/* state, title, url */) { + var url = arguments.length > 2 ? arguments[2] : undefined; + + // url argument is optional + if (url) { + // coerce to string (this is what pushState does) + self._captureUrlChange(self._lastHref, url + ''); + } + + return origPushState.apply(this, arguments); + }; + }, wrappedBuiltIns); + } + + if (autoBreadcrumbs.console && 'console' in _window && console.log) { + // console + var consoleMethodCallback = function (msg, data) { + self.captureBreadcrumb({ + message: msg, + level: data.level, + category: 'console' + }); + }; + + each(['debug', 'info', 'warn', 'error', 'log'], function (_, level) { + wrapConsoleMethod(console, level, consoleMethodCallback); + }); + } + + }, + + _restoreBuiltIns: function () { + // restore any wrapped builtins + var builtin; + while (this._wrappedBuiltIns.length) { + builtin = this._wrappedBuiltIns.shift(); + + var obj = builtin[0], + name = builtin[1], + orig = builtin[2]; + + obj[name] = orig; + } + }, + + _drainPlugins: function() { + var self = this; + + // FIX ME TODO + each(this._plugins, function(_, plugin) { + var installer = plugin[0]; + var args = plugin[1]; + installer.apply(self, [self].concat(args)); + }); + }, + + _parseDSN: function(str) { + var m = dsnPattern.exec(str), + dsn = {}, + i = 7; + + try { + while (i--) dsn[dsnKeys[i]] = m[i] || ''; + } catch(e) { + throw new RavenConfigError('Invalid DSN: ' + str); + } + + if (dsn.pass && !this._globalOptions.allowSecretKey) { + throw new RavenConfigError('Do not specify your secret key in the DSN. See: http://bit.ly/raven-secret-key'); + } + + return dsn; + }, + + _getGlobalServer: function(uri) { + // assemble the endpoint from the uri pieces + var globalServer = '//' + uri.host + + (uri.port ? ':' + uri.port : ''); + + if (uri.protocol) { + globalServer = uri.protocol + ':' + globalServer; + } + return globalServer; + }, + + _handleOnErrorStackInfo: function() { + // if we are intentionally ignoring errors via onerror, bail out + if (!this._ignoreOnError) { + this._handleStackInfo.apply(this, arguments); + } + }, + + _handleStackInfo: function(stackInfo, options) { + var frames = this._prepareFrames(stackInfo, options); + + this._triggerEvent('handle', { + stackInfo: stackInfo, + options: options + }); + + this._processException( + stackInfo.name, + stackInfo.message, + stackInfo.url, + stackInfo.lineno, + frames, + options + ); + }, + + _prepareFrames: function(stackInfo, options) { + var self = this; + var frames = []; + if (stackInfo.stack && stackInfo.stack.length) { + each(stackInfo.stack, function(i, stack) { + var frame = self._normalizeFrame(stack); + if (frame) { + frames.push(frame); + } + }); + + // e.g. frames captured via captureMessage throw + if (options && options.trimHeadFrames) { + for (var j = 0; j < options.trimHeadFrames && j < frames.length; j++) { + frames[j].in_app = false; + } + } + } + frames = frames.slice(0, this._globalOptions.stackTraceLimit); + return frames; + }, + + + _normalizeFrame: function(frame) { + if (!frame.url) return; + + // normalize the frames data + var normalized = { + filename: frame.url, + lineno: frame.line, + colno: frame.column, + 'function': frame.func || '?' + }; + + normalized.in_app = !( // determine if an exception came from outside of our app + // first we check the global includePaths list. + !!this._globalOptions.includePaths.test && !this._globalOptions.includePaths.test(normalized.filename) || + // Now we check for fun, if the function name is Raven or TraceKit + /(Raven|TraceKit)\./.test(normalized['function']) || + // finally, we do a last ditch effort and check for raven.min.js + /raven\.(min\.)?js$/.test(normalized.filename) + ); + + return normalized; + }, + + _processException: function(type, message, fileurl, lineno, frames, options) { + var stacktrace; + if (!!this._globalOptions.ignoreErrors.test && this._globalOptions.ignoreErrors.test(message)) return; + + message += ''; + + if (frames && frames.length) { + fileurl = frames[0].filename || fileurl; + // Sentry expects frames oldest to newest + // and JS sends them as newest to oldest + frames.reverse(); + stacktrace = {frames: frames}; + } else if (fileurl) { + stacktrace = { + frames: [{ + filename: fileurl, + lineno: lineno, + in_app: true + }] + }; + } + + if (!!this._globalOptions.ignoreUrls.test && this._globalOptions.ignoreUrls.test(fileurl)) return; + if (!!this._globalOptions.whitelistUrls.test && !this._globalOptions.whitelistUrls.test(fileurl)) return; + + var data = objectMerge({ + // sentry.interfaces.Exception + exception: { + values: [{ + type: type, + value: message, + stacktrace: stacktrace + }] + }, + culprit: fileurl + }, options); + + // Fire away! + this._send(data); + }, + + _trimPacket: function(data) { + // For now, we only want to truncate the two different messages + // but this could/should be expanded to just trim everything + var max = this._globalOptions.maxMessageLength; + if (data.message) { + data.message = truncate(data.message, max); + } + if (data.exception) { + var exception = data.exception.values[0]; + exception.value = truncate(exception.value, max); + } + + var request = data.request; + if (request) { + if (request.url) { + request.url = truncate(request.url, this._globalOptions.maxUrlLength); + } + if (request.Referer) { + request.Referer = truncate(request.Referer, this._globalOptions.maxUrlLength); + } + } + + if (data.breadcrumbs && data.breadcrumbs.values) + this._trimBreadcrumbs(data.breadcrumbs); + + return data; + }, + + /** + * Truncate breadcrumb values (right now just URLs) + */ + _trimBreadcrumbs: function (breadcrumbs) { + // known breadcrumb properties with urls + // TODO: also consider arbitrary prop values that start with (https?)?:// + var urlprops = {to: 1, from: 1, url: 1}, + crumb, + data; + + for (var i = 0; i < breadcrumbs.values.length; i++) { + crumb = breadcrumbs.values[i]; + if (!crumb.hasOwnProperty('data')) + continue; + + data = crumb.data; + for (var prop in urlprops) { + if (data.hasOwnProperty(prop)) { + data[prop] = truncate(data[prop], this._globalOptions.maxUrlLength); + } + } + } + }, + + _getHttpData: function() { + if (!this._hasNavigator && !this._hasDocument) return; + var httpData = {}; + + if (this._hasNavigator && _navigator.userAgent) { + httpData.headers = { + 'User-Agent': navigator.userAgent + }; + } + + if (this._hasDocument) { + if (_document.location && _document.location.href) { + httpData.url = _document.location.href; + } + if (_document.referrer) { + if (!httpData.headers) httpData.headers = {}; + httpData.headers.Referer = _document.referrer; + } + } + + return httpData; + }, + + _resetBackoff: function() { + this._backoffDuration = 0; + this._backoffStart = null; + }, + + _shouldBackoff: function() { + return this._backoffDuration && now() - this._backoffStart < this._backoffDuration; + }, + + /** + * Returns true if the in-process data payload matches the signature + * of the previously-sent data + * + * NOTE: This has to be done at this level because TraceKit can generate + * data from window.onerror WITHOUT an exception object (IE8, IE9, + * other old browsers). This can take the form of an "exception" + * data object with a single frame (derived from the onerror args). + */ + _isRepeatData: function (current) { + var last = this._lastData; + + if (!last || + current.message !== last.message || // defined for captureMessage + current.culprit !== last.culprit) // defined for captureException/onerror + return false; + + // Stacktrace interface (i.e. from captureMessage) + if (current.stacktrace || last.stacktrace) { + return isSameStacktrace(current.stacktrace, last.stacktrace); + } + // Exception interface (i.e. from captureException/onerror) + else if (current.exception || last.exception) { + return isSameException(current.exception, last.exception); + } + + return true; + }, + + _setBackoffState: function(request) { + // If we are already in a backoff state, don't change anything + if (this._shouldBackoff()) { + return; + } + + var status = request.status; + + // 400 - project_id doesn't exist or some other fatal + // 401 - invalid/revoked dsn + // 429 - too many requests + if (!(status === 400 || status === 401 || status === 429)) + return; + + var retry; + try { + // If Retry-After is not in Access-Control-Expose-Headers, most + // browsers will throw an exception trying to access it + retry = request.getResponseHeader('Retry-After'); + retry = parseInt(retry, 10) * 1000; // Retry-After is returned in seconds + } catch (e) { + /* eslint no-empty:0 */ + } + + + this._backoffDuration = retry + // If Sentry server returned a Retry-After value, use it + ? retry + // Otherwise, double the last backoff duration (starts at 1 sec) + : this._backoffDuration * 2 || 1000; + + this._backoffStart = now(); + }, + + _send: function(data) { + var globalOptions = this._globalOptions; + + var baseData = { + project: this._globalProject, + logger: globalOptions.logger, + platform: 'javascript' + }, httpData = this._getHttpData(); + + if (httpData) { + baseData.request = httpData; + } + + // HACK: delete `trimHeadFrames` to prevent from appearing in outbound payload + if (data.trimHeadFrames) delete data.trimHeadFrames; + + data = objectMerge(baseData, data); + + // Merge in the tags and extra separately since objectMerge doesn't handle a deep merge + data.tags = objectMerge(objectMerge({}, this._globalContext.tags), data.tags); + data.extra = objectMerge(objectMerge({}, this._globalContext.extra), data.extra); + + // Send along our own collected metadata with extra + data.extra['session:duration'] = now() - this._startTime; + + if (this._breadcrumbs && this._breadcrumbs.length > 0) { + // intentionally make shallow copy so that additions + // to breadcrumbs aren't accidentally sent in this request + data.breadcrumbs = { + values: [].slice.call(this._breadcrumbs, 0) + }; + } + + // If there are no tags/extra, strip the key from the payload alltogther. + if (isEmptyObject(data.tags)) delete data.tags; + + if (this._globalContext.user) { + // sentry.interfaces.User + data.user = this._globalContext.user; + } + + // Include the environment if it's defined in globalOptions + if (globalOptions.environment) data.environment = globalOptions.environment; + + // Include the release if it's defined in globalOptions + if (globalOptions.release) data.release = globalOptions.release; + + // Include server_name if it's defined in globalOptions + if (globalOptions.serverName) data.server_name = globalOptions.serverName; + + if (isFunction(globalOptions.dataCallback)) { + data = globalOptions.dataCallback(data) || data; + } + + // Why?????????? + if (!data || isEmptyObject(data)) { + return; + } + + // Check if the request should be filtered or not + if (isFunction(globalOptions.shouldSendCallback) && !globalOptions.shouldSendCallback(data)) { + return; + } + + // Backoff state: Sentry server previously responded w/ an error (e.g. 429 - too many requests), + // so drop requests until "cool-off" period has elapsed. + if (this._shouldBackoff()) { + this._logDebug('warn', 'Raven dropped error due to backoff: ', data); + return; + } + + if (typeof globalOptions.sampleRate === 'number') { + if (Math.random() < globalOptions.sampleRate) { + this._sendProcessedPayload(data); + } + } else { + this._sendProcessedPayload(data); + } + }, + + _getUuid: function () { + return uuid4(); + }, + + _sendProcessedPayload: function(data, callback) { + var self = this; + var globalOptions = this._globalOptions; + + if (!this.isSetup()) return; + + // Send along an event_id if not explicitly passed. + // This event_id can be used to reference the error within Sentry itself. + // Set lastEventId after we know the error should actually be sent + this._lastEventId = data.event_id || (data.event_id = this._getUuid()); + + // Try and clean up the packet before sending by truncating long values + data = this._trimPacket(data); + + // ideally duplicate error testing should occur *before* dataCallback/shouldSendCallback, + // but this would require copying an un-truncated copy of the data packet, which can be + // arbitrarily deep (extra_data) -- could be worthwhile? will revisit + if (!this._globalOptions.allowDuplicates && this._isRepeatData(data)) { + this._logDebug('warn', 'Raven dropped repeat event: ', data); + return; + } + + // Store outbound payload after trim + this._lastData = data; + + this._logDebug('debug', 'Raven about to send:', data); + + var auth = { + sentry_version: '7', + sentry_client: 'raven-js/' + this.VERSION, + sentry_key: this._globalKey + }; + if (this._globalSecret) { + auth.sentry_secret = this._globalSecret; + } + + var exception = data.exception && data.exception.values[0]; + this.captureBreadcrumb({ + category: 'sentry', + message: exception + ? (exception.type ? exception.type + ': ' : '') + exception.value + : data.message, + event_id: data.event_id, + level: data.level || 'error' // presume error unless specified + }); + + var url = this._globalEndpoint; + (globalOptions.transport || this._makeRequest).call(this, { + url: url, + auth: auth, + data: data, + options: globalOptions, + onSuccess: function success() { + self._resetBackoff(); + + self._triggerEvent('success', { + data: data, + src: url + }); + callback && callback(); + }, + onError: function failure(error) { + self._logDebug('error', 'Raven transport failed to send: ', error); + + if (error.request) { + self._setBackoffState(error.request); + } + + self._triggerEvent('failure', { + data: data, + src: url + }); + error = error || new Error('Raven send failed (no additional details provided)'); + callback && callback(error); + } + }); + }, + + _makeRequest: function(opts) { + var request = new XMLHttpRequest(); + + // if browser doesn't support CORS (e.g. IE7), we are out of luck + var hasCORS = + 'withCredentials' in request || + typeof XDomainRequest !== 'undefined'; + + if (!hasCORS) return; + + var url = opts.url; + + if ('withCredentials' in request) { + request.onreadystatechange = function () { + if (request.readyState !== 4) { + return; + } else if (request.status === 200) { + opts.onSuccess && opts.onSuccess(); + } else if (opts.onError) { + var err = new Error('Sentry error code: ' + request.status); + err.request = request; + opts.onError(err); + } + }; + } else { + request = new XDomainRequest(); + // xdomainrequest cannot go http -> https (or vice versa), + // so always use protocol relative + url = url.replace(/^https?:/, ''); + + // onreadystatechange not supported by XDomainRequest + if (opts.onSuccess) { + request.onload = opts.onSuccess; + } + if (opts.onError) { + request.onerror = function () { + var err = new Error('Sentry error code: XDomainRequest'); + err.request = request; + opts.onError(err); + } + } + } + + // NOTE: auth is intentionally sent as part of query string (NOT as custom + // HTTP header) so as to avoid preflight CORS requests + request.open('POST', url + '?' + urlencode(opts.auth)); + request.send(stringify(opts.data)); + }, + + _logDebug: function(level) { + if (this._originalConsoleMethods[level] && this.debug) { + // In IE<10 console methods do not have their own 'apply' method + Function.prototype.apply.call( + this._originalConsoleMethods[level], + this._originalConsole, + [].slice.call(arguments, 1) + ); + } + }, + + _mergeContext: function(key, context) { + if (isUndefined(context)) { + delete this._globalContext[key]; + } else { + this._globalContext[key] = objectMerge(this._globalContext[key] || {}, context); + } + } +}; + +/*------------------------------------------------ + * utils + * + * conditionally exported for test via Raven.utils + ================================================= + */ +var objectPrototype = Object.prototype; + +function isUndefined(what) { + return what === void 0; +} + +function isFunction(what) { + return typeof what === 'function'; +} + +function isString(what) { + return objectPrototype.toString.call(what) === '[object String]'; +} + + +function isEmptyObject(what) { + for (var _ in what) return false; // eslint-disable-line guard-for-in, no-unused-vars + return true; +} + +function each(obj, callback) { + var i, j; + + if (isUndefined(obj.length)) { + for (i in obj) { + if (hasKey(obj, i)) { + callback.call(null, i, obj[i]); + } + } + } else { + j = obj.length; + if (j) { + for (i = 0; i < j; i++) { + callback.call(null, i, obj[i]); + } + } + } +} + +function objectMerge(obj1, obj2) { + if (!obj2) { + return obj1; + } + each(obj2, function(key, value){ + obj1[key] = value; + }); + return obj1; +} + +function truncate(str, max) { + return !max || str.length <= max ? str : str.substr(0, max) + '\u2026'; +} + +/** + * hasKey, a better form of hasOwnProperty + * Example: hasKey(MainHostObject, property) === true/false + * + * @param {Object} host object to check property + * @param {string} key to check + */ +function hasKey(object, key) { + return objectPrototype.hasOwnProperty.call(object, key); +} + +function joinRegExp(patterns) { + // Combine an array of regular expressions and strings into one large regexp + // Be mad. + var sources = [], + i = 0, len = patterns.length, + pattern; + + for (; i < len; i++) { + pattern = patterns[i]; + if (isString(pattern)) { + // If it's a string, we need to escape it + // Taken from: https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Regular_Expressions + sources.push(pattern.replace(/([.*+?^=!:${}()|\[\]\/\\])/g, '\\$1')); + } else if (pattern && pattern.source) { + // If it's a regexp already, we want to extract the source + sources.push(pattern.source); + } + // Intentionally skip other cases + } + return new RegExp(sources.join('|'), 'i'); +} + +function urlencode(o) { + var pairs = []; + each(o, function(key, value) { + pairs.push(encodeURIComponent(key) + '=' + encodeURIComponent(value)); + }); + return pairs.join('&'); +} + +// borrowed from https://tools.ietf.org/html/rfc3986#appendix-B +// intentionally using regex and not href parsing trick because React Native and other +// environments where DOM might not be available +function parseUrl(url) { + var match = url.match(/^(([^:\/?#]+):)?(\/\/([^\/?#]*))?([^?#]*)(\?([^#]*))?(#(.*))?$/); + if (!match) return {}; + + // coerce to undefined values to empty string so we don't get 'undefined' + var query = match[6] || ''; + var fragment = match[8] || ''; + return { + protocol: match[2], + host: match[4], + path: match[5], + relative: match[5] + query + fragment // everything minus origin + }; +} +function uuid4() { + var crypto = _window.crypto || _window.msCrypto; + + if (!isUndefined(crypto) && crypto.getRandomValues) { + // Use window.crypto API if available + var arr = new Uint16Array(8); + crypto.getRandomValues(arr); + + // set 4 in byte 7 + arr[3] = arr[3] & 0xFFF | 0x4000; + // set 2 most significant bits of byte 9 to '10' + arr[4] = arr[4] & 0x3FFF | 0x8000; + + var pad = function(num) { + var v = num.toString(16); + while (v.length < 4) { + v = '0' + v; + } + return v; + }; + + return pad(arr[0]) + pad(arr[1]) + pad(arr[2]) + pad(arr[3]) + pad(arr[4]) + + pad(arr[5]) + pad(arr[6]) + pad(arr[7]); + } else { + // http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#2117523 + return 'xxxxxxxxxxxx4xxxyxxxxxxxxxxxxxxx'.replace(/[xy]/g, function(c) { + var r = Math.random()*16|0, + v = c === 'x' ? r : r&0x3|0x8; + return v.toString(16); + }); + } +} + +/** + * Given a child DOM element, returns a query-selector statement describing that + * and its ancestors + * e.g. [HTMLElement] => body > div > input#foo.btn[name=baz] + * @param elem + * @returns {string} + */ +function htmlTreeAsString(elem) { + /* eslint no-extra-parens:0*/ + var MAX_TRAVERSE_HEIGHT = 5, + MAX_OUTPUT_LEN = 80, + out = [], + height = 0, + len = 0, + separator = ' > ', + sepLength = separator.length, + nextStr; + + while (elem && height++ < MAX_TRAVERSE_HEIGHT) { + + nextStr = htmlElementAsString(elem); + // bail out if + // - nextStr is the 'html' element + // - the length of the string that would be created exceeds MAX_OUTPUT_LEN + // (ignore this limit if we are on the first iteration) + if (nextStr === 'html' || height > 1 && len + (out.length * sepLength) + nextStr.length >= MAX_OUTPUT_LEN) { + break; + } + + out.push(nextStr); + + len += nextStr.length; + elem = elem.parentNode; + } + + return out.reverse().join(separator); +} + +/** + * Returns a simple, query-selector representation of a DOM element + * e.g. [HTMLElement] => input#foo.btn[name=baz] + * @param HTMLElement + * @returns {string} + */ +function htmlElementAsString(elem) { + var out = [], + className, + classes, + key, + attr, + i; + + if (!elem || !elem.tagName) { + return ''; + } + + out.push(elem.tagName.toLowerCase()); + if (elem.id) { + out.push('#' + elem.id); + } + + className = elem.className; + if (className && isString(className)) { + classes = className.split(/\s+/); + for (i = 0; i < classes.length; i++) { + out.push('.' + classes[i]); + } + } + var attrWhitelist = ['type', 'name', 'title', 'alt']; + for (i = 0; i < attrWhitelist.length; i++) { + key = attrWhitelist[i]; + attr = elem.getAttribute(key); + if (attr) { + out.push('[' + key + '="' + attr + '"]'); + } + } + return out.join(''); +} + +/** + * Returns true if either a OR b is truthy, but not both + */ +function isOnlyOneTruthy(a, b) { + return !!(!!a ^ !!b); +} + +/** + * Returns true if the two input exception interfaces have the same content + */ +function isSameException(ex1, ex2) { + if (isOnlyOneTruthy(ex1, ex2)) + return false; + + ex1 = ex1.values[0]; + ex2 = ex2.values[0]; + + if (ex1.type !== ex2.type || + ex1.value !== ex2.value) + return false; + + return isSameStacktrace(ex1.stacktrace, ex2.stacktrace); +} + +/** + * Returns true if the two input stack trace interfaces have the same content + */ +function isSameStacktrace(stack1, stack2) { + if (isOnlyOneTruthy(stack1, stack2)) + return false; + + var frames1 = stack1.frames; + var frames2 = stack2.frames; + + // Exit early if frame count differs + if (frames1.length !== frames2.length) + return false; + + // Iterate through every frame; bail out if anything differs + var a, b; + for (var i = 0; i < frames1.length; i++) { + a = frames1[i]; + b = frames2[i]; + if (a.filename !== b.filename || + a.lineno !== b.lineno || + a.colno !== b.colno || + a['function'] !== b['function']) + return false; + } + return true; +} + +/** + * Polyfill a method + * @param obj object e.g. `document` + * @param name method name present on object e.g. `addEventListener` + * @param replacement replacement function + * @param track {optional} record instrumentation to an array + */ +function fill(obj, name, replacement, track) { + var orig = obj[name]; + obj[name] = replacement(orig); + if (track) { + track.push([obj, name, orig]); + } +} + +if (typeof __DEV__ !== 'undefined' && __DEV__) { + Raven.utils = { + isUndefined: isUndefined, + isFunction: isFunction, + isString: isString, + isObject: isObject, + isEmptyObject: isEmptyObject, + isError: isError, + each: each, + objectMerge: objectMerge, + truncate: truncate, + hasKey: hasKey, + joinRegExp: joinRegExp, + urlencode: urlencode, + uuid4: uuid4, + htmlTreeAsString: htmlTreeAsString, + htmlElementAsString: htmlElementAsString, + parseUrl: parseUrl, + fill: fill + }; +}; + +// Deprecations +Raven.prototype.setUser = Raven.prototype.setUserContext; +Raven.prototype.setReleaseContext = Raven.prototype.setRelease; + +module.exports = Raven; + +}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) +},{"1":1,"2":2,"5":5,"6":6,"7":7}],4:[function(_dereq_,module,exports){ +(function (global){ +/** + * Enforces a single instance of the Raven client, and the + * main entry point for Raven. If you are a consumer of the + * Raven library, you SHOULD load this file (vs raven.js). + **/ + +'use strict'; + +var RavenConstructor = _dereq_(3); + +// This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785) +var _window = typeof window !== 'undefined' ? window + : typeof global !== 'undefined' ? global + : typeof self !== 'undefined' ? self + : {}; +var _Raven = _window.Raven; + +var Raven = new RavenConstructor(); + +/* + * Allow multiple versions of Raven to be installed. + * Strip Raven from the global context and returns the instance. + * + * @return {Raven} + */ +Raven.noConflict = function () { + _window.Raven = _Raven; + return Raven; +}; + +Raven.afterLoad(); + +module.exports = Raven; + +}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) +},{"3":3}],5:[function(_dereq_,module,exports){ +'use strict'; + +function isObject(what) { + return typeof what === 'object' && what !== null; +} + +// Sorta yanked from https://github.com/joyent/node/blob/aa3b4b4/lib/util.js#L560 +// with some tiny modifications +function isError(what) { + var toString = {}.toString.call(what); + return isObject(what) && + toString === '[object Error]' || + toString === '[object Exception]' || // Firefox NS_ERROR_FAILURE Exceptions + what instanceof Error; +} + +module.exports = { + isObject: isObject, + isError: isError +}; +},{}],6:[function(_dereq_,module,exports){ +(function (global){ +'use strict'; + +var utils = _dereq_(5); + +/* + TraceKit - Cross brower stack traces + + This was originally forked from github.com/occ/TraceKit, but has since been + largely re-written and is now maintained as part of raven-js. Tests for + this are in test/vendor. + + MIT license +*/ + +var TraceKit = { + collectWindowErrors: true, + debug: false +}; + +// This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785) +var _window = typeof window !== 'undefined' ? window + : typeof global !== 'undefined' ? global + : typeof self !== 'undefined' ? self + : {}; + +// global reference to slice +var _slice = [].slice; +var UNKNOWN_FUNCTION = '?'; + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Error#Error_types +var ERROR_TYPES_RE = /^(?:[Uu]ncaught (?:exception: )?)?(?:((?:Eval|Internal|Range|Reference|Syntax|Type|URI|)Error): )?(.*)$/; + +function getLocationHref() { + if (typeof document === 'undefined' || typeof document.location === 'undefined') + return ''; + + return document.location.href; +} + + +/** + * TraceKit.report: cross-browser processing of unhandled exceptions + * + * Syntax: + * TraceKit.report.subscribe(function(stackInfo) { ... }) + * TraceKit.report.unsubscribe(function(stackInfo) { ... }) + * TraceKit.report(exception) + * try { ...code... } catch(ex) { TraceKit.report(ex); } + * + * Supports: + * - Firefox: full stack trace with line numbers, plus column number + * on top frame; column number is not guaranteed + * - Opera: full stack trace with line and column numbers + * - Chrome: full stack trace with line and column numbers + * - Safari: line and column number for the top frame only; some frames + * may be missing, and column number is not guaranteed + * - IE: line and column number for the top frame only; some frames + * may be missing, and column number is not guaranteed + * + * In theory, TraceKit should work on all of the following versions: + * - IE5.5+ (only 8.0 tested) + * - Firefox 0.9+ (only 3.5+ tested) + * - Opera 7+ (only 10.50 tested; versions 9 and earlier may require + * Exceptions Have Stacktrace to be enabled in opera:config) + * - Safari 3+ (only 4+ tested) + * - Chrome 1+ (only 5+ tested) + * - Konqueror 3.5+ (untested) + * + * Requires TraceKit.computeStackTrace. + * + * Tries to catch all unhandled exceptions and report them to the + * subscribed handlers. Please note that TraceKit.report will rethrow the + * exception. This is REQUIRED in order to get a useful stack trace in IE. + * If the exception does not reach the top of the browser, you will only + * get a stack trace from the point where TraceKit.report was called. + * + * Handlers receive a stackInfo object as described in the + * TraceKit.computeStackTrace docs. + */ +TraceKit.report = (function reportModuleWrapper() { + var handlers = [], + lastArgs = null, + lastException = null, + lastExceptionStack = null; + + /** + * Add a crash handler. + * @param {Function} handler + */ + function subscribe(handler) { + installGlobalHandler(); + handlers.push(handler); + } + + /** + * Remove a crash handler. + * @param {Function} handler + */ + function unsubscribe(handler) { + for (var i = handlers.length - 1; i >= 0; --i) { + if (handlers[i] === handler) { + handlers.splice(i, 1); + } + } + } + + /** + * Remove all crash handlers. + */ + function unsubscribeAll() { + uninstallGlobalHandler(); + handlers = []; + } + + /** + * Dispatch stack information to all handlers. + * @param {Object.} stack + */ + function notifyHandlers(stack, isWindowError) { + var exception = null; + if (isWindowError && !TraceKit.collectWindowErrors) { + return; + } + for (var i in handlers) { + if (handlers.hasOwnProperty(i)) { + try { + handlers[i].apply(null, [stack].concat(_slice.call(arguments, 2))); + } catch (inner) { + exception = inner; + } + } + } + + if (exception) { + throw exception; + } + } + + var _oldOnerrorHandler, _onErrorHandlerInstalled; + + /** + * Ensures all global unhandled exceptions are recorded. + * Supported by Gecko and IE. + * @param {string} message Error message. + * @param {string} url URL of script that generated the exception. + * @param {(number|string)} lineNo The line number at which the error + * occurred. + * @param {?(number|string)} colNo The column number at which the error + * occurred. + * @param {?Error} ex The actual Error object. + */ + function traceKitWindowOnError(message, url, lineNo, colNo, ex) { + var stack = null; + + if (lastExceptionStack) { + TraceKit.computeStackTrace.augmentStackTraceWithInitialElement(lastExceptionStack, url, lineNo, message); + processLastException(); + } else if (ex && utils.isError(ex)) { + // non-string `ex` arg; attempt to extract stack trace + + // New chrome and blink send along a real error object + // Let's just report that like a normal error. + // See: https://mikewest.org/2013/08/debugging-runtime-errors-with-window-onerror + stack = TraceKit.computeStackTrace(ex); + notifyHandlers(stack, true); + } else { + var location = { + 'url': url, + 'line': lineNo, + 'column': colNo + }; + + var name = undefined; + var msg = message; // must be new var or will modify original `arguments` + var groups; + if ({}.toString.call(message) === '[object String]') { + var groups = message.match(ERROR_TYPES_RE); + if (groups) { + name = groups[1]; + msg = groups[2]; + } + } + + location.func = UNKNOWN_FUNCTION; + + stack = { + 'name': name, + 'message': msg, + 'url': getLocationHref(), + 'stack': [location] + }; + notifyHandlers(stack, true); + } + + if (_oldOnerrorHandler) { + return _oldOnerrorHandler.apply(this, arguments); + } + + return false; + } + + function installGlobalHandler () + { + if (_onErrorHandlerInstalled) { + return; + } + _oldOnerrorHandler = _window.onerror; + _window.onerror = traceKitWindowOnError; + _onErrorHandlerInstalled = true; + } + + function uninstallGlobalHandler () + { + if (!_onErrorHandlerInstalled) { + return; + } + _window.onerror = _oldOnerrorHandler; + _onErrorHandlerInstalled = false; + _oldOnerrorHandler = undefined; + } + + function processLastException() { + var _lastExceptionStack = lastExceptionStack, + _lastArgs = lastArgs; + lastArgs = null; + lastExceptionStack = null; + lastException = null; + notifyHandlers.apply(null, [_lastExceptionStack, false].concat(_lastArgs)); + } + + /** + * Reports an unhandled Error to TraceKit. + * @param {Error} ex + * @param {?boolean} rethrow If false, do not re-throw the exception. + * Only used for window.onerror to not cause an infinite loop of + * rethrowing. + */ + function report(ex, rethrow) { + var args = _slice.call(arguments, 1); + if (lastExceptionStack) { + if (lastException === ex) { + return; // already caught by an inner catch block, ignore + } else { + processLastException(); + } + } + + var stack = TraceKit.computeStackTrace(ex); + lastExceptionStack = stack; + lastException = ex; + lastArgs = args; + + // If the stack trace is incomplete, wait for 2 seconds for + // slow slow IE to see if onerror occurs or not before reporting + // this exception; otherwise, we will end up with an incomplete + // stack trace + setTimeout(function () { + if (lastException === ex) { + processLastException(); + } + }, (stack.incomplete ? 2000 : 0)); + + if (rethrow !== false) { + throw ex; // re-throw to propagate to the top level (and cause window.onerror) + } + } + + report.subscribe = subscribe; + report.unsubscribe = unsubscribe; + report.uninstall = unsubscribeAll; + return report; +}()); + +/** + * TraceKit.computeStackTrace: cross-browser stack traces in JavaScript + * + * Syntax: + * s = TraceKit.computeStackTrace(exception) // consider using TraceKit.report instead (see below) + * Returns: + * s.name - exception name + * s.message - exception message + * s.stack[i].url - JavaScript or HTML file URL + * s.stack[i].func - function name, or empty for anonymous functions (if guessing did not work) + * s.stack[i].args - arguments passed to the function, if known + * s.stack[i].line - line number, if known + * s.stack[i].column - column number, if known + * + * Supports: + * - Firefox: full stack trace with line numbers and unreliable column + * number on top frame + * - Opera 10: full stack trace with line and column numbers + * - Opera 9-: full stack trace with line numbers + * - Chrome: full stack trace with line and column numbers + * - Safari: line and column number for the topmost stacktrace element + * only + * - IE: no line numbers whatsoever + * + * Tries to guess names of anonymous functions by looking for assignments + * in the source code. In IE and Safari, we have to guess source file names + * by searching for function bodies inside all page scripts. This will not + * work for scripts that are loaded cross-domain. + * Here be dragons: some function names may be guessed incorrectly, and + * duplicate functions may be mismatched. + * + * TraceKit.computeStackTrace should only be used for tracing purposes. + * Logging of unhandled exceptions should be done with TraceKit.report, + * which builds on top of TraceKit.computeStackTrace and provides better + * IE support by utilizing the window.onerror event to retrieve information + * about the top of the stack. + * + * Note: In IE and Safari, no stack trace is recorded on the Error object, + * so computeStackTrace instead walks its *own* chain of callers. + * This means that: + * * in Safari, some methods may be missing from the stack trace; + * * in IE, the topmost function in the stack trace will always be the + * caller of computeStackTrace. + * + * This is okay for tracing (because you are likely to be calling + * computeStackTrace from the function you want to be the topmost element + * of the stack trace anyway), but not okay for logging unhandled + * exceptions (because your catch block will likely be far away from the + * inner function that actually caused the exception). + * + */ +TraceKit.computeStackTrace = (function computeStackTraceWrapper() { + /** + * Escapes special characters, except for whitespace, in a string to be + * used inside a regular expression as a string literal. + * @param {string} text The string. + * @return {string} The escaped string literal. + */ + function escapeRegExp(text) { + return text.replace(/[\-\[\]{}()*+?.,\\\^$|#]/g, '\\$&'); + } + + /** + * Escapes special characters in a string to be used inside a regular + * expression as a string literal. Also ensures that HTML entities will + * be matched the same as their literal friends. + * @param {string} body The string. + * @return {string} The escaped string. + */ + function escapeCodeAsRegExpForMatchingInsideHTML(body) { + return escapeRegExp(body).replace('<', '(?:<|<)').replace('>', '(?:>|>)').replace('&', '(?:&|&)').replace('"', '(?:"|")').replace(/\s+/g, '\\s+'); + } + + // Contents of Exception in various browsers. + // + // SAFARI: + // ex.message = Can't find variable: qq + // ex.line = 59 + // ex.sourceId = 580238192 + // ex.sourceURL = http://... + // ex.expressionBeginOffset = 96 + // ex.expressionCaretOffset = 98 + // ex.expressionEndOffset = 98 + // ex.name = ReferenceError + // + // FIREFOX: + // ex.message = qq is not defined + // ex.fileName = http://... + // ex.lineNumber = 59 + // ex.columnNumber = 69 + // ex.stack = ...stack trace... (see the example below) + // ex.name = ReferenceError + // + // CHROME: + // ex.message = qq is not defined + // ex.name = ReferenceError + // ex.type = not_defined + // ex.arguments = ['aa'] + // ex.stack = ...stack trace... + // + // INTERNET EXPLORER: + // ex.message = ... + // ex.name = ReferenceError + // + // OPERA: + // ex.message = ...message... (see the example below) + // ex.name = ReferenceError + // ex.opera#sourceloc = 11 (pretty much useless, duplicates the info in ex.message) + // ex.stacktrace = n/a; see 'opera:config#UserPrefs|Exceptions Have Stacktrace' + + /** + * Computes stack trace information from the stack property. + * Chrome and Gecko use this property. + * @param {Error} ex + * @return {?Object.} Stack trace information. + */ + function computeStackTraceFromStackProp(ex) { + if (typeof ex.stack === 'undefined' || !ex.stack) return; + + var chrome = /^\s*at (.*?) ?\(((?:file|https?|blob|chrome-extension|native|eval|webpack||\/).*?)(?::(\d+))?(?::(\d+))?\)?\s*$/i, + gecko = /^\s*(.*?)(?:\((.*?)\))?(?:^|@)((?:file|https?|blob|chrome|webpack|resource|\[native).*?)(?::(\d+))?(?::(\d+))?\s*$/i, + winjs = /^\s*at (?:((?:\[object object\])?.+) )?\(?((?:file|ms-appx|https?|webpack|blob):.*?):(\d+)(?::(\d+))?\)?\s*$/i, + + // Used to additionally parse URL/line/column from eval frames + geckoEval = /(\S+) line (\d+)(?: > eval line \d+)* > eval/i, + chromeEval = /\((\S*)(?::(\d+))(?::(\d+))\)/, + + lines = ex.stack.split('\n'), + stack = [], + submatch, + parts, + element, + reference = /^(.*) is undefined$/.exec(ex.message); + + for (var i = 0, j = lines.length; i < j; ++i) { + if ((parts = chrome.exec(lines[i]))) { + var isNative = parts[2] && parts[2].indexOf('native') === 0; // start of line + var isEval = parts[2] && parts[2].indexOf('eval') === 0; // start of line + if (isEval && (submatch = chromeEval.exec(parts[2]))) { + // throw out eval line/column and use top-most line/column number + parts[2] = submatch[1]; // url + parts[3] = submatch[2]; // line + parts[4] = submatch[3]; // column + } + element = { + 'url': !isNative ? parts[2] : null, + 'func': parts[1] || UNKNOWN_FUNCTION, + 'args': isNative ? [parts[2]] : [], + 'line': parts[3] ? +parts[3] : null, + 'column': parts[4] ? +parts[4] : null + }; + } else if ( parts = winjs.exec(lines[i]) ) { + element = { + 'url': parts[2], + 'func': parts[1] || UNKNOWN_FUNCTION, + 'args': [], + 'line': +parts[3], + 'column': parts[4] ? +parts[4] : null + }; + } else if ((parts = gecko.exec(lines[i]))) { + var isEval = parts[3] && parts[3].indexOf(' > eval') > -1; + if (isEval && (submatch = geckoEval.exec(parts[3]))) { + // throw out eval line/column and use top-most line number + parts[3] = submatch[1]; + parts[4] = submatch[2]; + parts[5] = null; // no column when eval + } else if (i === 0 && !parts[5] && typeof ex.columnNumber !== 'undefined') { + // FireFox uses this awesome columnNumber property for its top frame + // Also note, Firefox's column number is 0-based and everything else expects 1-based, + // so adding 1 + // NOTE: this hack doesn't work if top-most frame is eval + stack[0].column = ex.columnNumber + 1; + } + element = { + 'url': parts[3], + 'func': parts[1] || UNKNOWN_FUNCTION, + 'args': parts[2] ? parts[2].split(',') : [], + 'line': parts[4] ? +parts[4] : null, + 'column': parts[5] ? +parts[5] : null + }; + } else { + continue; + } + + if (!element.func && element.line) { + element.func = UNKNOWN_FUNCTION; + } + + stack.push(element); + } + + if (!stack.length) { + return null; + } + + return { + 'name': ex.name, + 'message': ex.message, + 'url': getLocationHref(), + 'stack': stack + }; + } + + /** + * Adds information about the first frame to incomplete stack traces. + * Safari and IE require this to get complete data on the first frame. + * @param {Object.} stackInfo Stack trace information from + * one of the compute* methods. + * @param {string} url The URL of the script that caused an error. + * @param {(number|string)} lineNo The line number of the script that + * caused an error. + * @param {string=} message The error generated by the browser, which + * hopefully contains the name of the object that caused the error. + * @return {boolean} Whether or not the stack information was + * augmented. + */ + function augmentStackTraceWithInitialElement(stackInfo, url, lineNo, message) { + var initial = { + 'url': url, + 'line': lineNo + }; + + if (initial.url && initial.line) { + stackInfo.incomplete = false; + + if (!initial.func) { + initial.func = UNKNOWN_FUNCTION; + } + + if (stackInfo.stack.length > 0) { + if (stackInfo.stack[0].url === initial.url) { + if (stackInfo.stack[0].line === initial.line) { + return false; // already in stack trace + } else if (!stackInfo.stack[0].line && stackInfo.stack[0].func === initial.func) { + stackInfo.stack[0].line = initial.line; + return false; + } + } + } + + stackInfo.stack.unshift(initial); + stackInfo.partial = true; + return true; + } else { + stackInfo.incomplete = true; + } + + return false; + } + + /** + * Computes stack trace information by walking the arguments.caller + * chain at the time the exception occurred. This will cause earlier + * frames to be missed but is the only way to get any stack trace in + * Safari and IE. The top frame is restored by + * {@link augmentStackTraceWithInitialElement}. + * @param {Error} ex + * @return {?Object.} Stack trace information. + */ + function computeStackTraceByWalkingCallerChain(ex, depth) { + var functionName = /function\s+([_$a-zA-Z\xA0-\uFFFF][_$a-zA-Z0-9\xA0-\uFFFF]*)?\s*\(/i, + stack = [], + funcs = {}, + recursion = false, + parts, + item, + source; + + for (var curr = computeStackTraceByWalkingCallerChain.caller; curr && !recursion; curr = curr.caller) { + if (curr === computeStackTrace || curr === TraceKit.report) { + // console.log('skipping internal function'); + continue; + } + + item = { + 'url': null, + 'func': UNKNOWN_FUNCTION, + 'line': null, + 'column': null + }; + + if (curr.name) { + item.func = curr.name; + } else if ((parts = functionName.exec(curr.toString()))) { + item.func = parts[1]; + } + + if (typeof item.func === 'undefined') { + try { + item.func = parts.input.substring(0, parts.input.indexOf('{')); + } catch (e) { } + } + + if (funcs['' + curr]) { + recursion = true; + }else{ + funcs['' + curr] = true; + } + + stack.push(item); + } + + if (depth) { + // console.log('depth is ' + depth); + // console.log('stack is ' + stack.length); + stack.splice(0, depth); + } + + var result = { + 'name': ex.name, + 'message': ex.message, + 'url': getLocationHref(), + 'stack': stack + }; + augmentStackTraceWithInitialElement(result, ex.sourceURL || ex.fileName, ex.line || ex.lineNumber, ex.message || ex.description); + return result; + } + + /** + * Computes a stack trace for an exception. + * @param {Error} ex + * @param {(string|number)=} depth + */ + function computeStackTrace(ex, depth) { + var stack = null; + depth = (depth == null ? 0 : +depth); + + try { + stack = computeStackTraceFromStackProp(ex); + if (stack) { + return stack; + } + } catch (e) { + if (TraceKit.debug) { + throw e; + } + } + + try { + stack = computeStackTraceByWalkingCallerChain(ex, depth + 1); + if (stack) { + return stack; + } + } catch (e) { + if (TraceKit.debug) { + throw e; + } + } + return { + 'name': ex.name, + 'message': ex.message, + 'url': getLocationHref() + }; + } + + computeStackTrace.augmentStackTraceWithInitialElement = augmentStackTraceWithInitialElement; + computeStackTrace.computeStackTraceFromStackProp = computeStackTraceFromStackProp; + + return computeStackTrace; +}()); + +module.exports = TraceKit; + +}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) +},{"5":5}],7:[function(_dereq_,module,exports){ +'use strict'; + +/* + json-stringify-safe + Like JSON.stringify, but doesn't throw on circular references. + + Originally forked from https://github.com/isaacs/json-stringify-safe + version 5.0.1 on 3/8/2017 and modified for IE8 compatibility. + Tests for this are in test/vendor. + + ISC license: https://github.com/isaacs/json-stringify-safe/blob/master/LICENSE +*/ + +exports = module.exports = stringify +exports.getSerialize = serializer + +function indexOf(haystack, needle) { + for (var i = 0; i < haystack.length; ++i) { + if (haystack[i] === needle) return i; + } + return -1; +} + +function stringify(obj, replacer, spaces, cycleReplacer) { + return JSON.stringify(obj, serializer(replacer, cycleReplacer), spaces) +} + +function serializer(replacer, cycleReplacer) { + var stack = [], keys = [] + + if (cycleReplacer == null) cycleReplacer = function(key, value) { + if (stack[0] === value) return '[Circular ~]' + return '[Circular ~.' + keys.slice(0, indexOf(stack, value)).join('.') + ']' + } + + return function(key, value) { + if (stack.length > 0) { + var thisPos = indexOf(stack, this); + ~thisPos ? stack.splice(thisPos + 1) : stack.push(this) + ~thisPos ? keys.splice(thisPos, Infinity, key) : keys.push(key) + if (~indexOf(stack, value)) value = cycleReplacer.call(this, key, value) + } + else stack.push(value) + + return replacer == null ? value : replacer.call(this, key, value) + } +} + +},{}]},{},[4])(4) +}); \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/shot.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/shot.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/build/shot.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/build/shot.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,727 @@ +window.shot = (function () {let exports={}; // Note: in this library we can't use any "system" dependencies because this can be used from multiple +// environments +/* globals console */ + +/** Throws an error if the condition isn't true. Any extra arguments after the condition + are used as console.error() arguments. */ +function assert(condition, ...args) { + if (condition) { + return; + } + console.error("Failed assertion", ...args); + throw new Error("Failed assertion", ...args); +} + +/** True if `url` is a valid URL */ +function isUrl(url) { + // FIXME: this is rather naive, obviously + if ((/^about:.+$/i).test(url)) { + return true; + } + if ((/^file:\/.*$/i).test(url)) { + return true; + } + if ((/^data:.*$/i).test(url)) { + return true; + } + if ((/^chrome:.*/i).test(url)) { + return true; + } + if ((/^view-source:/i).test(url)) { + return isUrl(url.substr("view-source:".length)); + } + return (/^https?:\/\/[a-z0-9\.\-]+[a-z0-9](:[0-9]+)?\/?/i).test(url); +} + +function assertUrl(url) { + if (! url) { + throw new Error("Empty value is not URL"); + } + if (! isUrl(url)) { + let exc = new Error("Not a URL"); + exc.scheme = url.split(":")[0]; + throw exc; + } +} + +function assertOrigin(url) { + assertUrl(url); + if (url.search(/^https?:/i) != -1) { + let match = (/^https?:\/\/[^/:]+\/?$/i).exec(url); + if (! match) { + throw new Error("Bad origin, might include path"); + } + } +} + +function originFromUrl(url) { + if (! url) { + return null; + } + if (url.search(/^https?:/i) == -1) { + // Non-HTTP URLs don't have an origin + return null; + } + let match = (/^https?:\/\/[^/:]+/i).exec(url); + if (match) { + return match[0]; + } + return null; +} + +/** Check if the given object has all of the required attributes, and no extra + attributes exception those in optional */ +function checkObject(obj, required, optional) { + if (typeof obj != "object" || obj === null) { + throw new Error("Cannot check non-object: " + (typeof obj) + " that is " + JSON.stringify(obj)); + } + required = required || []; + for (let attr of required) { + if (! (attr in obj)) { + return false; + } + } + optional = optional || []; + for (let attr in obj) { + if (required.indexOf(attr) == -1 && optional.indexOf(attr) == -1) { + return false; + } + } + return true; +} + +/** Create a JSON object from a normal object, given the required and optional + attributes (filtering out any other attributes). Optional attributes are + only kept when they are truthy. */ +function jsonify(obj, required, optional) { + required = required || []; + let result = {}; + for (let attr of required) { + result[attr] = obj[attr]; + } + optional = optional || []; + for (let attr of optional) { + if (obj[attr]) { + result[attr] = obj[attr]; + } + } + return result; +} + +/** Resolve url relative to base */ +function resolveUrl(base, url) { + // FIXME: totally ad hoc and probably incorrect, but we can't + // use any libraries in this file + if (url.search(/^https?:/) != -1) { + // Absolute url + return url; + } + if (url.indexOf("//") === 0) { + // Protocol-relative URL + return (/^https?:/i).exec(base)[0] + url; + } + if (url.indexOf("/") === 0) { + // Domain-relative URL + return (/^https?:\/\/[a-z0-9\.\-]+/i).exec(base)[0] + url; + } + // Otherwise, a full relative URL + while (url.indexOf("./") === 0) { + url = url.substr(2); + } + let match = (/.*\//).exec(base)[0]; + if (match.search(/^https?:\/$/i) === 0) { + // Domain without path + match = match + "/"; + } + return match + url; +} + +/** True if the two objects look alike. Null, undefined, and absent properties + are all treated as equivalent. Traverses objects and arrays */ +function deepEqual(a, b) { + if ((a === null || a === undefined) && (b === null || b === undefined)) { + return true; + } + if (typeof a != "object" || typeof b != "object") { + return a === b; + } + if (Array.isArray(a)) { + if (! Array.isArray(b)) { + return false; + } + if (a.length != b.length) { + return false; + } + for (let i=0; i new this.Image(json)); + } + this.openGraph = attrs.openGraph || null; + this.twitterCard = attrs.twitterCard || null; + this.documentSize = attrs.documentSize || null; + this.fullScreenThumbnail = attrs.fullScreenThumbnail || null; + this.abTests = attrs.abTests || null; + this._clips = {}; + if (attrs.clips) { + for (let clipId in attrs.clips) { + let clip = attrs.clips[clipId]; + this._clips[clipId] = new this.Clip(this, clipId, clip); + } + } + + for (let attr in attrs) { + if (attr !== "clips" && attr !== "id" && this.REGULAR_ATTRS.indexOf(attr) === -1 && this.DEPRECATED_ATTRS.indexOf(attr) === -1) { + throw new Error("Unexpected attribute: " + attr); + } else if (attr === "id") { + console.warn("passing id in attrs in AbstractShot constructor"); + console.trace(); + assert(attrs.id === this.id); + } + } + } + + /** Update any and all attributes in the json object, with deep updating + of `json.clips` */ + update(json) { + let ALL_ATTRS = ["clips"].concat(this.REGULAR_ATTRS); + assert(checkObject(json, [], ALL_ATTRS), "Bad attr to new Shot():", Object.keys(json)); + for (let attr in json) { + if (attr == "clips") { + continue; + } + if (typeof json[attr] == "object" && typeof this[attr] == "object" && this[attr] !== null) { + let val = this[attr]; + if (val.asJson) { + val = val.asJson(); + } + if (! deepEqual(json[attr], val)) { + this[attr] = json[attr]; + } + } else if (json[attr] !== this[attr] && + (json[attr] || this[attr])) { + this[attr] = json[attr]; + } + } + if (json.clips) { + for (let clipId in json.clips) { + if (! json.clips[clipId]) { + this.delClip(clipId); + } else if (! this.getClip(clipId)) { + this.setClip(clipId, json.clips[clipId]); + } else if (! deepEqual(this.getClip(clipId).asJson(), json.clips[clipId])) { + this.setClip(clipId, json.clips[clipId]); + } + } + } + + } + + /** Returns a JSON version of this shot */ + asJson() { + let result = {}; + for (let attr of this.REGULAR_ATTRS) { + var val = this[attr]; + if (val && val.asJson) { + val = val.asJson(); + } + result[attr] = val; + } + result.clips = {}; + for (let attr in this._clips) { + result.clips[attr] = this._clips[attr].asJson(); + } + return result; + } + + /** A more minimal JSON representation for creating indexes of shots */ + asRecallJson() { + let result = {clips: {}}; + for (let attr of this.RECALL_ATTRS) { + var val = this[attr]; + if (val && val.asJson) { + val = val.asJson(); + } + result[attr] = val; + } + for (let name of this.clipNames()) { + result.clips[name] = this.getClip(name).asJson(); + } + return result; + } + + get backend() { + return this._backend; + } + + get id() { + return this._id; + } + + get url() { + return this.fullUrl || this.origin; + } + set url(val) { + throw new Error(".url is read-only"); + } + + get fullUrl() { + return this._fullUrl; + } + set fullUrl(val) { + if (val) { + assertUrl(val); + } + this._fullUrl = val || undefined; + } + + get origin() { + return this._origin; + } + set origin(val) { + if (val) { + assertOrigin(val); + } + this._origin = val || undefined; + } + + get filename() { + let filenameTitle = this.title; + let date = new Date(this.createdDate); + filenameTitle = filenameTitle.replace(/[\/!@&*.|\n\r\t]/g, " "); + filenameTitle = filenameTitle.replace(/\s+/g, " "); + let clipFilename = `Screenshot-${date.getFullYear()}-${date.getMonth() + 1}-${date.getDate()} ${filenameTitle}`; + const clipFilenameBytesSize = clipFilename.length * 2; // JS STrings are UTF-16 + if (clipFilenameBytesSize > 251) { // 255 bytes (Usual filesystems max) - 4 for the ".png" file extension string + const excedingchars = (clipFilenameBytesSize - 246) / 2; // 251 - 5 for ellipsis "[...]" + clipFilename = clipFilename.substring(0, clipFilename.length - excedingchars); + clipFilename = clipFilename + '[...]'; + } + return clipFilename + '.png'; + } + + get urlDisplay() { + if (! this.url) { + return null; + } + if (this.url.search(/^https?/i) != -1) { + let txt = this.url; + txt = txt.replace(/^[a-z]+:\/\//i, ""); + txt = txt.replace(/\/.*/, ""); + txt = txt.replace(/^www\./i, ""); + return txt; + } else if (this.url.startsWith("data:")) { + return "data:url"; + } else { + let txt = this.url; + txt = txt.replace(/\?.*/, ""); + return txt; + } + } + + get viewUrl() { + let url = this.backend + "/" + this.id; + return url; + } + + get creatingUrl() { + let url = `${this.backend}/creating/${this.id}`; + url += `?title=${encodeURIComponent(this.title || "")}`; + url += `&url=${encodeURIComponent(this.url)}`; + return url; + } + + get jsonUrl() { + return this.backend + "/data/" + this.id; + } + + get oembedUrl() { + return this.backend + "/oembed?url=" + encodeURIComponent(this.viewUrl); + } + + get docTitle() { + return this._title; + } + set docTitle(val) { + assert(val === null || typeof val == "string", "Bad docTitle:", val); + this._title = val; + } + + get openGraph() { + return this._openGraph || null; + } + set openGraph(val) { + assert(val === null || typeof val == "object", "Bad openGraph:", val); + if (val) { + assert(checkObject(val, [], this._OPENGRAPH_PROPERTIES), "Bad attr to openGraph:", Object.keys(val)); + this._openGraph = val; + } else { + this._openGraph = null; + } + } + + get twitterCard() { + return this._twitterCard || null; + } + set twitterCard(val) { + assert(val === null || typeof val == "object", "Bad twitterCard:", val); + if (val) { + assert(checkObject(val, [], this._TWITTERCARD_PROPERTIES), "Bad attr to twitterCard:", Object.keys(val)); + this._twitterCard = val; + } else { + this._twitterCard = null; + } + } + + get userTitle() { + return this._userTitle; + } + set userTitle(val) { + assert(val === null || typeof val == "string", "Bad userTitle:", val); + this._userTitle = val; + } + + get title() { + // FIXME: we shouldn't support both openGraph.title and ogTitle + let ogTitle = this.openGraph && this.openGraph.title; + let twitterTitle = this.twitterCard && this.twitterCard.title; + let title = this.userTitle || ogTitle || twitterTitle || this.docTitle || this.url; + if (Array.isArray(title)) { + title = title[0]; + } + return title; + } + + get createdDate() { + return this._createdDate; + } + set createdDate(val) { + assert(val === null || typeof val == "number", "Bad createdDate:", val); + this._createdDate = val; + } + + get favicon() { + return this._favicon; + } + set favicon(val) { + assert(val === null || isUrl(val), "Bad favicon URL:", val); + if (val) { + val = resolveUrl(this.url, val); + } + this._favicon = val; + } + + clipNames() { + let names = Object.getOwnPropertyNames(this._clips); + names.sort(function (a, b) { + return a.sortOrder < b.sortOrder ? 1 : 0; + }); + return names; + } + getClip(name) { + return this._clips[name]; + } + addClip(val) { + let name = makeRandomId(); + this.setClip(name, val); + return name; + } + setClip(name, val) { + let clip = new this.Clip(this, name, val); + this._clips[name] = clip; + } + delClip(name) { + if (! this._clips[name]) { + throw new Error("No existing clip with id: " + name); + } + delete this._clips[name]; + } + biggestClipSortOrder() { + let biggest = 0; + for (let clipId in this._clips) { + biggest = Math.max(biggest, this._clips[clipId].sortOrder); + } + return biggest; + } + updateClipUrl(clipId, clipUrl) { + let clip = this.getClip(clipId); + if ( clip && clip.image ) { + clip.image.url = clipUrl; + } else { + console.warn("Tried to update the url of a clip with no image:", clip); + } + } + + get siteName() { + return this._siteName || null; + } + set siteName(val) { + assert(typeof val == "string" || ! val); + this._siteName = val; + } + + get documentSize() { + return this._documentSize; + } + set documentSize(val) { + assert(typeof val == "object" || ! val); + if (val) { + assert(checkObject(val, ["height", "width"], "Bad attr to documentSize:", Object.keys(val))); + assert(typeof val.height == "number"); + assert(typeof val.width == "number"); + this._documentSize = val; + } else { + this._documentSize = null; + } + } + + get fullScreenThumbnail() { + return this._fullScreenThumbnail; + } + set fullScreenThumbnail(val) { + assert(typeof val == "string" || ! val); + if (val) { + assert(isUrl(val)); + this._fullScreenThumbnail = val; + } else { + this._fullScreenThumbnail = null; + } + } + + get abTests() { + return this._abTests; + } + set abTests(val) { + if (val === null || val === undefined) { + this._abTests = null; + return; + } + assert(typeof val == "object", "abTests should be an object, not:", typeof val); + assert(! Array.isArray(val), "abTests should not be an Array"); + for (let name in val) { + assert(val[name] && typeof val[name] == "string", `abTests.${name} should be a string:`, typeof val[name]); + } + this._abTests = val; + } + +} + +AbstractShot.prototype.REGULAR_ATTRS = (` +origin fullUrl docTitle userTitle createdDate favicon images +siteName openGraph twitterCard documentSize +fullScreenThumbnail abTests +`).split(/\s+/g); + +// Attributes that will be accepted in the constructor, but ignored/dropped +AbstractShot.prototype.DEPRECATED_ATTRS = (` +microdata history ogTitle createdDevice head body htmlAttrs bodyAttrs headAttrs +readable hashtags comments showPage isPublic resources deviceId url +`).split(/\s+/g); + +AbstractShot.prototype.RECALL_ATTRS = (` +url docTitle userTitle createdDate favicon +openGraph twitterCard images fullScreenThumbnail +`).split(/\s+/g); + +AbstractShot.prototype._OPENGRAPH_PROPERTIES = (` +title type url image audio description determiner locale site_name video +image:secure_url image:type image:width image:height +video:secure_url video:type video:width image:height +audio:secure_url audio:type +article:published_time article:modified_time article:expiration_time article:author article:section article:tag +book:author book:isbn book:release_date book:tag +profile:first_name profile:last_name profile:username profile:gender +`).split(/\s+/g); + +AbstractShot.prototype._TWITTERCARD_PROPERTIES = (` +card site title description image +player player:width player:height player:stream player:stream:content_type +`).split(/\s+/g); + +/** Represents one found image in the document (not a clip) */ +class _Image { + // FIXME: either we have to notify the shot of updates, or make + // this read-only + constructor(json) { + assert(typeof json === "object", "Clip Image given a non-object", json); + assert(checkObject(json, ["url"], ["dimensions", "title", "alt"]), "Bad attrs for Image:", Object.keys(json)); + assert(isUrl(json.url), "Bad Image url:", json.url); + this.url = json.url; + assert((! json.dimensions) || + (typeof json.dimensions.x == "number" && typeof json.dimensions.y == "number"), + "Bad Image dimensions:", json.dimensions); + this.dimensions = json.dimensions; + assert(typeof json.title == "string" || ! json.title, "Bad Image title:", json.title); + this.title = json.title; + assert(typeof json.alt == "string" || ! json.alt, "Bad Image alt:", json.alt); + this.alt = json.alt; + } + + asJson() { + return jsonify(this, ["url"], ["dimensions"]); + } +} + +AbstractShot.prototype.Image = _Image; + +/** Represents a clip, either a text or image clip */ +class _Clip { + constructor(shot, id, json) { + this._shot = shot; + assert(checkObject(json, ["createdDate", "image"], ["sortOrder"]), "Bad attrs for Clip:", Object.keys(json)); + assert(typeof id == "string" && id, "Bad Clip id:", id); + this._id = id; + this.createdDate = json.createdDate; + if ('sortOrder' in json) { + assert(typeof json.sortOrder == "number" || ! json.sortOrder, "Bad Clip sortOrder:", json.sortOrder); + } + if ('sortOrder' in json) { + this.sortOrder = json.sortOrder; + } else { + let biggestOrder = shot.biggestClipSortOrder(); + this.sortOrder = biggestOrder + 100; + } + this.image = json.image; + } + + toString() { + return `[Shot Clip id=${this.id} sortOrder=${this.sortOrder} image ${this.image.dimensions.x}x${this.image.dimensions.y}]`; + } + + asJson() { + return jsonify(this, ["createdDate"], ["sortOrder", "image"]); + } + + get id() { + return this._id; + } + + get createdDate() { + return this._createdDate; + } + set createdDate(val) { + assert(typeof val == "number" || ! val, "Bad Clip createdDate:", val); + this._createdDate = val; + } + + get image() { + return this._image; + } + set image(image) { + if (! image) { + this._image = undefined; + return; + } + assert(checkObject(image, ["url"], ["dimensions", "text", "location", "captureType"]), "Bad attrs for Clip Image:", Object.keys(image)); + assert(isUrl(image.url), "Bad Clip image URL:", image.url); + assert(image.captureType == "madeSelection" || image.captureType == "selection" || image.captureType == "visible" || image.captureType == "auto" || image.captureType == "fullPage" || ! image.captureType, "Bad image.captureType:", image.captureType); + assert(typeof image.text == "string" || ! image.text, "Bad Clip image text:", image.text); + if (image.dimensions) { + assert(typeof image.dimensions.x == "number" && typeof image.dimensions.y == "number", "Bad Clip image dimensions:", image.dimensions); + } + assert(image.location && + typeof image.location.left == "number" && + typeof image.location.right == "number" && + typeof image.location.top == "number" && + typeof image.location.bottom == "number", "Bad Clip image pixel location:", image.location); + if (image.location.topLeftElement || image.location.topLeftOffset || + image.location.bottomRightElement || image.location.bottomRightOffset) { + assert(typeof image.location.topLeftElement == "string" && + image.location.topLeftOffset && + typeof image.location.topLeftOffset.x == "number" && + typeof image.location.topLeftOffset.y == "number" && + typeof image.location.bottomRightElement == "string" && + image.location.bottomRightOffset && + typeof image.location.bottomRightOffset.x == "number" && + typeof image.location.bottomRightOffset.y == "number", + "Bad Clip image element location:", image.location); + } + this._image = image; + } + + isDataUrl() { + if (this.image) { + return this.image.url.startsWith("data:"); + } + } + + get sortOrder() { + return this._sortOrder || null; + } + set sortOrder(val) { + assert(typeof val == "number" || ! val, "Bad Clip sortOrder:", val); + this._sortOrder = val; + } + +} + +AbstractShot.prototype.Clip = _Clip; + +if (typeof exports != "undefined") { + exports.AbstractShot = AbstractShot; + exports.originFromUrl = originFromUrl; +} + +return exports; +})(); +null; + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/buildSettings.js.template firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/buildSettings.js.template --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/buildSettings.js.template 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/buildSettings.js.template 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,5 @@ +window.buildSettings = { + defaultSentryDsn: process.env.SCREENSHOTS_SENTRY, + logLevel: process.env.SCREENSHOTS_LOG_LEVEL || "warn" +}; +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/catcher.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/catcher.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/catcher.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/catcher.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,83 @@ +/* globals log */ + +"use strict"; + +var global = this; + +this.catcher = (function () { + let exports = {}; + + let handler; + + let queue = []; + + exports.unhandled = function (error, info) { + log.error("Unhandled error:", error, info); + let e = makeError(error, info); + if (! handler) { + queue.push(e); + } else { + handler(e); + } + }; + + /** Turn an exception into an error object */ + function makeError(exc, info) { + let result; + if (exc.fromMakeError) { + result = exc; + } else { + result = { + fromMakeError: true, + name: exc.name || "ERROR", + message: String(exc), + stack: exc.stack + }; + for (let attr in exc) { + result[attr] = exc[attr]; + } + } + if (info) { + for (let attr of Object.keys(info)) { + result[attr] = info[attr]; + } + } + return result; + } + + /** Wrap the function, and if it raises any exceptions then call unhandled() */ + exports.watchFunction = function watchFunction(func) { + return function () { + try { + return func.apply(this, arguments); + } catch (e) { + exports.unhandled(e); + throw e; + } + }; + }; + + exports.watchPromise = function watchPromise(promise) { + return promise.catch((e) => { + log.error("------Error in promise:", e); + log.error(e.stack); + exports.unhandled(makeError(e)); + throw e; + }); + }; + + exports.registerHandler = function (h) { + if (handler) { + log.error("registerHandler called after handler was already registered"); + return; + } + handler = h; + for (let error of queue) { + handler(error); + } + queue = []; + }; + + return exports; +})(); +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/clipboard.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/clipboard.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/clipboard.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/clipboard.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,23 @@ +/* globals catcher */ + +"use strict"; + +this.clipboard = (function () { + let exports = {}; + + exports.copy = function (text) { + let el = document.createElement("textarea"); + document.body.appendChild(el); + el.value = text; + el.select(); + const copied = document.execCommand("copy"); + document.body.removeChild(el); + if (!copied) { + catcher.unhandled(new Error("Clipboard copy failed")); + } + return copied; + }; + + return exports; +})(); +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/domainFromUrl.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/domainFromUrl.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/domainFromUrl.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/domainFromUrl.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,29 @@ +/** Returns the domain of a URL, but safely and in ASCII; URLs without domains + (such as about:blank) return the scheme, Unicode domains get stripped down + to ASCII */ + +"use strict"; + +this.domainFromUrl = (function () { + + return function urlDomainForId(location) { // eslint-disable-line no-unused-vars + let domain = location.hostname; + if (!domain) { + domain = location.origin.split(":")[0]; + if (! domain) { + domain = "unknown"; + } + } + if (domain.search(/^[a-z0-9.\-]+$/i) === -1) { + // Probably a unicode domain; we could use punycode but it wouldn't decode + // well in the URL anyway. Instead we'll punt. + domain = domain.replace(/[^a-z0-9.\-]/ig, ""); + if (! domain) { + domain = "site"; + } + } + return domain; + }; + +})(); +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/back.svg firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/back.svg --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/back.svg 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/back.svg 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,10 @@ + + + + + + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/cancel.svg firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/cancel.svg --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/cancel.svg 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/cancel.svg 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,11 @@ + + + + + + Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/copy.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/copy.png differ diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/done.svg firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/done.svg --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/done.svg 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/done.svg 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,10 @@ + + + + + + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/download.svg firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/download.svg --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/download.svg 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/download.svg 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,11 @@ + + + + + + Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-128.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-128.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-16.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-16.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-19.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-19.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-256.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-256.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-32.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-32.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-38.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-38.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-48.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-48.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-64.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-64.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-highlight-19.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-highlight-19.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-highlight-38.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-highlight-38.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-starred-19.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-starred-19.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/icon-starred-38.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/icon-starred-38.png differ diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/menu-fullpage.svg firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/menu-fullpage.svg --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/menu-fullpage.svg 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/menu-fullpage.svg 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,24 @@ + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/menu-myshot.svg firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/menu-myshot.svg --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/menu-myshot.svg 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/menu-myshot.svg 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,17 @@ + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/menu-visible.svg firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/menu-visible.svg --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/menu-visible.svg 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/menu-visible.svg 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,19 @@ + + + + + + + + Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/onboarding-1.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/onboarding-1.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/onboarding-2.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/onboarding-2.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/onboarding-3.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/onboarding-3.png differ Binary files /tmp/tmpgF2HuS/UaHVXPdKH8/firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/icons/onboarding-4.png and /tmp/tmpgF2HuS/_GGVZf51St/firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/icons/onboarding-4.png differ diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ach/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ach/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ach/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ach/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Mak vidio ma ki ngolo macego cego ki cal me wang kio ki i Kakube ka igwok gi pi tutunu onyo matwal." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Mak cal me wang kio" + }, + "myShotsLink": { + "message": "Cal Na" + }, + "screenshotInstructions": { + "message": "Ywar onyo dii ii potbuk me yero bute. Dii ESC me juko." + }, + "saveScreenshotSelectedArea": { + "message": "Gwoki" + }, + "saveScreenshotVisibleArea": { + "message": "Gwok ma nen" + }, + "saveScreenshotFullPage": { + "message": "Gwok potbuk weng" + }, + "cancelScreenshot": { + "message": "Juki" + }, + "downloadScreenshot": { + "message": "Gam" + }, + "notificationLinkCopiedTitle": { + "message": "Ki loko kakube" + }, + "notificationLinkCopiedDetails": { + "message": "Ki loko kakube me cal mamegi i bao me coc. Dii $META_KEY$-V me mwono ne.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Pe tye katic." + }, + "requestErrorDetails": { + "message": "Timwa kica! Pe onongo wa twero gwoko cal mamegi. Tim ber item doki lacen." + }, + "connectionErrorTitle": { + "message": "Pe watwero kube ki cal me wang kio mamegi." + }, + "connectionErrorDetails": { + "message": "Tim ber i rot kakube ni me intanet. Kace itwero kube i intanet, peko mo pi tutuno romo bedo tye i tic me Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Pe onongo wa twero gwoko cal mamegi pien peko mo tye i tic me Firefox Screenshots. Tim ber item doki lacen." + }, + "unshootablePageErrorTitle": { + "message": "Pe watwero mako cal me wang kio me potbuk man." + }, + "unshootablePageErrorDetails": { + "message": "Man pe obedo Kakube me rwom, pi meno pe watwero mako cal me wang kio ne." + }, + "selfScreenshotErrorTitle": { + "message": "Pe itwero mako cal me potbuk pa Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Woo! Firefox Screenshots opo oo." + }, + "genericErrorDetails": { + "message": "Pe wa ngeyo ngo ma otime kombedi. Iromo temo ne doki onyo mako cal pa potbuk mukene?" + }, + "tourBodyOne": { + "message": "Maki, gwoki, ki nywak cal me wang kio labongo weko Firefox." + }, + "tourHeaderTwo": { + "message": "Mak ngo ma imito keken" + }, + "tourBodyTwo": { + "message": "Dii ka i ywar me mako cal pa but potbuk keken. Itwero bene wot iwiye me wero yer mamegi." + }, + "tourHeaderThree": { + "message": "Kit ma imito" + }, + "tourBodyThree": { + "message": "Gwok cal mamegi ma ki ngolo ii Kakube pi nywako i yoo ma yot, onyo gamo gi i kompiuta ni. Itwero bene diyo mapeca me Cal Na me nongo cal ma i mako weng." + }, + "tourHeaderFour": { + "message": "Mak dirica onyo Potbuk weng" + }, + "tourBodyFour": { + "message": "Yer mapeca ma i tung lacuc malo me mako kabedo ma nen i dirica onyo me mako potbuk weng." + }, + "tourSkip": { + "message": "Kal" + }, + "tourNext": { + "message": "Cal malubo" + }, + "tourPrevious": { + "message": "Cal mukato" + }, + "tourDone": { + "message": "Otum" + }, + "termsAndPrivacyNotice": { + "message": "Tic ki Firefox Screenshots nyuto ni, i yee $TERMSANDPRIVACYNOTICETERMSLINK$ ki $TERMSANDPRIVACYNOTICEPRIVACYLINK$ me Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Cik" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Ngec me mung" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/be/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/be/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/be/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/be/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Рабіце кліпы і здымкі экрана ў Сеціве і захоўвайце іх часова або назаўжды." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Зрабіць здымак экрана" + }, + "myShotsLink": { + "message": "Мае здымкі" + }, + "screenshotInstructions": { + "message": "Пацягніце або пстрыкніце на старонцы для выбару вобласці. Для адмены націсніце ESC." + }, + "saveScreenshotSelectedArea": { + "message": "Захаваць" + }, + "saveScreenshotVisibleArea": { + "message": "Захаваць бачную вобласць" + }, + "saveScreenshotFullPage": { + "message": "Захаваць усю старонку" + }, + "cancelScreenshot": { + "message": "Скасаваць" + }, + "downloadScreenshot": { + "message": "Сцягнуць" + }, + "notificationLinkCopiedTitle": { + "message": "Спасылка скапіявана" + }, + "notificationLinkCopiedDetails": { + "message": "Спасылка на ваш здымак была скапіявана ў буфер абмену. Націсніце $META_KEY$-V для ўстаўкі.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Адбылася памылка." + }, + "requestErrorDetails": { + "message": "Выбачайце! Нам не ўдалося захаваць ваш здымак. Паспрабуйце пазней." + }, + "connectionErrorTitle": { + "message": "Мы не можам атрымаць доступ да вашых скрыншотаў." + }, + "connectionErrorDetails": { + "message": "Калі ласка, праверце ваша злучэнне з Інтэрнэтам. Калі ў вас усё ў парадку з падлучэннем да Інтэрнэту, магчыма, паўсталі часовыя праблемы са службай Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Нам не ўдалося захаваць ваш здымак, таму што ўзніклі праблемы са службай Firefox Screenshots. Паспрабуйце пазней." + }, + "unshootablePageErrorTitle": { + "message": "Мы не можам зрабіць скрыншот гэтай старонкі." + }, + "unshootablePageErrorDetails": { + "message": "Гэта не стандартная вэб-старонка, таму вы не можаце зрабіць яе скрыншот." + }, + "selfScreenshotErrorTitle": { + "message": "Вы не можаце зрабіць здымак старонкі Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Вой! З Firefox Screenshots нешта не так." + }, + "genericErrorDetails": { + "message": "Мы не ўпэўненыя, у чым праблема. Паспрабаваць яшчэ раз, ці зрабіць здымак іншай старонкі?" + }, + "tourBodyOne": { + "message": "Рабіце здымкі экрана, захоўвайце і дзяліцеся імі не выходзячы з Firefox." + }, + "tourHeaderTwo": { + "message": "Рабіце скрыншоты чаго заўгодна" + }, + "tourBodyTwo": { + "message": "Пстрыкніце і пацягніце мышшу для захопу часткі старонкі. Вы таксама можаце навесці курсор мышы для падсвятлення абранай вобласці." + }, + "tourHeaderThree": { + "message": "Як вам падабаецца" + }, + "tourBodyThree": { + "message": "Захоўваеце свае здымкі ў Інтэрнэце, каб лёгка імі дзяліцца, або загружайце іх на свой кампутар. Вы таксама можаце прагледзець усе захаваныя здымкі, націснуўшы на кнопку Мае здымкі." + }, + "tourHeaderFour": { + "message": "Рабіце захоп вокнаў або цэлых старонак" + }, + "tourBodyFour": { + "message": "З дапамогай кнопак у верхнім правым куце выбірайце захоп бачнай вобласці акна або старонкі цалкам." + }, + "tourSkip": { + "message": "Прапусьціць" + }, + "tourNext": { + "message": "Наступны слайд" + }, + "tourPrevious": { + "message": "Папярэдні слайд" + }, + "tourDone": { + "message": "Гатова" + }, + "termsAndPrivacyNotice": { + "message": "Выкарыстоўваючы Firefox Screenshots, вы згаджаецеся з яго $TERMSANDPRIVACYNOTICETERMSLINK$ і $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Умовамі выкарыстання" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Паведамленнем аб прыватнасці" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/bg/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/bg/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/bg/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/bg/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Прави клипове и снимки на уебстраница и ги запазва временно или за постоянно." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Снимка на екрана" + }, + "myShotsLink": { + "message": "Моите снимки" + }, + "screenshotInstructions": { + "message": "За да изберете участък влачете или щракнете с мишката в страницата. Натиснете ESC за отказ." + }, + "saveScreenshotSelectedArea": { + "message": "Запазване" + }, + "saveScreenshotVisibleArea": { + "message": "Запазване на видимата област" + }, + "saveScreenshotFullPage": { + "message": "Запазване на цялата страница" + }, + "cancelScreenshot": { + "message": "Отказ" + }, + "downloadScreenshot": { + "message": "Изтегляне" + }, + "notificationLinkCopiedTitle": { + "message": "Препратката е копирана" + }, + "notificationLinkCopiedDetails": { + "message": "Препратка към снимката е копирана в системния буфер. За да я поставите натиснете $META_KEY$-V.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Повреда." + }, + "requestErrorDetails": { + "message": "Съжаляваме! Снимката не е запазена. Опитайте по-късно." + }, + "connectionErrorTitle": { + "message": "Няма връзка с вашите снимки." + }, + "connectionErrorDetails": { + "message": "Моля, проверете своята връзка към интернет. Ако имате връзка с Мрежата, в такъв случай може да има временен проблем с услугата на Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Снимката не може да бъде запазена, защото има проблем с услугата на Firefox Screenshots. Опитайте по-късно." + }, + "unshootablePageErrorTitle": { + "message": "Снимка на тази страница не може да бъде направена." + }, + "unshootablePageErrorDetails": { + "message": "Това не е обикновена уебстраница и за това снимка не може да ѝ бъде направена." + }, + "selfScreenshotErrorTitle": { + "message": "Не може да правите снимки на страницата на Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Леле! Нещо се обърка с Firefox Screenshots." + }, + "genericErrorDetails": { + "message": "Не сме сигурни какво точно се случи. Може да опитате отново, както и да снимате друга страница." + }, + "tourBodyOne": { + "message": "Правете, запазвайте и споделяйте снимки на екрана без да напускате Firefox." + }, + "tourHeaderTwo": { + "message": "Уловете само нужното" + }, + "tourBodyTwo": { + "message": "Щракнете с мишката или влачете, за да уловите части от страницата. Посочвайки елементите на страницата те се осветяват." + }, + "tourHeaderThree": { + "message": "Както ви харесва" + }, + "tourBodyThree": { + "message": "Запазете снимките на страници от Мрежата за по-лесно споделяне или ги изтеглете на компютъра си. А бутонът „Моите снимки“ ще ви покаже всички направени от вас снимки." + }, + "tourHeaderFour": { + "message": "Улавяйте прозорци и цели страници" + }, + "tourBodyFour": { + "message": "Използвайте бутоните в горния десен ъгъл, за да уловите само видимата част или цялата страница." + }, + "tourSkip": { + "message": "Прескачане" + }, + "tourNext": { + "message": "Напред" + }, + "tourPrevious": { + "message": "Назад" + }, + "tourDone": { + "message": "Готово" + }, + "termsAndPrivacyNotice": { + "message": "Използвайки Firefox Screenshots вие се съгласявате с тези $TERMSANDPRIVACYNOTICETERMSLINK$ и $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Условия" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Политика на поверителност" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/bn_BD/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/bn_BD/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/bn_BD/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/bn_BD/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "ওয়েব থেকে ক্লিপ এবং স্ক্রিনশট নিন এবং সেগুলো সাময়িকভাবে বা স্থায়ীভাবে সংরক্ষণ করুন।" + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "একটি স্ক্রীনশট নিন" + }, + "myShotsLink": { + "message": "আমার সটসমূহ" + }, + "screenshotInstructions": { + "message": "ড্রাগ করে অথবা পেজে ক্লিক করে একটি অংশ নির্বাচন করুন। বাতিল করতে ESC টিপুন।" + }, + "saveScreenshotSelectedArea": { + "message": "সংরক্ষণ" + }, + "saveScreenshotVisibleArea": { + "message": "যতটুকু দেখা যাচ্ছে সংরক্ষণ করুন" + }, + "saveScreenshotFullPage": { + "message": "সম্পূর্ণ পেজ সংরক্ষণ করুন" + }, + "cancelScreenshot": { + "message": "বাতিল" + }, + "downloadScreenshot": { + "message": "ডাউনলোড" + }, + "notificationLinkCopiedTitle": { + "message": "লিঙ্ক কপি করা হয়েছে" + }, + "notificationLinkCopiedDetails": { + "message": "আপার সট এর লিংক ক্লিপবোর্ডে কপি করা হয়েছে। পেস্ট করতে $META_KEY$-V চাপুন।", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "বিকল।" + }, + "requestErrorDetails": { + "message": "দুঃখিত! আমরা আপনার সট সংরক্ষণ করতে পারিনি। অনুগ্রহ পুনরায় চেষ্টা করুন।" + }, + "connectionErrorTitle": { + "message": "আমরা আপনার স্ক্রিটসটসমূহ সংযোগ করতে পারছি না।" + }, + "connectionErrorDetails": { + "message": "অনুগ্রহ করে আপনার ইন্টারনেট সংযোগ পরীক্ষা করুন। আর যদি আপনার ইন্টারনেট সংযোগ ঠিক থাকে, তাহলে Firefox স্ক্রিনশট সেবাটিতে সাময়িক সমস্যা দেখা দিয়েছে।" + }, + "loginErrorDetails": { + "message": "আমরা আপনার শট সংরক্ষণ করতে পারিনি কারণ সেখানে Firefox স্ক্রিণশট সেবার সমস্যা আছে। অনুগ্রহ করে আবার চেস্টা করুন।" + }, + "unshootablePageErrorTitle": { + "message": "আমার এই পেজের স্ক্রিনশট নিতে পারব না।" + }, + "unshootablePageErrorDetails": { + "message": "এটা কোন আদর্শ ওয়েব পেজ না, তাই আপনি এটার স্ক্রিনশট তুলতে পারবেন না।" + }, + "selfScreenshotErrorTitle": { + "message": "আপনি Firefox স্ক্রিনশটের পেজের শট নিতে পারেন না!" + }, + "genericErrorTitle": { + "message": "আয় হায়! Firefox স্ক্রিনশট পাগল হয়ে গেছে।" + }, + "genericErrorDetails": { + "message": "এই মাত্র কি ঘটেছে আমরা নিশ্চিত নই। আপনি কি অনুগ্রহ করে পুরনায় সট নেবেন কিংবা ভিন্ন একটি পেজে চেষ্টা করবেন?" + }, + "tourBodyOne": { + "message": "Firefox ত্যাগ করা ছাড়াই স্ক্রিনশট তোল, সংরক্ষণ কর এবং শেয়ার কর।" + }, + "tourHeaderTwo": { + "message": "ক্যাপচার করুন আপনি যা চান" + }, + "tourBodyTwo": { + "message": "একটি পেজের কিয়দংশ ক্যাপচার করতে ক্লিক করে ড্রাগ করুন। অতঃপর আপনি মাউজ হোভার করে আপনার নির্বাচিত অংশ হাইলাইট করতে পারবেন।" + }, + "tourHeaderThree": { + "message": "আপনি যেমন পছন্দ করেন" + }, + "tourBodyThree": { + "message": "আপনার ক্রপ করা সটসমূহ ওয়েবে রাখুন সহজে শেয়ার করার সুবিধার্থে, অথবা আপনার কম্পিউটারে ডাউনলোড করুন। আপনার সকল সটসমূহ খুঁজে পেতে আমার সটসমূহ বাটনে ক্লিক করুন।" + }, + "tourHeaderFour": { + "message": "উইন্ডো ক্যাপচার করুন অথবা পুরো পেজ" + }, + "tourBodyFour": { + "message": "ইউন্ডোতে দৃশ্যমান অংশ অথবা সম্পূর্ণ পেজ ক্যাপচার করতে উপরে ডানদিকের বাটনগুলো থেকে নির্বাচন করুন।" + }, + "tourSkip": { + "message": "এড়িয়ে যান" + }, + "tourNext": { + "message": "পরবর্তী স্লাইড" + }, + "tourPrevious": { + "message": "পূর্ববর্তী স্লাইড" + }, + "tourDone": { + "message": "সম্পন্ন" + }, + "termsAndPrivacyNotice": { + "message": "Firefox Screenshots ব্যবহারের জন্য, আপনি স্ক্রিনশটের $TERMSANDPRIVACYNOTICETERMSLINK$ এবং $TERMSANDPRIVACYNOTICEPRIVACYLINK$ নীতিতে আগ্রহী।", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "শর্তাবলী" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "গোপনীয়তা নীতি" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/cs/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/cs/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/cs/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/cs/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Pořizujte snímky webových stránek a ukládejte je dočasně nebo natrvalo." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Pořídit snímek obrazovky" + }, + "myShotsLink": { + "message": "Mé snímky" + }, + "screenshotInstructions": { + "message": "Stiskněte tlačítko myši a tahem označte oblast snímku. Pro zrušení výběru stiskněte klávesu ESC." + }, + "saveScreenshotSelectedArea": { + "message": "Uložit" + }, + "saveScreenshotVisibleArea": { + "message": "Uložit viditelnou oblast" + }, + "saveScreenshotFullPage": { + "message": "Uložit celou stránku" + }, + "cancelScreenshot": { + "message": "Zrušit" + }, + "downloadScreenshot": { + "message": "Stáhnout" + }, + "notificationLinkCopiedTitle": { + "message": "Odkaz zkopírován" + }, + "notificationLinkCopiedDetails": { + "message": "Odkaz na váš snímek byl zkopírován do schránky. Pro vložení stiskněte $META_KEY$-V.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Mimo provoz." + }, + "requestErrorDetails": { + "message": "Je nám líto, ale nemohli jsme vás snímek uložit. Zkuste to prosím znovu později." + }, + "connectionErrorTitle": { + "message": "Nedaří se nám připojit k vašim snímkům." + }, + "connectionErrorDetails": { + "message": "Zkontrolujte prosím připojení k internetu. Pokud vám připojení funguje, mohlo dojít k dočasnému problému s naší službou Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Nemohli jsme uložit váš snímek, protože došlo k problému se službou Firefox Screenshots. Zkuste to prosím znovu později." + }, + "unshootablePageErrorTitle": { + "message": "Snímek této stránky nelze pořídit." + }, + "unshootablePageErrorDetails": { + "message": "Toto není běžná webová stránka, a proto z ní nelze pořizovat žádné snímky." + }, + "selfScreenshotErrorTitle": { + "message": "Nelze pořizovat snímek stránky Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Jejda! Služba Firefox Screenshots přestala pracovat." + }, + "genericErrorDetails": { + "message": "Nejsme si jistí, co se právě stalo. Chcete to zkusit znovu, nebo zkusíte pořídit snímek na jiné stránce?" + }, + "tourBodyOne": { + "message": "Pořizujte, ukládejte a sdílejte snímky webových stránek bez opuštění Firefoxu." + }, + "tourHeaderTwo": { + "message": "Zachyťte, cokoliv chcete" + }, + "tourBodyTwo": { + "message": "Stiskem tlačítka myši a tahem můžete vybrat oblast stránky. Výběr můžete provést také najetím myši na prvek stránky." + }, + "tourHeaderThree": { + "message": "Jak sami chcete" + }, + "tourBodyThree": { + "message": "Uložte si oříznutý snímek stránky na web pro rychlejší sdílení, nebo si ho stáhněte do počítače. Pro zobrazení všech snímků stačí klepnout na tlačítko Mé snímky." + }, + "tourHeaderFour": { + "message": "Pořizujte snímky jen částí nebo i celých stránek" + }, + "tourBodyFour": { + "message": "Pomocí tlačítek vpravo nahoře můžete pořídit snímek jen viditelné části nebo úplně celé stránky." + }, + "tourSkip": { + "message": "Přeskočit" + }, + "tourNext": { + "message": "Další snímek" + }, + "tourPrevious": { + "message": "Předchozí snímek" + }, + "tourDone": { + "message": "Hotovo" + }, + "termsAndPrivacyNotice": { + "message": "Používáním služby Firefox Screenshots souhlasíte s jejími $TERMSANDPRIVACYNOTICETERMSLINK$ a $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "podmínkami" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "zásadami ochrany osobních údajů" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/de/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/de/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/de/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/de/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Speichern Sie Ausschnitte und Bildschirmfotos von Webseiten, die Sie temporär oder dauerhaft speichern können." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Bildschirmfoto aufnehmen" + }, + "myShotsLink": { + "message": "Meine Bildschirmfotos" + }, + "screenshotInstructions": { + "message": "Ziehen oder Klicken Sie auf der Seite, um einen Bereich auszuwählen. Drücken Sie ESC zum Abbrechen." + }, + "saveScreenshotSelectedArea": { + "message": "Speichern" + }, + "saveScreenshotVisibleArea": { + "message": "Sichtbaren Bereich speichern" + }, + "saveScreenshotFullPage": { + "message": "Gesamte Seite speichern" + }, + "cancelScreenshot": { + "message": "Abbrechen" + }, + "downloadScreenshot": { + "message": "Herunterladen" + }, + "notificationLinkCopiedTitle": { + "message": "Link kopiert" + }, + "notificationLinkCopiedDetails": { + "message": "Der Link zu Ihrem Bildschirmfoto wurde in die Zwischenablage kopiert. Drücken Sie $META_KEY$-V zum Einfügen.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Außer Betrieb." + }, + "requestErrorDetails": { + "message": "Wir konnten Ihr Bildschirmfoto leider nicht speichern. Bitte versuchen Sie es später erneut." + }, + "connectionErrorTitle": { + "message": "Es war keine Verbindung zu Ihren Bildschirmfotos möglich." + }, + "connectionErrorDetails": { + "message": "Bitte überprüfen Sie Ihre Internetverbindung. Wenn diese funktioniert, gibt es eventuell ein temporäres Problem mit dem Dienst von Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Ihr Bildschirmfoto konnte nicht gespeichert werden, weil ein Problem mit dem Dienst Firefox Screenshots aufgetreten ist. Bitte versuchen Sie es später erneut." + }, + "unshootablePageErrorTitle": { + "message": "Ein Bildschirmfoto dieser Seite ist nicht möglich." + }, + "unshootablePageErrorDetails": { + "message": "Dies ist keine Standard-Webseite, daher sind keine Bildschirmfotos von ihr möglich." + }, + "selfScreenshotErrorTitle": { + "message": "Sie können kein Bildschirmfoto einer Firefox-Screenshots-Seite machen!" + }, + "genericErrorTitle": { + "message": "Firefox Screenshots funktioniert nicht richtig." + }, + "genericErrorDetails": { + "message": "Wir wissen auch nicht, was gerade passiert ist. Könnten Sie das Bildschirmfoto erneut oder auf einer anderen Seite aufnehmen?" + }, + "tourBodyOne": { + "message": "Bildschirmfotos aufnehmen, speichern und teilen, ohne Firefox zu verlassen." + }, + "tourHeaderTwo": { + "message": "Nehmen Sie auf, was Sie möchten" + }, + "tourBodyTwo": { + "message": "Klicken und ziehen Sie, um nur einen Teil einer Seite aufzunehmen. Sie können den Mauszeiger auch darüber bewegen, um Ihre Auswahl hervorzuheben." + }, + "tourHeaderThree": { + "message": "Wie Sie möchten" + }, + "tourBodyThree": { + "message": "Speichern Sie Ihre zugeschnittenen Bildschirmfotos im Internet, sodass sie leicht zu teilen sind, oder laden Sie sie auf Ihren Computer herunter. Sie können auch auf die Schaltfläche „Meine Bildschirmfotos“ klicken, um alle Ihre Bildschirmfotos zu finden." + }, + "tourHeaderFour": { + "message": "Fenster oder ganze Seiten speichern" + }, + "tourBodyFour": { + "message": "Nutzen Sie die Schaltflächen rechts oben, um den sichtbaren Bereich im Fenster oder eine ganze Seite zu speichern." + }, + "tourSkip": { + "message": "Überspringen" + }, + "tourNext": { + "message": "Nächste Folie" + }, + "tourPrevious": { + "message": "Vorherige Folie" + }, + "tourDone": { + "message": "Fertig" + }, + "termsAndPrivacyNotice": { + "message": "Durch die Verwendung von Firefox Screenshots stimmen Sie den entsprechenden $TERMSANDPRIVACYNOTICETERMSLINK$ und dem $TERMSANDPRIVACYNOTICEPRIVACYLINK$ zu.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Nutzungsbedingungen" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Datenschutzhinweis" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/dsb/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/dsb/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/dsb/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/dsb/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Wzejśo klipy a fota wobrazowki z weba a składujśo je nachylu abo na pśecej." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Foto wobrazowki gótowaś" + }, + "myShotsLink": { + "message": "Móje fota wobrazowki" + }, + "screenshotInstructions": { + "message": "Śěgniśo abo klikniśo na bok, aby wobcerk wubrał. Tłocćo na ESC, aby pśetergnuł." + }, + "saveScreenshotSelectedArea": { + "message": "Składowaś" + }, + "saveScreenshotVisibleArea": { + "message": "Widobny wobcerk składowaś" + }, + "saveScreenshotFullPage": { + "message": "Ceły bok składowaś" + }, + "cancelScreenshot": { + "message": "Pśetergnuś" + }, + "downloadScreenshot": { + "message": "Ześěgnuś" + }, + "notificationLinkCopiedTitle": { + "message": "Wótkaz kopěrowany" + }, + "notificationLinkCopiedDetails": { + "message": "Wótkaz k wašomu fotoju wobrazowki jo se do mjazywótkłada kopěrował. Tłocćo $META_KEY$-V, aby jen zasajźił.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Njeźěła." + }, + "requestErrorDetails": { + "message": "Bóžko njejsmy mógli wašo foto wobrazowki składowaś. Pšosym wopytajśo pózdźej hyšći raz." + }, + "connectionErrorTitle": { + "message": "Njamóžomy z wašymi fotami wobrazowki zwězaś." + }, + "connectionErrorDetails": { + "message": "Pšosym pśekontrolěrujśo swój internetny zwisk. Jolic móžośo z internetom zwězaś, dajo snaź nachylny problem ze słužbu Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Njesjmy mógli swójo foto wobrazowki składowaś, dokulaž dajo problem ze słužbu Firefox Screenshots. Pšosym wopytajśo pózdźej hyšći raz." + }, + "unshootablePageErrorTitle": { + "message": "Foto wobrazowki toś togo boka njejo móžne." + }, + "unshootablePageErrorDetails": { + "message": "To njejo standardny webbok, togodla foto wobrazowki wót njeje njejo móžne." + }, + "selfScreenshotErrorTitle": { + "message": "Njamóžośo wobrazowku boka Firefox Screenshots fotografěrowaś!" + }, + "genericErrorTitle": { + "message": "Hopla! Firefox Screenshots njeźěła." + }, + "genericErrorDetails": { + "message": "Njejsmy se wěste, což jo se stało. Cośo hyšći raz wopytaś abo cośo drugi bok fotografěrowaś?" + }, + "tourBodyOne": { + "message": "Gótujśo, składujśo a źělśo fota wobrazowki mimo až Firefox spušćaśo." + }, + "tourHeaderTwo": { + "message": "Fotografěrujśo jadnorje, což cośo" + }, + "tourBodyTwo": { + "message": "Klikniśo a ześěgniśo, aby źěl boka fotografěrował. Móžośo teke špěrku myški nad nim gibaś, aby swój wuběr wuzwignuł." + }, + "tourHeaderThree": { + "message": "Tak, kaž se wam spódoba" + }, + "tourBodyThree": { + "message": "Składujśo swóje pśirězane fota wobrazowki w interneśe, aby je lažcej źělił, abo ześěgniśo je na swójo licadło. Móžośo teke na tłocašk „Móje fota wobrazowki“ kliknuś, abye wšě fota wobrazowki namakał, kótarež sćo gótował." + }, + "tourHeaderFour": { + "message": "Wokna abo cełe boki składowaś" + }, + "tourBodyFour": { + "message": "Wubjeŕśo tłocašk górjejce napšawo, aby widobny wobcerk we woknje abo ceły bok fotografěrowaś." + }, + "tourSkip": { + "message": "Pśeskócyś" + }, + "tourNext": { + "message": "Pśiduce foto" + }, + "tourPrevious": { + "message": "Pjerwjejšne foto" + }, + "tourDone": { + "message": "Gótowo" + }, + "termsAndPrivacyNotice": { + "message": "Pśez wužywanje Firefox ScreenShots, zwolijośo do $TERMSANDPRIVACYNOTICETERMSLINK$ a $TERMSANDPRIVACYNOTICEPRIVACYLINK$ Firefox Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Wuměnjenja" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Powěźeńka priwatnosći" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/el/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/el/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/el/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/el/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Πραγματοποιήστε λήψη στιγμιοτύπων από το Διαδίκτυο και αποθηκεύστε τα προσωρινά ή μόνιμα." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Λήψη στιγμιότυπου" + }, + "myShotsLink": { + "message": "Οι λήψεις μου" + }, + "screenshotInstructions": { + "message": "Σύρετε ή κάντε κλικ στη σελίδα για να επιλέξετε μια περιοχή. Για ακύρωση πιέστε το πλήκτρο ESC." + }, + "saveScreenshotSelectedArea": { + "message": "Αποθήκευση" + }, + "saveScreenshotVisibleArea": { + "message": "Αποθήκευση ορατής περιοχής" + }, + "saveScreenshotFullPage": { + "message": "Αποθήκευση ολόκληρης σελίδας" + }, + "cancelScreenshot": { + "message": "Ακύρωση" + }, + "downloadScreenshot": { + "message": "Λήψη" + }, + "notificationLinkCopiedTitle": { + "message": "Αντιγραφή Συνδέσμου" + }, + "notificationLinkCopiedDetails": { + "message": "Ο σύνδεσμος προς την λήψη σας αντιγράφηκε στο πρόχειρο. Πατήστε $META_KEY$-V για επικόλληση.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Εκτός λειτουργίας." + }, + "requestErrorDetails": { + "message": "Συγνώμη! Δεν μπορέσαμε να αποθηκεύουμε την λήψη σας. Προσπαθήστε ξανά αργότερα." + }, + "connectionErrorTitle": { + "message": "Δεν μπορούμε να συνδεθούμε στις λήψεις σας." + }, + "connectionErrorDetails": { + "message": "Ελέγξτε τη σύνδεσή σας στο Internet. Εάν είστε σε θέση να συνδεθείτε στο Internet, ίσως υπάρχει ένα προσωρινό πρόβλημα με την υπηρεσία Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Δεν μπορέσαμε να αποθηκεύσουμε την λήψη σας γιατί υπάρχει κάποιο πρόβλημα με την υπηρεσία Firefox Screenshots. Προσπαθήστε ξανά αργότερα." + }, + "unshootablePageErrorTitle": { + "message": "Δεν μπορούμε να λάβουμε στιγμιότυπο αυτής της σελίδας." + }, + "unshootablePageErrorDetails": { + "message": "Δεν μπορεί να γίνει λήψη στιγμιότυπου καθώς αυτή δεν είναι μια τυπική σελίδα του Διαδικτύου." + }, + "selfScreenshotErrorTitle": { + "message": "Δεν μπορεί να γίνει λήψη ενός στιγμιότυπου της σελίδας Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Ωχ! Κάτι πήγε στραβά στην υπηρεσία Firefox Screenshots." + }, + "genericErrorDetails": { + "message": "Δεν είμαστε σίγουροι για το τι ακριβώς συνέβη. Προσπαθήστε ξανά ή κάντε λήψη σε μια άλλη σελίδα." + }, + "tourBodyOne": { + "message": "Λήψη, αποθήκευση και διαμοιρασμός στιγμιοτύπων μέσα από το Firefox." + }, + "tourHeaderTwo": { + "message": "Καταγράψτε αυτό που Εσείς Επιθυμείτε" + }, + "tourBodyTwo": { + "message": "Κάντε κλικ και σύρετε για την καταγραφή ενός τμήματος της σελίδας. Μπορείτε να επισημάνετε την επιλογή σας μετακινώντας τον ποντίκι σας επάνω της." + }, + "tourHeaderThree": { + "message": "Ακριβώς όπως το θέλετε" + }, + "tourBodyThree": { + "message": "Αποθηκεύστε της λήψεις σας στο Διαδίκτυο για ευκολότερο διαμοιρασμό, η λήψη τους στον υπολογιστή σας. Μπορείτε να βρείτε όλες τις λήψεις σας πατώντας στο κουμπί «Οι λήψεις μου»." + }, + "tourHeaderFour": { + "message": "Καταγράψτε Παράθυρα ή Ολόκληρες Σελίδες" + }, + "tourBodyFour": { + "message": "Επιλέξτε τα κουμπιά επάνω δεξιά για να καταγράψετε την ορατή περιοχή του παραθύρου ή να καταγράψετε μια ολόκληρη σελίδα." + }, + "tourSkip": { + "message": "Παράβλεψη" + }, + "tourNext": { + "message": "Επόμενη διαφάνεια" + }, + "tourPrevious": { + "message": "Προηγούμενη διαφάνεια" + }, + "tourDone": { + "message": "Τέλος" + }, + "termsAndPrivacyNotice": { + "message": "Χρησιμοποιώντας το Firefox Screenshots, συμφωνείτε με τους $TERMSANDPRIVACYNOTICETERMSLINK$ Στιγμιότυπων και τη $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Όρους" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Σημείωση απορρήτου" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/en_GB/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/en_GB/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/en_GB/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/en_GB/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,106 @@ +{ + "addonDescription": { + "message": "Take clips and screenshots from the Web and save them temporarily or permanently." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Take a Screenshot" + }, + "myShotsLink": { + "message": "My Shots" + }, + "screenshotInstructions": { + "message": "Drag or click on the page to select a region. Press ESC to cancel." + }, + "saveScreenshotSelectedArea": { + "message": "Save" + }, + "saveScreenshotVisibleArea": { + "message": "Save visible" + }, + "saveScreenshotFullPage": { + "message": "Save full page" + }, + "cancelScreenshot": { + "message": "Cancel" + }, + "downloadScreenshot": { + "message": "Download" + }, + "notificationLinkCopiedTitle": { + "message": "Link Copied" + }, + "notificationLinkCopiedDetails": { + "message": "The link to your shot has been copied to the clipboard. Press $META_KEY$-V to paste.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Out of order." + }, + "requestErrorDetails": { + "message": "Sorry! We couldn’t save your shot. Please try again later." + }, + "connectionErrorTitle": { + "message": "We can’t connect to your screenshots." + }, + "connectionErrorDetails": { + "message": "Please check your Internet connection. If you are able to connect to the Internet, there may be a temporary problem with the Firefox Screenshots service." + }, + "loginErrorDetails": { + "message": "We couldn’t save your shot because there is a problem with the Firefox Screenshots service. Please try again later." + }, + "unshootablePageErrorTitle": { + "message": "We can’t screenshot this page." + }, + "unshootablePageErrorDetails": { + "message": "This isn’t a standard Web page, so you can’t take a screenshot of it." + }, + "selfScreenshotErrorTitle": { + "message": "You can’t take a shot of a Firefox Screenshots page!" + }, + "genericErrorTitle": { + "message": "Whoa! Firefox Screenshots went haywire." + }, + "genericErrorDetails": { + "message": "We’re not sure what just happened. Care to try again or take a shot of a different page?" + }, + "tourBodyOne": { + "message": "Take, save, and share screenshots without leaving Firefox." + }, + "tourHeaderTwo": { + "message": "Capture Just What You Want" + }, + "tourBodyTwo": { + "message": "Click and drag to capture just a portion of a page. You can also hover to highlight your selection." + }, + "tourHeaderThree": { + "message": "As You Like it" + }, + "tourBodyThree": { + "message": "Save your cropped shots to the Web for easier sharing, or download them to your computer. You also can click on the My Shots button to find all the shots you’ve taken." + }, + "tourHeaderFour": { + "message": "Capture Windows or Entire Pages" + }, + "tourBodyFour": { + "message": "Select the buttons in the upper right to capture the visible area in the window or to capture an entire page." + }, + "tourSkip": { + "message": "SKIP" + }, + "tourNext": { + "message": "Next Slide" + }, + "tourPrevious": { + "message": "Previous Slide" + }, + "tourDone": { + "message": "Done" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/en_US/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/en_US/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/en_US/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/en_US/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Take clips and screenshots from the Web and save them temporarily or permanently." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Take a Screenshot" + }, + "myShotsLink": { + "message": "My Shots" + }, + "screenshotInstructions": { + "message": "Drag or click on the page to select a region. Press ESC to cancel." + }, + "saveScreenshotSelectedArea": { + "message": "Save" + }, + "saveScreenshotVisibleArea": { + "message": "Save visible" + }, + "saveScreenshotFullPage": { + "message": "Save full page" + }, + "cancelScreenshot": { + "message": "Cancel" + }, + "downloadScreenshot": { + "message": "Download" + }, + "notificationLinkCopiedTitle": { + "message": "Link Copied" + }, + "notificationLinkCopiedDetails": { + "message": "The link to your shot has been copied to the clipboard. Press $META_KEY$-V to paste.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Out of order." + }, + "requestErrorDetails": { + "message": "Sorry! We couldn’t save your shot. Please try again later." + }, + "connectionErrorTitle": { + "message": "We can’t connect to your screenshots." + }, + "connectionErrorDetails": { + "message": "Please check your Internet connection. If you are able to connect to the Internet, there may be a temporary problem with the Firefox Screenshots service." + }, + "loginErrorDetails": { + "message": "We couldn’t save your shot because there is a problem with the Firefox Screenshots service. Please try again later." + }, + "unshootablePageErrorTitle": { + "message": "We can’t screenshot this page." + }, + "unshootablePageErrorDetails": { + "message": "This isn’t a standard Web page, so you can’t take a screenshot of it." + }, + "selfScreenshotErrorTitle": { + "message": "You can’t take a shot of a Firefox Screenshots page!" + }, + "genericErrorTitle": { + "message": "Whoa! Firefox Screenshots went haywire." + }, + "genericErrorDetails": { + "message": "We’re not sure what just happened. Care to try again or take a shot of a different page?" + }, + "tourBodyOne": { + "message": "Take, save, and share screenshots without leaving Firefox." + }, + "tourHeaderTwo": { + "message": "Capture Just What You Want" + }, + "tourBodyTwo": { + "message": "Click and drag to capture just a portion of a page. You can also hover to highlight your selection." + }, + "tourHeaderThree": { + "message": "As You Like it" + }, + "tourBodyThree": { + "message": "Save your cropped shots to the Web for easier sharing, or download them to your computer. You also can click on the My Shots button to find all the shots you’ve taken." + }, + "tourHeaderFour": { + "message": "Capture Windows or Entire Pages" + }, + "tourBodyFour": { + "message": "Select the buttons in the upper right to capture the visible area in the window or to capture an entire page." + }, + "tourSkip": { + "message": "SKIP" + }, + "tourNext": { + "message": "Next Slide" + }, + "tourPrevious": { + "message": "Previous Slide" + }, + "tourDone": { + "message": "Done" + }, + "termsAndPrivacyNotice": { + "message": "By using Firefox Screenshots, you agree to the Screenshots $TERMSANDPRIVACYNOTICETERMSLINK$ and $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Terms" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Privacy Notice" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/es_AR/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/es_AR/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/es_AR/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/es_AR/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Tomá imágenes y capturas de la web y guardalos temporal o permanentemente." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Hacer captura de pantalla" + }, + "myShotsLink": { + "message": "Mis capturas" + }, + "screenshotInstructions": { + "message": "Arrastrá o hacé clic en la página para seleccionar una región. Presioná ESC para cancelar." + }, + "saveScreenshotSelectedArea": { + "message": "Guardar" + }, + "saveScreenshotVisibleArea": { + "message": "Guardar visible" + }, + "saveScreenshotFullPage": { + "message": "Guardar página completa" + }, + "cancelScreenshot": { + "message": "Cancelar" + }, + "downloadScreenshot": { + "message": "Descargar" + }, + "notificationLinkCopiedTitle": { + "message": "Enlace copiado" + }, + "notificationLinkCopiedDetails": { + "message": "EL enlace a la captura ha sido copiado al portapapeles. Presioná $META_KEY$-V para pegar.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "No funciona." + }, + "requestErrorDetails": { + "message": "¡Perdón! No pudimos guardar la captura. Intentá más tarde." + }, + "connectionErrorTitle": { + "message": "No podemos conectar a las capturas de pantalla." + }, + "connectionErrorDetails": { + "message": "Verificá la conexión a Internet. Si te podés conectar a Internet, hay un problema temporal con el servicio de capturas de Firefox." + }, + "loginErrorDetails": { + "message": "No pudimos guardar la captura porque hay un problema con el servicio de capturas de Firefox. Intentá más tarde." + }, + "unshootablePageErrorTitle": { + "message": "No podemos capturar esta página." + }, + "unshootablePageErrorDetails": { + "message": "Esta no es una página web estándar, así que no podemos guardar una captura." + }, + "selfScreenshotErrorTitle": { + "message": "¡No se puede hacer una captura de la página de capturas de Firefox!" + }, + "genericErrorTitle": { + "message": "¡Apa! La capturas de pantalla de Firefox se volvieron locas." + }, + "genericErrorDetails": { + "message": "No estamos seguros de lo que pasó. ¿Querés intenar de nuevo o tomar una captura de una página diferente?" + }, + "tourBodyOne": { + "message": "Hacer, guardar y compartir capturas de pantalla sin dejar Firefox." + }, + "tourHeaderTwo": { + "message": "Capturar sólo lo que querés" + }, + "tourBodyTwo": { + "message": "Hacé clic y arrastrá para capturar una porción de la página. También podés pasar por encima para resaltar la selección." + }, + "tourHeaderThree": { + "message": "Como te guste" + }, + "tourBodyThree": { + "message": "Guardá tus capturas recortadas a la web para compartir o descargarlas más fácilmente a tu computadora. También podés hacer clic en el botón Mis capturas para encontrar todas las capturas hechas." + }, + "tourHeaderFour": { + "message": "Capturar ventanas o páginas enteras" + }, + "tourBodyFour": { + "message": "Seleccioná los botones arriba a la derecha para capturar el área visible en la ventana o la página completa." + }, + "tourSkip": { + "message": "Saltear" + }, + "tourNext": { + "message": "Próxima diapositiva" + }, + "tourPrevious": { + "message": "Diapositiva anterior" + }, + "tourDone": { + "message": "Listo" + }, + "termsAndPrivacyNotice": { + "message": "Al usar Firefox Screenshots, aceptás los $TERMSANDPRIVACYNOTICETERMSLINK$ y $TERMSANDPRIVACYNOTICEPRIVACYLINK$ de Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Términos" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Nota de privacidad" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/es_CL/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/es_CL/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/es_CL/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/es_CL/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Toma capturas de un sitio Web para guardarlas de forma temporal o permanentemente." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Toma una captura de pantalla" + }, + "myShotsLink": { + "message": "Mis capturas" + }, + "screenshotInstructions": { + "message": "Arrastra o haz clic en la página para seleccionar una región. Presiona ESC para cancelar." + }, + "saveScreenshotSelectedArea": { + "message": "Guardar" + }, + "saveScreenshotVisibleArea": { + "message": "Guardar lo visible" + }, + "saveScreenshotFullPage": { + "message": "Guardar la página completa" + }, + "cancelScreenshot": { + "message": "Cancelar" + }, + "downloadScreenshot": { + "message": "Descargar" + }, + "notificationLinkCopiedTitle": { + "message": "Enlace copiado" + }, + "notificationLinkCopiedDetails": { + "message": "El enlace a tu captura ha sido copiado al portapapeles. Presiona $META_KEY$-V para pegarla.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Fuera de orden." + }, + "requestErrorDetails": { + "message": "¡Lo sentimos! No pudimos guardar tu captura. Por favor, vuelve a intentarlo más tarde." + }, + "connectionErrorTitle": { + "message": "No podemos conectar a tus capturas." + }, + "connectionErrorDetails": { + "message": "Por favor, revisa tu conexión a Internet. Si eres capaz de conectarte a Internet, puede que haya un problema temporal con el servicio de Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "No pudimos guardar tu captura porque hay un problema con el servicio de Firefox Screenshots. Por favor, vuelve a intentarlo más tarde." + }, + "unshootablePageErrorTitle": { + "message": "No podemos capturar esta página." + }, + "unshootablePageErrorDetails": { + "message": "Esta no es una página Web estándar, por lo que no puedes tomar una captura de ella." + }, + "selfScreenshotErrorTitle": { + "message": "¡No puedes tomar una captura de una página de Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "¡Guau! Firefox Screenshots se copetió." + }, + "genericErrorDetails": { + "message": "No estamos seguros de lo que sucedió. ¿Te importaría volver a intentarlo o tomar una captura de una página diferente?" + }, + "tourBodyOne": { + "message": "Toma, guarda y comparte capturas sin salir de Firefox." + }, + "tourHeaderTwo": { + "message": "Captura lo que necesitas" + }, + "tourBodyTwo": { + "message": "Haz clic y arrastra para captura justo una parte de la página. También puedes colocarte sobre una parte para destacar tu selección." + }, + "tourHeaderThree": { + "message": "Como tu quieras" + }, + "tourBodyThree": { + "message": "Guarda tus capturas recortadas en la Web para compartirlas fácilmente o descargarlas a tu computador. También puedes hacer clic en el botón Mis capturas para encontrar todas las que hayas tomado." + }, + "tourHeaderFour": { + "message": "Captura ventanas o páginas completas" + }, + "tourBodyFour": { + "message": "Selecciona los botones en la parte superior derecha para capturar el área visible ne la ventana o para capturar una página completa." + }, + "tourSkip": { + "message": "SALTAR" + }, + "tourNext": { + "message": "Siguiente diapositiva" + }, + "tourPrevious": { + "message": "Diapositiva anterior" + }, + "tourDone": { + "message": "Hecho" + }, + "termsAndPrivacyNotice": { + "message": "Al usar Firefox Screenshots, aceptas los $TERMSANDPRIVACYNOTICETERMSLINK$ y el $TERMSANDPRIVACYNOTICEPRIVACYLINK$ de Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Términos" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Aviso de privacidad" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/es_ES/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/es_ES/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/es_ES/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/es_ES/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Haz capturas y recortes de la web y guárdalos temporal o permanentemente." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Hacer una captura de pantalla" + }, + "myShotsLink": { + "message": "Mis capturas" + }, + "screenshotInstructions": { + "message": "Arrastra o haz clic en la página para seleccionar una región. Pulsa ESC para cancelar." + }, + "saveScreenshotSelectedArea": { + "message": "Guardar" + }, + "saveScreenshotVisibleArea": { + "message": "Guardar visible" + }, + "saveScreenshotFullPage": { + "message": "Guardar página completa" + }, + "cancelScreenshot": { + "message": "Cancelar" + }, + "downloadScreenshot": { + "message": "Descargar" + }, + "notificationLinkCopiedTitle": { + "message": "Enlace copiado" + }, + "notificationLinkCopiedDetails": { + "message": "Se ha copiado el enlace a la captura en el portapapeles. Pulsa $META_KEY$-V para pegar.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "No funciona." + }, + "requestErrorDetails": { + "message": "¡Lo sentimos! No hemos podido guardar tu captura. Inténtalo más tarde." + }, + "connectionErrorTitle": { + "message": "No podemos acceder a tus capturas de pantalla." + }, + "connectionErrorDetails": { + "message": "Comprueba tu conexión a Internet. Si puedes conectarte, puede que haya un problema temporal con el servicio de capturas de pantalla de Firefox." + }, + "loginErrorDetails": { + "message": "No se pudo guardar la captura porque hay un problema con el servicio de capturas de pantalla de Firefox. Inténtalo más tarde." + }, + "unshootablePageErrorTitle": { + "message": "No podemos hacer una captura de esta página." + }, + "unshootablePageErrorDetails": { + "message": "No es una página web común, por lo que no podemos hacer captura de pantalla." + }, + "selfScreenshotErrorTitle": { + "message": "¡No puedes hacer una captura de la página de capturas de Firefox!" + }, + "genericErrorTitle": { + "message": "¡Vaya! La página de capturas de pantalla de Firefox se ha vuelto loca." + }, + "genericErrorDetails": { + "message": "No estamos seguros de lo que acaba de pasar. ¿Te importa volver a intentarlo o hacer una captura de otra página?" + }, + "tourBodyOne": { + "message": "Hacer, guardar y compartir capturas de pantalla sin salir de Firefox." + }, + "tourHeaderTwo": { + "message": "Haz capturas solo de lo que tú quieras" + }, + "tourBodyTwo": { + "message": "Haz clic y arrastra para capturar solo una parte de la página. También puedes pasar por encima para resaltar tu selección." + }, + "tourHeaderThree": { + "message": "Como más te guste" + }, + "tourBodyThree": { + "message": "Guarda las capturas de la Web recortadas para compartirlas mejor o descárgalas en tu ordenador. También puedes hacer clic en Mis capturas para ver todas las capturas que has hecho." + }, + "tourHeaderFour": { + "message": "Haz capturas de Windows o páginas completas" + }, + "tourBodyFour": { + "message": "Selecciona los botones de la parte superior derecha para capturar el área visible en Windows o la página completa." + }, + "tourSkip": { + "message": "Saltar" + }, + "tourNext": { + "message": "Diapositiva siguiente" + }, + "tourPrevious": { + "message": "Diapositiva anterior" + }, + "tourDone": { + "message": "Hecho" + }, + "termsAndPrivacyNotice": { + "message": "Al usar Firefox Screenshots, aceptas los $TERMSANDPRIVACYNOTICETERMSLINK$ y el $TERMSANDPRIVACYNOTICEPRIVACYLINK$ de Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Términos" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Aviso de privacidad" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/es_MX/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/es_MX/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/es_MX/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/es_MX/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Tomar clips y capturas de pantalla de la web y guardarlos temporalmente o permanentemente." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Tomar captura de pantalla" + }, + "myShotsLink": { + "message": "Mis capturas" + }, + "screenshotInstructions": { + "message": "Arrastra o haz clic en la página para seleccionar la región. Presiona ESC para cancelar." + }, + "saveScreenshotSelectedArea": { + "message": "Guardar" + }, + "saveScreenshotVisibleArea": { + "message": "Guardar visible" + }, + "saveScreenshotFullPage": { + "message": "Guardar página completa" + }, + "cancelScreenshot": { + "message": "Cancelar" + }, + "downloadScreenshot": { + "message": "Descarga" + }, + "notificationLinkCopiedTitle": { + "message": "Enlace copiado" + }, + "notificationLinkCopiedDetails": { + "message": "El enlace que has capturado ha sido copiado al portapapeles. Presiona $META_KEY$-V para pegar.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Fuera de orden." + }, + "requestErrorDetails": { + "message": "¡Lo sentimos! No pudimos guardar tu captura. Por favor, intenta de nuevo más tarde." + }, + "connectionErrorTitle": { + "message": "No podemos conectar a tus capturas de pantalla." + }, + "connectionErrorDetails": { + "message": "Por favor, revisa tu conexión a Internet. Si eres capaz de conectarte a Internet, puede ser que exista un error temporal con el servicio de capturas de pantalla de Firefox." + }, + "loginErrorDetails": { + "message": "No pudimos guardar tu captura porque hay un problema con el servicio de capturas de pantalla de Firefox. Por favor, intenta de nuevo más tarde." + }, + "unshootablePageErrorTitle": { + "message": "No podemos realizar una captura de pantalla a esta página." + }, + "unshootablePageErrorDetails": { + "message": "Esta no es una página web estándar, por lo tanto no podemos tomar una captura de pantalla de ella." + }, + "selfScreenshotErrorTitle": { + "message": "¡No puedes tomar una captura de la página de capturas de pantalla de Firefox!" + }, + "genericErrorTitle": { + "message": "¡Oye! Las capturas de pantalla de Firefox salieron mal." + }, + "genericErrorDetails": { + "message": "No estamos seguros qué pasó. ¿Te importaría intentarlo de nuevo o tomar una captura de una página diferente?" + }, + "tourBodyOne": { + "message": "Toma, guarda y comparte capturas de pantalla sin dejar Firefox." + }, + "tourHeaderTwo": { + "message": "Captura sólo lo que necesitas" + }, + "tourBodyTwo": { + "message": "Haz clic y arrastra para capturas sólo una parte de la página. También puedes desplazarte para resaltar tu selección." + }, + "tourHeaderThree": { + "message": "Como te gusta" + }, + "tourBodyThree": { + "message": "Guarda tus capturas recortadas en la Web para compartirlas más fácilmente o descárgalas en tu computadora. También puedes hacer clic en el botón Mis Capturas para encontrar todas las fotos que has tomado." + }, + "tourHeaderFour": { + "message": "Captura ventanas o páginas enteras" + }, + "tourBodyFour": { + "message": "Selecciona los botones en la parte superior derecha para capturar el área visible en la ventana o para capturar una página completa." + }, + "tourSkip": { + "message": "Ignorar" + }, + "tourNext": { + "message": "Siguiente diapositiva" + }, + "tourPrevious": { + "message": "Diapositiva anterior" + }, + "tourDone": { + "message": "Terminado" + }, + "termsAndPrivacyNotice": { + "message": "Al usar Firefox Screenshots, estás de acuerdo con los $TERMSANDPRIVACYNOTICETERMSLINK$ y con el $TERMSANDPRIVACYNOTICETERMSLINK$ de Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Términos" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Aviso de privacidad" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/et/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/et/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/et/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/et/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Tee veebist klippe või ekraanipilte ning salvesta need ajutiselt või püsivalt." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Tee ekraanipilt" + }, + "myShotsLink": { + "message": "Minu pildid" + }, + "screenshotInstructions": { + "message": "Ala valimiseks klõpsavõi lohista lehel. Tühistamiseks vajuta ESC." + }, + "saveScreenshotSelectedArea": { + "message": "Salvesta" + }, + "saveScreenshotVisibleArea": { + "message": "Salvesta nähtav" + }, + "saveScreenshotFullPage": { + "message": "Salvesta terve leht" + }, + "cancelScreenshot": { + "message": "Tühista" + }, + "downloadScreenshot": { + "message": "Laadi alla" + }, + "notificationLinkCopiedTitle": { + "message": "Link kopeeriti" + }, + "notificationLinkCopiedDetails": { + "message": "Link sinu pildile kopeeriti lõikepuhvrisse. Asetamiseks vajuta $META_KEY$-V.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Tekkis viga." + }, + "requestErrorDetails": { + "message": "Vabandame! Me ei suutnud su pilti salvestada. Palun proovi hiljem uuesti." + }, + "connectionErrorTitle": { + "message": "Ühendumine sinu ekraanipiltidega ei õnnestunud." + }, + "connectionErrorDetails": { + "message": "Palun kontrolli internetiühenduse toimimist. Kui saad internetiga ühendust, siis võib tegemist olla Firefox Screenshots teenuse ajutise probleemiga." + }, + "loginErrorDetails": { + "message": "Ekraanipildi salvestamine ebaõnnestus Firefox Screenshots teenuse probleemi tõttu. Palun proovi hiljem uuesti." + }, + "unshootablePageErrorTitle": { + "message": "Sellest lehest ei saa ekraanipilti teha." + }, + "unshootablePageErrorDetails": { + "message": "Tegemist pole standardse veebilehega, seetõttu ei saa sellest ekraanipilti teha." + }, + "selfScreenshotErrorTitle": { + "message": "Firefox Screenshots lehest ei saa ekraanipilti teha!" + }, + "genericErrorTitle": { + "message": "Oi-oi! Firefox Screenshots läks sassi." + }, + "genericErrorDetails": { + "message": "Me pole kindlad, mis just juhtus. Proovid ehk uuesti või teed ekraanipildi mõnest teisest lehest?" + }, + "tourBodyOne": { + "message": "Tee, salvesta ja jaga ekraanipilte Firefoxist lahkumata." + }, + "tourHeaderTwo": { + "message": "Salvesta just seda, mida soovid" + }, + "tourBodyTwo": { + "message": "Klõpsa ja lohista lehe osa valimiseks. Samuti võid valiku esile toomiseks kursorit selle kohal hoida." + }, + "tourHeaderThree": { + "message": "Nii, kuidas sulle meeldib" + }, + "tourBodyThree": { + "message": "Salvesta kärbitud pilte lihtsamaks jagamiseks veebi või laadi need alla enda arvutisse. Võid ka klõpsata Minu pildid nupul kõigi tehtud piltide vaatamiseks." + }, + "tourHeaderFour": { + "message": "Salvesta aknaid või terveid lehti" + }, + "tourBodyFour": { + "message": "Kasuta nuppe ülal paremal aknas nähtava ala või terve lehe salvestamiseks." + }, + "tourSkip": { + "message": "Jäta vahele" + }, + "tourNext": { + "message": "Järgmine slaid" + }, + "tourPrevious": { + "message": "Eelmine slaid" + }, + "tourDone": { + "message": "Valmis" + }, + "termsAndPrivacyNotice": { + "message": "Firefox Screenshots kasutamisel nõustud Screenshots $TERMSANDPRIVACYNOTICETERMSLINK$ ja $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "kasutustingimuste" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "privaatsuspoliitikaga" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/fa/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/fa/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/fa/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/fa/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "از وب عکس بگیرید و کلیپ بسازید و به صورت موقت یا دایمی ذخیره کنید." + }, + "addonAuthorsList": { + "message": "موزیلا " + }, + "contextMenuLabel": { + "message": "از صفحه عکس بگیرید" + }, + "myShotsLink": { + "message": "عکس‌های من" + }, + "screenshotInstructions": { + "message": "با کشیدن یا کلیک کردن روی صفحه یک منطقه را انتخاب کنید. برای لغو، ESC را فشار دهید." + }, + "saveScreenshotSelectedArea": { + "message": "ذخیره" + }, + "saveScreenshotVisibleArea": { + "message": "ذخیره ناحیه قابل مشاهده" + }, + "saveScreenshotFullPage": { + "message": "ذخیره صفحه کامل" + }, + "cancelScreenshot": { + "message": "لغو" + }, + "downloadScreenshot": { + "message": "دریافت" + }, + "notificationLinkCopiedTitle": { + "message": "پیوند کپی شد" + }, + "notificationLinkCopiedDetails": { + "message": "لینک عکس شما در کلیپ‌بورد رونوشت شد. $META_KEY$-V را برای جای‌گذاری فشار دهید.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "خارج از سرویس." + }, + "requestErrorDetails": { + "message": "متاسفم! نتوانستیم عکس شما را ذخیره کنیم. لطفاً بعدا دوباره تلاش کنید." + }, + "connectionErrorTitle": { + "message": "نمی‌توانیم به تصاویر صفحه شما متصل شویم." + }, + "connectionErrorDetails": { + "message": "لطفا اتصال اینترنت خود را بررسی کنید. اگر قادر به اتصال به اینترنت هستید، ممکن است مشکلی موقتی در سرویس تصاویر صفحهٔ فایرفاکس وجود داشته باشد." + }, + "loginErrorDetails": { + "message": "به علت وجود مشکل در سرویس تصاویر صفحه فایرفاکس نتوانستیم عکس شما را ذخیره کنیم. لطفاً بعدا دوباره تلاش کنید." + }, + "unshootablePageErrorTitle": { + "message": "نمی‌توانیم از این صفحه تصویر بگیریم." + }, + "unshootablePageErrorDetails": { + "message": "این یک صفحه استاندارد وب نیست، بنابراین شما نمی‌توانید از آن تصویر بگیرید." + }, + "selfScreenshotErrorTitle": { + "message": "نمی‌توانید از صفحهٔ تصاویرِ فایرفاکس عکس بگیرید!" + }, + "genericErrorTitle": { + "message": "اوه! سرویس تصاویر صفحه فایرفاکس قاطی کرده." + }, + "genericErrorDetails": { + "message": "مطمئن نیستیم چه اتفاقی افتاده است. می‌خواهید دوباره امتحان کنید یا از یک صفحهٔ دیگر عکس بگیرید؟" + }, + "tourBodyOne": { + "message": "بدون خارج شدن از فایرفاکس، عکس بگیرید، ذخیره کنید و به اشتراک بگذارید." + }, + "tourHeaderTwo": { + "message": "ضبط آنچه شما می‌خواهید" + }, + "tourBodyTwo": { + "message": "کلیک کنید و بکشید تا فقط از قسمتی از صفحه عکس بگیرید. می‌توانید برای برجسته کردن روی ناحیه انتخاب شده حرکت کنید." + }, + "tourHeaderThree": { + "message": "همانطور که می‌پسندید" + }, + "tourBodyThree": { + "message": "عکس‌های بریده شده خود را برای به اشتراک‌گذاری راحت‌تر روی وب ذخیره کنید، یا آن‌ها را روی رایانه خود دریافت کنید. همچنین برای دیدن همهٔ عکس‌هایی که گرفتید می‌توانید روی دکمه «عکس‌های من» کلیک کنید." + }, + "tourHeaderFour": { + "message": "ضبط پنجره یا کل صفحه‌ها" + }, + "tourBodyFour": { + "message": "برای گرفتن عکس از ناحیه قابل مشاهده در پنجره یا تمام صفحه از دکمه‌های بالا سمت راست استفاده کنید." + }, + "tourSkip": { + "message": "رد کردن" + }, + "tourNext": { + "message": "اسلاید بعدی" + }, + "tourPrevious": { + "message": "اسلاید قبلی" + }, + "tourDone": { + "message": "انجام شد" + }, + "termsAndPrivacyNotice": { + "message": "با استفاده از سرویسِ تصاویرِ صفحهٔ فایرفاکس، شما با $TERMSANDPRIVACYNOTICETERMSLINK$ و $TERMSANDPRIVACYNOTICEPRIVACYLINK$ موافقت می‌کنید.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "شرایط" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "نکات حریم‌خصوصی" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/fr/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/fr/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/fr/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/fr/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Effectuez des captures d’écran sur le Web et sauvegardez-les de manière temporaire ou permanente." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Effectuer une capture d’écran" + }, + "myShotsLink": { + "message": "Mes captures d’écran" + }, + "screenshotInstructions": { + "message": "Sélectionnez une zone de la page par cliquer-glisser ou en cliquant sur l’élément à sélectionner. Appuyez sur Échap pour annuler." + }, + "saveScreenshotSelectedArea": { + "message": "Enregistrer" + }, + "saveScreenshotVisibleArea": { + "message": "Capturer la zone visible" + }, + "saveScreenshotFullPage": { + "message": "Capturer la page complète" + }, + "cancelScreenshot": { + "message": "Annuler" + }, + "downloadScreenshot": { + "message": "Télécharger" + }, + "notificationLinkCopiedTitle": { + "message": "Lien copié" + }, + "notificationLinkCopiedDetails": { + "message": "Le lien de votre capture a été copié dans le presse-papiers. Appuyez sur $META_KEY$-V pour le coller.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Impossible d’effectuer cette action." + }, + "requestErrorDetails": { + "message": "Votre capture d’écran n’a pas pu être enregistrée. Veuillez réessayer plus tard." + }, + "connectionErrorTitle": { + "message": "Nous ne pouvons pas nous connecter à vos captures d’écran." + }, + "connectionErrorDetails": { + "message": "Veuillez vérifier votre connexion à Internet. Si celle-ci fonctionne normalement, il peut y avoir un problème temporaire avec le service de Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Nous n’avons pas pu enregistrer votre capture d’écran, car le service de Firefox Screenshot rencontre des difficultés. Veuillez réessayer plus tard." + }, + "unshootablePageErrorTitle": { + "message": "Impossible d’effectuer une capture d’écran de cette page." + }, + "unshootablePageErrorDetails": { + "message": "Impossible d’effectuer une capture d’écran, car cette page web n’est pas standard." + }, + "selfScreenshotErrorTitle": { + "message": "Vous ne pouvez pas effectuer une capture d’écran d’une page Firefox Screenshots." + }, + "genericErrorTitle": { + "message": "Firefox Screenshots semble avoir un petit problème." + }, + "genericErrorDetails": { + "message": "Un problème non identifié est survenu. Vous pouvez réessayer ou effectuer une capture d’écran d’une autre page." + }, + "tourBodyOne": { + "message": "Effectuez des captures d’écran, enregistrez et partagez-les sans quitter Firefox." + }, + "tourHeaderTwo": { + "message": "Capturez ce que vous voulez" + }, + "tourBodyTwo": { + "message": "Cliquez et glissez pour capturer seulement une partie de la page. Vous pouvez aussi survoler une zone avec votre curseur pour surligner votre sélection." + }, + "tourHeaderThree": { + "message": "À votre guise" + }, + "tourBodyThree": { + "message": "Sauvegardez en ligne vos captures recadrées pour les partager plus facilement, ou téléchargez-les sur votre ordinateur. Vous pouvez aussi cliquer sur « Mes captures d’écran » pour retrouver toutes vos captures." + }, + "tourHeaderFour": { + "message": "Effectuez des captures d’écran de fenêtres ou de pages entières" + }, + "tourBodyFour": { + "message": "Utilisez les boutons en haut à droite pour capturer au choix la zone visible dans la fenêtre ou la page entière." + }, + "tourSkip": { + "message": "IGNORER" + }, + "tourNext": { + "message": "Écran suivant" + }, + "tourPrevious": { + "message": "Écran précédent" + }, + "tourDone": { + "message": "Terminé" + }, + "termsAndPrivacyNotice": { + "message": "En utilisant Firefox Screenshots, vous acceptez les $TERMSANDPRIVACYNOTICETERMSLINK$ et la $TERMSANDPRIVACYNOTICEPRIVACYLINK$ de Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "mentions légales" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "politique de confidentialité" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/fy_NL/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/fy_NL/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/fy_NL/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/fy_NL/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Meitsje skermprintsjes of klips fan it web en bewarje se tydlik of permanint." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Meitsje in skermprintsje" + }, + "myShotsLink": { + "message": "Myn skermprintsjes" + }, + "screenshotInstructions": { + "message": "Sleep of klik op de side om in gebiet te selektearjen. Druk op ESC om te annulearjen." + }, + "saveScreenshotSelectedArea": { + "message": "Bewarje" + }, + "saveScreenshotVisibleArea": { + "message": "Sichtbere bewarje" + }, + "saveScreenshotFullPage": { + "message": "Folsleine side bewarje" + }, + "cancelScreenshot": { + "message": "Annulearje" + }, + "downloadScreenshot": { + "message": "Downloade" + }, + "notificationLinkCopiedTitle": { + "message": "Keppeling kopiearre" + }, + "notificationLinkCopiedDetails": { + "message": "De keppeling nei jo skermprintsje is nei it klamboerd kopiearre. Brûk $META_KEY$-V om te plakken.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Bûten tsjinst." + }, + "requestErrorDetails": { + "message": "Sorry! Wy koene jo skermprintsje net bewarje. Probearje it letter nochris." + }, + "connectionErrorTitle": { + "message": "Wy kinne net ferbine nei jo skermprintsjes." + }, + "connectionErrorDetails": { + "message": "Kontrolearje jo ynternetferbining. As jo wol ferbining meitsje kinne mei it ynternet, kin it wêze dat der tydlik in probleem is mei de tsjinst Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Wy koene jo skermprintsje net bewarje, omdat der in probleem is mei de tsjinst Firefox Screenshots. Probearje it letter nochris." + }, + "unshootablePageErrorTitle": { + "message": "It is net mooglik in skermprintsje fan dizze side te meitsjen." + }, + "unshootablePageErrorDetails": { + "message": "Dit is net in standert webside, dus jo kinne der net in skermprintsje fan meitsje." + }, + "selfScreenshotErrorTitle": { + "message": "Jo kinne net in skermprintsje meitsje fan in Firefox Screenshots-side!" + }, + "genericErrorTitle": { + "message": "Oeps! Firefox Screenshots is yn 'e war." + }, + "genericErrorDetails": { + "message": "Wy binne net wis wat der krekt bard is. Wolle jo it nochris probearje of in skermprintsje fan in oare side meitsje?" + }, + "tourBodyOne": { + "message": "Meitsje, bewarje en diel skermprintsjes sûnder Firefox te ferlitten." + }, + "tourHeaderTwo": { + "message": "Fetsje wat jo wolle" + }, + "tourBodyTwo": { + "message": "Klik en sleep om in part fan in side te fetsjen. Jo kinne ek oer in gebiet gean om jo seleksje út te ljochtsjen." + }, + "tourHeaderThree": { + "message": "Nei jo winsk" + }, + "tourBodyThree": { + "message": "Bewarje jo byknippe skermprintsjes nei it web om se maklik te dielen, of download se nei jo kompjûter. Jo kinne ek op de knop Myn skermprintsjes klikke om al jo makke skermprintsjes te finen." + }, + "tourHeaderFour": { + "message": "Fetsje finsters of folsleine websiden" + }, + "tourBodyFour": { + "message": "Selektearje knoppen rjochts boppe-oan om it sichtbere gebiet yn it finster te fetsjen, of fetsje in folsleine side." + }, + "tourSkip": { + "message": "Oerslaan" + }, + "tourNext": { + "message": "Folgjende ôfbylding" + }, + "tourPrevious": { + "message": "Foarige ôfbylding" + }, + "tourDone": { + "message": "Dien" + }, + "termsAndPrivacyNotice": { + "message": "Troch Firefox Screenshots te brûken, gean jo akkoard mei de $TERMSANDPRIVACYNOTICETERMSLINK$ en $TERMSANDPRIVACYNOTICEPRIVACYLINK$ fan Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Betingsten" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Privacyferklearring" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/gu_IN/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/gu_IN/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/gu_IN/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/gu_IN/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "વેબમાંથી ક્લિપ્સ અને સ્ક્રીનશૉટ્સ લો અને તેમને કામચલાઉ અથવા કાયમી રીતે સાચવો." + }, + "addonAuthorsList": { + "message": "Mozilla" + }, + "contextMenuLabel": { + "message": "સ્ક્રીનશૉટ લેવા" + }, + "myShotsLink": { + "message": "મારા શોટ્સ" + }, + "screenshotInstructions": { + "message": "ખેંચો અથવા એક પ્રદેશ પસંદ કરવા માટે પાનાં પર ક્લિક કરો. રદ કરવા માટે ESC દબાવો." + }, + "saveScreenshotSelectedArea": { + "message": "સાચવો" + }, + "saveScreenshotVisibleArea": { + "message": "દૃશ્યમાન સાચવો" + }, + "saveScreenshotFullPage": { + "message": "સંપૂર્ણ પૃષ્ઠ સાચવો" + }, + "cancelScreenshot": { + "message": "રદ" + }, + "downloadScreenshot": { + "message": "ડાઉનલોડ" + }, + "notificationLinkCopiedTitle": { + "message": "લિંક કૉપિ" + }, + "notificationLinkCopiedDetails": { + "message": "તમારા શોટ માટે લિંક ક્લિપબોર્ડ પર કૉપિ કરવામાં આવ્યું છે. પ્રેસ $META_KEY$ -V પેસ્ટ કરવા માટે.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "હુકમ બહાર." + }, + "requestErrorDetails": { + "message": "માફ કરશો! અમે તમારા શોટ સાચવી શક્યા નથી. પછીથી ફરી પ્રયત્ન કરો." + }, + "connectionErrorTitle": { + "message": "અમે તમારા સ્ક્રીનશૉટ્સ ને કનેક્ટ થઈ શકતા નથી." + }, + "connectionErrorDetails": { + "message": "તમારું ઇન્ટરનેટ કનેક્શન તપાસો. તમે ઇન્ટરનેટથી કનેક્ટ કરવા માટે સક્ષમ છો, તો ત્યાં ફાયરફોક્સ સ્ક્રીનશોટ્સ સેવા સાથે એક અસ્થાયી સમસ્યા હોઈ શકે છે." + }, + "loginErrorDetails": { + "message": "અમે તમારા શોટ સાચવી શક્યા નથી કારણ કે Firefox સ્ક્રીનશોટ્સ સેવા સાથે એક સમસ્યા છે. પછીથી ફરી પ્રયત્ન કરો." + }, + "unshootablePageErrorTitle": { + "message": "અમે આ પૃષ્ઠ સ્ક્રીનશૉટ ન કરી શકીએ." + }, + "unshootablePageErrorDetails": { + "message": "આ એક પ્રમાણભૂત વેબ પૃષ્ઠ, જેથી તમે તેને એક સ્ક્રીનશૉટ ન લઈ શકો." + }, + "selfScreenshotErrorTitle": { + "message": "તમે પૃષ્ઠના Firefox સ્ક્રીનશોટ્સ શોટ લઇ શકો નહિ!" + }, + "genericErrorTitle": { + "message": "થોભો! Firefox સ્ક્રીનશોટ્સ અવ્યવસ્થિત થઈ ગયા." + }, + "genericErrorDetails": { + "message": "અમે ખાતરી નથીકે શું માત્ર થયું છે . ફરી પ્રયાસ કરો અથવા એક અલગ પૃષ્ઠ એક શોટ લેવા માટે કાળજી કરો?" + }, + "tourBodyOne": { + "message": "લેવા, સાચવેલા, અને વહેંચાયેલ સ્ક્રીનશૉટ્સ Firefox છોડ્યાં વિના." + }, + "tourHeaderTwo": { + "message": "કેદ કરો તમને જોઈએ તે" + }, + "tourBodyTwo": { + "message": "પાનાંના માત્ર એક ભાગ મેળવવા માટે ક્લિક કરો અને ખેંચો. તમે પણ તમારી પસંદગી પ્રકાશિત કરવા માટે હૉવર કરી શકો છો." + }, + "tourHeaderThree": { + "message": "તમને જે ગમે" + }, + "tourBodyThree": { + "message": "સરળ શેરિંગ માટે વેબ પર તમારા કપાઈ શોટ સાચવો, અથવા તેમને તમારા કમ્પ્યુટર પર ડાઉનલોડ કરો. તમે બધા શોટ મેળવવા માટે મારું શોટ્સ બટન પર ક્લિક કરી પણ શકો છો બધા શોટ તમે લીધેલા શોધવા માટે." + }, + "tourHeaderFour": { + "message": "વિન્ડોઝ અથવા સમગ્ર પાના કેદ કરો" + }, + "tourBodyFour": { + "message": "ઉપર જમણા બટનો પસંદ કરો વિન્ડોમાં દૃશ્યમાન વિસ્તાર મેળવવા માટે અથવા આખુ પાનું કેપ્ચર કરવા માટે." + }, + "tourSkip": { + "message": "છોડવા" + }, + "tourNext": { + "message": "આગલી સ્લાઇડ" + }, + "tourPrevious": { + "message": "પહેલાની સ્લાઇડ" + }, + "tourDone": { + "message": "થઈ ગયું" + }, + "termsAndPrivacyNotice": { + "message": "Firefox સ્ક્રીનશોટ્સ વાપરીને, તમે સ્ક્રીનશૉટ્સ થી સંમત છો $TERMSANDPRIVACYNOTICETERMSLINK$ અને $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "શરતો" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "ખાનગી સૂચના" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/he/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/he/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/he/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/he/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,94 @@ +{ + "addonDescription": { + "message": "יצירת צילומי מסך של דפי אינטרנט ושמירה שלהם באופן זמני או קבוע." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "צילום מסך" + }, + "myShotsLink": { + "message": "צילומי המסך שלי" + }, + "screenshotInstructions": { + "message": "נא לגרור או ללחוץ על הדף כדי לבחור תחום או על ESC לביטול." + }, + "saveScreenshotSelectedArea": { + "message": "שמירה" + }, + "saveScreenshotVisibleArea": { + "message": "שמירת התחום המוצג" + }, + "saveScreenshotFullPage": { + "message": "שמירת הדף במלואו" + }, + "cancelScreenshot": { + "message": "ביטול" + }, + "downloadScreenshot": { + "message": "הורדה" + }, + "notificationLinkCopiedTitle": { + "message": "הקישור הועתק" + }, + "notificationLinkCopiedDetails": { + "message": "הקישור לתמונה שלך הועתק ללוח. נא ללחוץ על $META_KEY$-V כדי להדביק.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "לא תקין." + }, + "requestErrorDetails": { + "message": "אנו מצטערים, אך לא ניתן היה לשמור את התמונה. נא לנסות שוב מאוחר יותר." + }, + "connectionErrorTitle": { + "message": "לא ניתן היה להתחבר אל מאגר צילומי המסך שלך." + }, + "connectionErrorDetails": { + "message": "נא לבדוק את החיבור לאינטרנט. אם הצלחת להתחבר לאינטרנט כנראה שקיימת תקלה זמנית עם שירות Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "אין אפשרות לשמור את צילום המסך שלך כיוון שישנה תקלה עם שירות Firefox Screenshots. נא לנסות שוב מאוחר יותר." + }, + "unshootablePageErrorTitle": { + "message": "לא ניתן לצלם דף זה." + }, + "unshootablePageErrorDetails": { + "message": "דף זה אינו דף אינטרנט תקני, ולכן לא ניתן היה לצלם אותו." + }, + "selfScreenshotErrorTitle": { + "message": "לא ניתן לצלם את הדף של Firefox Screenshot עצמו!" + }, + "genericErrorTitle": { + "message": "אויש! Firefox Screenshots ירד מהפסים." + }, + "genericErrorDetails": { + "message": "אנחנו לא בטוחים מה קרה פה הרגע. אכפת לך לנסות שוב או לצלם דף אחר?" + }, + "tourBodyOne": { + "message": "צילום, שמירה ושיתוף של צילומי מסך מבלי לעזוב את Firefox." + }, + "tourHeaderTwo": { + "message": "לצלם רק את מה שנחוץ לך" + }, + "tourBodyTwo": { + "message": "ניתן ללחוץ ולגרור כדי לצלם רק מקטע מהעמוד. ניתן גם לרחף מעל כדי לסמן את הבחירה שלך." + }, + "tourHeaderThree": { + "message": "לפי טעמך" + }, + "tourBodyThree": { + "message": "שמירת הצילומים החתוכים שלך לאחסון מקוון לצורך שיתוף פשוט יותר, או להוריד אותם למחשב שלך. ניתן גם ללחוץ על כפתור הצילומים שלי כדי למצוא את כל הצילומים שצילמת." + }, + "tourHeaderFour": { + "message": "לצלם חלונות או דפים שלמים" + }, + "tourBodyFour": { + "message": "נא לבחור בכפתורים שבחלק העליון כדי לצלם את האזור הגלוי בחלון או לצלם את הדף כולו." + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/hsb/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/hsb/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/hsb/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/hsb/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Wzmiće klipy a fota wobrazowki z weba a składujće je nachwilu abo na přeco." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Foto wobrazowki činić" + }, + "myShotsLink": { + "message": "Moje fota wobrazowki" + }, + "screenshotInstructions": { + "message": "Ćehńće abo klikńće na stronu, zo byšće wobwod wubrał. Tłóčće na ESC, zo byšće přetorhnył." + }, + "saveScreenshotSelectedArea": { + "message": "Składować" + }, + "saveScreenshotVisibleArea": { + "message": "Widźomny wobwod składować" + }, + "saveScreenshotFullPage": { + "message": "Cyłu stronu składować" + }, + "cancelScreenshot": { + "message": "Přetorhnyć" + }, + "downloadScreenshot": { + "message": "Sćahnyć" + }, + "notificationLinkCopiedTitle": { + "message": "Wotkaz kopěrowany" + }, + "notificationLinkCopiedDetails": { + "message": "Wotkaz k wašemu fotu wobrazowki je so do mjezyskłada kopěrował. Tłóčće $META_KEY$-V, zo byšće jón zasadźił.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Skóncowany." + }, + "requestErrorDetails": { + "message": "Bohužel njemóžachmy waše foto wobrazowki składować. Prošu spytajće pozdźišo hišće raz." + }, + "connectionErrorTitle": { + "message": "Njemóžemy z wašimi fotami wobrazowki zwjazać." + }, + "connectionErrorDetails": { + "message": "Prošu přepruwujće swój internetny zwisk. Jeli móžeće z internetom zwjazać, je snano nachwilny problem ze słužbu Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Njemóžachmy swoje foto wobrazowki składować, dokelž je problem ze słužbu Firefox Screenshots. Prošu spytajće pozdźišo hišće raz." + }, + "unshootablePageErrorTitle": { + "message": "Foto wobrazowki tuteje strony móžne njeje." + }, + "unshootablePageErrorDetails": { + "message": "To standardna webstrona njeje, tohodla foto wobrazowki wot njeje móžne njeje." + }, + "selfScreenshotErrorTitle": { + "message": "Njemóžeće wobrazowku strony Firefox Screenshots fotografować!" + }, + "genericErrorTitle": { + "message": "Hopla! Firefox Screenshots njefunguje." + }, + "genericErrorDetails": { + "message": "Njejsmy sej wěsći, štož je so stało. Chceće hišće raz spytać abo chceće druhu stronu fotografować?" + }, + "tourBodyOne": { + "message": "Čińće, składujće a dźělće fota wobrazowki bjez toho, zo byšće Firefox wopušćił." + }, + "tourHeaderTwo": { + "message": "Fotografujće prosće, štož chceće" + }, + "tourBodyTwo": { + "message": "Klikńće a ćehńće, zo byšće dźěl strony fotografował. Móžeće tež pokazowak myški nad nim pohibować, zo byšće swój wuběr wuzběhnył." + }, + "tourHeaderThree": { + "message": "Tak, kaž so wam spodoba" + }, + "tourBodyThree": { + "message": "Składujće swoje přitřihane fota wobrazowki w interneće, zo byšće je lóšo dźělił, abo sćehńće je na swój ličak. Móžeće tež na tłóčatko „Moje fota wobrazowki“ kliknyć, zo byšće wšě fota wobrazowki namakał, kotrež sće činił." + }, + "tourHeaderFour": { + "message": "Wokna abo cyłe strony składować" + }, + "tourBodyFour": { + "message": "Wubjerće tłóčatka horjeka naprawo, zo byšće widźomny wobwod we woknje abo cyłu stronu fotografować." + }, + "tourSkip": { + "message": "Přeskočić" + }, + "tourNext": { + "message": "Přichodne foto" + }, + "tourPrevious": { + "message": "Předchadne foto" + }, + "tourDone": { + "message": "Hotowo" + }, + "termsAndPrivacyNotice": { + "message": "Přez wužiwanje Firefox ScreenShots, zwoliće do $TERMSANDPRIVACYNOTICETERMSLINK$ a $TERMSANDPRIVACYNOTICEPRIVACYLINK$ Firefox Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Wuměnjenja" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Pokaz priwatnosće" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/hu/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/hu/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/hu/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/hu/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Készítsen videoklipeket és képernyőképeket a webről, és mentse őket ideiglenesen vagy véglegesen." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Készítsen képernyőképet" + }, + "myShotsLink": { + "message": "Az Ön képei" + }, + "screenshotInstructions": { + "message": "Húzza, vagy kattintson a lapra a terület kiválasztásához. Nyomjon ESC-t a megszakításhoz." + }, + "saveScreenshotSelectedArea": { + "message": "Mentés" + }, + "saveScreenshotVisibleArea": { + "message": "Láthatóak mentése" + }, + "saveScreenshotFullPage": { + "message": "Teljes oldal mentése" + }, + "cancelScreenshot": { + "message": "Mégse" + }, + "downloadScreenshot": { + "message": "Letöltés" + }, + "notificationLinkCopiedTitle": { + "message": "Hivatkozás másolva" + }, + "notificationLinkCopiedDetails": { + "message": "A képernyőképre mutató hivatkozás a vágólapra lett másolva. Nyomjon $META_KEY$-V-t a beillesztéshez.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Nem működik." + }, + "requestErrorDetails": { + "message": "Bocsánat! Nem tudtuk menteni a képet. Próbálkozzon később." + }, + "connectionErrorTitle": { + "message": "Nem tudunk kapcsolódni a képernyőképekhez." + }, + "connectionErrorDetails": { + "message": "Ellenőrizze az internetkapcsolatot. Ha tud kapcsolódni az internetre, akkor lehet, hogy ideiglenes probléma van a Firefox képernyőképek szolgáltatással." + }, + "loginErrorDetails": { + "message": "Nem tudtuk elmenteni a képét, mert probléma lépett fel a Firefox képernyőképek szolgáltatással. Próbálja újra később." + }, + "unshootablePageErrorTitle": { + "message": "Nem lehet képet készíteni erről a lapról." + }, + "unshootablePageErrorDetails": { + "message": "Ez egy nem szabványos weblap, így nem készíthet róla képernyőképet." + }, + "selfScreenshotErrorTitle": { + "message": "Nem készíthet képet a Firefox képernyőképek oldalról!" + }, + "genericErrorTitle": { + "message": "Húha! A Firefox képernyőképek megkergült." + }, + "genericErrorDetails": { + "message": "Nem vagyunk benne biztosak, hogy mi történt. Próbálja újra, vagy készítsen képet egy másik oldalról." + }, + "tourBodyOne": { + "message": "Készítsen, mentsen és osszon meg képernyőképeket, anélkül, hogy elhagyná a Firefoxot." + }, + "tourHeaderTwo": { + "message": "Csak azt mentse, amit szeretne" + }, + "tourBodyTwo": { + "message": "Kattintson és húzzon, hogy csak a lap egy részét mentse el. Vagy csak rá is mutathat a kijelöléshez." + }, + "tourHeaderThree": { + "message": "Ahogy tetszik" + }, + "tourBodyThree": { + "message": "Mentse a kivágott képeket a webre a könnyebb megosztáshoz, vagy töltse le a számítógépére. Rá is kattinthat a Képernyőképek gombra, hogy megtalálja az összes képét." + }, + "tourHeaderFour": { + "message": "Mentsen ablakokat vagy teljes lapokat" + }, + "tourBodyFour": { + "message": "Válassza a jobb felső sarokban lévő gombokat, hogy egy látható területet mentsen az ablakból, vagy elmentsen egy teljes oldalt." + }, + "tourSkip": { + "message": "Kihagyás" + }, + "tourNext": { + "message": "Következő dia" + }, + "tourPrevious": { + "message": "Előző dia" + }, + "tourDone": { + "message": "Kész" + }, + "termsAndPrivacyNotice": { + "message": "A Firefox képernyőképek használatával, Ön beleegyezik a képernyőképek $TERMSANDPRIVACYNOTICETERMSLINK$ és $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Feltételeibe" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Adatvédelmi nyilatkozatába" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/hy_AM/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/hy_AM/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/hy_AM/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/hy_AM/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,106 @@ +{ + "addonDescription": { + "message": "Ստացեք հոլովակներ և էկրանի հանույթներ վեբից և պահպանեք դանք ժամանակավոր կամ մշտապես:" + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Ստանալ էկրանի պատկերը" + }, + "myShotsLink": { + "message": "Իմ պատկերները" + }, + "screenshotInstructions": { + "message": "Քաշեք և սեղմեք էջի վրա՝ ընտրելու տարածքը: Սեղմեք ESC՝ չեղարկելու համար:" + }, + "saveScreenshotSelectedArea": { + "message": "Պահպանել" + }, + "saveScreenshotVisibleArea": { + "message": "Պահպանելի տեսանելի" + }, + "saveScreenshotFullPage": { + "message": "Պահպանել ամբողջ էջը" + }, + "cancelScreenshot": { + "message": "Չեղարկել" + }, + "downloadScreenshot": { + "message": "Ներբեռնել" + }, + "notificationLinkCopiedTitle": { + "message": "Հղումը պատճենվել է" + }, + "notificationLinkCopiedDetails": { + "message": "Ձեր պատկերի հղումը պատճենվել է: Սեղմեք $META_KEY$-V՝ այն տեղադրելու համար:", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Անսարք:" + }, + "requestErrorDetails": { + "message": "Ցավոք մենք չենք կարող պահպանել պատկեր: Կրկին փորձեք ավելի ուշ:" + }, + "connectionErrorTitle": { + "message": "Հնարավոր չէ ապակցել էկրանի ձեր հանույթներին:" + }, + "connectionErrorDetails": { + "message": "Խնդրում ենք ստուգել համացանցային կապակցումը: Եթե մուտք չունեք համացանց՝ հնարավոր է՝ դա Firefox Screenshots ծառայության հետ կապված ժամանակավոր խնդիր է:" + }, + "loginErrorDetails": { + "message": "Մենք չենք կարող պահպանել ձեր պատկերը, քանի որ խնդիր կա Firefox Screenshots ծառայության հետ: Փորձեք ավելի ուշ:" + }, + "unshootablePageErrorTitle": { + "message": "Հնարավոր չէ ստանալ էկրանի պատկերը:" + }, + "unshootablePageErrorDetails": { + "message": "Սա ստանդարտ վեբ էջ չէ, ուստի դուք չեք կարող ստանալ դրա պատկերը:" + }, + "selfScreenshotErrorTitle": { + "message": "Դուք չեք կարող ստանալ Firefox Screenshots-ի էջի պատկերը:" + }, + "genericErrorTitle": { + "message": "Firefox Screenshots-ը գնաց գլխիվայր:" + }, + "genericErrorDetails": { + "message": "Մենք վստահ չենք, թե ինչ է տեղի ունեցնել: Կրկին փորձեք կամ փորձեք ստանալ մեկ այլ էջի պատկերը:" + }, + "tourBodyOne": { + "message": "Ստացեք, պահպանեք և համօգտագործեք էկրանի հանույթները՝ առանց Firefox-ը լքելու: " + }, + "tourHeaderTwo": { + "message": "Ստացեք միայն այն, ինչ Ձեզ պետք է:" + }, + "tourBodyTwo": { + "message": "Սեղմեք և քաշեք՝ ստանալու համար միայն էջի մի մասը: Նաև կարող եք վրայով անցկացնել՝ գունանշելու համար ընտրումը:" + }, + "tourHeaderThree": { + "message": "Ինչպես որ հավանում եք այն" + }, + "tourBodyThree": { + "message": "Պահպանեք ձեր եզրատած որոշ պատկերներ վեբում՝ դրանք հեշտությամբ համօգտագործելու կամ ներբեռնելու համար ձեր համակարգչում: Նաև կարող եք սեղմել Իմ պատկերները՝ գտնելու ձեր բոլոր ֆայլերը:" + }, + "tourHeaderFour": { + "message": "Ստանալ պատուհանը կամ ամբողջ էջեր" + }, + "tourBodyFour": { + "message": "Ընտրեք կոճակները վերևի աջ մասում՝ տեսանելի հատվածը ստանալու համար պատուհանում կամ ամբողջ էջը ստանալու համար:" + }, + "tourSkip": { + "message": "Բաց թողնել" + }, + "tourNext": { + "message": "Հաջորդ սահիկը" + }, + "tourPrevious": { + "message": "Նախորդ սահիկը" + }, + "tourDone": { + "message": "Պատրաստ է" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/id/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/id/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/id/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/id/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Rekam klip dan tangkapan layar dari Web dan simpan untuk sementara atau secara permanen." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Buat Tangkapan layar" + }, + "myShotsLink": { + "message": "Gambar Saya" + }, + "screenshotInstructions": { + "message": "Seret atau klik pada laman untuk memilih area. Tekan ESC untuk membatalkan." + }, + "saveScreenshotSelectedArea": { + "message": "Simpan" + }, + "saveScreenshotVisibleArea": { + "message": "Simpan yang terlihat" + }, + "saveScreenshotFullPage": { + "message": "Simpan laman sepenuhnya" + }, + "cancelScreenshot": { + "message": "Batal" + }, + "downloadScreenshot": { + "message": "Unduh" + }, + "notificationLinkCopiedTitle": { + "message": "Tautan Disalin" + }, + "notificationLinkCopiedDetails": { + "message": "Tautan ke gambar Anda telah disalin ke papan klip. Tekan $META_KEY$-V untuk menempelkan.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Tak dapat digunakan." + }, + "requestErrorDetails": { + "message": "Maaf! Kami tidak dapat menyimpan gambar Anda. Silakan coba lagi." + }, + "connectionErrorTitle": { + "message": "Kami tidak dapat terhubung dengan tangkapan layar Anda." + }, + "connectionErrorDetails": { + "message": "Silakan periksa sambungan Internet Anda. Jika Anda dapat tersambung ke Internet, mungkin terjadi masalah sementara pada layanan Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Kami tidak dapat menyimpan gambar Anda karena ada masalah dengan layanan Firefox Screenshots. Silakan coba kembali nanti." + }, + "unshootablePageErrorTitle": { + "message": "Kami tidak dapat menangkap layar laman ini." + }, + "unshootablePageErrorDetails": { + "message": "Ini bukan laman Web yang standar, sehingga Anda tidak dapat membuat tangkapan dari layar ini." + }, + "selfScreenshotErrorTitle": { + "message": "Anda tidak dapat merekam gambar dari laman Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Wah! Firefox Screenshots mendadak kacau." + }, + "genericErrorDetails": { + "message": "Kami tidak yakin akan apa yang terjadi. Ingin mencoba lagi atau merekam gambar dari laman yang berbeda?" + }, + "tourBodyOne": { + "message": "Ambil, simpan, dan bagikan tangkapan layar tanpa meninggalkan Firefox." + }, + "tourHeaderTwo": { + "message": "Rekam Bagian Yang Anda Inginkan" + }, + "tourBodyTwo": { + "message": "Klik dan seret untuk merekam sebagian area laman. Anda juga dapat menggeser kursor untuk menyoroti pilihan Anda." + }, + "tourHeaderThree": { + "message": "Sesuka Anda" + }, + "tourBodyThree": { + "message": "Simpan potongan tangkapan Anda ke Web agar mudah dibagikan, atau unduh ke komputer. Anda pun dapat mengeklik pada tombol Gambar Saya untuk menemukan semua tangkapan yang pernah Anda rekam." + }, + "tourHeaderFour": { + "message": "Rekam Jendela atau Seluruh Laman" + }, + "tourBodyFour": { + "message": "Pilih tombol di kanan atas untuk merekam area yang terlihat pada jendela atau rekam seluruh laman." + }, + "tourSkip": { + "message": "Lewati" + }, + "tourNext": { + "message": "Salindia Selanjutnya" + }, + "tourPrevious": { + "message": "Salindia Sebelumnya" + }, + "tourDone": { + "message": "Selesai" + }, + "termsAndPrivacyNotice": { + "message": "Dengan menggunakan Firefox Screenshots, Anda setuju dengan $TERMSANDPRIVACYNOTICETERMSLINK$ dan $TERMSANDPRIVACYNOTICEPRIVACYLINK$ Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Ketentuan" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Kebijakan Privasi" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/it/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/it/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/it/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/it/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Crea screenshot di contenuti sul Web e salvali, solo per un periodo di tempo o in modo permanente." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Cattura screenshot" + }, + "myShotsLink": { + "message": "I miei screenshot" + }, + "screenshotInstructions": { + "message": "Trascina o fai clic su una pagina per selezionare una regione. Premi ESC per annullare." + }, + "saveScreenshotSelectedArea": { + "message": "Salva" + }, + "saveScreenshotVisibleArea": { + "message": "Salva l’area visibile" + }, + "saveScreenshotFullPage": { + "message": "Salva l’intera schermata" + }, + "cancelScreenshot": { + "message": "Annulla" + }, + "downloadScreenshot": { + "message": "Scarica" + }, + "notificationLinkCopiedTitle": { + "message": "Link aggiunto agli appunti" + }, + "notificationLinkCopiedDetails": { + "message": "Il link all’immagine è stato copiato negli appunti. Utilizza $META_KEY$-V per incollarlo.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Fuori servizio" + }, + "requestErrorDetails": { + "message": "Siamo spiacenti, non è stato possibile salvare l’immagine. Riprova più tardi." + }, + "connectionErrorTitle": { + "message": "Non è possibile accedere agli screenshot salvati." + }, + "connectionErrorDetails": { + "message": "Verifica che la connessione a Internet stia funzionando correttamente. Se è possibile accedere ad altri siti, potrebbe trattarsi di un problema temporaneo con il servizio Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Non è stato possibile salvare l’immagine in quanto si è verificato un problema con il servizio Firefox Screenshots. Riprova più tardi." + }, + "unshootablePageErrorTitle": { + "message": "Non è possibile salvare uno screenshot di questa pagina." + }, + "unshootablePageErrorDetails": { + "message": "Non è possibile salvare uno screenshot in quanto non si tratta di una normale pagina web." + }, + "selfScreenshotErrorTitle": { + "message": "Non è possibile salvare uno screenshot di una pagina di Firefox Screenshots" + }, + "genericErrorTitle": { + "message": "Wow! Firefox Screenshots è andato in tilt" + }, + "genericErrorDetails": { + "message": "Non sappiamo che cosa sia successo. Riprova, magari con una pagina diversa." + }, + "tourBodyOne": { + "message": "Cattura, salva e condividi screenshot senza mai uscire da Firefox." + }, + "tourHeaderTwo": { + "message": "Cattura solo ciò che ti serve" + }, + "tourBodyTwo": { + "message": "Fai clic e trascina per catturare solo una parte della pagina. Posiziona il mouse sopra all’area selezionata per evidenziarla." + }, + "tourHeaderThree": { + "message": "Come piace a te" + }, + "tourBodyThree": { + "message": "Cattura lo screenshot di una pagina web, ritaglialo e salvalo online per condividerlo in modo più veloce, oppure scaricalo sul tuo computer. Puoi anche utilizzare il pulsante “I miei screenshot” per ritrovare tutte le immagini che hai salvato." + }, + "tourHeaderFour": { + "message": "Cattura una finestra o una pagina intera" + }, + "tourBodyFour": { + "message": "Utilizza i pulsanti in alto a destra per catturare una parte della finestra o l’intera pagina." + }, + "tourSkip": { + "message": "Ignora" + }, + "tourNext": { + "message": "Schermata successiva" + }, + "tourPrevious": { + "message": "Schermata precedente" + }, + "tourDone": { + "message": "Fine" + }, + "termsAndPrivacyNotice": { + "message": "Utilizzando Firefox Screenshots si accettano le $TERMSANDPRIVACYNOTICETERMSLINK$ e l’$TERMSANDPRIVACYNOTICEPRIVACYLINK$ del servizio.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "condizioni di utilizzo" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "informativa sulla privacy" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ja/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ja/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ja/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ja/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "ウェブからスクリーンショットを撮って、一時的または永久にそれを保存しましょう。" + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "スクリーンショットを撮る" + }, + "myShotsLink": { + "message": "自分のショット" + }, + "screenshotInstructions": { + "message": "ページをドラッグまたはクリックして範囲を選択してください。ESC キーを押すとキャンセルできます。" + }, + "saveScreenshotSelectedArea": { + "message": "保存" + }, + "saveScreenshotVisibleArea": { + "message": "表示範囲を保存" + }, + "saveScreenshotFullPage": { + "message": "ページ全体を保存" + }, + "cancelScreenshot": { + "message": "キャンセル" + }, + "downloadScreenshot": { + "message": "ダウンロード" + }, + "notificationLinkCopiedTitle": { + "message": "リンクをコピーしました" + }, + "notificationLinkCopiedDetails": { + "message": "ショットへのリンクがクリップボードにコピーされました。$META_KEY$+V キーで貼り付けられます。", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "問題が発生しました。" + }, + "requestErrorDetails": { + "message": "申し訳ありませんが、ショットを保存できませんでした。また後で試してください。" + }, + "connectionErrorTitle": { + "message": "スクリーンショットへ接続できません。" + }, + "connectionErrorDetails": { + "message": "お使いのインターネット接続を確認してください。インターネットへ接続できる場合は、Firefox Screenshots サービスに一時的な問題が発生しているものと思われます。" + }, + "loginErrorDetails": { + "message": "Firefox Screenshots サービスに問題があるため、ショットを保存できませんでした。また後で試してください。" + }, + "unshootablePageErrorTitle": { + "message": "このページはスクリーンショットを撮れません。" + }, + "unshootablePageErrorDetails": { + "message": "これは通常のウェブページでないため、スクリーンショットを撮ることができません。" + }, + "selfScreenshotErrorTitle": { + "message": "Firefox Screenshots ページのショットは撮れません。" + }, + "genericErrorTitle": { + "message": "Firefox Screenshots に問題が発生しました。" + }, + "genericErrorDetails": { + "message": "何か問題が発生したようです。再度試すか、別のページのショットを撮ってみてください。" + }, + "tourBodyOne": { + "message": "Firefox を離れることなく、スクリーンショットを撮影、保存、共有。" + }, + "tourHeaderTwo": { + "message": "必要なものだけをキャプチャー" + }, + "tourBodyTwo": { + "message": "クリック&ドラッグでページの一部だけをキャプチャーできます。また、マウスを当てれば選択範囲が強調表示されます。" + }, + "tourHeaderThree": { + "message": "お好きなように" + }, + "tourBodyThree": { + "message": "切り取ったショットを簡単に共有できるようウェブ上に保存したり、手元へダウンロードしたり。また「自分のショット」ボタンをクリックすれば、これまでに撮ったすべてのショットを見られます。" + }, + "tourHeaderFour": { + "message": "ウィンドウもしくはページ全体をキャプチャー" + }, + "tourBodyFour": { + "message": "右上のボタンを選択して、ウィンドウ内の表示範囲もしくはページ全体をキャプチャーしましょう。" + }, + "tourSkip": { + "message": "スキップ" + }, + "tourNext": { + "message": "次のスライド" + }, + "tourPrevious": { + "message": "前のスライド" + }, + "tourDone": { + "message": "完了" + }, + "termsAndPrivacyNotice": { + "message": "Firefox Screenshots を使うことで、あなたは Screenshots の $TERMSANDPRIVACYNOTICETERMSLINK$ と $TERMSANDPRIVACYNOTICEPRIVACYLINK$ に同意したことになります。", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "利用規約" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "プライバシー通知" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/kab/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/kab/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/kab/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/kab/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Ṭṭef imrayen akked igdilen si Web sakin sekles-iten s wudem askudan neɣ s wudem yezgan." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Ṭṭef agdil" + }, + "myShotsLink": { + "message": "Tuṭṭfiwin-iw" + }, + "screenshotInstructions": { + "message": "Zuγer sakin sit γef af usebter akken ad tferneḍ tamnaṭ. Senned γef ESC akken ad tesfesxeḍ." + }, + "saveScreenshotSelectedArea": { + "message": "Sekles" + }, + "saveScreenshotVisibleArea": { + "message": "Sekles ayen ibanen" + }, + "saveScreenshotFullPage": { + "message": "Sekles asebter meṛṛa" + }, + "cancelScreenshot": { + "message": "Sefsex" + }, + "downloadScreenshot": { + "message": "Sider" + }, + "notificationLinkCopiedTitle": { + "message": "Aseγwen yettwanγel" + }, + "notificationLinkCopiedDetails": { + "message": "Aseγwen ar tuṭṭfa-ik yettwanγel yef afus. Senned yef $META_KEY$-V akken ad tsenṭḍeḍ.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Yeffeγ i talast." + }, + "requestErrorDetails": { + "message": "Suref-aγ! Ur nezmir ara ad nsekles tuṭṭfa-ik. Ɛreḍ tikelt-nniḍen." + }, + "connectionErrorTitle": { + "message": "Ur nezmir ara ad neqqen ar tuṭṭfiwin-ik n ugdil." + }, + "connectionErrorDetails": { + "message": "Senqed tuqqna-ik Internet. Ma yella tzemred ad teqqneḍ ar Internet, ahat d ugur kan meẓẓiyen deg umeẓlu Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "UR nseklas ara tuṭṭfa-ik acku yella ugur akked umezlu Firefox Screenshots. Ma ulac aɣilif ɛreḍ tikelt-nniḍen." + }, + "unshootablePageErrorTitle": { + "message": "Ur nezmir ara ad neṭṭef agdil n usebter-agi." + }, + "unshootablePageErrorDetails": { + "message": "Mačči d asebter Web am iyaḍ, ur tizmireḍ ara ad s-teṭṭfeḍ agdil." + }, + "selfScreenshotErrorTitle": { + "message": "Ur tezmireḍ ar ad teṭṭfeḍ agdil n usebter Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Ihuh! Firefox Screenshots ur iteddu ara." + }, + "genericErrorDetails": { + "message": "Ur neẓri ara acu yeḍran. Ɛreḍ tikelt-nniḍen neɣ ṭṭef agdil n usebter-nniḍen?" + }, + "tourBodyOne": { + "message": "Ṭṭef, sekles, bḍu igdilen war ma teffɣeḍ si Firefox." + }, + "tourHeaderTwo": { + "message": "Ṭṭef kan ayen tebγiḍ" + }, + "tourBodyTwo": { + "message": "Sit sakin zuɣer akken ad teṭṭfeḍ aḥric seg usebter. Tzemreḍ daɣen ad tesrifgeḍ akken ad tsebṛuṛqeḍ afran-ik." + }, + "tourHeaderThree": { + "message": "Akken tebγiḍ" + }, + "tourBodyThree": { + "message": "Sekles tuṭṭfiwin-ik ar Web i beṭṭu fessusen, neɣ sider-itent-id ar uselkim-ik. Tzemr€d daɣen ad tiseḍ ɣef tqeffalt Tiṭṭfiwin-iw akken ad tafeḍ akk tuṭṭfiwin n ugdil i teggid." + }, + "tourHeaderFour": { + "message": "Ṭṭef isfuyla neγ isebtar meṛṛa" + }, + "tourBodyFour": { + "message": "Fren tiqeffalin s afella ayeffus akken ad teṭṭfeḍ tamnaṭ yettbanen deg usfaylu neɣ asebter i meṛṛa." + }, + "tourSkip": { + "message": "Zgel" + }, + "tourNext": { + "message": "Tigri n zdat" + }, + "tourPrevious": { + "message": "Tigri n deffir" + }, + "tourDone": { + "message": "Immed" + }, + "termsAndPrivacyNotice": { + "message": "S useqdec Firefox Screenshots, ad tqebleḍ $TERMSANDPRIVACYNOTICETERMSLINK$ n Screenshots akked $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Tiwtilin" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Tasertit n tbaḍnit" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/kk/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/kk/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/kk/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/kk/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,85 @@ +{ + "addonDescription": { + "message": "Интернеттен скриншоттарды түсіріп, оларды уақытша немесе тұрақты түрде сақтаңыз." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Скриншотты түсіру" + }, + "myShotsLink": { + "message": "Менің скриншоттарым" + }, + "screenshotInstructions": { + "message": "Аймақты таңдау үшін бетте шертіңіз. Бас тарту үшін ESC басыңыз." + }, + "saveScreenshotSelectedArea": { + "message": "Сақтау" + }, + "saveScreenshotVisibleArea": { + "message": "Көрінетінді сақтау" + }, + "saveScreenshotFullPage": { + "message": "Толық парақты сақтау" + }, + "cancelScreenshot": { + "message": "Бас тарту" + }, + "downloadScreenshot": { + "message": "Жүктеп алу" + }, + "notificationLinkCopiedTitle": { + "message": "Сілтеме көшірілді" + }, + "notificationLinkCopiedDetails": { + "message": "Сіздің скриншотыңызға сілтеме алмасу буферіне көшірілді. Кірістіру үшін $META_KEY$-V басыңыз.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Жұмыс істемейді." + }, + "requestErrorDetails": { + "message": "Кешіріңіз! Сіздің скриншотыңызды сақтай алмадық. Кейінірек қайталап көріңіз." + }, + "connectionErrorTitle": { + "message": "Скриншоттарыңызға байланыса алмадық." + }, + "unshootablePageErrorTitle": { + "message": "Бұл беттің скриншотын түсіре алмаймыз." + }, + "unshootablePageErrorDetails": { + "message": "Бұл қалыпты веб беті емес, сондықтан оның скриншотын түсіру мүмкін емес." + }, + "selfScreenshotErrorTitle": { + "message": "Firefox скриншоттары бетінің скриншотын түсіру мүмкін емес!" + }, + "genericErrorTitle": { + "message": "Қап! Firefox скриншоттары жасамай қалған сияқты." + }, + "tourBodyOne": { + "message": "Firefox ішінен скриншоттарды түсіру, сақтау және олармен бөлісу." + }, + "tourHeaderTwo": { + "message": "Тек керек нәрсені түсіріңіз" + }, + "tourHeaderThree": { + "message": "Өзіңізге керек түрде" + }, + "tourSkip": { + "message": "Аттап кету" + }, + "tourNext": { + "message": "Келесі слайд" + }, + "tourPrevious": { + "message": "Алдыңғы слайд" + }, + "tourDone": { + "message": "Дайын" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ko/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ko/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ko/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ko/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "웹 페이지를 찍거나 영상으로 만들어 임시로, 혹은 영구히 보관하세요." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "스크린샷 찍기" + }, + "myShotsLink": { + "message": "내 스크린샷" + }, + "screenshotInstructions": { + "message": "캡처 할 범위를 드래그하거나 클릭하세요. ESC를 누르면 취소됩니다." + }, + "saveScreenshotSelectedArea": { + "message": "저장" + }, + "saveScreenshotVisibleArea": { + "message": "보이는 내용 저장" + }, + "saveScreenshotFullPage": { + "message": "전체 페이지 저장" + }, + "cancelScreenshot": { + "message": "취소" + }, + "downloadScreenshot": { + "message": "다운로드" + }, + "notificationLinkCopiedTitle": { + "message": "링크 복사됨" + }, + "notificationLinkCopiedDetails": { + "message": "방금 찍은 스냅샷의 링크가 클립보드에 저장됐습니다. 붙여넣으려면 $META_KEY$-V를 누르세요.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "문제가 발생했습니다." + }, + "requestErrorDetails": { + "message": "죄송합니다. 스크린샷을 저장하지 못했습니다. 잠시 후에 다시 시도해주세요." + }, + "connectionErrorTitle": { + "message": "스크린샷에 접속할 수 없습니다." + }, + "connectionErrorDetails": { + "message": "인터넷 연결 상태를 확인해주세요. 만약 인터넷이 연결돼있다면, Firefox Screenshots 서비스에 잠깐 문제가 있을 수도 있습니다." + }, + "loginErrorDetails": { + "message": "Firefox Screenshots 서비스에 잠시 문제가 있어 저장에 실패했습니다. 잠시 후에 다시 시도해주세요." + }, + "unshootablePageErrorTitle": { + "message": "이 페이지를 캡처할 수 없습니다." + }, + "unshootablePageErrorDetails": { + "message": "표준 웹 페이지가 아니어서 스크린샷을 찍을 수 없습니다." + }, + "selfScreenshotErrorTitle": { + "message": "Firefox Screenshots 페이지는 캡처할 수 없어요!" + }, + "genericErrorTitle": { + "message": "와우! Firefox Screenshots이 망가졌네요." + }, + "genericErrorDetails": { + "message": "무슨 일이 있었는지 모르겠네요. 다시 시도하시거나 다른 페이지 스크린샷을 찍어 보시겠어요?" + }, + "tourBodyOne": { + "message": "Firefox를 떠나지 않은 채로 찍고, 저장하고, 공유하세요." + }, + "tourHeaderTwo": { + "message": "원하는 것을 캡춰하세요" + }, + "tourBodyTwo": { + "message": "캡춰할 페이지의 부분을 클릭해서 드래그 해 보세요. 마우스를 올려서 선택한 부분을 확인할 수 있습니다." + }, + "tourHeaderThree": { + "message": "내가 원하는 대로" + }, + "tourBodyThree": { + "message": "스크린샷을 공유하거나, 컴퓨터로 다운로드할 수도 있습니다. 내 스크린샷 버튼을 눌러서 지금까지 찍었던 모든 스크린샷을 찾을 수도 있습니다." + }, + "tourHeaderFour": { + "message": "창이나 페이지 전체를 캡춰할 수 있습니다" + }, + "tourBodyFour": { + "message": "우측 위에 있는 버튼을 눌러 창을 캡처하거나 페이지 전체를 캡처할 수 있습니다." + }, + "tourSkip": { + "message": "건너뛰기" + }, + "tourNext": { + "message": "다음 슬라이드" + }, + "tourPrevious": { + "message": "이전 슬라이드" + }, + "tourDone": { + "message": "완료" + }, + "termsAndPrivacyNotice": { + "message": "Firefox Screenshots를 사용하므로써, $TERMSANDPRIVACYNOTICETERMSLINK$와 $TERMSANDPRIVACYNOTICEPRIVACYLINK$에 동의하게 됩니다.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "이용약관" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "개인 정보 취급 방침" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/lij/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/lij/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/lij/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/lij/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,106 @@ +{ + "addonDescription": { + "message": "Fanni de föto do schermo da-o Web e sarvale in mòddo tenporaneo ò cin mòddo che restan." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Fanni 'na föto do schermo" + }, + "myShotsLink": { + "message": "E mæ föto do schermo" + }, + "screenshotInstructions": { + "message": "Rebela ò sciacca in sciâ pagina pe seleçionâ 'na region. Sciacca ESC pe anulâ." + }, + "saveScreenshotSelectedArea": { + "message": "Sarva" + }, + "saveScreenshotVisibleArea": { + "message": "Sarva o vixibile" + }, + "saveScreenshotFullPage": { + "message": "Sarva tutta a pagina" + }, + "cancelScreenshot": { + "message": "Anulla" + }, + "downloadScreenshot": { + "message": "Descarega" + }, + "notificationLinkCopiedTitle": { + "message": "Colegamento copiou inti aponti" + }, + "notificationLinkCopiedDetails": { + "message": "O colegamento a l'inmagine o l'é stæto copiou inti aponti. Sciacca$META_KEY$-V pe incolalo.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Feua serviçio." + }, + "requestErrorDetails": { + "message": "Ne spiaxe! No poemmo sarvâ l'inmagine. Pe piaxei preuva torna dòppo." + }, + "connectionErrorTitle": { + "message": "No poemmo conetise a-e teu föto do schermo." + }, + "connectionErrorDetails": { + "message": "Pe piaxei contròlla a teu conescion a l'Internet. Se ti riesci a conetite a l'Internet, ghe poeiva ese 'n problema tenporaneo co-o serviçio de Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "No poemmo sarvâ a teu inmagine perché gh'é 'n problema co-o serviçio de Firefox Screenshot. Pe piaxei preuva torna dòppo." + }, + "unshootablePageErrorTitle": { + "message": "No poemmo fâ 'na föto do schermo de sta pagina." + }, + "unshootablePageErrorDetails": { + "message": "Sta chi a no l'é 'na pagina Web standard, coscì no peu faghe 'na föto do schermo." + }, + "selfScreenshotErrorTitle": { + "message": "No ti peu fâ 'na föto do schermo a 'na pagina de Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Ahime mi! Firefox Screeshot o s'é ciantou." + }, + "genericErrorDetails": { + "message": "Niatri no emmo ben acapio cöse l'é sucesso. Ti peu miga preuvâ co-ina pagina dispægia?" + }, + "tourBodyOne": { + "message": "Fanni, sarva e condividdi föto do schermo sensa sciortî da Firefox." + }, + "tourHeaderTwo": { + "message": "Catua solo quello che t'eu" + }, + "tourBodyTwo": { + "message": "Sciacca e rebela pe catuâ solo 'na porçion de 'na pagina. Ti peu anche anâ co-o ratto sorvia l'area seleçionâ pe evidençiala." + }, + "tourHeaderThree": { + "message": "Comme te piaxe" + }, + "tourBodyThree": { + "message": "Sarva 'n ritaggio de 'na pagina Web pe condividila in mòddo ciù façile ò scaregala into teu computer. Ti peu anche sciacâ into pomello “E mæ föto do schermo pe atrovâ” quello che t'æ za pigiou." + }, + "tourHeaderFour": { + "message": "Catua 'n barcon ò 'na pagina intrega" + }, + "tourBodyFour": { + "message": "Seleçionn-a i pomelli de d'ato a drita pe catuâ l'area vixibile into barcon ò a pagina intrega." + }, + "tourSkip": { + "message": "Ignòra" + }, + "tourNext": { + "message": "Pròscima schermâ" + }, + "tourPrevious": { + "message": "Schermâ de primma" + }, + "tourDone": { + "message": "Fæto" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/lo/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/lo/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/lo/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/lo/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,38 @@ +{ + "addonAuthorsList": { + "message": "Mozilla " + }, + "saveScreenshotSelectedArea": { + "message": "ບັນທຶກ" + }, + "saveScreenshotVisibleArea": { + "message": "ບັນທຶກສ່ວນທີ່ເບິງເຫັນໄດ້" + }, + "saveScreenshotFullPage": { + "message": "ບັນທຶກຫມົດຫນ້າ" + }, + "cancelScreenshot": { + "message": "" + }, + "downloadScreenshot": { + "message": "ດາວໂຫລດ" + }, + "notificationLinkCopiedTitle": { + "message": "ໄດ້ສຳເນົາລີ້ງໄວ້ແລ້ວ" + }, + "unshootablePageErrorTitle": { + "message": "ພວກເຮົາບໍ່ສາມາດຖ່າຍຮູບຫນ້າຈໍຂອງຫນ້ານີ້ໄດ້." + }, + "tourSkip": { + "message": "ຂ້າມໄປ" + }, + "tourNext": { + "message": "ສະໄລດ໌ຕໍ່ໄປ" + }, + "tourPrevious": { + "message": "ສະໄລດ໌ກ່ອນຫນ້ານີ້" + }, + "tourDone": { + "message": "ສຳເລັດ" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/lt/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/lt/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/lt/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/lt/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Darykite iškarpas ir ekrano nuotraukos su interneto turiniu bei saugokite jas laikinai arba visąlaik." + }, + "addonAuthorsList": { + "message": "„Mozilla“ " + }, + "contextMenuLabel": { + "message": "Padaryti ekrano nuotrauką" + }, + "myShotsLink": { + "message": "Mano kadrai" + }, + "screenshotInstructions": { + "message": "Tempkite arba spustelėkite tinklalapyje norėdami pasirinkti regioną. Spustelėkite „ESC“ norėdami atsisakyti." + }, + "saveScreenshotSelectedArea": { + "message": "Įrašyti" + }, + "saveScreenshotVisibleArea": { + "message": "Įrašyti matomą" + }, + "saveScreenshotFullPage": { + "message": "Įrašyti visą tinklalapį" + }, + "cancelScreenshot": { + "message": "Atsisakyti" + }, + "downloadScreenshot": { + "message": "Atsisiųsti" + }, + "notificationLinkCopiedTitle": { + "message": "Saitas nukopijuotas" + }, + "notificationLinkCopiedDetails": { + "message": "Jūsų nuotraukos saitas buvo nukopijuotas į iškarpinę. Spustelėkite „$META_KEY$-V“ norėdami įdėti.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Neveikia." + }, + "requestErrorDetails": { + "message": "Atsiprašome! Mums nepavyko įrašyti jūsų nuotraukos. Prašome pabandyti vėliau." + }, + "connectionErrorTitle": { + "message": "Mums nepavyko prisijungti prie jūsų ekrano nuotraukų." + }, + "connectionErrorDetails": { + "message": "Patikrinkite savo interneto ryšį. Jeigu galite prisijungti prie interneto, gali būti, kad yra laikina problema su „Firefox Screenshots“ paslauga." + }, + "loginErrorDetails": { + "message": "Mums nepavyko įrašyti jūsų nuotraukos, nes yra problema su „Firefox Screenshots“ paslauga. Prašome pabandyti vėliau." + }, + "unshootablePageErrorTitle": { + "message": "Mums nepavyko nufotografuoti šio tinklalapio." + }, + "unshootablePageErrorDetails": { + "message": "Tai nėra įprastas tinklalapis, tad negalite padaryti jo nuotraukos." + }, + "selfScreenshotErrorTitle": { + "message": "Negalite padaryti „Firefox Screenshots“ tinklalapio nuotraukos!" + }, + "genericErrorTitle": { + "message": "Vau! „Firefox Screenshots“ sugedo." + }, + "genericErrorDetails": { + "message": "Mes nesame tikri, kas ką tik nutiko. Norite pabandyti dar kartą arba nufotografuoti kitą tinklalapį?" + }, + "tourBodyOne": { + "message": "Darykite, įrašykite ir dalinkitės ekrano nuotraukomis nepalikdami „Firefox“." + }, + "tourHeaderTwo": { + "message": "Užfiksuokite būtent tai, ką norite" + }, + "tourBodyTwo": { + "message": "Spustelėkite ir tempkite, kad užfiksuotumėte tik dalį tinklalapio. Taip pat galite užvesti pelę, norėdami paryškinti savo pasirinkimą." + }, + "tourHeaderThree": { + "message": "Kaip jums patogiau" + }, + "tourBodyThree": { + "message": "Įrašykite padarytas nuotraukas saityne patogesniam dalinimuisi, arba atsisiųskite jas į savo kompiuterį. Spustelėję mygtuką „Mano kadrai“, matysite visas savo padarytas nuotraukas." + }, + "tourHeaderFour": { + "message": "Fiksuokite langus arba ištisus tinklalapius" + }, + "tourBodyFour": { + "message": "Pasirinkite mygtukus aukščiau dešinėje, norėdami užfiksuoti matomą lango dalį arba visą tinklalapį." + }, + "tourSkip": { + "message": "SKIP" + }, + "tourNext": { + "message": "Kita skaidrė" + }, + "tourPrevious": { + "message": "Buvusi skaidrė" + }, + "tourDone": { + "message": "Baigta" + }, + "termsAndPrivacyNotice": { + "message": "Naudodamiesi „Firefox Screenshots“, sutinkate su jų $TERMSANDPRIVACYNOTICETERMSLINK$ ir $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "sąlygomis" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "privatumo nuostatais" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ms/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ms/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ms/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ms/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,106 @@ +{ + "addonDescription": { + "message": "Ambil klip dan skrinshot dari Web dan simpan untuk sementara waktu atau kekal." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Ambil skrinshot" + }, + "myShotsLink": { + "message": "Shot Saya" + }, + "screenshotInstructions": { + "message": "Seret atau klik pada halaman untuk memilih kawasan. Tekan ESC untuk batalkan." + }, + "saveScreenshotSelectedArea": { + "message": "Simpan" + }, + "saveScreenshotVisibleArea": { + "message": "Simpan yang terpapar" + }, + "saveScreenshotFullPage": { + "message": "Simpan halaman penuh" + }, + "cancelScreenshot": { + "message": "Batal" + }, + "downloadScreenshot": { + "message": "Muat turun" + }, + "notificationLinkCopiedTitle": { + "message": "Pautan Disalin" + }, + "notificationLinkCopiedDetails": { + "message": "Pautan ke shot anda telah disalin ke klipbod. Tekan $META_KEY$-V untuk tampal.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Tidak berfungsi." + }, + "requestErrorDetails": { + "message": "Maaf! Kita tidak dapat menyimpan shot anda. Sila cuba lagi nanti." + }, + "connectionErrorTitle": { + "message": "Kami tidak dapat menyambungkan ke skrinshot anda." + }, + "connectionErrorDetails": { + "message": "Sila semak sambungan Internet anda. Jika anda boleh dapat sambungan ke Internet, mungkin ada masalah sementara dengan perkhidmatan screenshot di Firefox." + }, + "loginErrorDetails": { + "message": "Kita tidak dapat menyimpan skrinshot anda kerana ada masalah dengan perkhidmatan skrinshot di Firefox. Sila cuba lagi nanti." + }, + "unshootablePageErrorTitle": { + "message": "Halaman ini tidak boleh diskrinshot." + }, + "unshootablePageErrorDetails": { + "message": "Ini bukan halaman Web piawai, jadi anda tidak boleh membuat skrinshot." + }, + "selfScreenshotErrorTitle": { + "message": "Anda tidak boleh mengambil gambar halaman Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Oh tidak! Firefox Screenshot tidak berfungsi dengan betul." + }, + "genericErrorDetails": { + "message": "Kami tidak pasti apa yang baru berlaku. Anda mahu cuba lagi atau mengambil gambar halaman lain?" + }, + "tourBodyOne": { + "message": "Ambil, simpan, dan kongsi screenshot tanpa meninggalkan pelayar Firefox." + }, + "tourHeaderTwo": { + "message": "Ambil gambar hanya yang anda mahu" + }, + "tourBodyTwo": { + "message": "Klik dan seret untuk mengambil gambar sebahagian daripada halaman. Anda boleh juga serlahkan pilihan anda." + }, + "tourHeaderThree": { + "message": "Seperti Yang Anda Suka" + }, + "tourBodyThree": { + "message": "Simpan rakaman yang dipotong ke Web, cara yang lebih mudah untuk berkongsi, atau memuatturunnya ke komputer anda. Anda juga boleh klik pada butang Shot Saya untuk mencari semua rakaman yang telah diambil." + }, + "tourHeaderFour": { + "message": "Tangkap Tetingkap atau Keseluruhan Halaman" + }, + "tourBodyFour": { + "message": "Pilih butang di bahagian atas kanan untuk merakam kawasan paparan dalam tetingkap atau untuk merakamkan keseluruhan halaman." + }, + "tourSkip": { + "message": "Langkau" + }, + "tourNext": { + "message": "Slaid Seterusnya" + }, + "tourPrevious": { + "message": "Slaid Sebelumnya" + }, + "tourDone": { + "message": "Selesai" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/nb_NO/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/nb_NO/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/nb_NO/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/nb_NO/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Ta klipp og skjermbilder fra nettet og lagre de midlertidig eller permanent." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Ta et skjermbilde" + }, + "myShotsLink": { + "message": "Mine skjermbilder" + }, + "screenshotInstructions": { + "message": "Dra eller klikk på siden for å velge en region. Trykk på ESC for å avbryte." + }, + "saveScreenshotSelectedArea": { + "message": "Lagre" + }, + "saveScreenshotVisibleArea": { + "message": "Lagre synlig område" + }, + "saveScreenshotFullPage": { + "message": "Lagre hele siden" + }, + "cancelScreenshot": { + "message": "Avbryt" + }, + "downloadScreenshot": { + "message": "Last ned" + }, + "notificationLinkCopiedTitle": { + "message": "Lenke kopiert" + }, + "notificationLinkCopiedDetails": { + "message": "Lenken til skjermbildet ditt er kopiert til utklippstavlen. Trykk på $META_KEY$-V for å lime inn.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "I ustand." + }, + "requestErrorDetails": { + "message": "Beklager! Vi klarte ikke å lagre skjermbildet ditt. Prøv igjen senere." + }, + "connectionErrorTitle": { + "message": "Vi kan ikke koble til dine skjermbilder." + }, + "connectionErrorDetails": { + "message": "Kontroller din internett-tilkopling. Om du kan koble til internett, kan det være et midlertidig problem med tjenesten Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Vi klarte ikke å lagre skjermbildet ditt, fordi det er et problem med tjenesten Firefox Screenshots. Prøv igjen senere." + }, + "unshootablePageErrorTitle": { + "message": "Vi kan ikke ta skjermbilde av siden." + }, + "unshootablePageErrorDetails": { + "message": "Dette er ikke en vanlig nettside, og du kan ikke ta skjermbilde av den." + }, + "selfScreenshotErrorTitle": { + "message": "Du kan ikke ta skjermbilde av siden Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Oi! Det ser ut til at Firefox Screenshots ikke fungerer korrekt." + }, + "genericErrorDetails": { + "message": "Vi er ikke sikre på hva som hendte. Kan du prøve igjen eller ta et bilde av en annen side?" + }, + "tourBodyOne": { + "message": "Ta, lagre og del skjermbilder uten å forlate Firefox." + }, + "tourHeaderTwo": { + "message": "Ta bilde av akkurat hva du vil" + }, + "tourBodyTwo": { + "message": "Klikk for å dra og ta skjermbilde av bare en del av siden. Du kan også føre musen over for å framheve merket område." + }, + "tourHeaderThree": { + "message": "Som du vil ha det" + }, + "tourBodyThree": { + "message": "Lagre de beskjærte skjermbildene dine på nettet for enklere deling, eller last de ned til din datamaskin. Du kan også klikke på knappen Mine skjermbilde for å finne alle skjermbildene du har tatt." + }, + "tourHeaderFour": { + "message": "Ta skjermbilde av vinduer eller hele sider." + }, + "tourBodyFour": { + "message": "Bruk knappene i det øvre høyre hjørnet for å ta skjermbilde av det synlige området i vinduet eller for å ta skjermbilde av en hel side." + }, + "tourSkip": { + "message": "Hopp over" + }, + "tourNext": { + "message": "Neste slide" + }, + "tourPrevious": { + "message": "Forrige slide" + }, + "tourDone": { + "message": "Ferdig" + }, + "termsAndPrivacyNotice": { + "message": "Ved å bruke Firefox Screenshots, godtar du $TERMSANDPRIVACYNOTICETERMSLINK$ og $TERMSANDPRIVACYNOTICEPRIVACYLINK$ for Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "vilkår" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "personvernbestemmelser" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/nl/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/nl/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/nl/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/nl/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Maak clips en schermafbeeldingen van het web en sla deze tijdelijk of permanent op." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Een schermafbeelding maken" + }, + "myShotsLink": { + "message": "Mijn afbeeldingen" + }, + "screenshotInstructions": { + "message": "Sleep of klik op de pagina om een gebied te selecteren. Druk op ESC om te annuleren." + }, + "saveScreenshotSelectedArea": { + "message": "Opslaan" + }, + "saveScreenshotVisibleArea": { + "message": "Zichtbaar gebied opslaan" + }, + "saveScreenshotFullPage": { + "message": "Volledige pagina opslaan" + }, + "cancelScreenshot": { + "message": "Annuleren" + }, + "downloadScreenshot": { + "message": "Downloaden" + }, + "notificationLinkCopiedTitle": { + "message": "Koppeling gekopieerd" + }, + "notificationLinkCopiedDetails": { + "message": "De koppeling naar uw afbeelding is naar het klembord gekopieerd. Druk op $META_KEY$-V om te plakken.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Buiten werking." + }, + "requestErrorDetails": { + "message": "Sorry! Uw afbeelding kon niet worden opgeslagen. Probeer het later opnieuw." + }, + "connectionErrorTitle": { + "message": "We kunnen geen verbinding met uw schermafdrukken maken." + }, + "connectionErrorDetails": { + "message": "Controleer uw internetverbinding. Als u verbinding met het internet kunt maken, kan er sprake zijn van een tijdelijk probleem met de Firefox Screenshots-service." + }, + "loginErrorDetails": { + "message": "Uw afbeelding kon niet worden opgeslagen, omdat er een probleem is met de Firefox Screenshots-service. Probeer het later opnieuw." + }, + "unshootablePageErrorTitle": { + "message": "Van deze pagina kan geen schermafbeelding worden gemaakt." + }, + "unshootablePageErrorDetails": { + "message": "Dit is geen standaardwebpagina, dus u kunt er geen schermafbeelding van maken." + }, + "selfScreenshotErrorTitle": { + "message": "U kunt geen afbeelding van een Firefox Screenshots-pagina maken!" + }, + "genericErrorTitle": { + "message": "Ho! Er is iets mis met Firefox Screenshots." + }, + "genericErrorDetails": { + "message": "We weten niet precies wat er zonet is gebeurd. Wilt u het nogmaals proberen of een schermafbeelding van een andere pagina maken?" + }, + "tourBodyOne": { + "message": "Maak, bewaar en deel schermafbeeldingen zonder Firefox te verlaten." + }, + "tourHeaderTwo": { + "message": "Leg alleen vast wat u wilt" + }, + "tourBodyTwo": { + "message": "Klik en sleep om alleen een gedeelte van een pagina vast te leggen. U kunt ook de muisaanwijzer boven een gebied houden om uw selectie te accentueren." + }, + "tourHeaderThree": { + "message": "Zoals u wilt" + }, + "tourBodyThree": { + "message": "Sla uw bijgesneden afbeeldingen op op het web voor makkelijker delen, of download ze naar uw computer. U kunt ook op de knop Mijn afbeeldingen klikken om al uw gemaakte afbeeldingen te vinden." + }, + "tourHeaderFour": { + "message": "Leg vensters of hele pagina’s vast" + }, + "tourBodyFour": { + "message": "Selecteer de knoppen rechtsboven om het zichtbare gebied in het venster vast te leggen, of om een hele pagina vast te leggen." + }, + "tourSkip": { + "message": "Overslaan" + }, + "tourNext": { + "message": "Volgende slide" + }, + "tourPrevious": { + "message": "Vorige slide" + }, + "tourDone": { + "message": "Gereed" + }, + "termsAndPrivacyNotice": { + "message": "Door Firefox Screenshots te gebruiken, gaat u akkoord met de $TERMSANDPRIVACYNOTICETERMSLINK$ en $TERMSANDPRIVACYNOTICEPRIVACYLINK$ van Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Voorwaarden" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Privacyverklaring" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/nn_NO/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/nn_NO/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/nn_NO/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/nn_NO/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Ta klipp og skjermbilde frå nettet og lagre dei mellombels eller permanent." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Ta eit skjermbilde" + }, + "myShotsLink": { + "message": "Mine skjermbilde" + }, + "screenshotInstructions": { + "message": "Drag eller klikk på sida for å velje ein region. Trykk på ESC for å avbryte." + }, + "saveScreenshotSelectedArea": { + "message": "Lagre" + }, + "saveScreenshotVisibleArea": { + "message": "Lagre synleg område" + }, + "saveScreenshotFullPage": { + "message": "Lagre heile sida" + }, + "cancelScreenshot": { + "message": "Avbryt" + }, + "downloadScreenshot": { + "message": "Last ned" + }, + "notificationLinkCopiedTitle": { + "message": "Lenke kopiert" + }, + "notificationLinkCopiedDetails": { + "message": "Lenka til skjermbildet ditt er kopiert til utklipp. Trykk på $META_KEY$-V for å lime inn.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "I ustand." + }, + "requestErrorDetails": { + "message": "Beklagar! Vi klarte ikkje å lagre skjermbiildet ditt. Prøv igjen seinare." + }, + "connectionErrorTitle": { + "message": "Vi kan ikkje kople til skjermbilda dine." + }, + "connectionErrorDetails": { + "message": "Kontroller internett-tilkoplinga di. Om du kan kople til internett, kan det vere eit mellombels problem med tenesta Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Vi klarte ikkje å lagre skjermbildet ditt, fordi det er eit problem med tenesta Firefox Screenshots. Prøv igjen seinare." + }, + "unshootablePageErrorTitle": { + "message": "Vi kan ikkje ta skjermbilde av sida." + }, + "unshootablePageErrorDetails": { + "message": "Dette er ikkje ei vanleg nettside, og du kan ikkje ta skjermbilde av henne." + }, + "selfScreenshotErrorTitle": { + "message": "Du kan ikkje ta skjermbilde av sida Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Oj! Det ser ut til at Firefox Screenshots ikkje fungerer korrekt." + }, + "genericErrorDetails": { + "message": "Vi er ikkje sikre på kva som hende. Kan du prøve igjen eller ta eit bilde på ei anna side?" + }, + "tourBodyOne": { + "message": "Ta, lagre og del skjermbilde utan å forlate Firefox." + }, + "tourHeaderTwo": { + "message": "Knips akkurat det du vil" + }, + "tourBodyTwo": { + "message": "Klikk for å drage og knipse berre ein del av sida. Du kan også føre musa over for å framheve merkt område." + }, + "tourHeaderThree": { + "message": "Som du vil ha det" + }, + "tourBodyThree": { + "message": "Lagre dei tilskjerte bilda dine på nettet for enklare deling, eller last dei ned til datamaskina di. Du kan også klikke på knappen Mine skjermbilde for å finne alle bilda du har tatt." + }, + "tourHeaderFour": { + "message": "Knips vindauge eller heile sider" + }, + "tourBodyFour": { + "message": "Vel knappane i det øvre høgre hjørnet for å knipse det synlege området i vindauget eller for å knipse ei heil side." + }, + "tourSkip": { + "message": "Hopp over" + }, + "tourNext": { + "message": "Neste slide" + }, + "tourPrevious": { + "message": "Føregåande slide" + }, + "tourDone": { + "message": "Ferdig" + }, + "termsAndPrivacyNotice": { + "message": "Ved å bruke Firefox Screenshots, godtar du $TERMSANDPRIVACYNOTICETERMSLINK$ og $TERMSANDPRIVACYNOTICEPRIVACYLINK$ for Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Vilkår" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Personvernmerknad" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/pa_IN/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/pa_IN/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/pa_IN/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/pa_IN/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,47 @@ +{ + "addonAuthorsList": { + "message": "ਮੌਜ਼ੀਲਾ " + }, + "contextMenuLabel": { + "message": "ਸਕਰੀਨ-ਸ਼ਾਟ ਲਵੋ" + }, + "myShotsLink": { + "message": "ਮੇਰੇ ਸ਼ਾਟ" + }, + "screenshotInstructions": { + "message": "ਖੇਤਰ ਨੂੰ ਚੁਣਨ ਵਾਸਤੇ ਖਿੱਚੋ ਜਾਂ ਕਲਿੱਕ ਕਰੋ। ਰੱਦ ਕਰਨ ਵਾਸਤੇ ESC ਦੱਬੋ।" + }, + "saveScreenshotSelectedArea": { + "message": "ਸੰਭਾਲੋ" + }, + "saveScreenshotVisibleArea": { + "message": "ਦਿੱਖ ਨੂੰ ਸੰਭਾਲੋ" + }, + "saveScreenshotFullPage": { + "message": "ਪੂਰੇ ਸਫ਼ੇ ਨੂੰ ਸੰਭਾਲੋ" + }, + "cancelScreenshot": { + "message": "ਰੱਦ ਕਰੋ" + }, + "downloadScreenshot": { + "message": "ਡਾਊਨਲੋਡ ਕਰੋ" + }, + "notificationLinkCopiedTitle": { + "message": "ਲਿੰਕ ਕਾਪੀ ਕੀਤਾ ਗਿਆ" + }, + "requestErrorTitle": { + "message": "ਖ਼ਰਾਬ ਹੈ।" + }, + "tourSkip": { + "message": "ਛੱਡੋ" + }, + "tourNext": { + "message": "ਅਗਲੀ ਸਲਾਈਡ" + }, + "tourPrevious": { + "message": "ਪਿਛਲੀ ਸਲਾਈਡ" + }, + "tourDone": { + "message": "ਮੁਕੰਮਲ" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/pl/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/pl/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/pl/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/pl/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Twórz wycinki i zrzuty stron internetowych i zapisuj je tymczasowo lub trwale." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Wykonaj zrzut ekranu" + }, + "myShotsLink": { + "message": "Moje zrzuty" + }, + "screenshotInstructions": { + "message": "Przeciągnij lub kliknij na stronie, aby wybrać obszar. Naciśnij klawisz Esc, aby anulować." + }, + "saveScreenshotSelectedArea": { + "message": "Zapisz" + }, + "saveScreenshotVisibleArea": { + "message": "Zapisz widoczne" + }, + "saveScreenshotFullPage": { + "message": "Zapisz całą stronę" + }, + "cancelScreenshot": { + "message": "Anuluj" + }, + "downloadScreenshot": { + "message": "Pobierz" + }, + "notificationLinkCopiedTitle": { + "message": "Skopiowano odnośnik" + }, + "notificationLinkCopiedDetails": { + "message": "Odnośnik do zrzutu został skopiowany do schowka. Naciśnij $META_KEY$-V, aby go wkleić.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Awaria." + }, + "requestErrorDetails": { + "message": "Nie można zapisać zrzutu. Spróbuj ponownie później." + }, + "connectionErrorTitle": { + "message": "Nie można połączyć się z zrzutami ekranu." + }, + "connectionErrorDetails": { + "message": "Sprawdź swoje połączenie z Internetem. Jeśli działa ono prawidłowo, to może występować tymczasowy problem z usługą Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Nie można zapisać zrzutu, ponieważ występuje problem z usługą Firefox Screenshots. Spróbuj ponownie później." + }, + "unshootablePageErrorTitle": { + "message": "Nie można wykonać zrzutu tej strony." + }, + "unshootablePageErrorDetails": { + "message": "To nie jest standardowa strona internetowa, więc nie można wykonać jej zrzutu." + }, + "selfScreenshotErrorTitle": { + "message": "Nie można wykonać zrzutu strony Firefox Screenshots." + }, + "genericErrorTitle": { + "message": "Firefox Screenshots wymknęło się spod kontroli." + }, + "genericErrorDetails": { + "message": "Nie bardzo wiemy, co się wydarzyło. Spróbujesz ponownie lub wykonasz zrzut innej strony?" + }, + "tourBodyOne": { + "message": "Wykonuj, zapisuj i udostępniaj zrzuty ekranu bez wychodzenia z Firefoksa." + }, + "tourHeaderTwo": { + "message": "Zapisuj tylko to, co potrzebujesz" + }, + "tourBodyTwo": { + "message": "Kliknij i przeciągnij, aby zapisać tylko część strony. Możesz także najechać, aby wyróżnić zaznaczony obszar." + }, + "tourHeaderThree": { + "message": "Tak, jak lubisz" + }, + "tourBodyThree": { + "message": "Zapisuj przycięte zrzuty w Internecie, aby łatwiej je udostępniać, albo pobierz je na swój komputer. Możesz też kliknąć przycisk „Moje zrzuty”, aby przeglądać wszystkie wykonane zrzuty." + }, + "tourHeaderFour": { + "message": "Zapisuj zrzuty okien lub całych stron" + }, + "tourBodyFour": { + "message": "Kliknij przycisk w górnym prawym rogu, aby zapisać obszar widoczny w oknie lub całą stronę." + }, + "tourSkip": { + "message": "Pomiń" + }, + "tourNext": { + "message": "Dalej" + }, + "tourPrevious": { + "message": "Wstecz" + }, + "tourDone": { + "message": "Zamknij" + }, + "termsAndPrivacyNotice": { + "message": "Używając Firefox Screenshots, zgadzasz się na $TERMSANDPRIVACYNOTICETERMSLINK$ i $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "warunki korzystania z usługi" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "zasady ochrony prywatności" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/pt_BR/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/pt_BR/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/pt_BR/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/pt_BR/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Tire clipes e capturas de tela da Web e guarde-as temporariamente ou permanentemente." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Tirar uma captura de tela" + }, + "myShotsLink": { + "message": "Minhas capturas" + }, + "screenshotInstructions": { + "message": "Arraste ou clique na página para selecionar uma área. Pressione ESC para cancelar." + }, + "saveScreenshotSelectedArea": { + "message": "Salvar" + }, + "saveScreenshotVisibleArea": { + "message": "Salvar área visível" + }, + "saveScreenshotFullPage": { + "message": "Salvar página completa" + }, + "cancelScreenshot": { + "message": "Cancelar" + }, + "downloadScreenshot": { + "message": "Baixar" + }, + "notificationLinkCopiedTitle": { + "message": "Link copiado" + }, + "notificationLinkCopiedDetails": { + "message": "O link da sua captura foi copiado para a área de transferência. Pressione $META_KEY$-V para colar.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Fora de ordem." + }, + "requestErrorDetails": { + "message": "Desculpa! Não pudemos salvar a sua captura de tela. Por favor, tente novamente mais tarde." + }, + "connectionErrorTitle": { + "message": "Não conseguimos conectar suas capturas de tela." + }, + "connectionErrorDetails": { + "message": "Por favor verifique a sua conexão com a Internet. Se consegue conecta-se à Internet, pode existir um problema temporário com o serviço capturas de tela do Firefox." + }, + "loginErrorDetails": { + "message": "Não conseguimos salvar a sua captura porque existe um problema com o serviço de capturas de tela do Firefox. Por favor tente novamente mais tarde." + }, + "unshootablePageErrorTitle": { + "message": "Não conseguimos capturar a tela nesta página." + }, + "unshootablePageErrorDetails": { + "message": "Esta não é uma página web padrão, por isso não podemos tirar uma captura de tela da mesma." + }, + "selfScreenshotErrorTitle": { + "message": "Você não pode tirar uma captura em uma página de capturas de tela do Firefox!" + }, + "genericErrorTitle": { + "message": "Uau! Algo correu mal com a capturas de tela do Firefox." + }, + "genericErrorDetails": { + "message": "Não temos certeza do que acabou de acontecer. Tentar novamente ou fazer uma captura de uma página diferente?" + }, + "tourBodyOne": { + "message": "Capture, salve e compartilhe telas sem sair do Firefox." + }, + "tourHeaderTwo": { + "message": "Capture apenas o que você quer" + }, + "tourBodyTwo": { + "message": "Clique e arraste para capturar apenas uma parte de uma página. Você também pode passar o mouse para realçar sua seleção." + }, + "tourHeaderThree": { + "message": "Como você quiser" + }, + "tourBodyThree": { + "message": "Salve as suas capturas na Web para compartilhar mais facilmente ou baixe-as no seu computador. Você também pode clicar no botão Minhas capturas para encontras todas as capturas que tirou." + }, + "tourHeaderFour": { + "message": "Capture janelas ou páginas inteiras" + }, + "tourBodyFour": { + "message": "Selecione os botões no canto superior direito para capturar a área visível na janela ou capturar uma página inteira." + }, + "tourSkip": { + "message": "Pular" + }, + "tourNext": { + "message": "Próximo slide" + }, + "tourPrevious": { + "message": "Slide anterior" + }, + "tourDone": { + "message": "Concluir" + }, + "termsAndPrivacyNotice": { + "message": "Usando Firefox Screenshots, você concorda com os $TERMSANDPRIVACYNOTICETERMSLINK$ e $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Termos" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Política de privacidade" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/pt_PT/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/pt_PT/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/pt_PT/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/pt_PT/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Tire clipes e capturas de ecrã da Web e guarde-as temporariamente ou permanentemente." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Tirar uma captura de ecrã" + }, + "myShotsLink": { + "message": "Minhas capturas" + }, + "screenshotInstructions": { + "message": "Arraste ou clique na página para selecionar uma região. Pressione ESC para cancelar." + }, + "saveScreenshotSelectedArea": { + "message": "Guardar" + }, + "saveScreenshotVisibleArea": { + "message": "Guardar visível" + }, + "saveScreenshotFullPage": { + "message": "Guardar página inteira" + }, + "cancelScreenshot": { + "message": "Cancelar" + }, + "downloadScreenshot": { + "message": "Descarregar" + }, + "notificationLinkCopiedTitle": { + "message": "Ligação copiada" + }, + "notificationLinkCopiedDetails": { + "message": "A ligação à sua captura foi copiada para a área de transferência. Pressione $META_KEY$-V para colar.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Fora de serviço." + }, + "requestErrorDetails": { + "message": "Desculpe! Não conseguimos guardar a sua captura. Por favor tente novamente mais tarde." + }, + "connectionErrorTitle": { + "message": "Não conseguimos ligar às suas capturas de ecrã." + }, + "connectionErrorDetails": { + "message": "Por favor verifique a sua ligação à Internet. Se consegue ligar-se à Internet, pode existir um problema temporário com o serviço Capturas de ecrã Firefox." + }, + "loginErrorDetails": { + "message": "Não conseguimos guardar a sua captura porque existe um problema com o serviço Capturas de ecrã Firefox. Por favor tente novamente mais tarde." + }, + "unshootablePageErrorTitle": { + "message": "Não conseguimos capturar o ecrã nesta página." + }, + "unshootablePageErrorDetails": { + "message": "Esta não é uma página web padrão, por isso não podemos tirar uma captura de ecrã da mesma." + }, + "selfScreenshotErrorTitle": { + "message": "Não pode tirar uma captura duma página Capturas de ecrã Firefox!" + }, + "genericErrorTitle": { + "message": "Uau! Algo correu mal com o Capturas de ecrã Firefox." + }, + "genericErrorDetails": { + "message": "Não temos a certeza do que acabou de acontecer. Tentar novamente ou tirar uma captura de uma página diferente?" + }, + "tourBodyOne": { + "message": "Tire, guarde, e partilhe capturas de ecrã sem sair do Firefox." + }, + "tourHeaderTwo": { + "message": "Capture aquilo mesmo que pretende" + }, + "tourBodyTwo": { + "message": "Clique e arraste para capturar apenas uma porção de uma página. Pode também pairar para destacar a sua seleção." + }, + "tourHeaderThree": { + "message": "Como gosta" + }, + "tourBodyThree": { + "message": "Guarde as suas capturas na Web para partilhar mais facilmente, ou descarregue-as para o seu computador. Pode também clicar no botão Minhas capturas para encontras todas as capturas que tirou." + }, + "tourHeaderFour": { + "message": "Capture janelas ou páginas inteiras" + }, + "tourBodyFour": { + "message": "Selecione os botões no canto superior direito para capturar a área visível na janela ou capturar uma página inteira." + }, + "tourSkip": { + "message": "Saltar" + }, + "tourNext": { + "message": "Diapositivo seguinte" + }, + "tourPrevious": { + "message": "Diapositivo anterior" + }, + "tourDone": { + "message": "Feito" + }, + "termsAndPrivacyNotice": { + "message": "Ao utilizar o Firefox Screenshots, você concorda com os $TERMSANDPRIVACYNOTICETERMSLINK$ e com a $TERMSANDPRIVACYNOTICEPRIVACYLINK$ do Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Termos" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Nota de privacidade" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/rm/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/rm/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/rm/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/rm/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Fai maletgs da visur dal web ed als memorisescha temporarmain u permanentamain." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Far in maletg dal visur" + }, + "myShotsLink": { + "message": "Mes maletgs da visur" + }, + "screenshotInstructions": { + "message": "Tira u clicca sin la pagina per tscherner ina regiun. Smatga ESC per interrumper." + }, + "saveScreenshotSelectedArea": { + "message": "Memorisar" + }, + "saveScreenshotVisibleArea": { + "message": "Memorisar la regiun visibla" + }, + "saveScreenshotFullPage": { + "message": "Memorisar la pagina cumpletta" + }, + "cancelScreenshot": { + "message": "Interrumper" + }, + "downloadScreenshot": { + "message": "Telechargiar" + }, + "notificationLinkCopiedTitle": { + "message": "Copià la colliaziun" + }, + "notificationLinkCopiedDetails": { + "message": "La colliaziun tar tes maletg da visur è vegnida copiada en l'archiv provisoric. Smatga $META_KEY$-V per l'encollar.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Ord funcziun." + }, + "requestErrorDetails": { + "message": "Perstgisa! I è actualmain betg pussibel da memorisar tes maletg da visur. Emprova p.pl. pli tard anc ina giada." + }, + "connectionErrorTitle": { + "message": "Impussibel da connectar a tes maletgs da visur." + }, + "connectionErrorDetails": { + "message": "Controllescha tia connexiun a l'internet. Sche ti has access a l'internet ha il servetsch da Firefox Screenshots forsa temporarmain in problem." + }, + "loginErrorDetails": { + "message": "Impussibel da memorisar tes maletg da virus perquai ch'i dat in problem un il servetsch da Firefox Screenshots. Emprova p.pl. pli tard." + }, + "unshootablePageErrorTitle": { + "message": "Impussibel da far in maletg da visur da questa pagina." + }, + "unshootablePageErrorDetails": { + "message": "Quai n'è betg ina pagina web da standard, perquai n'èsi betg pussaivel da far in maletg da visur dad ella." + }, + "selfScreenshotErrorTitle": { + "message": "Impussibel da far in maletg da visur dad ina pagina da Firefox Screenshots." + }, + "genericErrorTitle": { + "message": "Oh dieu! Firefox Screenshots ha il singlut." + }, + "genericErrorDetails": { + "message": "Nus na savain betg tge ch'è gist capità. Vuls empruvar anc ina giada, forsa cun in'autra pagina?" + }, + "tourBodyOne": { + "message": "Far, memorisar e cundivider maletgs da visur senza bandunar Firefox." + }, + "tourHeaderTwo": { + "message": "Far maletgs da visur da tut che vi vuls" + }, + "tourBodyTwo": { + "message": "Clicca e tira per far in maletg da be ina part da la pagina. Ti pos posiziunar la mieur sur la selecziun per la relevar." + }, + "tourHeaderThree": { + "message": "Co che ti prefereschas" + }, + "tourBodyThree": { + "message": "Memorisescha ils maletgs da visur en il web per als pudair cundivider u telechargiar sin tes computer. Ti pos era cliccar sin il buttun «Mes maletgs da visur» per vesair tut ils maletgs dal visur che ti has fatg." + }, + "tourHeaderFour": { + "message": "Far maletgs da fanestras u paginas cumplettas" + }, + "tourBodyFour": { + "message": "Tscherna il buttun sura dretg per far in maletg da la part visibla en la fanestra u per far in maletg da la pagina cumpletta." + }, + "tourSkip": { + "message": "Sursiglir" + }, + "tourNext": { + "message": "Proxim pass" + }, + "tourPrevious": { + "message": "Ultim pass" + }, + "tourDone": { + "message": "Finì" + }, + "termsAndPrivacyNotice": { + "message": "Cun utilisar Firefox Screenshots accepteschas ti $TERMSANDPRIVACYNOTICETERMSLINK$ e $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "las cundiziuns d'utilisaziun" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "la decleraziun da protecziun da datas" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ru/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ru/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ru/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ru/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Делайте вырезки и скриншоты из Интернета и сохраняйте их временно или навсегда." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Сделать скриншот" + }, + "myShotsLink": { + "message": "Мои снимки" + }, + "screenshotInstructions": { + "message": "Потяните мышью или щёлкните по странице, чтобы выбрать область. Нажмите ESC для отмены." + }, + "saveScreenshotSelectedArea": { + "message": "Сохранить" + }, + "saveScreenshotVisibleArea": { + "message": "Сохранить видимую область" + }, + "saveScreenshotFullPage": { + "message": "Сохранить всю страницу" + }, + "cancelScreenshot": { + "message": "Отмена" + }, + "downloadScreenshot": { + "message": "Загрузить" + }, + "notificationLinkCopiedTitle": { + "message": "Ссылка скопирована" + }, + "notificationLinkCopiedDetails": { + "message": "Ссылка на ваш снимок была скопирована в буфер обмена. Нажмите $META_KEY$-V для её вставки.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Произошла ошибка." + }, + "requestErrorDetails": { + "message": "Извините! Мы не смогли сохранить ваш снимок. Пожалуйста, попробуйте позже." + }, + "connectionErrorTitle": { + "message": "Мы не смогли получить доступ к вашим скриншотам." + }, + "connectionErrorDetails": { + "message": "Пожалуйста, проверьте соединение с Интернетом. Если у вам удаётся войти в Интернет, то возможно, возникла временная проблема со службой Скриншотов Firefox." + }, + "loginErrorDetails": { + "message": "Мы не можем сохранить ваш снимок, так как возникла проблема с сервисом Скриншотов Firefox. Пожалуйста, попробуйте позже." + }, + "unshootablePageErrorTitle": { + "message": "Мы не можем сделать скриншот этой страницы." + }, + "unshootablePageErrorDetails": { + "message": "Так как это не обычная веб-страница, мы не сможем сделать её скриншот." + }, + "selfScreenshotErrorTitle": { + "message": "Вы не можете сделать скриншот страницы Скриншотов Firefox." + }, + "genericErrorTitle": { + "message": "Ого! Скриншоты Firefox вышли из строя." + }, + "genericErrorDetails": { + "message": "Мы не уверены, в чём проблема. Попробуете ещё раз или сделаете снимок другой страницы?" + }, + "tourBodyOne": { + "message": "Делайте, сохраняйте и делитесь скриншотами прямо в Firefox." + }, + "tourHeaderTwo": { + "message": "Делайте снимки чего угодно" + }, + "tourBodyTwo": { + "message": "Щелкните и потяните мышью для захвата части страницы. Вы также можете навести курсор мыши для подсветки выбранной области." + }, + "tourHeaderThree": { + "message": "Как вам нравится" + }, + "tourBodyThree": { + "message": "Сохраняйте свои снимки в Интернете, чтобы легко ими делиться, или загружайте их на свой компьютер. Вы также можете просмотреть все сохранённые снимки, нажав на кнопку Мои снимки." + }, + "tourHeaderFour": { + "message": "Захватывайте окна или целые страницы" + }, + "tourBodyFour": { + "message": "С помощью кнопок в верхнем правом углу выбирайте захват видимой области окна или страницы целиком." + }, + "tourSkip": { + "message": "Пропустить" + }, + "tourNext": { + "message": "Следующий слайд" + }, + "tourPrevious": { + "message": "Предыдущий слайд" + }, + "tourDone": { + "message": "Готово" + }, + "termsAndPrivacyNotice": { + "message": "Используя Firefox Screenshots, вы соглашаетесь с его $TERMSANDPRIVACYNOTICETERMSLINK$ и $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Условиями использования" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Уведомлением о приватности" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/sk/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/sk/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/sk/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/sk/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Vytvorte si snímky obrazovky na webe a uložte si ich dočasne či navždy." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Urobiť snímku obrazovky" + }, + "myShotsLink": { + "message": "Moje snímky" + }, + "screenshotInstructions": { + "message": "Potiahnutím alebo kliknutím si vyberte oblasť, ktorú chcete zachytiť. Výber zrušíte stlačením klávesa ESC." + }, + "saveScreenshotSelectedArea": { + "message": "Uložiť" + }, + "saveScreenshotVisibleArea": { + "message": "Uložiť viditeľnú časť" + }, + "saveScreenshotFullPage": { + "message": "Uložiť celú stránku" + }, + "cancelScreenshot": { + "message": "Zrušiť" + }, + "downloadScreenshot": { + "message": "Prevziať" + }, + "notificationLinkCopiedTitle": { + "message": "Odkaz bol skopírovaný" + }, + "notificationLinkCopiedDetails": { + "message": "Odkaz na vašu snímku bol skopírovaný do schránky. Stlačením $META_KEY$-V ho prilepíte.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Mimo prevádzky." + }, + "requestErrorDetails": { + "message": "Mrzí nás to, no nemôžeme uložiť vašu snímku. Skúste to, prosím, neskôr." + }, + "connectionErrorTitle": { + "message": "Nemôžeme sa spojiť s vašimi snímkami." + }, + "connectionErrorDetails": { + "message": "Prosím, skontrolujte svoje internetové pripojenie. Ak ste pripojení na internet, môže ísť o dočasný problém na strane služby Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Nemohli sme uložiť vašu snímku, pretože nastal problém so službou Firefox Screenshots. Skúste to, prosím, neskôr." + }, + "unshootablePageErrorTitle": { + "message": "Túto stránku nemôžeme zachytiť." + }, + "unshootablePageErrorDetails": { + "message": "Toto nie je štandardná webová stránka, takže z nej nemôžeme vytvoriť snímku obrazovky." + }, + "selfScreenshotErrorTitle": { + "message": "Nemôžete vytvoriť snímku obrazovky stránky Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Ups! Služba Firefox Screenshots prestala pracovať." + }, + "genericErrorDetails": { + "message": "Nie sme si istí, čo sa práve stalo. Chcete tú skúsiť znova alebo chcete vytvoriť snímku inej stránky?" + }, + "tourBodyOne": { + "message": "Tvorte, ukladajte a zdieľajte snímky obrazovky bez toho, aby ste museli opustiť Firefox." + }, + "tourHeaderTwo": { + "message": "Zachyťte to, čo chcete" + }, + "tourBodyTwo": { + "message": "Ak chcete zachytiť časť stránky, urobíte to kliknutím a potiahnutím. Váš výber zvýrazníte tak, že sa naň presuniete myšou." + }, + "tourHeaderThree": { + "message": "Tak ako to chcete" + }, + "tourBodyThree": { + "message": "Uložte si orezanú snímku na web, aby ste ju mohli ľahšie zdieľať alebo si ju prevziať do počítača. Môžete si taktiež pozrieť všetky vaše snímky, stačí ak kliknete na tlačidlo Moje snímky." + }, + "tourHeaderFour": { + "message": "Zachyťte okná alebo celé webové stránky" + }, + "tourBodyFour": { + "message": "Kliknutím na tlačidlo v pravom hornom rohu môžete zachytiť viditeľnú časť stránky. Pomocou ďalšieho tlačidla zachytíte celú stránku." + }, + "tourSkip": { + "message": "Preskočiť" + }, + "tourNext": { + "message": "Ďalšia snímka" + }, + "tourPrevious": { + "message": "Predchádzajúca snímka" + }, + "tourDone": { + "message": "Hotovo" + }, + "termsAndPrivacyNotice": { + "message": "Používaním služby Firefox Screenshots vyjadrujete súhlas s $TERMSANDPRIVACYNOTICETERMSLINK$ služby Screenshots a so $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "podmienkami" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "zásadami ochrany súkromia" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/sl/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/sl/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/sl/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/sl/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Zajemajte posnetke zaslona s spleta ter jih shranite začasno ali trajno." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Zajemi posnetek zaslona" + }, + "myShotsLink": { + "message": "Moji posnetki" + }, + "screenshotInstructions": { + "message": "Povlecite ali kliknite na strani za izbiro območja. Pritisnite ESC za preklic." + }, + "saveScreenshotSelectedArea": { + "message": "Shrani" + }, + "saveScreenshotVisibleArea": { + "message": "Shrani vidno" + }, + "saveScreenshotFullPage": { + "message": "Shrani celotno stran" + }, + "cancelScreenshot": { + "message": "Prekliči" + }, + "downloadScreenshot": { + "message": "Prenesi" + }, + "notificationLinkCopiedTitle": { + "message": "Povezava kopirana" + }, + "notificationLinkCopiedDetails": { + "message": "Povezava do vašega posnetka zaslona je bila kopirana v odložišče. Pritisnite $META_KEY$-V, da jo prilepite.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Ne dela." + }, + "requestErrorDetails": { + "message": "Vašega posnetka nismo uspeli shraniti. Poskusite znova kasneje." + }, + "connectionErrorTitle": { + "message": "Ne moremo vzpostaviti povezave do vaših posnetkov." + }, + "connectionErrorDetails": { + "message": "Preverite svojo internetno povezavo. V kolikor povezava deluje, gre morda za začasno težavo s storitvijo Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Ne moremo shraniti vašega posnetka, ker je prišlo do težave s storitvijo Firefox Screenshots. Poskusite znova kasneje." + }, + "unshootablePageErrorTitle": { + "message": "Ne moremo zajeti posnetka te strani." + }, + "unshootablePageErrorDetails": { + "message": "To ni običajna spletna stran, zato ne morete zajeti njenega zaslonskega posnetka." + }, + "selfScreenshotErrorTitle": { + "message": "Posnetka strani Firefox Screenshots ni mogoče zajeti!" + }, + "genericErrorTitle": { + "message": "Uf! Firefox Screenshots se je pokvaril." + }, + "genericErrorDetails": { + "message": "Ne vemo točno, kaj se je pravkar zgodilo. Bi radi poskusili znova ali pa zajeli posnetek kakšne druge strani?" + }, + "tourBodyOne": { + "message": "Zajemite, shranite in delite zaslonske posnetke, ne da bi zapustili Firefox." + }, + "tourHeaderTwo": { + "message": "Zajemite to, kar hočete" + }, + "tourBodyTwo": { + "message": "Kliknite in povlecite, če želite zajeti samo del strani. Svojo izbiro lahko tudi poudarite, tako da preko nje povlečete miškin kazalec." + }, + "tourHeaderThree": { + "message": "Kot vi želite" + }, + "tourBodyThree": { + "message": "Shranite obrezane posnetke na splet za lažje deljenje ali jih prenesite na svoj računalnik. Vse zajete posnetke lahko najdete s klikom na gumb My Shots." + }, + "tourHeaderFour": { + "message": "Zajemite okna ali celotne strani" + }, + "tourBodyFour": { + "message": "V zgornjem desnem kotu izberite gumb za zajem vidnega območja v oknu ali celotne strani." + }, + "tourSkip": { + "message": "Preskoči" + }, + "tourNext": { + "message": "Naslednji diapozitiv" + }, + "tourPrevious": { + "message": "Prejšnji diapozitiv" + }, + "tourDone": { + "message": "Končano" + }, + "termsAndPrivacyNotice": { + "message": "Z uporabo razširitve Firefox Screenshots se strinjate s $TERMSANDPRIVACYNOTICETERMSLINK$ in $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "pogoji" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "obvestilom o zasebnosti" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/sq/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/sq/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/sq/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/sq/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,14 @@ +{ + "saveScreenshotSelectedArea": { + "message": "Ruaje" + }, + "cancelScreenshot": { + "message": "Anuloje" + }, + "downloadScreenshot": { + "message": "Shkarkoje" + }, + "notificationLinkCopiedTitle": { + "message": "Lidhja u Kopjua" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/sr/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/sr/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/sr/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/sr/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Бележите снимке екрана са веба и сачувајте их привремено или трајно." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Усликајте екран" + }, + "myShotsLink": { + "message": "Моји снимци" + }, + "screenshotInstructions": { + "message": "Превуците или кликните на страници да изаберете област. Притисните ESC да прекинете." + }, + "saveScreenshotSelectedArea": { + "message": "Сачувај" + }, + "saveScreenshotVisibleArea": { + "message": "Сачувај видљиво" + }, + "saveScreenshotFullPage": { + "message": "Сачувај целу страницу" + }, + "cancelScreenshot": { + "message": "Откажи" + }, + "downloadScreenshot": { + "message": "Преузми" + }, + "notificationLinkCopiedTitle": { + "message": "Веза копирана" + }, + "notificationLinkCopiedDetails": { + "message": "Веза коју сте забележили је копирана у бележницу. Притисните $META_KEY$-V да налепите.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Не ради." + }, + "requestErrorDetails": { + "message": "Жао нам је! Нисмо могли сачувати ваш снимак. Покушајте поново касније." + }, + "connectionErrorTitle": { + "message": "Не можемо се повезати на ваше снимке." + }, + "connectionErrorDetails": { + "message": "Проверите вашу интернет конекцију. Ако можете да се конектујете, онда можда постоји привремени проблем са Firefox Screenshots-ом." + }, + "loginErrorDetails": { + "message": "Нисмо могли сачувати ваш снимак јер постоји проблем са Firefox Screenshots-ом. Покушајте поново касније." + }, + "unshootablePageErrorTitle": { + "message": "Не можемо забележити снимак ове странице." + }, + "unshootablePageErrorDetails": { + "message": "Ово није стандардна веб страница, тако да не можете забележити њен снимак." + }, + "selfScreenshotErrorTitle": { + "message": "Не можете усликати Firefox Screenshots страницу!" + }, + "genericErrorTitle": { + "message": "Ајој! Firefox Screenshots је пошашавио." + }, + "genericErrorDetails": { + "message": "Нисмо сигурни шта се управо догодило. Желите ли покушати поново или да усликате другачију страницу?" + }, + "tourBodyOne": { + "message": "Забележите, сачувајте и поделите снимке екрана без напуштања Firefox-а." + }, + "tourHeaderTwo": { + "message": "Усликајте баш оно што желите" + }, + "tourBodyTwo": { + "message": "Кликните и превуците да усликате само део странице. Такође можете означити вашу селекцију." + }, + "tourHeaderThree": { + "message": "Као што волите" + }, + "tourBodyThree": { + "message": "Сачувајте ваш исечени снимак на веб ради лакшег дељења или преузимања на ваш рачунар. Такође можете кликнути на дугме \"Моји снимци\" да пронађете све ваше снимке." + }, + "tourHeaderFour": { + "message": "Усликајте прозоре или целе странице" + }, + "tourBodyFour": { + "message": "Изаберите дугмад у горњем десном углу да усликате видљиве делове прозора или да усликате целу страницу." + }, + "tourSkip": { + "message": "Прескочи" + }, + "tourNext": { + "message": "Следећи слајд" + }, + "tourPrevious": { + "message": "Претходни слајд" + }, + "tourDone": { + "message": "Готово" + }, + "termsAndPrivacyNotice": { + "message": "Коришћењем услуге Firefox Screenshots, слажете се са $TERMSANDPRIVACYNOTICETERMSLINK$ и $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "условима" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "обавештењем о приватности" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/sv_SE/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/sv_SE/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/sv_SE/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/sv_SE/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Ta klipp och skärmbilder från webben och spara dem tillfälligt eller permanent." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Ta en skärmbild" + }, + "myShotsLink": { + "message": "Mina skärmbilder" + }, + "screenshotInstructions": { + "message": "Dra eller klicka på sidan för att välja en region. Tryck på ESC för att avbryta." + }, + "saveScreenshotSelectedArea": { + "message": "Spara" + }, + "saveScreenshotVisibleArea": { + "message": "Spara synligt område" + }, + "saveScreenshotFullPage": { + "message": "Spara hela sidan" + }, + "cancelScreenshot": { + "message": "Avbryt" + }, + "downloadScreenshot": { + "message": "Ladda ner" + }, + "notificationLinkCopiedTitle": { + "message": "Länk kopierad" + }, + "notificationLinkCopiedDetails": { + "message": "Länken till din skärmbild har kopierats till urklipp. Tryck på $META_KEY$-V för att klistra in.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Ur funktion." + }, + "requestErrorDetails": { + "message": "Förlåt! Vi kunde inte spara din skärmbild. Försök igen senare." + }, + "connectionErrorTitle": { + "message": "Vi kan inte ansluta till dina skärmbilder." + }, + "connectionErrorDetails": { + "message": "Kontrollera din internetanslutning. Om du kan ansluta till internet, kan det vara ett tillfälligt problem med tjänsten Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Vi kunde inte spara din skärmbild eftersom det finns ett problem med tjänsten Firefox Screenshots. Försök igen senare." + }, + "unshootablePageErrorTitle": { + "message": "Vi kan inte ta en skärmbild av sidan." + }, + "unshootablePageErrorDetails": { + "message": "Detta är inte en vanlig webbsida, så du kan inte ta en skärmbild av den." + }, + "selfScreenshotErrorTitle": { + "message": "Du kan inte ta en skärmbild av sidan Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Oj! Firefox Screenshots verkar inte fungera korrekt." + }, + "genericErrorDetails": { + "message": "Vi är inte säkra på vad som just hände. Kan du försöka igen eller ta en bild på en annan sida?" + }, + "tourBodyOne": { + "message": "Ta, spara, och dela skärmbilder utan att lämna Firefox." + }, + "tourHeaderTwo": { + "message": "Fånga precis vad du vill" + }, + "tourBodyTwo": { + "message": "Klicka och dra för att fånga bara en del av en sida. Du kan också hovra för att markera ditt val." + }, + "tourHeaderThree": { + "message": "Som du vill ha det" + }, + "tourBodyThree": { + "message": "Spara dina beskurna bilder till webben för enklare delning, eller hämta dem till datorn. Du kan också klicka på knappen Mina skärmbilder för att hitta alla bilder du tagit." + }, + "tourHeaderFour": { + "message": "Fånga fönster eller hela sidor" + }, + "tourBodyFour": { + "message": "Välj knapparna i det övre högra hörnet för att fånga det synliga området i fönstret eller för att fånga en hel sida." + }, + "tourSkip": { + "message": "Hoppa över" + }, + "tourNext": { + "message": "Nästa sida" + }, + "tourPrevious": { + "message": "Föregående sida" + }, + "tourDone": { + "message": "Färdig" + }, + "termsAndPrivacyNotice": { + "message": "Genom att använda Firefox Screenshots, godkänner du $TERMSANDPRIVACYNOTICETERMSLINK$ och $TERMSANDPRIVACYNOTICEPRIVACYLINK$ för Screenshots.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Villkor" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Sekretesspolicy" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/th/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/th/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/th/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/th/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "จับภาพหน้าจอจากเว็บและบันทึกไว้ชั่วคราวหรือถาวร" + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "จับภาพหน้าจอ" + }, + "myShotsLink": { + "message": "ภาพของฉัน" + }, + "screenshotInstructions": { + "message": "ลากหรือคลิกหน้าเว็บเพื่อเลือกบริเวณ กด ESC เพื่อยกเลิก" + }, + "saveScreenshotSelectedArea": { + "message": "บันทึก" + }, + "saveScreenshotVisibleArea": { + "message": "บันทึกส่วนที่เห็น" + }, + "saveScreenshotFullPage": { + "message": "บันทึกเต็มหน้า" + }, + "cancelScreenshot": { + "message": "ยกเลิก" + }, + "downloadScreenshot": { + "message": "ดาวน์โหลด" + }, + "notificationLinkCopiedTitle": { + "message": "คัดลอกลิงก์แล้ว" + }, + "notificationLinkCopiedDetails": { + "message": "คัดลอกลิงก์ภาพของไว้ในคลิปบอร์ดแล้ว กด $META_KEY$-V เพื่อวาง", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "ใช้งานไม่ได้" + }, + "requestErrorDetails": { + "message": "ขออภัย! เราไม่สามารถบันทึกภาพของคุณได้ โปรดลองอีกครั้งหลังจากนี้" + }, + "connectionErrorTitle": { + "message": "เราเชื่อมต่อภาพหน้าจอของคุณไม่ได้" + }, + "connectionErrorDetails": { + "message": "กรุณาตรวจสอบการเชื่อมต่ออินเทอร์เน็ต หากคุณสามารถเชื่อมต่อกับอินเทอร์เน็ต บริการ Firefox Screenshots อาจมีปัญหาชั่วคราว " + }, + "loginErrorDetails": { + "message": "เราไม่สามารถบันทึกภาพได้เพราะมีปัญหากับบริการ Firefox Screenshots โปรดลองใหม่ภายหลัง" + }, + "unshootablePageErrorTitle": { + "message": "เราไม่สามารถจับภาพหน้าจอหน้านี้" + }, + "unshootablePageErrorDetails": { + "message": "นี่ไม่ใช่หน้าเว็บมาตรฐานดังนั้นคุณไม่สามารถจับภาพได้" + }, + "selfScreenshotErrorTitle": { + "message": "คุณไม่สามารถจับภาพหน้าจอของหน้า Firefox Screenshots" + }, + "genericErrorTitle": { + "message": "โอ๊ย! Firefox Screenshots รวน" + }, + "genericErrorDetails": { + "message": "เราไม่แน่ใจว่าเกิดอะไรขึ้น โปรดลองอีกครั้งหรือจับภาพของหน้าอื่น" + }, + "tourBodyOne": { + "message": "จับ บันทึกและแบ่งปันภาพหน้าจอโดยที่ไม่ต้องออกจาก Firefox" + }, + "tourHeaderTwo": { + "message": "จับภาพตามที่คุณต้องการ" + }, + "tourBodyTwo": { + "message": "คลิกหรือลากเพื่อจับภาพเฉพาะบางส่วนของหน้าเว็บ คุณสามารถเลื่อนมาชี้เพื่อเน้นภาพส่วนที่คุณเลือก" + }, + "tourHeaderThree": { + "message": "ตามที่คุณโปรด" + }, + "tourBodyThree": { + "message": "บันทึกและครอปภาพลงในเว็บเพื่อให้แบ่งปันได้ง่าย หรือดาวน์โหลดลงคอมพิวเตอร์ของคุณ คุณยังสามารถคลิกที่ปุ่มภาพของฉันเพื่อที่จะหาภาพที่คุณจับไว้" + }, + "tourHeaderFour": { + "message": "จับภาพหน้าต่างหรือทั้งหน้า" + }, + "tourBodyFour": { + "message": "กดปุ่มด้านบนขวาเพื่อจับภาพบริเวณที่มองเห็นในหน้าต่างหรือทั้งหน้าเว็บ" + }, + "tourSkip": { + "message": "ข้าม" + }, + "tourNext": { + "message": "ภาพนิ่งถัดไป" + }, + "tourPrevious": { + "message": "ภาพนิ่งก่อนหน้า" + }, + "tourDone": { + "message": "เสร็จสิ้น" + }, + "termsAndPrivacyNotice": { + "message": "เพื่อใช้ Firefox Screenshots คุณยอมรับ $TERMSANDPRIVACYNOTICETERMSLINK$ และ $TERMSANDPRIVACYNOTICEPRIVACYLINK$ ของ Screenshots", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "ข้อกำหนด" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "ประกาศความเป็นส่วนตัว" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/tl/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/tl/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/tl/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/tl/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Dalhin ang clip at mga screenshot mula sa Web at i-save ang mga ito pansamantala o permanente." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Kumuha ng Screenshot" + }, + "myShotsLink": { + "message": "Aking Shots" + }, + "screenshotInstructions": { + "message": "I-drag o i-click sa pahina upang pumili ng rehiyon. Pindutin ang ESC upang kanselahin." + }, + "saveScreenshotSelectedArea": { + "message": "I-save" + }, + "saveScreenshotVisibleArea": { + "message": "I-save na nakikita" + }, + "saveScreenshotFullPage": { + "message": "I-save ang buong pahina" + }, + "cancelScreenshot": { + "message": "Kanselahin" + }, + "downloadScreenshot": { + "message": "Download" + }, + "notificationLinkCopiedTitle": { + "message": "Kinopya ang Link" + }, + "notificationLinkCopiedDetails": { + "message": "Ang link na ito sa iyong shot ay kinopya sa clipboard. Pindutin $META_KEY$-V i-paste.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Mula sa pagkakasunod-sunod." + }, + "requestErrorDetails": { + "message": "Paumanhin! Hindi namin mai-save ang iyong mga shot. Subukang muli mamaya." + }, + "connectionErrorTitle": { + "message": "Hindi namin maaaring i-kunekta sa iyong mga screenshot." + }, + "connectionErrorDetails": { + "message": "Mangyaring suriin ang iyong koneksyon sa Internet. Kung ikaw ay kumonekta sa Internet, maaaring may isang pansamantalang problema sa serbisyo Firefox screenshot." + }, + "loginErrorDetails": { + "message": "Hindi namin mai-save ang iyong mga shot dahil may problema sa serbisyo Firefox screenshot. Subukang muli mamaya." + }, + "unshootablePageErrorTitle": { + "message": "Hindi namin maaaring screenshot pahinang ito." + }, + "unshootablePageErrorDetails": { + "message": "Ito ay hindi isang standard na Web page, kaya hindi ka maaaring kumuha ng isang screenshot ng mga ito." + }, + "selfScreenshotErrorTitle": { + "message": "Hindi ka maaaring kumuha ng isang shot ng isang pahina ng Firefox screenshot!" + }, + "genericErrorTitle": { + "message": "Whoa! Nagiging magulo ang Firefox screenshot." + }, + "genericErrorDetails": { + "message": "Hindi kami sigurado kung ano ang nangyari. Pag-aalaga upang subukang muli o kumuha ng isang shot ng isang iba't ibang mga pahina?" + }, + "tourBodyOne": { + "message": "Dumaan, i-save, at ibahagi ang mga screenshot nang hindi umaalis sa Firefox." + }, + "tourHeaderTwo": { + "message": "Kunan Kung Ano Ang Gusto Mo" + }, + "tourBodyTwo": { + "message": "I-click at i-drag upang makuha lamang ang isang bahagi ng isang pahina. Maaari mo ring i-hover upang i-highlight ang iyong pagpili." + }, + "tourHeaderThree": { + "message": "Bilang Nagustuhan Mo ito" + }, + "tourBodyThree": { + "message": "I-save ang iyong crop shot sa Web para sa madaling pagbabahagi, o i-download ito sa iyong computer. Maaari mo ring i-click sa pindutan ng My Shots upang mahanap ang lahat ng mga pag-shot na kinunan mo." + }, + "tourHeaderFour": { + "message": "I-capture ang Windows o Buong Pahina" + }, + "tourBodyFour": { + "message": "Piliin ang pindutan sa kanang itaas upang makuha ang nakikitang lugar sa window o upang makuha ang isang buong pahina." + }, + "tourSkip": { + "message": "Laktawan" + }, + "tourNext": { + "message": "Susunod na Slide" + }, + "tourPrevious": { + "message": "Nakaraan na Slide" + }, + "tourDone": { + "message": "Tapos" + }, + "termsAndPrivacyNotice": { + "message": "Sa pamamagitan ng paggamit ng Firefox screenshot, sumasang-ayon ka sa mga screenshot $TERMSANDPRIVACYNOTICETERMSLINK$ at $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Mga tuntunin" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Abiso sa Privacy" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/tr/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/tr/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/tr/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/tr/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Web sayfalarının ekran görüntülerini alın, ister geçici ister kalıcı olarak kaydedin." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Ekran görüntüsü al" + }, + "myShotsLink": { + "message": "Ekran görüntülerim" + }, + "screenshotInstructions": { + "message": "Bir bölgeyi seçmek için işaretçiyi sürükleyin veya tıklayın. İptal etmek için ESC tuşuna basın." + }, + "saveScreenshotSelectedArea": { + "message": "Kaydet" + }, + "saveScreenshotVisibleArea": { + "message": "Görünür alanı kaydet" + }, + "saveScreenshotFullPage": { + "message": "Tüm sayfayı kaydet" + }, + "cancelScreenshot": { + "message": "Vazgeç" + }, + "downloadScreenshot": { + "message": "İndir" + }, + "notificationLinkCopiedTitle": { + "message": "Bağlantı kopyalandı" + }, + "notificationLinkCopiedDetails": { + "message": "Ekran görüntünüzün bağlantısı panoya kopyalandı. Yapıştırmak için $META_KEY$-V tuşlarına basabilirsiniz.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Arıza var." + }, + "requestErrorDetails": { + "message": "Ekran görüntünüzü kaydedemedik. Lütfen daha sonra yeniden deneyin." + }, + "connectionErrorTitle": { + "message": "Ekran görüntülerinize bağlanamadık." + }, + "connectionErrorDetails": { + "message": "Lütfen internet bağlantınızı kontrol edin. İnternete bağlanabiliyorsanız Firefox Screenhosts hizmeti ile ilgili geçici bir sorun olabilir." + }, + "loginErrorDetails": { + "message": "Firefox Screenshosts hizmetinde bir sorun yaşandığı için ekran görüntünüzü kaydedemedik. Lütfen daha sonra yeniden deneyin." + }, + "unshootablePageErrorTitle": { + "message": "Bu sayfanın ekran görüntüsü alınamıyor." + }, + "unshootablePageErrorDetails": { + "message": "Bu sayfa standart bir web sayfası olmadığı için ekran görüntüsünü alamazsınız." + }, + "selfScreenshotErrorTitle": { + "message": "Firefox Screenshots sayfalarının ekran görüntüsünü alamazsınz." + }, + "genericErrorTitle": { + "message": "Firefox Screenshosts kafayı yedi!" + }, + "genericErrorDetails": { + "message": "Ne olduğunu biz de anlamadık. Bir daha denemeye veya başka bir sayfanın ekran görüntüsünü almaya ne dersiniz?" + }, + "tourBodyOne": { + "message": "Firefox'tan çıkmadan ekran görüntüleri alın, kaydedin ve paylaşın." + }, + "tourHeaderTwo": { + "message": "İstediğini yakala" + }, + "tourBodyTwo": { + "message": "Sayfanın belli bir kısmını yakalamak için işaretçiyi tıklayıp sürükleyin. Seçiminizi vurgulamak için fareyle üzerine gelebilirsiniz." + }, + "tourHeaderThree": { + "message": "İstediğin gibi yakala" + }, + "tourBodyThree": { + "message": "Ekran görüntülerinizi daha kolay paylşamak veya bilgisayarınıza indirmek için web'e kaydedin. Kaydettiğiniz tüm görüntüleri bulmak için \"Ekran görüntülerim\" düğmesine tıklayabilirsiniz." + }, + "tourHeaderFour": { + "message": "Pencereleri veya sayfaların tamamını yakala" + }, + "tourBodyFour": { + "message": "Yalnızda pencerede gördüğünüz alanı veya sayfanın tamamını yakalamak için sağ üstteki düğmelerden uygun olanı seçin." + }, + "tourSkip": { + "message": "GEÇ" + }, + "tourNext": { + "message": "Sonraki slayt" + }, + "tourPrevious": { + "message": "Önceki slayt" + }, + "tourDone": { + "message": "Tamam" + }, + "termsAndPrivacyNotice": { + "message": "Firefox Screenshots'ı kullandığınızda Screenshosts $TERMSANDPRIVACYNOTICETERMSLINK$ ve $TERMSANDPRIVACYNOTICEPRIVACYLINK$ kabul etmiş sayılırsınız.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Koşullarını" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Gizlilik Bildirimini" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/uk/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/uk/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/uk/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/uk/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "Робіть вирізки та знімки екрану в Інтернеті та зберігайте їх для подальшої роботи." + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "Зробити знімок екрану" + }, + "myShotsLink": { + "message": "Мої знімки" + }, + "screenshotInstructions": { + "message": "Потягніть або клацніть на сторінці для вибору області. Натисніть ESC для скасування." + }, + "saveScreenshotSelectedArea": { + "message": "Зберегти" + }, + "saveScreenshotVisibleArea": { + "message": "Зберегти видиму область" + }, + "saveScreenshotFullPage": { + "message": "Зберегти всю сторінку" + }, + "cancelScreenshot": { + "message": "Скасувати" + }, + "downloadScreenshot": { + "message": "Завантажити" + }, + "notificationLinkCopiedTitle": { + "message": "Посилання скопійовано" + }, + "notificationLinkCopiedDetails": { + "message": "Посилання на ваш знімок було скопійоване до буфера обміну. Натисніть $META_KEY$-V для вставлення.", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "Сталася помилка." + }, + "requestErrorDetails": { + "message": "Вибачте! Нам не вдалося зберегти ваш знімок. Спробуйте знову пізніше." + }, + "connectionErrorTitle": { + "message": "Ми не можемо отримати доступ до ваших знімків." + }, + "connectionErrorDetails": { + "message": "Будь ласка, перевірте ваше підключення до Інтернету. Якщо у вас все в порядку з Інтернетом, можливо, виникли тимчасові проблеми зі службою Firefox Screenshots." + }, + "loginErrorDetails": { + "message": "Нам не вдалося зберегти ваш знімок, тому що виникли проблеми зі службою Firefox Screenshots. Спробуйте знову пізніше." + }, + "unshootablePageErrorTitle": { + "message": "Ми не можемо зробити знімок цієї сторінки." + }, + "unshootablePageErrorDetails": { + "message": "Це не стандартна веб-сторінка, тому ви не можете зробити її знімок." + }, + "selfScreenshotErrorTitle": { + "message": "Ви не можете зробити знімок сторінки Firefox Screenshots!" + }, + "genericErrorTitle": { + "message": "Оу! З Firefox Screenshots щось негаразд." + }, + "genericErrorDetails": { + "message": "Ми не впевнені, в чому проблема. Спробувати ще раз, або ж зробити знімок іншої сторінки?" + }, + "tourBodyOne": { + "message": "Робіть знімки екрану, зберігайте та діліться ними прямо в Firefox." + }, + "tourHeaderTwo": { + "message": "Робіть знімки чого завгодно" + }, + "tourBodyTwo": { + "message": "Клацніть і потягніть мишею для захоплення частини сторінки. Ви також можете навести курсор миші для підсвічення вибраної області." + }, + "tourHeaderThree": { + "message": "Як вам подобається" + }, + "tourBodyThree": { + "message": "Зберігайте свої знімки в Інтернеті, щоб легко ними ділитися, або завантажуйте їх на свій комп'ютер. Ви також можете переглянути всі збережені знімки, натиснувши на кнопку Мої знімки." + }, + "tourHeaderFour": { + "message": "Захоплюйте вікна або цілі сторінки" + }, + "tourBodyFour": { + "message": "За допомогою кнопок у верхній правій частині обирайте захоплення видимої області вікна, або сторінки повністю." + }, + "tourSkip": { + "message": "Пропустити" + }, + "tourNext": { + "message": "Наступний слайд" + }, + "tourPrevious": { + "message": "Попередній слайд" + }, + "tourDone": { + "message": "Готово" + }, + "termsAndPrivacyNotice": { + "message": "Використовуючи Firefox Screenshots, ви погоджуєтеся з його $TERMSANDPRIVACYNOTICETERMSLINK$ та $TERMSANDPRIVACYNOTICEPRIVACYLINK$.", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "Умовами використання" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "Повідомленням про приватність" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ur/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ur/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/ur/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/ur/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,103 @@ +{ + "addonDescription": { + "message": "ویب سے کللبس یاا اسکرین شاٹیں لیں اور ان کو عارظی یا مستقل طور پر محفوظ کریں۔" + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "ایک سکرین شاٹ لیں" + }, + "myShotsLink": { + "message": "میری شاٹس" + }, + "screenshotInstructions": { + "message": "علاقہ منتخب کرنے کے لیئے گھسیٹیں یا صفحہ پر کلک کریں۔ منسوخ کرنے کے لیئے ESC دبائیں۔" + }, + "saveScreenshotSelectedArea": { + "message": "محفوظ کریں" + }, + "saveScreenshotVisibleArea": { + "message": "مرئی محفوظ کریں" + }, + "saveScreenshotFullPage": { + "message": "پورا صفحہ محفوظ کریں" + }, + "cancelScreenshot": { + "message": "منسوخ کریں" + }, + "downloadScreenshot": { + "message": "ڈاؤن لوڈ" + }, + "notificationLinkCopiedTitle": { + "message": "تبط نقل کر دیا گیا" + }, + "notificationLinkCopiedDetails": { + "message": "آُپ کی شاٹس کا ربط و تختہ تراشہ پر نقل کر دیا گیا ہے۔ چسپاں کرنے کے لیئے $META_KEY$-V دبائِں۔", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "خراب ہے۔" + }, + "requestErrorDetails": { + "message": "معاف کیجیئے گا! ہم آپ کی شاٹ محفوظ نہیں کر سکے۔ براہ مہربانی کچھ دیر بعد کوشش کریں۔" + }, + "connectionErrorTitle": { + "message": "ہم آپ کی اسکرین شاٹس سے نہیں جڑ سکتے۔" + }, + "connectionErrorDetails": { + "message": "براہ مہربانی اپنے انٹرنیٹ کنکشن کی پڑتال کریں۔ اگر آپ انٹرنیٹ سے جڑنے کے قابل ہیں، تو شاید Firefox اسکرین شاٹ خدمات کے ساتھ عارظی مسلہ ہو۔" + }, + "loginErrorDetails": { + "message": "ہم آُپ کی شاٹ محفوظ نہیں کر سکے کیونکہ Firefox اسکرین شاٹ خدمت کے ساتھ مسلہ ہے۔ براہ مہربانی کچھ دیربعد کوشش کیجیئے۔ " + }, + "unshootablePageErrorTitle": { + "message": "ہم اس صفحہ کی اسکرین شاٹ نہیں کر سکتے۔" + }, + "unshootablePageErrorDetails": { + "message": "یہ ایک میعاری صفحہ نہہیں، تو آپ اسکی اسکرین شاٹ نہیں لے سکتے۔" + }, + "selfScreenshotErrorTitle": { + "message": "آپ Firefox اسکرین شاٹس صفحے! کی ایک شاٹ نہیں لے سکت" + }, + "genericErrorDetails": { + "message": "ہمیں یقین نہیں کہ کیا ہوا تھا۔ خیال رکھ کر پھر کوشش کریں یا بھر مختلف صفحہ کی تصویرلیں؟" + }, + "tourBodyOne": { + "message": "۔Firefox کو چھوڑے بغیر اسکرینشاٹس لیں، محفوظ کریں اور شیئر کریں۔" + }, + "tourHeaderTwo": { + "message": "جو آپ چاہتے ہیں وہ گرفت کریں" + }, + "tourBodyTwo": { + "message": "صفحہ کا ایک حصہ گرفت کرنے کے لیئے گھسیتیں اور کلک کریں.آُپ اپنے انتخاب کو نمایاں کرنے کے لیئے منڈلا سکتے ہیں۔" + }, + "tourHeaderThree": { + "message": "جس طرح آپ کو پسند ہے" + }, + "tourBodyThree": { + "message": "اپنے کمپیوٹڑ میں ڈائونلوڈ کرنے یا ویب پر آسانی سے شیئر کرنے کے لیئےاپنی کتری ہوئی شاٹس محفوظ کریں۔ آپ میری شاٹس کے بٹن پ کلک کر کے بھی اتمام پنی لی گئی شاٹس ڈھّونڈ سکتےہیں۔" + }, + "tourHeaderFour": { + "message": "دریچہ ہا مکمل صفحہ گرفت کریں" + }, + "tourBodyFour": { + "message": "دریچہ میں نظر آنے والے علاقے یا مکمل صفحہ کو گرفت کرنے کے لیئے بالائی دائیں جانب بٹن کا انتخاب کریں۔" + }, + "tourSkip": { + "message": "اچٹیں\t " + }, + "tourNext": { + "message": "اگلى سلائيڈ" + }, + "tourPrevious": { + "message": "پچھلی سلائڈ" + }, + "tourDone": { + "message": "ہوگیا" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/zh_CN/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/zh_CN/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/zh_CN/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/zh_CN/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "剪辑和拍摄 Web 截图,临时或永久保存它们。" + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "拍摄截图" + }, + "myShotsLink": { + "message": "我的截图" + }, + "screenshotInstructions": { + "message": "在页面上拖动或点击以选择范围。按 ESC 取消。" + }, + "saveScreenshotSelectedArea": { + "message": "保存" + }, + "saveScreenshotVisibleArea": { + "message": "保存可见范围" + }, + "saveScreenshotFullPage": { + "message": "保存整个页面" + }, + "cancelScreenshot": { + "message": "取消" + }, + "downloadScreenshot": { + "message": "下载" + }, + "notificationLinkCopiedTitle": { + "message": "链接已复制" + }, + "notificationLinkCopiedDetails": { + "message": "您的截图的链接已复制到剪贴板。按 $META_KEY$-V 粘贴。", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "出故障了。" + }, + "requestErrorDetails": { + "message": "很抱歉,我们无法为您保存截图。请稍后再试。" + }, + "connectionErrorTitle": { + "message": "我们无法连接到您的截图。" + }, + "connectionErrorDetails": { + "message": "请检查您的互联网连接。如果您正常连接到互联网,Firefox Screenshots 的服务器可能遇到了问题。" + }, + "loginErrorDetails": { + "message": "Firefox Screenshots 服务遇到问题,我们现在无法保存您的截图。请稍后再试。" + }, + "unshootablePageErrorTitle": { + "message": "我们无法截图此页面。" + }, + "unshootablePageErrorDetails": { + "message": "这不是一个标准的网页,所以无法截图。" + }, + "selfScreenshotErrorTitle": { + "message": "您不能拍摄 Firefox Screenshots 的页面!" + }, + "genericErrorTitle": { + "message": "哎呀,Firefox Screenshots 遇到问题。" + }, + "genericErrorDetails": { + "message": "我们不确定发生了什么。您可以再试一次或者试试另一个页面。" + }, + "tourBodyOne": { + "message": "拍摄、保存和分享屏幕截图,无需 Firefox 以外的工具。" + }, + "tourHeaderTwo": { + "message": "只拍摄想要的部分" + }, + "tourBodyTwo": { + "message": "单击并拖动以只拍摄页面某个区域。您也可以悬停以高亮您的选择范围。" + }, + "tourHeaderThree": { + "message": "做你所想" + }, + "tourBodyThree": { + "message": "将您裁剪后的截图保存到网上以便共享,或者下载到您的计算机。您也可以点击“我的截图”按钮找到您拍摄的所有截图。" + }, + "tourHeaderFour": { + "message": "拍摄窗口或整个页面" + }, + "tourBodyFour": { + "message": "选择右上角的按钮可以拍摄窗口中的可见区域或者整个页面。" + }, + "tourSkip": { + "message": "跳过" + }, + "tourNext": { + "message": "下一页" + }, + "tourPrevious": { + "message": "上一页" + }, + "tourDone": { + "message": "完成" + }, + "termsAndPrivacyNotice": { + "message": "使用 Firefox Screenshots 即代表您同意 Screenshots 的$TERMSANDPRIVACYNOTICETERMSLINK$和$TERMSANDPRIVACYNOTICEPRIVACYLINK$。", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "条款" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "隐私声明" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/zh_TW/messages.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/zh_TW/messages.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/_locales/zh_TW/messages.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/_locales/zh_TW/messages.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,123 @@ +{ + "addonDescription": { + "message": "拍攝網頁的擷圖,可暫時儲存或永久儲存。" + }, + "addonAuthorsList": { + "message": "Mozilla " + }, + "contextMenuLabel": { + "message": "拍攝畫面擷圖" + }, + "myShotsLink": { + "message": "我的擷圖" + }, + "screenshotInstructions": { + "message": "拖曳或點擊頁面來選擇區域,按下 ESC 取消。" + }, + "saveScreenshotSelectedArea": { + "message": "儲存" + }, + "saveScreenshotVisibleArea": { + "message": "儲存可見範圍" + }, + "saveScreenshotFullPage": { + "message": "儲存完整頁面" + }, + "cancelScreenshot": { + "message": "取消" + }, + "downloadScreenshot": { + "message": "下載" + }, + "notificationLinkCopiedTitle": { + "message": "已複製鏈結" + }, + "notificationLinkCopiedDetails": { + "message": "已將您拍攝的圖片鏈結複製到剪貼簿,按下 $META_KEY$+V 即可貼上。", + "placeholders": { + "meta_key": { + "content": "$1" + } + } + }, + "requestErrorTitle": { + "message": "系統維護中。" + }, + "requestErrorDetails": { + "message": "抱歉!無法儲存您拍攝的圖片,請稍候再試一次。" + }, + "connectionErrorTitle": { + "message": "無法連線至您的畫面擷圖。" + }, + "connectionErrorDetails": { + "message": "請檢查您的網路連線。若您可以正常上網,可能是 Firefox Screenshots 臨時出了問題。" + }, + "loginErrorDetails": { + "message": "Firefox Screenshots 服務發生問題,我們無法儲存您拍攝的擷圖。請稍候再試。" + }, + "unshootablePageErrorTitle": { + "message": "無法幫此頁面拍照。" + }, + "unshootablePageErrorDetails": { + "message": "這不是標準的網頁,無法拍照。" + }, + "selfScreenshotErrorTitle": { + "message": "您不能幫 Firefox Screenshots 的頁面拍照!" + }, + "genericErrorTitle": { + "message": "唉呀,Firefox Screenshots 有點秀逗了。" + }, + "genericErrorDetails": { + "message": "我們不確定剛剛發生了什麼事,您可以再試一次,或拍攝其他頁面的擷圖嗎?" + }, + "tourBodyOne": { + "message": "不用離開 Firefox 就可以拍攝、儲存、分享畫面擷圖。" + }, + "tourHeaderTwo": { + "message": "只拍你想拍的" + }, + "tourBodyTwo": { + "message": "點擊並拖曳出頁面當中的一部份,您也可以停留下來,強調選擇範圍。" + }, + "tourHeaderThree": { + "message": "用您想要的方式分享" + }, + "tourBodyThree": { + "message": "直接將裁切過的擷圖傳到網路上方便分享,或者下載到電腦上。您也可以點擊「我的擷圖」按鈕,尋找您拍過的所有擷圖。" + }, + "tourHeaderFour": { + "message": "拍攝視窗或整張網頁" + }, + "tourBodyFour": { + "message": "透過右上角的不同按鈕來選擇只拍攝視窗中的可見區域,或是整張網頁。" + }, + "tourSkip": { + "message": "略過" + }, + "tourNext": { + "message": "下一頁" + }, + "tourPrevious": { + "message": "上一頁" + }, + "tourDone": { + "message": "完成" + }, + "termsAndPrivacyNotice": { + "message": "使用 Firefox Screenshots,代表您同意 Screenshots 的 $TERMSANDPRIVACYNOTICETERMSLINK$ 及 $TERMSANDPRIVACYNOTICEPRIVACYLINK$。", + "placeholders": { + "termsandprivacynoticetermslink": { + "content": "$1" + }, + "termsandprivacynoticeprivacylink": { + "content": "$2" + } + } + }, + "termsAndPrivacyNoticeTermsLink": { + "message": "使用條款" + }, + "termsAndPrivacyNoticyPrivacyLink": { + "message": "隱私權保護政策" + } +} \ No newline at end of file diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/log.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/log.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/log.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/log.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,47 @@ +/* globals buildSettings */ + +"use strict"; + +this.log = (function () { + let exports = {}; + + const levels = ["debug", "info", "warn", "error"]; + if (! levels.includes(buildSettings.logLevel)) { + console.warn("Invalid buildSettings.logLevel:", buildSettings.logLevel); + } + let shouldLog = {}; + + { + let startLogging = false; + for (let level of levels) { + if (buildSettings.logLevel === level) { + startLogging = true; + } + if (startLogging) { + shouldLog[level] = true; + } + } + } + + function stub() {} + exports.debug = exports.info = exports.warn = exports.error = stub; + + if (shouldLog.debug) { + exports.debug = console.debug.bind(console); + } + + if (shouldLog.info) { + exports.info = console.info.bind(console); + } + + if (shouldLog.warn) { + exports.warn = console.warn.bind(console); + } + + if (shouldLog.error) { + exports.error = console.error.bind(console); + } + + return exports; +})(); +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/makeUuid.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/makeUuid.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/makeUuid.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/makeUuid.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,19 @@ +"use strict"; + +this.makeUuid = (function () { + + // generates a v4 UUID + return function makeUuid() { // eslint-disable-line no-unused-vars + // get sixteen unsigned 8 bit random values + var randomValues = window + .crypto + .getRandomValues(new Uint8Array(36)); + + return 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, function(c) { + var i = Array.prototype.slice.call(arguments).slice(-2)[0]; // grab the `offset` parameter + var r = randomValues[i]%16|0, v = c === 'x' ? r : (r&0x3|0x8); + return v.toString(16); + }); + }; +})(); +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/manifest.json firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/manifest.json --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/manifest.json 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/manifest.json 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,87 @@ +{ + "manifest_version": 2, + "name": "Firefox Screenshots", + "version": "6.3.0", + "description": "__MSG_addonDescription__", + "author": "__MSG_addonAuthorsList__", + "homepage_url": "https://github.com/mozilla-services/screenshots", + "applications": { + "gecko": { + "id": "screenshots@mozilla.org" + } + }, + "default_locale": "en_US", + "icons": { + "16": "icons/icon-16.png", + "32": "icons/icon-32.png", + "48": "icons/icon-48.png", + "64": "icons/icon-64.png", + "128": "icons/icon-128.png", + "256": "icons/icon-256.png" + }, + "browser_action": { + "default_icon": { + "19": "icons/icon-19.png", + "38": "icons/icon-38.png" + }, + "default_title": "__MSG_contextMenuLabel__", + "browser_style": false + }, + "background": { + "scripts": [ + "build/buildSettings.js", + "log.js", + "makeUuid.js", + "catcher.js", + "background/selectorLoader.js", + "background/communication.js", + "background/auth.js", + "background/senderror.js", + "build/raven.js", + "build/shot.js", + "background/analytics.js", + "background/deviceInfo.js", + "background/takeshot.js", + "background/main.js" + ] + }, + "content_scripts": [ + { + "matches": ["https://screenshots.firefox.com/*"], + "js": [ + "build/buildSettings.js", + "log.js", + "catcher.js", + "selector/callBackground.js", + "sitehelper.js" + ], + "run_at": "document_start" + } + ], + "web_accessible_resources": [ + "blank.html", + "icons/cancel.svg", + "icons/download.svg", + "icons/icon-256.png", + "icons/back.svg", + "icons/menu-fullpage.svg", + "icons/menu-visible.svg", + "icons/menu-myshot.svg", + "icons/onboarding-1.png", + "icons/onboarding-2.png", + "icons/onboarding-3.png", + "icons/onboarding-4.png", + "icons/done.svg" + ], + "permissions": [ + "activeTab", + "downloads", + "tabs", + "storage", + "notifications", + "clipboardWrite", + "contextMenus", + "", + "https://screenshots.firefox.com/" + ] +} diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/onboarding/slides.html firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/onboarding/slides.html --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/onboarding/slides.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/onboarding/slides.html 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,60 @@ + + + + + + + + +
+ +
+
+ +
+
+
+

Firefox ScreenshotsBeta

+

+
+ +
+
+
+
+
+

+

+
+
+
+
+
+

+

+
+
+
+
+
+

+

+
+
+ + + + + + +
+ + + + +
+ +
+
+ + diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/onboarding/slides.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/onboarding/slides.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/onboarding/slides.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/onboarding/slides.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,202 @@ +/* globals catcher, onboardingHtml, onboardingCss, browser, util, shooter, callBackground, assertIsTrusted */ + +"use strict"; + +this.slides = (function () { + let exports = {}; + + const { watchFunction } = catcher; + + let iframe; + let doc; + let currentSlide = 1; + let numberOfSlides; + let callbacks; + let backend; + + exports.display = function (addCallbacks) { + if (iframe) { + throw new Error("Attemted to call slides.display() twice"); + } + return new Promise((resolve, reject) => { + callbacks = addCallbacks; + // FIXME: a lot of this iframe logic is in ui.js; maybe move to util.js + iframe = document.createElement("iframe"); + iframe.src = browser.extension.getURL("blank.html"); + iframe.id = "firefox-screenshots-onboarding-iframe"; + iframe.style.zIndex = "99999999999"; + iframe.style.border = "none"; + iframe.style.position = "fixed"; + iframe.style.top = "0"; + iframe.style.left = "0"; + iframe.style.margin = "0"; + iframe.scrolling = "no"; + updateIframeSize(); + let html = onboardingHtml.replace('', ``); + html = html.replace(/MOZ_EXTENSION([^\"]+)/g, (match, filename) => { + return browser.extension.getURL(filename); + }); + iframe.onload = catcher.watchFunction(() => { + let parsedDom = (new DOMParser()).parseFromString( + html, + "text/html" + ); + doc = iframe.contentDocument; + doc.replaceChild( + doc.adoptNode(parsedDom.documentElement), + doc.documentElement + ); + doc.addEventListener("keyup", onKeyUp, false); + callBackground("getBackend").then((backendResult) => { + backend = backendResult; + localizeText(doc); + activateSlide(doc); + resolve(); + }).catch((error) => { + // Handled in communication.js + }); + }); + document.body.appendChild(iframe); + iframe.focus(); + window.addEventListener("resize", onResize, false); + }); + }; + + exports.remove = exports.unload = function () { + window.removeEventListener("resize", onResize, false); + if (doc) { + doc.removeEventListener("keyup", onKeyUp, false); + } + util.removeNode(iframe); + iframe = doc = null; + currentSlide = 1; + numberOfSlides = undefined; + callbacks = undefined; + }; + + function localizeText(doc) { + let els = doc.querySelectorAll("[data-l10n-id]"); + for (let el of els) { + let id = el.getAttribute("data-l10n-id"); + let text = browser.i18n.getMessage(id); + el.textContent = text; + } + els = doc.querySelectorAll("[data-l10n-label-id]"); + for (let el of els) { + let id = el.getAttribute("data-l10n-label-id"); + let text = browser.i18n.getMessage(id); + el.setAttribute("aria-label", text); + } + // termsAndPrivacyNotice is a more complicated substitution: + let termsContainer = doc.querySelector(".onboarding-legal-notice"); + termsContainer.innerHTML = ""; + let termsSentinal = "__TERMS__"; + let privacySentinal = "__PRIVACY__"; + let sentinalSplitter = "!!!"; + let linkTexts = { + [termsSentinal]: browser.i18n.getMessage("termsAndPrivacyNoticeTermsLink"), + [privacySentinal]: browser.i18n.getMessage("termsAndPrivacyNoticyPrivacyLink") + }; + let linkUrls = { + [termsSentinal]: "https://www.mozilla.org/about/legal/terms/services/", + [privacySentinal]: "https://www.mozilla.org/privacy/firefox-cloud/" + }; + let text = browser.i18n.getMessage( + "termsAndPrivacyNotice", + [sentinalSplitter + termsSentinal + sentinalSplitter, + sentinalSplitter + privacySentinal + sentinalSplitter]); + let parts = text.split(sentinalSplitter); + for (let part of parts) { + let el; + if (part === termsSentinal || part === privacySentinal) { + el = doc.createElement("a"); + el.href = linkUrls[part]; + el.textContent = linkTexts[part]; + el.target = "_blank"; + } else { + el = doc.createTextNode(part); + } + termsContainer.appendChild(el); + } + } + + function activateSlide(doc) { + numberOfSlides = parseInt(doc.querySelector("[data-number-of-slides]").getAttribute("data-number-of-slides"), 10); + doc.querySelector("#next").addEventListener("click", watchFunction(assertIsTrusted(() => { + shooter.sendEvent("navigate-slide", "next"); + next(); + })), false); + doc.querySelector("#prev").addEventListener("click", watchFunction(assertIsTrusted(() => { + shooter.sendEvent("navigate-slide", "prev"); + prev(); + })), false); + for (let el of doc.querySelectorAll(".goto-slide")) { + el.addEventListener("click", watchFunction(assertIsTrusted((event) => { + shooter.sendEvent("navigate-slide", "goto"); + let el = event.target; + let index = parseInt(el.getAttribute("data-number"), 10); + setSlide(index); + })), false); + } + doc.querySelector("#skip").addEventListener("click", watchFunction(assertIsTrusted((event) => { + shooter.sendEvent("cancel-slides", "skip"); + callbacks.onEnd(); + })), false); + doc.querySelector("#done").addEventListener("click", watchFunction(assertIsTrusted((event) => { + shooter.sendEvent("finish-slides", "done"); + callbacks.onEnd(); + })), false); + setSlide(1); + } + + function next() { + setSlide(currentSlide + 1); + } + + function prev() { + setSlide(currentSlide - 1); + } + + const onResize = catcher.watchFunction(function () { + if (! iframe) { + log.warn("slides onResize called when iframe is not setup"); + return; + } + updateIframeSize(); + }); + + function updateIframeSize() { + iframe.style.height = window.innerHeight + "px"; + iframe.style.width = window.innerWidth + "px"; + } + + const onKeyUp = catcher.watchFunction(assertIsTrusted(function (event) { + if ((event.key || event.code) === "Escape") { + shooter.sendEvent("cancel-slides", "keyboard-escape"); + callbacks.onEnd(); + } + })); + + function setSlide(index) { + if (index < 1) { + index = 1; + } + if (index > numberOfSlides) { + index = numberOfSlides; + } + shooter.sendEvent("visited-slide", `slide-${index}`); + currentSlide = index; + let slideEl = doc.querySelector("#slide-container"); + for (let i=1; i<=numberOfSlides; i++) { + let className = `active-slide-${i}`; + if (i == currentSlide) { + slideEl.classList.add(className); + } else { + slideEl.classList.remove(className); + } + } + } + + return exports; +})(); +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/randomString.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/randomString.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/randomString.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/randomString.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,14 @@ +/* exported randomString */ + +"use strict"; + +this.randomString = function randomString(length, chars) { + let randomStringChars = "abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789"; + chars = chars || randomStringChars; + let result = ""; + for (let i=0; i { + if (result.type === "success") { + return result.value; + } else if (result.type === "error") { + let exc = new Error(result.message); + exc.name = "BackgroundError"; + throw exc; + } else { + log.error("Unexpected background result:", result); + let exc = new Error(`Bad response type from background page: ${result.type || undefined}`); + exc.resultType = result.type || "undefined"; + throw exc; + } + }); +} +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/selector/documentMetadata.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/selector/documentMetadata.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/selector/documentMetadata.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/selector/documentMetadata.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,87 @@ +"use strict"; + +this.documentMetadata = (function () { + + function findSiteName() { + let el = document.querySelector("meta[property='og:site_name']"); + if (el) { + return el.getAttribute("content"); + } + // nytimes.com uses this property: + el = document.querySelector("meta[name='cre']"); + if (el) { + return el.getAttribute("content"); + } + return null; + } + + function getOpenGraph() { + let openGraph = {}; + // If you update this, also update _OPENGRAPH_PROPERTIES in shot.js: + let forceSingle = `title type url`.split(/\s+/g); + let openGraphProperties = ` + title type url image audio description determiner locale site_name video + image:secure_url image:type image:width image:height + video:secure_url video:type video:width image:height + audio:secure_url audio:type + article:published_time article:modified_time article:expiration_time article:author article:section article:tag + book:author book:isbn book:release_date book:tag + profile:first_name profile:last_name profile:username profile:gender + `.split(/\s+/g); + for (let prop of openGraphProperties) { + let elems = document.querySelectorAll(`meta[property='og:${prop}']`); + if (forceSingle.includes(prop) && elems.length > 1) { + elems = [elems[0]]; + } + let value; + if (elems.length > 1) { + value = []; + for (let elem of elems) { + let v = elem.getAttribute("content"); + if (v) { + value.push(v); + } + } + if (! value.length) { + value = null; + } + } else if (elems.length === 1) { + value = elems[0].getAttribute("content"); + } + if (value) { + openGraph[prop] = value; + } + } + return openGraph; + } + + function getTwitterCard() { + let twitterCard = {}; + // If you update this, also update _TWITTERCARD_PROPERTIES in shot.js: + let properties = ` + card site title description image + player player:width player:height player:stream player:stream:content_type + `.split(/\s+/g); + for (let prop of properties) { + let elem = document.querySelector(`meta[name='twitter:${prop}']`); + if (elem) { + let value = elem.getAttribute("content"); + if (value) { + twitterCard[prop] = value; + } + } + } + return twitterCard; + } + + return function documentMetadata() { + let result = {}; + result.docTitle = document.title; + result.siteName = findSiteName(); + result.openGraph = getOpenGraph(); + result.twitterCard = getTwitterCard(); + return result; + }; + +})(); +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/selector/shooter.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/selector/shooter.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/selector/shooter.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/selector/shooter.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,151 @@ +/* globals callBackground, documentMetadata, uicontrol, util, ui, catcher */ +/* globals XMLHttpRequest, window, location, alert, console, domainFromUrl, randomString */ +/* globals clipboard, document, setTimeout, location */ + +"use strict"; + +this.shooter = (function () { // eslint-disable-line no-unused-vars + let exports = {}; + const { AbstractShot } = window.shot; + + const RANDOM_STRING_LENGTH = 16; + let backend; + let shot; + let supportsDrawWindow; + + function regexpEscape(str) { + // http://stackoverflow.com/questions/3115150/how-to-escape-regular-expression-special-characters-using-javascript + return str.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + } + + function sanitizeError(data) { + const href = new RegExp(regexpEscape(window.location.href), 'g'); + const origin = new RegExp(`${regexpEscape(window.location.origin)}[^\s",>]*`, 'g'); + const json = JSON.stringify(data) + .replace(href, 'REDACTED_HREF') + .replace(origin, 'REDACTED_URL'); + const result = JSON.parse(json); + return result; + } + + catcher.registerHandler((errorObj) => { + callBackground("reportError", sanitizeError(errorObj)); + }); + + { + let canvas = document.createElementNS('http://www.w3.org/1999/xhtml', 'canvas'); + let ctx = canvas.getContext('2d'); + supportsDrawWindow = !! ctx.drawWindow; + } + + function screenshotPage(selectedPos) { + if (! supportsDrawWindow) { + return null; + } + let height = selectedPos.bottom - selectedPos.top; + let width = selectedPos.right - selectedPos.left; + let canvas = document.createElementNS('http://www.w3.org/1999/xhtml', 'canvas'); + canvas.width = width * window.devicePixelRatio; + canvas.height = height * window.devicePixelRatio; + let ctx = canvas.getContext('2d'); + if (window.devicePixelRatio !== 1) { + ctx.scale(window.devicePixelRatio, window.devicePixelRatio); + } + ui.iframe.hide(); + try { + ctx.drawWindow(window, selectedPos.left, selectedPos.top, width, height, "#fff"); + } finally { + ui.iframe.unhide(); + } + return canvas.toDataURL(); + } + + let isSaving = null; + + exports.takeShot = function (captureType, selectedPos) { + // isSaving indicates we're aleady in the middle of saving + // we use a timeout so in the case of a failure the button will + // still start working again + if (isSaving) { + return; + } + isSaving = setTimeout(() => { + isSaving = null; + }, 1000); + selectedPos = selectedPos.asJson(); + let captureText = util.captureEnclosedText(selectedPos); + let dataUrl = screenshotPage(selectedPos); + if (dataUrl) { + shot.addClip({ + createdDate: Date.now(), + image: { + url: dataUrl, + captureType, + text: captureText, + location: selectedPos, + dimensions: { + x: selectedPos.right - selectedPos.left, + y: selectedPos.bottom - selectedPos.top + } + } + }); + } + catcher.watchPromise(callBackground("takeShot", { + captureType, + captureText, + scroll: { + scrollX: window.scrollX, + scrollY: window.scrollY, + innerHeight: window.innerHeight, + innerWidth: window.innerWidth + }, + selectedPos, + shotId: shot.id, + shot: shot.asJson() + }).then((url) => { + const copied = clipboard.copy(url); + return callBackground("openShot", { url, copied }); + }, (error) => { + if (error.name != "BackgroundError") { + // BackgroundError errors are reported in the Background page + throw error; + } + }).then(() => uicontrol.deactivate())); + }; + + exports.downloadShot = function (selectedPos) { + let dataUrl = screenshotPage(selectedPos); + let promise = Promise.resolve(dataUrl); + if (! dataUrl) { + promise = callBackground( + "screenshotPage", + selectedPos.asJson(), + { + scrollX: window.scrollX, + scrollY: window.scrollY, + innerHeight: window.innerHeight, + innerWidth: window.innerWidth + }); + } + catcher.watchPromise(promise.then((dataUrl) => { + ui.triggerDownload(dataUrl, shot.filename); + uicontrol.deactivate(); + })); + }; + + exports.sendEvent = function (...args) { + callBackground("sendEvent", ...args); + }; + + shot = new AbstractShot( + backend, + randomString(RANDOM_STRING_LENGTH) + "/" + domainFromUrl(location), + { + origin: window.shot.originFromUrl(location.href) + } + ); + shot.update(documentMetadata()); + + return exports; +})(); +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/selector/uicontrol.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/selector/uicontrol.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/selector/uicontrol.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/selector/uicontrol.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,907 @@ +/* globals console, catcher, util, ui, slides */ +/* globals window, document, location, shooter, callBackground, selectorLoader, assertIsTrusted */ + +"use strict"; + +this.uicontrol = (function () { + let exports = {}; + + /********************************************************** + * selection + */ + + /* States: + + "crosshairs": + Nothing has happened, and the crosshairs will follow the movement of the mouse + "draggingReady": + The user has pressed the mouse button, but hasn't moved enough to create a selection + "dragging": + The user has pressed down a mouse button, and is dragging out an area far enough to show a selection + "selected": + The user has selected an area + "resizing": + The user is resizing the selection + "cancelled": + Everything has been cancelled + + A mousedown goes from crosshairs to dragging. + A mouseup goes from dragging to selected + A click outside of the selection goes from selected to crosshairs + A click on one of the draggers goes from selected to resizing + + State variables: + + state (string, one of the above) + mousedownPos (object with x/y during draggingReady, shows where the selection started) + selectedPos (object with x/y/h/w during selected or dragging, gives the entire selection) + resizeDirection (string: top, topLeft, etc, during resizing) + resizeStartPos (x/y position where resizing started) + mouseupNoAutoselect (true if a mouseup in draggingReady should not trigger autoselect) + + */ + + const { watchFunction, watchPromise } = catcher; + + const MAX_PAGE_HEIGHT = 5000; + const MAX_PAGE_WIDTH = 5000; + // An autoselection smaller than these will be ignored entirely: + const MIN_DETECT_ABSOLUTE_HEIGHT = 10; + const MIN_DETECT_ABSOLUTE_WIDTH = 30; + // An autoselection smaller than these will not be preferred: + const MIN_DETECT_HEIGHT = 30; + const MIN_DETECT_WIDTH = 100; + // An autoselection bigger than either of these will be ignored: + const MAX_DETECT_HEIGHT = Math.max(window.innerHeight + 100, 700); + const MAX_DETECT_WIDTH = Math.max(window.innerWidth + 100, 1000); + // This is how close (in pixels) you can get to the edge of the window and then + // it will scroll: + const SCROLL_BY_EDGE = 20; + + const { sendEvent } = shooter; + + function round10(n) { + return Math.floor(n / 10) * 10; + } + + function eventOptionsForBox(box) { + return { + cd1: round10(Math.abs(box.bottom - box.top)), + cd2: round10(Math.abs(box.right - box.left)) + }; + } + + function eventOptionsForResize(boxStart, boxEnd) { + return { + cd1: round10( + (boxEnd.bottom - boxEnd.top) + - (boxStart.bottom - boxStart.top)), + cd2: round10( + (boxEnd.right - boxEnd.left) + - (boxStart.right - boxStart.left)) + }; + } + + function eventOptionsForMove(posStart, posEnd) { + return { + cd1: round10(posEnd.y - posStart.y), + cd2: round10(posEnd.x - posStart.x) + }; + } + + /*********************************************** + * State and stateHandlers infrastructure + */ + + // This enumerates all the anchors on the selection, and what part of the + // selection they move: + const movements = { + topLeft: ["x1", "y1"], + top: [null, "y1"], + topRight: ["x2", "y1"], + left: ["x1", null], + right: ["x2", null], + bottomLeft: ["x1", "y2"], + bottom: [null, "y2"], + bottomRight: ["x2", "y2"], + move: ["*", "*"] + }; + + const doNotAutoselectTags = { + H1: true, + H2: true, + H3: true, + H4: true, + H5: true, + H6: true + }; + + let standardDisplayCallbacks = { + cancel: () => { + sendEvent("cancel-shot", "overlay-cancel-button"); + exports.deactivate(); + }, save: () => { + sendEvent("save-shot", "overlay-save-button"); + shooter.takeShot("selection", selectedPos); + }, download: () => { + sendEvent("download-shot", "overlay-download-button"); + shooter.downloadShot(selectedPos); + } + }; + + let standardOverlayCallbacks = { + onOpenMyShots: () => { + sendEvent("goto-myshots", "selection-button"); + callBackground("openMyShots") + .then(() => exports.deactivate()) + .catch(() => { + // Handled in communication.js + }); + }, + onClickVisible: () => { + sendEvent("capture-visible", "selection-button"); + selectedPos = new Selection( + window.scrollX, window.scrollY, + window.scrollX + window.innerWidth, window.scrollY + window.innerHeight); + shooter.takeShot("visible", selectedPos); + }, + onClickFullPage: () => { + sendEvent("capture-full-page", "selection-button"); + let width = Math.max( + document.body.clientWidth, + document.documentElement.clientWidth, + document.body.scrollWidth, + document.documentElement.scrollWidth); + width = Math.min(width, MAX_PAGE_WIDTH); + let height = Math.max( + document.body.clientHeight, + document.documentElement.clientHeight, + document.body.scrollHeight, + document.documentElement.scrollHeight); + height = Math.min(height, MAX_PAGE_HEIGHT); + selectedPos = new Selection( + 0, 0, + width, height); + shooter.takeShot("fullPage", selectedPos); + } + } + + /** Holds all the objects that handle events for each state: */ + let stateHandlers = {}; + + function getState() { + return getState.state; + } + getState.state = "cancel"; + + function setState(s) { + if (! stateHandlers[s]) { + throw new Error("Unknown state: " + s); + } + let cur = getState.state; + let handler = stateHandlers[cur]; + if (handler.end) { + handler.end(); + } + getState.state = s; + if (stateHandlers[s].start) { + stateHandlers[s].start(); + } + } + + /** Various values that the states use: */ + let mousedownPos; + let selectedPos; + let resizeDirection; + let resizeStartPos; + let resizeStartSelected; + let resizeHasMoved; + let mouseupNoAutoselect = false; + let autoDetectRect; + + /** Represents a selection box: */ + class Selection { + constructor(x1, y1, x2, y2) { + this.x1 = x1; + this.y1 = y1; + this.x2 = x2; + this.y2 = y2; + } + + rect() { + return { + top: Math.floor(this.top), + left: Math.floor(this.left), + bottom: Math.floor(this.bottom), + right: Math.floor(this.right) + }; + } + + get top() { + return Math.min(this.y1, this.y2); + } + set top(val) { + if (this.y1 < this.y2) { + this.y1 = val; + } else { + this.y2 = val; + } + } + + get bottom() { + return Math.max(this.y1, this.y2); + } + set bottom(val) { + if (this.y1 > this.y2) { + this.y1 = val; + } else { + this.y2 = val; + } + } + + get left() { + return Math.min(this.x1, this.x2); + } + set left(val) { + if (this.x1 < this.x2) { + this.x1 = val; + } else { + this.x2 = val; + } + } + + get right() { + return Math.max(this.x1, this.x2); + } + set right(val) { + if (this.x1 > this.x2) { + this.x1 = val; + } else { + this.x2 = val; + } + } + + get width() { + return Math.abs(this.x1 - this.x2); + } + get height() { + return Math.abs(this.y1 - this.y2); + } + + /** Sort x1/x2 and y1/y2 so x1 this.x2) { + let tmp = this.x2; + this.x2 = this.x1; + this.x1 = tmp; + } + if (this.y1 > this.y2) { + let tmp = this.y2; + this.y2 = this.y1; + this.y1 = tmp; + } + } + + union(other) { + return new Selection( + Math.min(this.left, other.left), + Math.min(this.top, other.top), + Math.max(this.right, other.right), + Math.max(this.bottom, other.bottom) + ); + } + + clone() { + return new Selection(this.x1, this.y1, this.x2, this.y2); + } + + asJson() { + return { + left: this.left, + right: this.right, + top: this.top, + bottom: this.bottom + }; + } + } + + Selection.getBoundingClientRect = function (el) { + if (! el.getBoundingClientRect) { + // Typically the element or somesuch + return null; + } + let rect = el.getBoundingClientRect(); + if (! rect) { + return null; + } + return new Selection(rect.left, rect.top, rect.right, rect.bottom); + }; + + /** Represents a single x/y point, typically for a mouse click that doesn't have a drag: */ + class Pos { + constructor(x, y) { + this.x = x; + this.y = y; + } + + elementFromPoint() { + return ui.iframe.getElementFromPoint( + this.x - window.pageXOffset, + this.y - window.pageYOffset + ); + } + + distanceTo(x, y) { + return Math.sqrt(Math.pow(this.x - x, 2), Math.pow(this.y - y)); + } + } + + /*********************************************** + * all stateHandlers + */ + + stateHandlers.onboarding = { + start: function () { + if (typeof slides == "undefined") { + throw new Error("Attempted to set state to onboarding without loading slides"); + } + catcher.watchPromise(slides.display({ + onEnd: this.slidesOnEnd.bind(this) + })); + }, + + slidesOnEnd: function () { + callBackground("hasSeenOnboarding"); + setState("crosshairs"); + }, + + end: function () { + slides.remove(); + } + }; + + stateHandlers.crosshairs = { + + cachedEl: null, + + start: function () { + selectedPos = mousedownPos = null; + this.cachedEl = null; + watchPromise(ui.iframe.display(installHandlersOnDocument, standardOverlayCallbacks).then(() => { + ui.iframe.usePreSelection(); + ui.Box.remove(); + const handler = watchFunction(assertIsTrusted(keyupHandler)); + document.addEventListener("keyup", handler, false); + registeredDocumentHandlers.push({name: "keyup", doc: document, handler}); + })); + }, + + mousemove: function (event) { + ui.PixelDimensions.display(event.pageX, event.pageY, event.pageX, event.pageY); + if (event.target.classList && + (! event.target.classList.contains("preview-overlay"))) { + // User is hovering over a toolbar button or control + autoDetectRect = null; + ui.HoverBox.hide(); + return; + } + let el; + if (event.target.classList.contains("preview-overlay")) { + // The hover is on the overlay, so we need to figure out the real element + el = ui.iframe.getElementFromPoint( + event.pageX + window.scrollX - window.pageXOffset, + event.pageY + window.scrollY - window.pageYOffset + ); + } else { + // The hover is on the element we care about, so we use that + el = event.target; + } + if (this.cachedEl && this.cachedEl === el) { + // Still hovering over the same element + return; + } + this.cachedEl = el; + this.setAutodetectBasedOnElement(el); + }, + + setAutodetectBasedOnElement: function (el) { + let lastRect; + let lastNode; + let rect; + let attemptExtend = false; + let node = el; + while (node) { + rect = Selection.getBoundingClientRect(node); + if (! rect) { + rect = lastRect; + break; + } + if (rect.width > MAX_DETECT_WIDTH || rect.height > MAX_DETECT_HEIGHT) { + // Then the last rectangle is better + rect = lastRect; + attemptExtend = true; + break; + } + if (rect.width >= MIN_DETECT_WIDTH && rect.height >= MIN_DETECT_HEIGHT) { + if (! doNotAutoselectTags[node.tagName]) { + break; + } + } + lastRect = rect; + lastNode = node; + node = node.parentNode; + } + if (rect && node) { + let evenBetter = this.evenBetterElement(node, rect); + if (evenBetter) { + node = lastNode = evenBetter; + rect = Selection.getBoundingClientRect(evenBetter); + attemptExtend = false; + } + } + if (rect && attemptExtend) { + let extendNode = lastNode.nextSibling; + while (extendNode) { + if (extendNode.nodeType === document.ELEMENT_NODE) { + break; + } + extendNode = extendNode.nextSibling; + if (! extendNode) { + let parent = lastNode.parentNode; + for (let i=0; i this.minMove) { + selectedPos = new Selection( + mousedownPos.x, + mousedownPos.y, + event.pageX + window.scrollX, + event.pageY + window.scrollY); + mousedownPos = null; + setState("dragging"); + } + }, + + mouseup: function (event) { + // If we don't get into "dragging" then we attempt an autoselect + if (mouseupNoAutoselect) { + sendEvent("cancel-selection", "selection-background-mousedown"); + setState("crosshairs"); + return false; + } + if (autoDetectRect) { + selectedPos = autoDetectRect; + selectedPos.x1 += window.scrollX; + selectedPos.y1 += window.scrollY; + selectedPos.x2 += window.scrollX; + selectedPos.y2 += window.scrollY; + autoDetectRect = null; + mousedownPos = null; + ui.iframe.useSelection(); + ui.Box.display(selectedPos, standardDisplayCallbacks); + sendEvent("make-selection", "selection-click", eventOptionsForBox(selectedPos)); + setState("selected"); + sendEvent("autoselect"); + } else { + sendEvent("no-selection", "no-element-found"); + setState("crosshairs"); + } + }, + + click: function (event) { + this.mouseup(event); + }, + + findGoodEl: function () { + let el = mousedownPos.elementFromPoint(); + if (! el) { + return null; + } + let isGoodEl = (el) => { + if (el.nodeType != document.ELEMENT_NODE) { + return false; + } + if (el.tagName == "IMG") { + let rect = el.getBoundingClientRect(); + return rect.width >= this.minAutoImageWidth && rect.height >= this.minAutoImageHeight; + } + let display = window.getComputedStyle(el).display; + if (['block', 'inline-block', 'table'].indexOf(display) != -1) { + return true; + // FIXME: not sure if this is useful: + //let rect = el.getBoundingClientRect(); + //return rect.width <= this.maxAutoElementWidth && rect.height <= this.maxAutoElementHeight; + } + return false; + }; + while (el) { + if (isGoodEl(el)) { + return el; + } + el = el.parentNode; + } + return null; + }, + + end: function () { + mouseupNoAutoselect = false; + } + + }; + + stateHandlers.dragging = { + + start: function () { + ui.iframe.useSelection(); + ui.Box.display(selectedPos); + }, + + mousemove: function (event) { + selectedPos.x2 = util.truncateX(event.pageX); + selectedPos.y2 = util.truncateY(event.pageY); + scrollIfByEdge(event.pageX, event.pageY); + ui.Box.display(selectedPos); + ui.PixelDimensions.display(event.pageX, event.pageY, selectedPos.width, selectedPos.height); + }, + + mouseup: function (event) { + selectedPos.x2 = util.truncateX(event.pageX); + selectedPos.y2 = util.truncateY(event.pageY); + ui.Box.display(selectedPos, standardDisplayCallbacks); + sendEvent( + "make-selection", "selection-drag", + eventOptionsForBox({ + top: selectedPos.y1, + bottom: selectedPos.y2, + left: selectedPos.x1, + right: selectedPos.x2 + })); + setState("selected"); + }, + + end: function () { + ui.PixelDimensions.remove(); + } + }; + + stateHandlers.selected = { + start: function () { + ui.iframe.useSelection(); + }, + + mousedown: function (event) { + let target = event.target; + if (target.tagName == "HTML") { + // This happens when you click on the scrollbar + return; + } + let direction = ui.Box.draggerDirection(target); + if (direction) { + sendEvent("start-resize-selection", "handle"); + stateHandlers.resizing.startResize(event, direction); + } else if (ui.Box.isSelection(target)) { + sendEvent("start-move-selection", "selection"); + stateHandlers.resizing.startResize(event, "move"); + } else if (! ui.Box.isControl(target)) { + mousedownPos = new Pos(event.pageX, event.pageY); + setState("crosshairs"); + } + event.preventDefault(); + return false; + } + }; + + stateHandlers.resizing = { + start: function () { + ui.iframe.useSelection(); + selectedPos.sortCoords(); + }, + + startResize: function (event, direction) { + selectedPos.sortCoords(); + resizeDirection = direction; + resizeStartPos = new Pos(event.pageX, event.pageY); + resizeStartSelected = selectedPos.clone(); + resizeHasMoved = false; + setState("resizing"); + }, + + mousemove: function (event) { + this._resize(event); + return false; + }, + + mouseup: function (event) { + this._resize(event); + sendEvent("selection-resized"); + ui.Box.display(selectedPos, standardDisplayCallbacks); + if (resizeHasMoved) { + if (resizeDirection == "move") { + let startPos = new Pos(resizeStartSelected.left, resizeStartSelected.top); + let endPos = new Pos(selectedPos.left, selectedPos.top); + sendEvent( + "move-selection", "mouseup", + eventOptionsForMove(startPos, endPos)); + } else { + sendEvent( + "resize-selection", "mouseup", + eventOptionsForResize(resizeStartSelected, selectedPos)); + } + } else { + if (resizeDirection == "move") { + sendEvent("keep-resize-selection", "mouseup"); + } else { + sendEvent("keep-move-selection", "mouseup"); + } + } + setState("selected"); + }, + + _resize: function (event) { + let diffX = event.pageX - resizeStartPos.x; + let diffY = event.pageY - resizeStartPos.y; + let movement = movements[resizeDirection]; + if (movement[0]) { + let moveX = movement[0]; + moveX = moveX == "*" ? ["x1", "x2"] : [moveX]; + for (let moveDir of moveX) { + selectedPos[moveDir] = util.truncateX(resizeStartSelected[moveDir] + diffX); + } + } + if (movement[1]) { + let moveY = movement[1]; + moveY = moveY == "*" ? ["y1", "y2"] : [moveY]; + for (let moveDir of moveY) { + selectedPos[moveDir] = util.truncateY(resizeStartSelected[moveDir] + diffY); + } + } + if (diffX || diffY) { + resizeHasMoved = true; + } + scrollIfByEdge(event.pageX, event.pageY); + ui.Box.display(selectedPos); + }, + + end: function () { + resizeDirection = resizeStartPos = resizeStartSelected = null; + selectedPos.sortCoords(); + } + }; + + stateHandlers.cancel = { + start: function () { + ui.iframe.hide(); + ui.Box.remove(); + } + }; + + let documentWidth = Math.max( + document.body.clientWidth, + document.documentElement.clientWidth, + document.body.scrollWidth, + document.documentElement.scrollWidth); + let documentHeight = Math.max( + document.body.clientHeight, + document.documentElement.clientHeight, + document.body.scrollHeight, + document.documentElement.scrollHeight); + + function scrollIfByEdge(pageX, pageY) { + let top = window.scrollY; + let bottom = top + window.innerHeight; + let left = window.scrollX; + let right = left + window.innerWidth; + if (pageY + SCROLL_BY_EDGE >= bottom && bottom < documentHeight) { + window.scrollBy(0, SCROLL_BY_EDGE); + } else if (pageY - SCROLL_BY_EDGE <= top) { + window.scrollBy(0, -SCROLL_BY_EDGE); + } + if (pageX + SCROLL_BY_EDGE >= right && right < documentWidth) { + window.scrollBy(SCROLL_BY_EDGE, 0); + } else if (pageX - SCROLL_BY_EDGE <= left) { + window.scrollBy(-SCROLL_BY_EDGE, 0); + } + } + + /*********************************************** + * Selection communication + */ + + // If the slides module is loaded then we're supposed to onboard + let shouldOnboard = typeof slides !== "undefined"; + + exports.activate = function () { + if (isFrameset()) { + callBackground("abortFrameset"); + selectorLoader.unloadModules(); + return; + } + addHandlers(); + // FIXME: self.options is gone + if (self.options && self.options.styleMyShotsButton) { + ui.iframe.addClassName = `styleMyShotsButton-${self.options.styleMyShotsButton.value}`; + } + if (shouldOnboard) { + setState("onboarding"); + } else { + setState("crosshairs"); + } + } + + function isFrameset() { + return document.body.tagName == "FRAMESET"; + } + + exports.deactivate = function () { + try { + setState("cancel"); + callBackground('closeSelector'); + selectorLoader.unloadModules(); + } catch (e) { + log.error('Error in deactivate', e) + // Sometimes this fires so late that the document isn't available + // We don't care about the exception, so we swallow it here + } + }; + + exports.unload = function () { + // Note that ui.unload() will be called on its own + removeHandlers(); + }; + + /*********************************************** + * Event handlers + */ + + let primedDocumentHandlers = new Map(); + let registeredDocumentHandlers = [] + + function addHandlers() { + ["mouseup", "mousedown", "mousemove", "click"].forEach((eventName) => { + let fn = watchFunction((function (eventName, event) { + if (typeof event.button == "number" && event.button !== 0) { + // Not a left click + return; + } + if (event.ctrlKey || event.shiftKey || event.altKey || event.metaKey) { + // Modified click of key + return; + } + let state = getState(); + let handler = stateHandlers[state]; + if (handler[eventName]) { + return handler[eventName](event); + } + }).bind(null, eventName)); + primedDocumentHandlers.set(eventName, fn); + }); + primedDocumentHandlers.set("keyup", keyupHandler); + window.addEventListener('beforeunload', beforeunloadHandler); + } + + function installHandlersOnDocument(docObj) { + for (let [eventName, handler] of primedDocumentHandlers) { + let watchHandler = watchFunction(handler); + docObj.addEventListener(eventName, watchHandler, eventName !== "keyup"); + registeredDocumentHandlers.push({name: eventName, doc: docObj, watchHandler}); + } + let mousedownHandler = primedDocumentHandlers.get("mousedown"); + document.addEventListener("mousedown", mousedownHandler, true); + registeredDocumentHandlers.push({name: "mousedown", doc: document, watchHandler: mousedownHandler, useCapture: true}); + } + + function beforeunloadHandler() { + sendEvent("cancel-shot", "tab-load"); + exports.deactivate(); + } + + function keyupHandler(event) { + if (event.ctrlKey || event.shiftKey || event.altKey || event.metaKey) { + // Modified + return; + } + if ((event.key || event.code) === "Escape") { + sendEvent("cancel-shot", "keyboard-escape"); + exports.deactivate(); + } + if ((event.key || event.code) === "Enter") { + if (getState.state === "selected") { + sendEvent("save-shot", "keyboard-enter"); + shooter.takeShot("selection", selectedPos); + } + } + } + + function removeHandlers() { + window.removeEventListener("beforeunload", beforeunloadHandler); + for (let {name, doc, handler, useCapture} of registeredDocumentHandlers) { + doc.removeEventListener(name, handler, !!useCapture); + } + registeredDocumentHandlers = []; + } + + exports.activate(); + + return exports; +})(); + +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/selector/ui.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/selector/ui.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/selector/ui.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/selector/ui.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,609 @@ +/* globals window, document, console, browser */ +/* globals util, catcher, inlineSelectionCss, callBackground, assertIsTrusted */ + +"use strict"; + +this.ui = (function () { // eslint-disable-line no-unused-vars + let exports = {}; + const SAVE_BUTTON_HEIGHT = 50; + + const { watchFunction } = catcher; + + // The tag itself can have margins and offsets, which need to be used when + // setting the position of the boxEl. + function getBodyRect() { + if (getBodyRect.cached) { + return getBodyRect.cached; + } + let rect = document.body.getBoundingClientRect(); + let cached = { + top: rect.top + window.scrollY, + bottom: rect.bottom + window.scrollY, + left: rect.left + window.scrollX, + right: rect.right + window.scrollX + }; + // FIXME: I can't decide when this is necessary + // *not* necessary on http://patriciogonzalezvivo.com/2015/thebookofshaders/ + // (actually causes mis-selection there) + // *is* necessary on http://atirip.com/2015/03/17/sorry-sad-state-of-matrix-transforms-in-browsers/ + cached = {top: 0, bottom: 0, left: 0, right: 0}; + getBodyRect.cached = cached; + return cached; + } + + exports.isHeader = function (el) { + while (el) { + if (el.classList && + (el.classList.contains("myshots-button") || + el.classList.contains("visible") || + el.classList.contains("full-page"))) { + return true; + } + el = el.parentNode; + } + return false; + } + + let substitutedCss = inlineSelectionCss.replace(/MOZ_EXTENSION([^\"]+)/g, (match, filename) => { + return browser.extension.getURL(filename); + }); + + function makeEl(tagName, className) { + if (! iframe.document()) { + throw new Error("Attempted makeEl before iframe was initialized"); + } + let el = iframe.document().createElement(tagName); + if (className) { + el.className = className; + } + return el; + } + + function onResize() { + if (this.sizeTracking.windowDelayer) { + clearTimeout(this.sizeTracking.windowDelayer); + } + this.sizeTracking.windowDelayer = setTimeout(watchFunction(() => { + this.updateElementSize(true); + }), 50); + } + + let iframeSelection = exports.iframeSelection = { + element: null, + addClassName: "", + sizeTracking: { + timer: null, + windowDelayer: null, + lastHeight: null, + lastWidth: null + }, + document: null, + display: function (installHandlerOnDocument) { + return new Promise((resolve, reject) => { + if (! this.element) { + this.element = document.createElement("iframe"); + this.element.src = browser.extension.getURL("blank.html"); + this.element.id = "firefox-screenshots-selection-iframe"; + this.element.style.display = "none"; + this.element.style.zIndex = "99999999999"; + this.element.style.border = "none"; + this.element.style.position = "absolute"; + this.element.style.top = "0"; + this.element.style.left = "0"; + this.element.style.margin = "0"; + this.element.scrolling = "no"; + this.updateElementSize(); + this.element.onload = watchFunction(() => { + this.document = this.element.contentDocument; + this.document.documentElement.innerHTML = ` + + + + + `; + installHandlerOnDocument(this.document); + if (this.addClassName) { + this.document.body.className = this.addClassName; + } + resolve(); + }); + document.body.appendChild(this.element); + } else { + resolve(); + } + }); + }, + + hide: function () { + this.element.style.display = "none"; + this.stopSizeWatch(); + }, + + unhide: function () { + this.updateElementSize(); + this.element.style.display = ""; + this.initSizeWatch(); + this.element.focus(); + }, + + updateElementSize: function (force) { + // Note: if someone sizes down the page, then the iframe will keep the + // document from naturally shrinking. We use force to temporarily hide + // the element so that we can tell if the document shrinks + const visible = this.element.style.display !== "none"; + if (force && visible) { + this.element.style.display = "none"; + } + let height = Math.max( + document.documentElement.clientHeight, + document.body.clientHeight, + document.documentElement.scrollHeight, + document.body.scrollHeight, + window.innerHeight); + if (height !== this.sizeTracking.lastHeight) { + this.sizeTracking.lastHeight = height; + this.element.style.height = height + "px"; + } + let width = Math.max( + document.documentElement.clientWidth, + document.body.clientWidth, + document.documentElement.scrollWidth, + document.body.scrollWidth, + window.innerWidth); + if (width !== this.sizeTracking.lastWidth) { + this.sizeTracking.lastWidth = width; + this.element.style.width = width + "px"; + } + if (force && visible) { + this.element.style.display = ""; + } + }, + + initSizeWatch: function () { + this.stopSizeWatch(); + this.sizeTracking.timer = setInterval(watchFunction(this.updateElementSize.bind(this)), 2000); + window.addEventListener("resize", this.onResize, true); + }, + + stopSizeWatch: function () { + if (this.sizeTracking.timer) { + clearTimeout(this.sizeTracking.timer); + this.sizeTracking.timer = null; + } + if (this.sizeTracking.windowDelayer) { + clearTimeout(this.sizeTracking.windowDelayer); + this.sizeTracking.windowDelayer = null; + } + this.sizeTracking.lastHeight = this.sizeTracking.lastWidth = null; + window.removeEventListener("resize", this.onResize, true); + }, + + getElementFromPoint: function (x, y) { + this.element.style.pointerEvents = "none"; + let el; + try { + el = document.elementFromPoint(x, y); + } finally { + this.element.style.pointerEvents = ""; + } + return el; + }, + + remove: function () { + this.stopSizeWatch(); + util.removeNode(this.element); + this.element = this.document = null; + } + }; + + iframeSelection.onResize = watchFunction(onResize.bind(iframeSelection)); + + let iframePreSelection = exports.iframePreSelection = { + element: null, + document: null, + sizeTracking: { + windowDelayer: null + }, + display: function (installHandlerOnDocument, standardOverlayCallbacks) { + return new Promise((resolve, reject) => { + if (! this.element) { + this.element = document.createElement("iframe"); + this.element.src = browser.extension.getURL("blank.html"); + this.element.id = "firefox-screenshots-preselection-iframe"; + this.element.style.zIndex = "99999999999"; + this.element.style.border = "none"; + this.element.style.position = "fixed"; + this.element.style.top = "0"; + this.element.style.left = "0"; + this.element.style.margin = "0"; + this.element.scrolling = "no"; + this.updateElementSize(); + this.element.onload = watchFunction(() => { + this.document = this.element.contentDocument; + this.document.documentElement.innerHTML= ` + + + + + +
+
+
+
+ +
+ + +
+
+
+ `; + installHandlerOnDocument(this.document); + if (this.addClassName) { + this.document.body.className = this.addClassName; + } + const overlay = this.document.querySelector(".preview-overlay"); + overlay.querySelector(".preview-instructions").textContent = browser.i18n.getMessage("screenshotInstructions"); + overlay.querySelector(".myshots-link").textContent = browser.i18n.getMessage("myShotsLink"); + overlay.querySelector(".visible").textContent = browser.i18n.getMessage("saveScreenshotVisibleArea"); + overlay.querySelector(".full-page").textContent = browser.i18n.getMessage("saveScreenshotFullPage"); + overlay.querySelector(".myshots-button").addEventListener( + "click", watchFunction(assertIsTrusted(standardOverlayCallbacks.onOpenMyShots)), false); + overlay.querySelector(".visible").addEventListener( + "click", watchFunction(assertIsTrusted(standardOverlayCallbacks.onClickVisible)), false); + overlay.querySelector(".full-page").addEventListener( + "click", watchFunction(assertIsTrusted(standardOverlayCallbacks.onClickFullPage)), false); + resolve(); + }); + document.body.appendChild(this.element); + this.unhide(); + } else { + resolve(); + } + }); + }, + + updateElementSize: function () { + this.element.style.height = window.innerHeight + "px"; + this.element.style.width = window.innerWidth + "px"; + }, + + hide: function () { + window.removeEventListener("scroll", this.onScroll, false); + window.removeEventListener("resize", this.onResize, true); + if (this.element) { + this.element.style.display = "none"; + } + }, + + unhide: function () { + this.updateElementSize(); + window.addEventListener("scroll", this.onScroll, false); + window.addEventListener("resize", this.onResize, true); + this.element.style.display = ""; + this.element.focus(); + }, + + onScroll: function () { + exports.HoverBox.hide(); + }, + + getElementFromPoint: function (x, y) { + this.element.style.pointerEvents = "none"; + let el; + try { + el = document.elementFromPoint(x, y); + } finally { + this.element.style.pointerEvents = ""; + } + return el; + }, + + remove: function () { + this.hide(); + util.removeNode(this.element); + this.element = null; + this.document = null; + } + }; + + iframePreSelection.onResize = watchFunction(onResize.bind(iframePreSelection)); + + let iframe = exports.iframe = { + currentIframe: iframePreSelection, + display: function (installHandlerOnDocument, standardOverlayCallbacks) { + return iframeSelection.display(installHandlerOnDocument) + .then(() => iframePreSelection.display(installHandlerOnDocument, standardOverlayCallbacks)); + }, + + hide: function () { + this.currentIframe.hide(); + }, + + unhide: function () { + this.currentIframe.unhide(); + }, + + getElementFromPoint: function (x, y) { + return this.currentIframe.getElementFromPoint(x, y); + }, + + remove: function () { + iframeSelection.remove(); + iframePreSelection.remove(); + }, + + document: function () { + return this.currentIframe.document; + }, + + useSelection: function () { + if (this.currentIframe === iframePreSelection) { + this.hide(); + } + this.currentIframe = iframeSelection; + this.unhide(); + }, + + usePreSelection: function () { + if (this.currentIframe === iframeSelection) { + this.hide(); + } + this.currentIframe = iframePreSelection; + this.unhide(); + } + }; + + let movements = ["topLeft", "top", "topRight", "left", "right", "bottomLeft", "bottom", "bottomRight"]; + + /** Creates the selection box */ + exports.Box = { + + display: function (pos, callbacks) { + this._createEl(); + if (callbacks !== undefined && callbacks.cancel) { + // We use onclick here because we don't want addEventListener + // to add multiple event handlers to the same button + this.cancel.onclick = watchFunction(assertIsTrusted(callbacks.cancel)); + this.cancel.style.display = ""; + } else { + this.cancel.style.display = "none"; + } + if (callbacks !== undefined && callbacks.save) { + // We use onclick here because we don't want addEventListener + // to add multiple event handlers to the same button + this.save.removeAttribute("disabled"); + this.save.onclick = watchFunction(assertIsTrusted((e) => { + this.save.setAttribute("disabled", "true"); + callbacks.save(e); + })); + this.save.style.display = ""; + } else { + this.save.style.display = "none"; + } + if (callbacks !== undefined && callbacks.download) { + this.download.removeAttribute("disabled"); + this.download.onclick = watchFunction(assertIsTrusted((e) => { + this.download.setAttribute("disabled", true); + callbacks.download(e); + e.preventDefault(); + e.stopPropagation(); + return false; + })); + this.download.style.display = ""; + } else { + this.download.style.display = "none"; + } + let bodyRect = getBodyRect(); + // Note, document.documentElement.scrollHeight is zero on some strange pages (such as the page created when you load an image): + let docHeight = Math.max(document.documentElement.scrollHeight || 0, document.body.scrollHeight); + let docWidth = Math.max(document.documentElement.scrollWidth, document.body.scrollWidth); + + let winBottom = window.innerHeight; + let pageYOffset = window.pageYOffset; + + if ((pos.right - pos.left) < 78 || (pos.bottom - pos.top) < 78) { + this.el.classList.add("small-selection"); + } else { + this.el.classList.remove("small-selection"); + } + + // if the selection bounding box is w/in SAVE_BUTTON_HEIGHT px of the bottom of + // the window, flip controls into the box + if (pos.bottom > ((winBottom + pageYOffset) - SAVE_BUTTON_HEIGHT)) { + this.el.classList.add("bottom-selection"); + } else { + this.el.classList.remove("bottom-selection"); + } + this.el.style.top = (pos.top - bodyRect.top) + "px"; + this.el.style.left = (pos.left - bodyRect.left) + "px"; + this.el.style.height = (pos.bottom - pos.top - bodyRect.top) + "px"; + this.el.style.width = (pos.right - pos.left - bodyRect.left) + "px"; + this.bgTop.style.top = "0px"; + this.bgTop.style.height = (pos.top - bodyRect.top) + "px"; + this.bgTop.style.left = "0px"; + this.bgTop.style.width = docWidth + "px"; + this.bgBottom.style.top = (pos.bottom - bodyRect.top) + "px"; + this.bgBottom.style.height = docHeight - (pos.bottom - bodyRect.top) + "px"; + this.bgBottom.style.left = "0px"; + this.bgBottom.style.width = docWidth + "px"; + this.bgLeft.style.top = (pos.top - bodyRect.top) + "px"; + this.bgLeft.style.height = pos.bottom - pos.top + "px"; + this.bgLeft.style.left = "0px"; + this.bgLeft.style.width = (pos.left - bodyRect.left) + "px"; + this.bgRight.style.top = (pos.top - bodyRect.top) + "px"; + this.bgRight.style.height = pos.bottom - pos.top + "px"; + this.bgRight.style.left = (pos.right - bodyRect.left) + "px"; + this.bgRight.style.width = docWidth - (pos.right - bodyRect.left) + "px"; + }, + + remove: function () { + for (let name of ["el", "bgTop", "bgLeft", "bgRight", "bgBottom"]) { + if (name in this) { + util.removeNode(this[name]); + this[name] = null; + } + } + }, + + _createEl: function () { + let boxEl = this.el; + if (boxEl) { + return; + } + boxEl = makeEl("div", "highlight"); + let buttons = makeEl("div", "highlight-buttons"); + let cancel = makeEl("button", "highlight-button-cancel"); + cancel.title = browser.i18n.getMessage("cancelScreenshot"); + buttons.appendChild(cancel); + let download = makeEl("button", "highlight-button-download"); + download.title = browser.i18n.getMessage("downloadScreenshot"); + buttons.appendChild(download); + let save = makeEl("button", "highlight-button-save"); + save.textContent = browser.i18n.getMessage("saveScreenshotSelectedArea"); + save.title = browser.i18n.getMessage("saveScreenshotSelectedArea"); + buttons.appendChild(save); + this.cancel = cancel; + this.download = download; + this.save = save; + boxEl.appendChild(buttons); + for (let name of movements) { + let elTarget = makeEl("div", "mover-target direction-" + name); + let elMover = makeEl("div", "mover"); + elTarget.appendChild(elMover); + boxEl.appendChild(elTarget); + } + this.bgTop = makeEl("div", "bghighlight"); + iframe.document().body.appendChild(this.bgTop); + this.bgLeft = makeEl("div", "bghighlight"); + iframe.document().body.appendChild(this.bgLeft); + this.bgRight = makeEl("div", "bghighlight"); + iframe.document().body.appendChild(this.bgRight); + this.bgBottom = makeEl("div", "bghighlight"); + iframe.document().body.appendChild(this.bgBottom); + iframe.document().body.appendChild(boxEl); + this.el = boxEl; + }, + + draggerDirection: function (target) { + while (target) { + if (target.nodeType == document.ELEMENT_NODE) { + if (target.classList.contains("mover-target")) { + for (let name of movements) { + if (target.classList.contains("direction-" + name)) { + return name; + } + } + catcher.unhandled(new Error("Surprising mover element"), {element: target.outerHTML}); + log.warn("Got mover-target that wasn't a specific direction"); + } + } + target = target.parentNode; + } + return null; + }, + + isSelection: function (target) { + while (target) { + if (target.tagName === "BUTTON") { + return false; + } + if (target.nodeType == document.ELEMENT_NODE && target.classList.contains("highlight")) { + return true; + } + target = target.parentNode; + } + return false; + }, + + isControl: function (target) { + while (target) { + if (target.nodeType === document.ELEMENT_NODE && target.classList.contains("highlight-buttons")) { + return true; + } + target = target.parentNode; + } + return false; + }, + + el: null, + boxTopEl: null, + boxLeftEl: null, + boxRightEl: null, + boxBottomEl: null + }; + + exports.HoverBox = { + + el: null, + + display: function (rect) { + if (! this.el) { + this.el = makeEl("div", "hover-highlight"); + iframe.document().body.appendChild(this.el); + } + this.el.style.display = ""; + this.el.style.top = (rect.top - 1) + "px"; + this.el.style.left = (rect.left - 1) + "px"; + this.el.style.width = (rect.right - rect.left + 2) + "px"; + this.el.style.height = (rect.bottom - rect.top + 2) + "px"; + }, + + hide: function () { + if (this.el) { + this.el.style.display = "none"; + } + }, + + remove: function () { + util.removeNode(this.el); + this.el = null; + } + }; + + exports.PixelDimensions = { + el: null, + xEl: null, + yEl: null, + display: function (xPos, yPos, x, y) { + if (! this.el) { + this.el = makeEl("div", "pixel-dimensions"); + this.xEl = makeEl("div"); + this.el.appendChild(this.xEl); + this.yEl = makeEl("div"); + this.el.appendChild(this.yEl); + iframe.document().body.appendChild(this.el); + } + this.xEl.textContent = x; + this.yEl.textContent = y; + this.el.style.top = (yPos + 12) + "px"; + this.el.style.left = (xPos + 12) + "px"; + }, + remove: function () { + util.removeNode(this.el); + this.el = this.xEl = this.yEl = null; + } + }; + + /** Removes every UI this module creates */ + exports.remove = function () { + for (let name in exports) { + if (name.startsWith("iframe")) { + continue; + } + if (typeof exports[name] == "object" && exports[name].remove) { + exports[name].remove(); + } + } + exports.iframe.remove(); + }; + + exports.triggerDownload = function (url, filename) { + return catcher.watchPromise(callBackground("downloadShot", {url, filename})); + }; + + exports.unload = exports.remove; + + return exports; +})(); +null; diff -Nru firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/selector/util.js firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/selector/util.js --- firefox-54.0~b1+build1/browser/extensions/screenshots/webextension/selector/util.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/browser/extensions/screenshots/webextension/selector/util.js 2017-04-25 05:28:19.000000000 +0000 @@ -0,0 +1,106 @@ +"use strict"; + +this.util = (function () { // eslint-disable-line no-unused-vars + let exports = {}; + + /** Removes a node from its document, if it's a node and the node is attached to a parent */ + exports.removeNode = function (el) { + if (el && el.parentNode) { + el.parentNode.removeChild(el); + } + }; + + /** Truncates the X coordinate to the document size */ + exports.truncateX = function (x) { + let max = Math.max(document.documentElement.clientWidth, document.body.clientWidth, document.documentElement.scrollWidth, document.body.scrollWidth); + if (x < 0) { + return 0; + } else if (x > max) { + return max; + } else { + return x; + } + }; + + /** Truncates the Y coordinate to the document size */ + exports.truncateY = function (y) { + let max = Math.max(document.documentElement.clientHeight, document.body.clientHeight, document.documentElement.scrollHeight, document.body.scrollHeight); + if (y < 0) { + return 0; + } else if (y > max) { + return max; + } else { + return y; + } + }; + + // Pixels of wiggle the captured region gets in captureSelectedText: + var CAPTURE_WIGGLE = 10; + const ELEMENT_NODE = document.ELEMENT_NODE; + + exports.captureEnclosedText = function (box) { + var scrollX = window.scrollX; + var scrollY = window.scrollY; + var text = []; + function traverse(el) { + var elBox = el.getBoundingClientRect(); + elBox = { + top: elBox.top + scrollY, + bottom: elBox.bottom + scrollY, + left: elBox.left + scrollX, + right: elBox.right + scrollX + }; + if (elBox.bottom < box.top || + elBox.top > box.bottom || + elBox.right < box.left || + elBox.left > box.right) { + // Totally outside of the box + return; + } + if (elBox.bottom > box.bottom + CAPTURE_WIGGLE || + elBox.top < box.top - CAPTURE_WIGGLE || + elBox.right > box.right + CAPTURE_WIGGLE || + elBox.left < box.left - CAPTURE_WIGGLE) { + // Partially outside the box + for (var i=0; i { + callBackground("reportError", errorObj); + }); + + + function sendCustomEvent(name, detail) { + if (typeof detail == "object") { + // Note sending an object can lead to security problems, while a string + // is safe to transfer: + detail = JSON.stringify(detail); + } + document.dispatchEvent(new CustomEvent(name, {detail})); + } + + document.addEventListener("delete-everything", catcher.watchFunction((event) => { + // FIXME: reset some data in the add-on + }, false)); + + document.addEventListener("request-login", catcher.watchFunction((event) => { + let shotId = event.detail; + catcher.watchPromise(callBackground("getAuthInfo", shotId || null).then((info) => { + sendCustomEvent("login-successful", {deviceId: info.deviceId, isOwner: info.isOwner}); + })); + })); + + // Depending on the script loading order, the site might get the addon-present event, + // but probably won't - instead the site will ask for that event after it has loaded + document.addEventListener("request-addon-present", catcher.watchFunction(() => { + sendCustomEvent("addon-present"); + }), false); + + sendCustomEvent("addon-present"); + +})(); +null; diff -Nru firefox-54.0~b1+build1/browser/locales/shipped-locales firefox-54.0~b2+build1/browser/locales/shipped-locales --- firefox-54.0~b1+build1/browser/locales/shipped-locales 2017-04-20 12:54:04.000000000 +0000 +++ firefox-54.0~b2+build1/browser/locales/shipped-locales 2017-04-25 05:28:19.000000000 +0000 @@ -63,6 +63,7 @@ ml mr ms +my nb-NO nl nn-NO diff -Nru firefox-54.0~b1+build1/debian/changelog firefox-54.0~b2+build1/debian/changelog --- firefox-54.0~b1+build1/debian/changelog 2017-04-18 13:00:08.000000000 +0000 +++ firefox-54.0~b2+build1/debian/changelog 2017-04-25 05:45:13.000000000 +0000 @@ -1,3 +1,13 @@ +firefox (54.0~b2+build1-0ubuntu0.17.04.1) zesty; urgency=medium + + * New upstream release from the beta channel (FIREFOX_54_0b2_BUILD1) + * Refresh shipped locales + - update debian/config/locales.* + - update debian/config/searchplugins.conf + - update debian/control + + -- Rico Tzschichholz Tue, 25 Apr 2017 07:45:13 +0200 + firefox (54.0~b1+build1-0ubuntu0.17.04.1) zesty; urgency=medium [ Chris Coulson ] diff -Nru firefox-54.0~b1+build1/debian/config/locales.all firefox-54.0~b2+build1/debian/config/locales.all --- firefox-54.0~b1+build1/debian/config/locales.all 2017-04-18 13:00:08.000000000 +0000 +++ firefox-54.0~b2+build1/debian/config/locales.all 2017-04-25 05:45:13.000000000 +0000 @@ -58,6 +58,7 @@ mn:Mongolian mr:Marathi ms:Malay +my:Myanmar nb:Bokmål, Norwegian; Norwegian Bokmål nl:Dutch; Flemish nn:Norwegian Nynorsk; Nynorsk, Norwegian diff -Nru firefox-54.0~b1+build1/debian/config/locales.shipped firefox-54.0~b2+build1/debian/config/locales.shipped --- firefox-54.0~b1+build1/debian/config/locales.shipped 2017-04-18 13:00:08.000000000 +0000 +++ firefox-54.0~b2+build1/debian/config/locales.shipped 2017-04-25 05:45:13.000000000 +0000 @@ -58,6 +58,7 @@ ml:ml mr:mr ms:ms +my:my nb-NO:nb nl:nl nn-NO:nn diff -Nru firefox-54.0~b1+build1/debian/config/searchplugins.conf firefox-54.0~b2+build1/debian/config/searchplugins.conf --- firefox-54.0~b1+build1/debian/config/searchplugins.conf 2017-04-18 13:00:08.000000000 +0000 +++ firefox-54.0~b2+build1/debian/config/searchplugins.conf 2017-04-25 05:45:13.000000000 +0000 @@ -2,7 +2,7 @@ "overrides": [ { "name": "Amazon", - "include_locales": [ "af", "ar", "as", "az", "bg", "bn-IN", "br", "cak", "cy", "da", "de", "el", "en-GB", "en-US", "en-ZA", "eo", "es-AR", "eu", "fa", "fr", "ga-IE", "gd", "gl", "gn", "hr", "hsb", "hy-AM", "is", "it", "ja", "ka", "km", "kn", "ku", "lt", "mk", "mr", "ms", "nb-NO", "nn-NO", "or", "pt-PT", "ro", "si", "son", "sq", "sr", "te", "th", "ur", "uz", "zh-CN", "zu"], + "include_locales": [ "af", "ar", "as", "az", "bg", "bn-IN", "br", "cak", "cy", "da", "de", "el", "en-GB", "en-US", "en-ZA", "eo", "es-AR", "eu", "fa", "fr", "ga-IE", "gd", "gl", "gn", "hr", "hsb", "hy-AM", "is", "it", "ja", "ka", "km", "kn", "ku", "lt", "mk", "mr", "ms", "my", "nb-NO", "nn-NO", "or", "pt-PT", "ro", "si", "son", "sq", "sr", "te", "th", "ur", "uz", "zh-CN", "zu"], "exclude_locales": [], "match": "amazon*.xml", "source": "en-US/amazondotcom.xml", diff -Nru firefox-54.0~b1+build1/debian/control firefox-54.0~b2+build1/debian/control --- firefox-54.0~b1+build1/debian/control 2017-04-18 13:00:08.000000000 +0000 +++ firefox-54.0~b2+build1/debian/control 2017-04-25 05:45:13.000000000 +0000 @@ -120,7 +120,7 @@ Depends: ${shlibs:Depends}, ${misc:Depends}, firefox (= ${binary:Version}), - firefox-locale-af (= ${binary:Version}), firefox-locale-an (= ${binary:Version}), firefox-locale-ar (= ${binary:Version}), firefox-locale-as (= ${binary:Version}), firefox-locale-ast (= ${binary:Version}), firefox-locale-az (= ${binary:Version}), firefox-locale-be (= ${binary:Version}), firefox-locale-bg (= ${binary:Version}), firefox-locale-bn (= ${binary:Version}), firefox-locale-br (= ${binary:Version}), firefox-locale-bs (= ${binary:Version}), firefox-locale-ca (= ${binary:Version}), firefox-locale-cak (= ${binary:Version}), firefox-locale-cs (= ${binary:Version}), firefox-locale-csb (= ${binary:Version}), firefox-locale-cy (= ${binary:Version}), firefox-locale-da (= ${binary:Version}), firefox-locale-de (= ${binary:Version}), firefox-locale-el (= ${binary:Version}), firefox-locale-en (= ${binary:Version}), firefox-locale-eo (= ${binary:Version}), firefox-locale-es (= ${binary:Version}), firefox-locale-et (= ${binary:Version}), firefox-locale-eu (= ${binary:Version}), firefox-locale-fa (= ${binary:Version}), firefox-locale-fi (= ${binary:Version}), firefox-locale-fr (= ${binary:Version}), firefox-locale-fy (= ${binary:Version}), firefox-locale-ga (= ${binary:Version}), firefox-locale-gd (= ${binary:Version}), firefox-locale-gl (= ${binary:Version}), firefox-locale-gn (= ${binary:Version}), firefox-locale-gu (= ${binary:Version}), firefox-locale-he (= ${binary:Version}), firefox-locale-hi (= ${binary:Version}), firefox-locale-hr (= ${binary:Version}), firefox-locale-hsb (= ${binary:Version}), firefox-locale-hu (= ${binary:Version}), firefox-locale-hy (= ${binary:Version}), firefox-locale-id (= ${binary:Version}), firefox-locale-is (= ${binary:Version}), firefox-locale-it (= ${binary:Version}), firefox-locale-ja (= ${binary:Version}), firefox-locale-ka (= ${binary:Version}), firefox-locale-kab (= ${binary:Version}), firefox-locale-kk (= ${binary:Version}), firefox-locale-km (= ${binary:Version}), firefox-locale-kn (= ${binary:Version}), firefox-locale-ko (= ${binary:Version}), firefox-locale-ku (= ${binary:Version}), firefox-locale-lg (= ${binary:Version}), firefox-locale-lt (= ${binary:Version}), firefox-locale-lv (= ${binary:Version}), firefox-locale-mai (= ${binary:Version}), firefox-locale-mk (= ${binary:Version}), firefox-locale-ml (= ${binary:Version}), firefox-locale-mn (= ${binary:Version}), firefox-locale-mr (= ${binary:Version}), firefox-locale-ms (= ${binary:Version}), firefox-locale-nb (= ${binary:Version}), firefox-locale-nl (= ${binary:Version}), firefox-locale-nn (= ${binary:Version}), firefox-locale-nso (= ${binary:Version}), firefox-locale-oc (= ${binary:Version}), firefox-locale-or (= ${binary:Version}), firefox-locale-pa (= ${binary:Version}), firefox-locale-pl (= ${binary:Version}), firefox-locale-pt (= ${binary:Version}), firefox-locale-ro (= ${binary:Version}), firefox-locale-ru (= ${binary:Version}), firefox-locale-si (= ${binary:Version}), firefox-locale-sk (= ${binary:Version}), firefox-locale-sl (= ${binary:Version}), firefox-locale-sq (= ${binary:Version}), firefox-locale-sr (= ${binary:Version}), firefox-locale-sv (= ${binary:Version}), firefox-locale-sw (= ${binary:Version}), firefox-locale-ta (= ${binary:Version}), firefox-locale-te (= ${binary:Version}), firefox-locale-th (= ${binary:Version}), firefox-locale-tr (= ${binary:Version}), firefox-locale-uk (= ${binary:Version}), firefox-locale-ur (= ${binary:Version}), firefox-locale-uz (= ${binary:Version}), firefox-locale-vi (= ${binary:Version}), firefox-locale-xh (= ${binary:Version}), firefox-locale-zh-hans (= ${binary:Version}), firefox-locale-zh-hant (= ${binary:Version}), firefox-locale-zu (= ${binary:Version}), + firefox-locale-af (= ${binary:Version}), firefox-locale-an (= ${binary:Version}), firefox-locale-ar (= ${binary:Version}), firefox-locale-as (= ${binary:Version}), firefox-locale-ast (= ${binary:Version}), firefox-locale-az (= ${binary:Version}), firefox-locale-be (= ${binary:Version}), firefox-locale-bg (= ${binary:Version}), firefox-locale-bn (= ${binary:Version}), firefox-locale-br (= ${binary:Version}), firefox-locale-bs (= ${binary:Version}), firefox-locale-ca (= ${binary:Version}), firefox-locale-cak (= ${binary:Version}), firefox-locale-cs (= ${binary:Version}), firefox-locale-csb (= ${binary:Version}), firefox-locale-cy (= ${binary:Version}), firefox-locale-da (= ${binary:Version}), firefox-locale-de (= ${binary:Version}), firefox-locale-el (= ${binary:Version}), firefox-locale-en (= ${binary:Version}), firefox-locale-eo (= ${binary:Version}), firefox-locale-es (= ${binary:Version}), firefox-locale-et (= ${binary:Version}), firefox-locale-eu (= ${binary:Version}), firefox-locale-fa (= ${binary:Version}), firefox-locale-fi (= ${binary:Version}), firefox-locale-fr (= ${binary:Version}), firefox-locale-fy (= ${binary:Version}), firefox-locale-ga (= ${binary:Version}), firefox-locale-gd (= ${binary:Version}), firefox-locale-gl (= ${binary:Version}), firefox-locale-gn (= ${binary:Version}), firefox-locale-gu (= ${binary:Version}), firefox-locale-he (= ${binary:Version}), firefox-locale-hi (= ${binary:Version}), firefox-locale-hr (= ${binary:Version}), firefox-locale-hsb (= ${binary:Version}), firefox-locale-hu (= ${binary:Version}), firefox-locale-hy (= ${binary:Version}), firefox-locale-id (= ${binary:Version}), firefox-locale-is (= ${binary:Version}), firefox-locale-it (= ${binary:Version}), firefox-locale-ja (= ${binary:Version}), firefox-locale-ka (= ${binary:Version}), firefox-locale-kab (= ${binary:Version}), firefox-locale-kk (= ${binary:Version}), firefox-locale-km (= ${binary:Version}), firefox-locale-kn (= ${binary:Version}), firefox-locale-ko (= ${binary:Version}), firefox-locale-ku (= ${binary:Version}), firefox-locale-lg (= ${binary:Version}), firefox-locale-lt (= ${binary:Version}), firefox-locale-lv (= ${binary:Version}), firefox-locale-mai (= ${binary:Version}), firefox-locale-mk (= ${binary:Version}), firefox-locale-ml (= ${binary:Version}), firefox-locale-mn (= ${binary:Version}), firefox-locale-mr (= ${binary:Version}), firefox-locale-ms (= ${binary:Version}), firefox-locale-my (= ${binary:Version}), firefox-locale-nb (= ${binary:Version}), firefox-locale-nl (= ${binary:Version}), firefox-locale-nn (= ${binary:Version}), firefox-locale-nso (= ${binary:Version}), firefox-locale-oc (= ${binary:Version}), firefox-locale-or (= ${binary:Version}), firefox-locale-pa (= ${binary:Version}), firefox-locale-pl (= ${binary:Version}), firefox-locale-pt (= ${binary:Version}), firefox-locale-ro (= ${binary:Version}), firefox-locale-ru (= ${binary:Version}), firefox-locale-si (= ${binary:Version}), firefox-locale-sk (= ${binary:Version}), firefox-locale-sl (= ${binary:Version}), firefox-locale-sq (= ${binary:Version}), firefox-locale-sr (= ${binary:Version}), firefox-locale-sv (= ${binary:Version}), firefox-locale-sw (= ${binary:Version}), firefox-locale-ta (= ${binary:Version}), firefox-locale-te (= ${binary:Version}), firefox-locale-th (= ${binary:Version}), firefox-locale-tr (= ${binary:Version}), firefox-locale-uk (= ${binary:Version}), firefox-locale-ur (= ${binary:Version}), firefox-locale-uz (= ${binary:Version}), firefox-locale-vi (= ${binary:Version}), firefox-locale-xh (= ${binary:Version}), firefox-locale-zh-hans (= ${binary:Version}), firefox-locale-zh-hant (= ${binary:Version}), firefox-locale-zu (= ${binary:Version}), python, dbus-x11, xvfb, @@ -768,6 +768,16 @@ This package contains Malay translations and search plugins for Firefox +Package: firefox-locale-my +Architecture: any +Depends: ${misc:Depends} +Replaces: language-pack-my-base +Conflicts: ${app:Conflicts} +Provides: ${app:Provides} +Description: Myanmar language pack for Firefox + This package contains Myanmar translations and search plugins + for Firefox + Package: firefox-locale-nb Architecture: any Depends: ${misc:Depends} diff -Nru firefox-54.0~b1+build1/dom/base/nsGlobalWindow.cpp firefox-54.0~b2+build1/dom/base/nsGlobalWindow.cpp --- firefox-54.0~b1+build1/dom/base/nsGlobalWindow.cpp 2017-04-20 12:54:05.000000000 +0000 +++ firefox-54.0~b2+build1/dom/base/nsGlobalWindow.cpp 2017-04-25 05:28:20.000000000 +0000 @@ -9961,6 +9961,8 @@ { MOZ_RELEASE_ASSERT(IsOuterWindow()); + Unused << aShowDialog; + if (Preferences::GetBool("dom.disable_window_find", false)) { aError.Throw(NS_ERROR_NOT_AVAILABLE); return false; @@ -9993,32 +9995,7 @@ framesFinder->SetCurrentSearchFrame(AsOuter()); } - // The Find API does not accept empty strings. Launch the Find Dialog. - if (aString.IsEmpty() || aShowDialog) { - // See if the find dialog is already up using nsIWindowMediator - nsCOMPtr windowMediator = - do_GetService(NS_WINDOWMEDIATOR_CONTRACTID); - - nsCOMPtr findDialog; - - if (windowMediator) { - windowMediator->GetMostRecentWindow(u"findInPage", - getter_AddRefs(findDialog)); - } - - if (findDialog) { - // The Find dialog is already open, bring it to the top. - auto* piFindDialog = nsPIDOMWindowOuter::From(findDialog); - aError = piFindDialog->Focus(); - } else if (finder) { - // Open a Find dialog - nsCOMPtr dialog; - aError = OpenDialog(NS_LITERAL_STRING("chrome://global/content/finddialog.xul"), - NS_LITERAL_STRING("_blank"), - NS_LITERAL_STRING("chrome, resizable=no, dependent=yes"), - finder, getter_AddRefs(dialog)); - } - + if (aString.IsEmpty()) { return false; } diff -Nru firefox-54.0~b1+build1/dom/events/TouchEvent.cpp firefox-54.0~b2+build1/dom/events/TouchEvent.cpp --- firefox-54.0~b1+build1/dom/events/TouchEvent.cpp 2017-04-20 12:54:06.000000000 +0000 +++ firefox-54.0~b2+build1/dom/events/TouchEvent.cpp 2017-04-25 05:28:21.000000000 +0000 @@ -223,8 +223,8 @@ if (enabled && aDocShell) { // APZ might be disabled on this particular widget, in which case // TouchEvent support will also be disabled. Try to detect that. - nsPresContext* pc = nullptr; - aDocShell->GetPresContext(&pc); + RefPtr pc; + aDocShell->GetPresContext(getter_AddRefs(pc)); if (pc && pc->GetRootWidget()) { enabled &= pc->GetRootWidget()->AsyncPanZoomEnabled(); } diff -Nru firefox-54.0~b1+build1/dom/media/mediasource/test/mochitest.ini firefox-54.0~b2+build1/dom/media/mediasource/test/mochitest.ini --- firefox-54.0~b1+build1/dom/media/mediasource/test/mochitest.ini 2017-04-20 12:54:07.000000000 +0000 +++ firefox-54.0~b2+build1/dom/media/mediasource/test/mochitest.ini 2017-04-25 05:28:21.000000000 +0000 @@ -70,7 +70,7 @@ [test_EndOfStream_mp4.html] skip-if = ((os == "win" && os_version == "5.1") || (toolkit == 'android')) # Not supported on xp and android 2.3 [test_Eviction_mp4.html] -skip-if = (os == "win" && os_version == "5.1") # Not supported on xp. +skip-if = (os == "win" && os_version == "5.1") || (android_version == '15') # Not supported on xp. Android(Bug 1358271) [test_FrameSelection.html] [test_FrameSelection_mp4.html] skip-if = ((os == "win" && os_version == "5.1") || (toolkit == 'android')) # Not supported on xp and android 2.3 diff -Nru firefox-54.0~b1+build1/dom/media/test/eme.js firefox-54.0~b2+build1/dom/media/test/eme.js --- firefox-54.0~b1+build1/dom/media/test/eme.js 2017-04-20 12:54:07.000000000 +0000 +++ firefox-54.0~b2+build1/dom/media/test/eme.js 2017-04-25 05:28:21.000000000 +0000 @@ -337,10 +337,19 @@ function processInitDataQueue() { - if (initDataQueue === null) { return; } + function maybeResolveInitDataPromise() { + if (params && params.initDataPromise) { + params.initDataPromise.resolve(); + } + } + if (initDataQueue === null) { + maybeResolveInitDataPromise(); + return; + } // If we're processed all our init data null the queue to indicate encrypted event handled. if (initDataQueue.length === 0) { initDataQueue = null; + maybeResolveInitDataPromise(); return; } var ev = initDataQueue.shift(); diff -Nru firefox-54.0~b1+build1/dom/media/test/test_eme_canvas_blocked.html firefox-54.0~b2+build1/dom/media/test/test_eme_canvas_blocked.html --- firefox-54.0~b1+build1/dom/media/test/test_eme_canvas_blocked.html 2017-04-20 12:54:07.000000000 +0000 +++ firefox-54.0~b2+build1/dom/media/test/test_eme_canvas_blocked.html 2017-04-25 05:28:21.000000000 +0000 @@ -17,8 +17,10 @@ manager.started(token); var sessions = []; + // Will be resolved when all initData are processed. + let initDataPromise = new EMEPromise; - var v = SetupEME(test, token); + var v = SetupEME(test, token, { initDataPromise: initDataPromise }); v.preload = "auto"; // Required due to "canplay" not firing for MSE unless we do this. var p1 = new EMEPromise; @@ -40,7 +42,7 @@ }); var p2 = LoadTest(test, v, token, { onlyLoadFirstFragments:2, noEndOfStream:false }); - EMEPromiseAll(v, token, [p1.promise, p2]); + EMEPromiseAll(v, token, [p1.promise, p2, initDataPromise.promise]); } function beginTest() { diff -Nru firefox-54.0~b1+build1/dom/media/tests/mochitest/mochitest.ini firefox-54.0~b2+build1/dom/media/tests/mochitest/mochitest.ini --- firefox-54.0~b1+build1/dom/media/tests/mochitest/mochitest.ini 2017-04-20 12:54:07.000000000 +0000 +++ firefox-54.0~b2+build1/dom/media/tests/mochitest/mochitest.ini 2017-04-25 05:28:21.000000000 +0000 @@ -31,7 +31,7 @@ [test_dataChannel_basicAudioVideoNoBundle.html] skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) [test_dataChannel_basicAudioVideoCombined.html] -skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = toolkit == 'android' # Bug 1189784 [test_dataChannel_basicDataOnly.html] [test_dataChannel_basicVideo.html] skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) @@ -45,7 +45,7 @@ skip-if = os == 'android' [test_getUserMedia_active_autoplay.html] [test_getUserMedia_audioCapture.html] -skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = toolkit == 'android' # android(Bug 1189784, timeouts on 4.3 emulator), android(Bug 1264333) [test_getUserMedia_addTrackRemoveTrack.html] skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) [test_getUserMedia_addtrack_removetrack_events.html] @@ -111,7 +111,7 @@ [test_peerConnection_basicAudioVideo.html] skip-if = (android_version == '18') # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_basicAudioVideoCombined.html] -skip-if = (android_version == '18') # android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = toolkit == 'android' # Bug 1189784 [test_peerConnection_basicAudioVideoNoBundle.html] skip-if = (android_version == '18') # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_basicAudioVideoNoBundleNoRtcpMux.html] @@ -127,7 +127,7 @@ # frequent timeouts/crashes on e10s (bug 1048455) skip-if = toolkit == 'android' # no screenshare on android [test_peerConnection_basicH264Video.html] -skip-if = os == 'android' # bug 1043403 +skip-if = toolkit == 'android' # Bug 1043403, Bug 1355786, Bug 1149374 [test_peerConnection_bug822674.html] [test_peerConnection_bug825703.html] [test_peerConnection_bug827843.html] @@ -136,11 +136,11 @@ [test_peerConnection_bug1013809.html] skip-if = (android_version == '18') # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_bug1042791.html] -skip-if = os == 'android' # bug 1043403 +skip-if = toolkit == 'android' # Bug 1043403, Bug 1355786, Bug 1149374 [test_peerConnection_bug1064223.html] [test_peerConnection_capturedVideo.html] tags=capturestream -skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = toolkit == 'android' # android(Bug 1189784, timeouts on 4.3 emulator), Bug 1264340 [test_peerConnection_captureStream_canvas_2d.html] skip-if = android_version == '18' # android(Bug 1319019, timeouts on 4.3 emulator) [test_peerConnection_captureStream_canvas_2d_noSSRC.html] @@ -148,6 +148,7 @@ [test_peerConnection_multiple_captureStream_canvas_2d.html] skip-if = (android_version == '18' && debug) # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_captureStream_canvas_webgl.html] +skip-if = android_version <= '17' # bug 1346630 # [test_peerConnection_certificates.html] # bug 1180968 [test_peerConnection_close.html] [test_peerConnection_closeDuringIce.html] @@ -155,11 +156,11 @@ skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_errorCallbacks.html] [test_peerConnection_iceFailure.html] -skip-if = os == 'linux' || os == 'mac' || os == 'win' || android_version == '18' # (Bug 1180388 for win, mac and linux), android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = os == 'linux' || os == 'mac' || os == 'win' || toolkit == 'android' # (Bug 1180388 for win, mac and linux), android(Bug 1189784, timeouts on 4.3 emulator), Bug 1180388 [test_peerConnection_insertDTMF.html] skip-if = (android_version == '18') # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_forwarding_basicAudioVideoCombined.html] -skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = toolkit == 'android' # Bug 1189784 [test_peerConnection_noTrickleAnswer.html] skip-if = (android_version == '18') # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_noTrickleOffer.html] @@ -170,32 +171,32 @@ skip-if = (android_version == '18') # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_offerRequiresReceiveVideo.html] [test_peerConnection_offerRequiresReceiveVideoAudio.html] -skip-if = (android_version == '18') # android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = toolkit == 'android' # android(Bug 1189784) [test_peerConnection_promiseSendOnly.html] skip-if = (android_version == '18') # android(Bug 1189784, 1318809 timeouts on 4.3 emulator) [test_peerConnection_renderAfterRenegotiation.html] skip-if = (android_version == '18') # android(Bug 1189784, 1326005 timeouts on 4.3 emulator) [test_peerConnection_restartIce.html] -skip-if = android_version +skip-if = toolkit == 'android' [test_peerConnection_restartIceNoBundle.html] -skip-if = android_version +skip-if = toolkit == 'android' [test_peerConnection_restartIceNoBundleNoRtcpMux.html] -skip-if = android_version +skip-if = toolkit == 'android' [test_peerConnection_restartIceNoRtcpMux.html] -skip-if = android_version +skip-if = toolkit == 'android' [test_peerConnection_restartIceLocalRollback.html] -skip-if = android_version +skip-if = toolkit == 'android' [test_peerConnection_restartIceLocalAndRemoteRollback.html] -skip-if = android_version +skip-if = toolkit == 'android' [test_peerConnection_scaleResolution.html] -skip-if = (android_version == '18') # android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = toolkit == 'android' # android(Bug 1189784, timeouts on 4.3 emulator), Bug 1264343 [test_peerConnection_simulcastOffer.html] skip-if = android_version # no simulcast support on android -#[test_peerConnection_relayOnly.html] +#[test_peerConnection_relayOnly.html] Bug 1222983 [test_peerConnection_callbacks.html] -skip-if = (android_version == '18' && debug) # android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = toolkit == 'android' # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_replaceTrack.html] -skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = toolkit == 'android' # Bug 1189784 [test_peerConnection_syncSetDescription.html] skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_setLocalAnswerInHaveLocalOffer.html] @@ -211,7 +212,7 @@ [test_peerConnection_trackDisabling_clones.html] skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_trackDisabling.html] -skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = toolkit == 'android' # android(Bug 1189784, timeouts on 4.3 emulator), Bug 1265878 [test_peerConnection_twoAudioStreams.html] skip-if = (android_version == '18') # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_twoAudioTracksInOneStream.html] @@ -219,11 +220,11 @@ [test_peerConnection_twoAudioVideoStreams.html] skip-if = (os == 'linux' && debug && e10s) || android_version == '18' # Bug 1171255 for Linux debug e10s, android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_twoAudioVideoStreamsCombined.html] -skip-if = (os == 'linux' && debug && e10s) || android_version == '18' # Bug 1127828 for Linux debug e10s, android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = (os == 'linux' && debug && e10s) || toolkit == 'android' # Bug 1127828 for Linux debug e10s, android(Bug 1189784) [test_peerConnection_twoVideoStreams.html] skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_twoVideoTracksInOneStream.html] -skip-if = os == "android" # android(Bug 1189784, timeouts on 4.3 emulator) +skip-if = android_version == '18' # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_addAudioTrackToExistingVideoStream.html] skip-if = (android_version == '18') # android(Bug 1189784, timeouts on 4.3 emulator) [test_peerConnection_addSecondAudioStream.html] diff -Nru firefox-54.0~b1+build1/dom/tests/mochitest/bugs/mochitest.ini firefox-54.0~b2+build1/dom/tests/mochitest/bugs/mochitest.ini --- firefox-54.0~b1+build1/dom/tests/mochitest/bugs/mochitest.ini 2017-04-20 12:54:07.000000000 +0000 +++ firefox-54.0~b2+build1/dom/tests/mochitest/bugs/mochitest.ini 2017-04-25 05:28:22.000000000 +0000 @@ -162,3 +162,5 @@ [test_bug1112040.html] [test_bug1160342_marquee.html] [test_bug1171215.html] +[test_no_find_showDialog.html] +skip-if = toolkit == 'android' # Bug 1358633 - window.find doesn't work for Android diff -Nru firefox-54.0~b1+build1/dom/tests/mochitest/bugs/test_no_find_showDialog.html firefox-54.0~b2+build1/dom/tests/mochitest/bugs/test_no_find_showDialog.html --- firefox-54.0~b1+build1/dom/tests/mochitest/bugs/test_no_find_showDialog.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/dom/tests/mochitest/bugs/test_no_find_showDialog.html 2017-04-25 05:28:21.000000000 +0000 @@ -0,0 +1,92 @@ + + + + + Test for Bug 1348409 + + + + + + + +
Mozilla Bug 1348409 + +

+ Here's some text to search for: fhqwhgads! A hovercraft full of eels! +

+ +

+ +
+
+ + \ No newline at end of file diff -Nru firefox-54.0~b1+build1/editor/composer/nsEditorSpellCheck.cpp firefox-54.0~b2+build1/editor/composer/nsEditorSpellCheck.cpp --- firefox-54.0~b1+build1/editor/composer/nsEditorSpellCheck.cpp 2017-04-20 12:54:08.000000000 +0000 +++ firefox-54.0~b2+build1/editor/composer/nsEditorSpellCheck.cpp 2017-04-25 05:28:22.000000000 +0000 @@ -665,6 +665,10 @@ NS_IMETHODIMP nsEditorSpellCheck::UpdateCurrentDictionary(nsIEditorSpellCheckCallback* aCallback) { + if (NS_WARN_IF(!mSpellChecker)) { + return NS_ERROR_NOT_INITIALIZED; + } + nsresult rv; RefPtr kungFuDeathGrip = this; diff -Nru firefox-54.0~b1+build1/.eslintignore firefox-54.0~b2+build1/.eslintignore --- firefox-54.0~b1+build1/.eslintignore 2017-04-20 12:54:03.000000000 +0000 +++ firefox-54.0~b2+build1/.eslintignore 2017-04-25 05:28:18.000000000 +0000 @@ -65,6 +65,8 @@ browser/components/tabview/** # generated & special files in cld2 browser/components/translation/cld2/** +# Screenshots is imported as a system add-on and has its own lint rules currently. +browser/extensions/screenshots/** browser/extensions/pdfjs/content/build** browser/extensions/pdfjs/content/web** # generated or library files in pocket diff -Nru firefox-54.0~b1+build1/.gitignore firefox-54.0~b2+build1/.gitignore --- firefox-54.0~b1+build1/.gitignore 2017-04-20 12:54:03.000000000 +0000 +++ firefox-54.0~b2+build1/.gitignore 2017-04-25 05:28:18.000000000 +0000 @@ -7,6 +7,7 @@ TAGS tags ID +!/browser/extensions/screenshots/webextension/_locales/id/ .DS_Store* *.pdb *.egg-info diff -Nru firefox-54.0~b1+build1/ipc/glue/CrashReporterHost.cpp firefox-54.0~b2+build1/ipc/glue/CrashReporterHost.cpp --- firefox-54.0~b1+build1/ipc/glue/CrashReporterHost.cpp 2017-04-20 12:54:09.000000000 +0000 +++ firefox-54.0~b2+build1/ipc/glue/CrashReporterHost.cpp 2017-04-25 05:28:23.000000000 +0000 @@ -141,7 +141,8 @@ { MOZ_ASSERT(!NS_IsMainThread()); - if (mProcessType == nsICrashService::PROCESS_TYPE_CONTENT) { + if (mProcessType == nsICrashService::PROCESS_TYPE_CONTENT || + mProcessType == nsICrashService::PROCESS_TYPE_GPU) { CrashReporter::RunMinidumpAnalyzer(mChildDumpID); } diff -Nru firefox-54.0~b1+build1/l10n/changesets firefox-54.0~b2+build1/l10n/changesets --- firefox-54.0~b1+build1/l10n/changesets 2017-04-20 13:13:50.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/changesets 2017-04-25 05:41:10.000000000 +0000 @@ -1,93 +1,94 @@ -ach 641:f828da8318c5 -af 1058:56493f94c27c -an 677:d14828442830 -ar 2417:0e317bbe87ce -as 785:b1f1d8f25055 -ast 1929:dbe86b5e686d -az 774:d195d1ed1c12 -bg 2123:16f590ce9b0f -bn-BD 1656:10b1583cdc76 -bn-IN 1026:629d993fd9a1 -br 1974:fbbc7d86e614 -bs 690:1630720359e4 -ca 3197:5526823b69b1 -cak 657:f5e7638d0783 -cs 5020:190e87e5f3f5 -cy 1788:c239474a72a9 +ach 644:b32543aada0e +af 1061:ffc18d69de6c +an 680:32e563d09531 +ar 2420:4bffa186f062 +as 788:cb7be77baa1a +ast 1930:02436a8aba0a +az 778:70ec2cb50f04 +bg 2146:4005fb5d8beb +bn-BD 1659:bad28887dfcb +bn-IN 1027:f6284e5cda3e +br 1976:9d6d5ea80392 +bs 692:787f9f6836a6 +ca 3200:e17d83cc36f1 +cak 659:ce0710fb8ade +cs 5043:6716185dfdd7 +cy 1790:0ec1ea9ecac2 da 2930:2fc7ef6ff3cc -de 5719:0d12a52554f7 -dsb 989:45c21aa4ecbc -el 2167:341e3daff19b -en-GB 2600:386758cec551 -en-ZA 660:a8f7cfe80eca -eo 1397:75ebc355acda -es-AR 3881:1e03932f76c0 -es-CL 1479:335a70488493 -es-ES 5052:af5f04b33325 -es-MX 1380:a95fc166c386 -et 2393:f398afd6847a -eu 2256:1528090b01c9 -fa 1468:161ac84d62db -ff 720:e2c886c4d1ae -fi 2998:c9f15992c51f -fr 8098:661e5ad66451 -fy-NL 3468:8ce02fd5f2d0 -ga-IE 2488:19789847b533 -gd 2304:7336dacf2130 -gl 3598:79cfb53f6982 -gn 313:04addc8ff99d -gu-IN 1270:20ee82b35b2f -he 2158:e744937d682f -hi-IN 1260:863afa74dea4 -hr 2344:db3dc9aa35c0 -hsb 1176:b6ccadc66f2e -hu 3280:d984107cfa66 -hy-AM 1866:3290cd1d0ce7 -id 2390:909e9cca2801 -is 2013:aaf3929b83b2 -it 7897:3d3859ba2a55 +de 5720:f1614188f3eb +dsb 991:ac2f9d7a85af +el 2174:7528ee450487 +en-GB 2601:0c24a38a97da +en-ZA 663:807c285d989d +eo 1398:1ec04241aa34 +es-AR 3882:53200d366f3e +es-CL 1484:90e9b83f1240 +es-ES 5053:aa0f81eafadc +es-MX 1393:102df2a2e3d9 +et 2394:adf2136ba5f7 +eu 2258:ce17659029d5 +fa 1471:7e53228c3aa8 +ff 722:2464c8b71d6f +fi 2999:37abe3974f60 +fr 8112:40b71a8af77f +fy-NL 3472:0c252ed8e882 +ga-IE 2491:709c76441a9b +gd 2306:3c263e351df8 +gl 3599:191549b58b9b +gn 315:5f9620b23ad2 +gu-IN 1271:435d5d994f94 +he 2169:a994dcad91e0 +hi-IN 1262:cd983d758d01 +hr 2347:9d1eb2847a01 +hsb 1179:ab76f82d30cd +hu 3283:c6f6cac8e674 +hy-AM 1868:9ff24d8990a2 +id 2398:c98d47a4aff4 +is 2016:5a69311f6537 +it 7915:f967f34570f2 ja 3137:649896e0ce5d ja-JP-mac 2569:9eed77671578 -ka 322:7363ef97a47e -kab 514:e23fda2a23c9 -kk 1301:4a6d1371f530 -km 912:996add793765 -kn 1171:e28f3a2d4409 -ko 2666:e459063f5b59 -lij 890:3c9600ffe288 -lt 3779:5a8bdd66fef0 -lv 1461:213692c74b3e -mai 861:7dc75d50b6e7 -mk 624:0fa25691a78b -ml 1035:34d2cf8081a2 -mr 1230:2b71cd3a403a -ms 898:8680ec16d45e -nb-NO 3436:d6b823bcb639 -nl 6315:6f43bd87f3ab -nn-NO 2226:01451322c393 -or 858:02f921b19b92 -pa-IN 2383:b7730af4cd47 -pl 10034:124bbec0f832 -pt-BR 3365:23a867d7a861 -pt-PT 6001:a1e326f7ddfc -rm 1951:7e68f7190007 -ro 2695:0547798229ae -ru 4957:726930da4608 -si 1642:bec949365afe -sk 4804:0c05a55b0dc2 -sl 3220:1a5f01ecc19c -son 971:c7fec6f32078 -sq 2565:4c992ed2587b -sr 1826:a0cd3eda68ec -sv-SE 5516:9d519c5a2483 -ta 1017:d2104059cf69 -te 1288:13d1cfa98de8 -th 1740:6642c6f38232 -tr 3011:5710cd54832d -uk 3934:38690f58d402 -ur 509:da71d799a853 -uz 709:aee78c03cf34 -vi 1301:d3ab8f572c27 -xh 901:2a56e89fe387 -zh-CN 3320:d25b5181a2db -zh-TW 3355:ce919472c211 +ka 324:463a957dfa89 +kab 522:a5296d6b10e2 +kk 1303:4bafda6c438d +km 924:5b2911e3454b +kn 1173:09161eeb51fb +ko 2676:9289fb2e8e51 +lij 894:7a954bd539e1 +lt 3782:c44c263b4f6e +lv 1462:895376ce3fac +mai 863:25c11394313b +mk 625:8b61b68744ac +ml 1037:bf4cbd061017 +mr 1232:4ea513afb2fc +ms 900:1831d6031930 +my 588:f0fec5a6dd5c +nb-NO 3438:be42542a2c9b +nl 6321:d2795e318e86 +nn-NO 2232:9afeaff3be84 +or 860:c395b7b8f725 +pa-IN 2384:f31ef61d2ecd +pl 10037:fe8b2f1b52da +pt-BR 3384:3a4ccfa8f337 +pt-PT 6006:f16ffb0ef179 +rm 1952:c595bbfda2f3 +ro 2699:0c28b18a75d8 +ru 4959:3ec8e5a28547 +si 1643:ea6d021454b3 +sk 4809:95cdc79f8936 +sl 3223:df22dc7ffdc1 +son 973:713a98dc91ac +sq 2567:8f3c929059e4 +sr 1836:3c50265e37bc +sv-SE 5522:443e415e883c +ta 1019:a0b74e8afcc9 +te 1294:c3c5e8d3f2cb +th 1751:70d2074a728d +tr 3014:85cd55f08939 +uk 3945:b14b37ce5a06 +ur 511:2b7d5fea7d8d +uz 712:5430724a2681 +vi 1303:2043800dfd69 +xh 903:bebf98591889 +zh-CN 3329:53d9de02f49e +zh-TW 3360:8f035f808031 diff -Nru firefox-54.0~b1+build1/l10n/fr/browser/chrome/browser/downloads/downloads.dtd firefox-54.0~b2+build1/l10n/fr/browser/chrome/browser/downloads/downloads.dtd --- firefox-54.0~b1+build1/l10n/fr/browser/chrome/browser/downloads/downloads.dtd 2017-04-20 13:01:25.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/fr/browser/chrome/browser/downloads/downloads.dtd 2017-04-25 05:32:59.000000000 +0000 @@ -63,7 +63,7 @@ - + diff -Nru firefox-54.0~b1+build1/l10n/fy-NL/browser/chrome/browser/browser.properties firefox-54.0~b2+build1/l10n/fy-NL/browser/chrome/browser/browser.properties --- firefox-54.0~b1+build1/l10n/fy-NL/browser/chrome/browser/browser.properties 2017-04-20 13:01:43.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/fy-NL/browser/chrome/browser/browser.properties 2017-04-25 05:33:09.000000000 +0000 @@ -216,7 +216,7 @@ compactLightTheme.description=In kompakt tema mei in ljocht kleureskema. # LOCALIZATION NOTE (compactDarkTheme.name): This is displayed in about:addons -> Appearance -compactDarkTheme.name=Kompakte Donker +compactDarkTheme.name=Kompakt Donker compactDarkTheme.description=In kompakt tema mei in donker kleureskema. # LOCALIZATION NOTE (lwthemeInstallRequest.message): %S will be replaced with diff -Nru firefox-54.0~b1+build1/l10n/my/browser/branding/official/brand.dtd firefox-54.0~b2+build1/l10n/my/browser/branding/official/brand.dtd --- firefox-54.0~b1+build1/l10n/my/browser/branding/official/brand.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/branding/official/brand.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,9 @@ + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/branding/official/brand.properties firefox-54.0~b2+build1/l10n/my/browser/branding/official/brand.properties --- firefox-54.0~b1+build1/l10n/my/browser/branding/official/brand.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/branding/official/brand.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,16 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +brandShorterName=Firefox +brandShortName=Firefox +brandFullName=Mozilla Firefox +vendorShortName=Mozilla + +homePageSingleStartMain=Firefox Start၊ ရှာဖွေရေးပါဝင်သည့် လျင်မြန်စွာ အသုံးပြုနိုင်သော အဖွင့်စာမျက်နှာ +homePageImport=%S မှ သင်ရဲ့ အဖွင့်စာမျက်နှာကို သွင်းယူပါ + +homePageMigrationPageTitle=အဖွင့်စာမျက်နှာကို ရွေးချယ်ခြင်း +homePageMigrationDescription=သင်အသုံးပြုလိုသည့် အဖွင့်စာမျက်နှာကို ရွေးချယ်ပါ + +syncBrandShortName=Sync diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutAccounts.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutAccounts.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutAccounts.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutAccounts.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,14 @@ + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutDialog.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutDialog.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutDialog.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutDialog.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,108 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutHealthReport.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutHealthReport.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutHealthReport.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutHealthReport.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,6 @@ + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutHome.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutHome.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutHome.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutHome.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,40 @@ + + + +%brandDTD; + +%syncBrandDTD; + + + + + + +စွမ်းဆောင်ရည်အသစ်များ အကြောင်း ပိုမိုလေ့လာနိုင်ပါသည်။"> + +ထောင်ပေါင်းများစွာသော ပေါင်းစပ်အတ်အွန်များ ရွေးချယ်ရန်"> + +ရပိုင်ခွင့်များကို သိရှိရန်…"> + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutPrivateBrowsing.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutPrivateBrowsing.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutPrivateBrowsing.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutPrivateBrowsing.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,32 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutPrivateBrowsing.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutPrivateBrowsing.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutPrivateBrowsing.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutPrivateBrowsing.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,6 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +title.head=လုံခြုံစွာ ဝဘ်ဆိုက်ကြည့်ရှုခြင်း +title.normal=သီးသန့်ဝင်းဒိုးကို ဖွင့်ပါမည်လား။ diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutRobots.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutRobots.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutRobots.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutRobots.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,29 @@ + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutSearchReset.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutSearchReset.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutSearchReset.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutSearchReset.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,30 @@ + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutSessionRestore.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutSessionRestore.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutSessionRestore.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutSessionRestore.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,51 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutSyncTabs.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutSyncTabs.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutSyncTabs.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutSyncTabs.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,20 @@ + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutTabCrashed.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutTabCrashed.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/aboutTabCrashed.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/aboutTabCrashed.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,30 @@ + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/accounts.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/accounts.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/accounts.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/accounts.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,70 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (reconnectDescription) - %S = Email address of user's Firefox Account +reconnectDescription = %S ကို ပြန်ချိတ်ဆက်ပါ + +# LOCALIZATION NOTE (verifyDescription) - %S = Email address of user's Firefox Account +verifyDescription = %S ကို အတည်ပြုရန် + +# These strings are shown in a desktop notification after the +# user requests we resend a verification email. +verificationSentTitle = အတည်ပြုချက်ပေးပို့ပြီး +# LOCALIZATION NOTE (verificationSentBody) - %S = Email address of user's Firefox Account +verificationSentBody = အတည်ပြုခြင်းဆိုင်ရာ လင့်ခ်တစ်ခုကို %S သို့ ပို့လိုက်သည်။ +verificationNotSentTitle = အတည်ပြုချက်ကို မပေးပို့နိုင်ပါ +verificationNotSentBody = ဒီအချိန်တွင် အတည်ပြုရန်ချောစာကို ကျွန်ုပ်တို့ မပို့နိုင်သေးပါ။ ကျေးဇူးပြု၍ နောင်တွင် ထပ်မံ ဆောင်ရွက်ကြည့်ပါ။ + +# LOCALIZATION NOTE (deviceConnectedTitle, deviceConnectedBody, deviceConnectedBody.noDeviceName) +# These strings are used in a notification shown when a new device joins the Sync account. +# deviceConnectedBody.noDeviceName is shown instead of deviceConnectedBody when we +# could not get the device name that joined +deviceConnectedTitle = Firefox Sync +deviceConnectedBody = ယခုကွန်ပြူတာသည် %S နှင့် တစ်ပြေးညီဖြစ်စေရန် ဆောင်ရွက်နေသည်။ +deviceConnectedBody.noDeviceName = ယခု ကွန်ပျူတာအား အခြားပစ္စည်းတစ်ခုဖြင့် ချိတ်ဆက်ကူးယူနေသှ် + +# LOCALIZATION NOTE (syncStartNotification.title, syncStartNotification.body) +# These strings are used in a notification shown after Sync is connected. +syncStartNotification.title = Sync ကို ဖွင့်ထားသည် +# %S is brandShortName +syncStartNotification.body2 = %S သည် အချိန်တိုင်းနီးပါး တစ်ပြေးညီထပ်တူပြုမှုကို ဆောင်ရွက်လိမ့်မည်။ + +# LOCALIZATION NOTE (deviceDisconnectedNotification.title, deviceDisconnectedNotification.body) +# These strings are used in a notification shown after Sync was disconnected remotely. +deviceDisconnectedNotification.title = Sync ကို ချိတ်ဆက်မထားပါ +deviceDisconnectedNotification.body = ဒီကွန်ပျူတာသည် Firefox Sync ထံမှ ချိတ်ဆက်မှုကို အောင်မြင်စွာ ဖြုတ်ချနိုင်သည်။ + +# LOCALIZATION NOTE (sendTabToAllDevices.menuitem) +# Displayed in the Send Tabs context menu when right clicking a tab, a page or a link. +sendTabToAllDevices.menuitem = ကိရိယာအားလုံး + +# LOCALIZATION NOTE (tabArrivingNotification.title, tabArrivingNotificationWithDevice.title, +# tabsArrivingNotification.title, unnamedTabsArrivingNotification2.body, +# unnamedTabsArrivingNotificationMultiple2.body, unnamedTabsArrivingNotificationNoDevice.body) +# These strings are used in a notification shown when we're opening tab(s) another device sent us to display. + +# LOCALIZATION NOTE (tabArrivingNotification.title, tabArrivingNotificationWithDevice.title) +# The body for these is the URL of the tab recieved +tabArrivingNotification.title = ရရှိထားသော တပ်ဗ် +# LOCALIZATION NOTE (tabArrivingNotificationWithDevice.title) %S is the device name +tabArrivingNotificationWithDevice.title = %S ထံမှ တပ်ဗ် + +tabsArrivingNotification.title = တပ်ဗ်များကို ရရှိထားသည် +# LOCALIZATION NOTE (unnamedTabsArrivingNotification2.body): +# Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the number of tabs received and #2 is the device name. +unnamedTabsArrivingNotification2.body = တပ်ဗ် #1 ခုကို #2 ထံမှ ရရှိထားသည်။;တပ်ဗ် #1 ခုကို #2 ထံမှ ရရှိထားသည်။ +# LOCALIZATION NOTE (unnamedTabsArrivingNotificationMultiple2.body): +# Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the number of tabs received. +unnamedTabsArrivingNotificationMultiple2.body = တပ်ဗ် #1 ခုကို ချိတ်ဆက်ထားသော ကိရိယာများထံမှ ရရှိထားသည်;တပ်ဗ် #1 ခုကို ချိတ်ဆက်ထားသော ကိရိယာများထံမှ ရရှိထားသည် + +# LOCALIZATION NOTE (unnamedTabsArrivingNotificationNoDevice.body): +# Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the number of tabs received +# This version is used when we don't know any device names. +unnamedTabsArrivingNotificationNoDevice.body = တပ်ဗ် #1 ခု ရရှိထားသည်;တပ်ဗ် #1 ခု ရရှိထားသည် diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/baseMenuOverlay.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/baseMenuOverlay.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/baseMenuOverlay.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/baseMenuOverlay.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,54 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/browser.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/browser.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/browser.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/browser.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,901 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +ကွက်ကီးများကို ဖျက်ရန်"> +မှတ်တမ်းကို ဖျက်ရန်"> +တပ်ဗ်များ နှင့် ဝင်းဒိုးများအားလုံးကို ပိတ်ပါ"> + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/browser.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/browser.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/browser.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/browser.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,865 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +nv_timeout=သတ်မှတ်ထားသောအချိန် ကျော်လွန်သွားသည် +openFile=ဖိုင်ကို ဖွင့်ပါ + +droponhometitle=အဖွင့်စာမျက်နှာကို သတ်မှတ်ရန် +droponhomemsg=ဤဝဘ်ဆိုက်စာမျက်နှာကို အဖွင့်စာမျက်နှာအဖြစ် အသုံးပြုလိုပါသလား။ +droponhomemsgMultiple=ဒီစာတမ်းများကို အဖွင့်စာမျက်နှာများအဖြစ် ထားရှိလိုပါသလား။ + +# context menu strings + +# LOCALIZATION NOTE (contextMenuSearch): %1$S is the search engine, +# %2$S is the selection string. +contextMenuSearch=“%2$S” ကို %1$S တွင် ရှာဖွေပါ +contextMenuSearch.accesskey=S + +# bookmark dialog strings + +bookmarkAllTabsDefault=[ဖိုင်တွဲ အမည်] + +xpinstallPromptMessage=သင့်ကွန်ပျူတာတွင် ဆော့ဖ်ဝဲတပ်ဆင်ရန် တောင်းဆိုသည့် ဤဝဘ်ဆိုက်ကို %S က တားမြစ်ထားသည်။ +xpinstallPromptMessage.dontAllow=ခွင့်မပြုပါနှင့် +xpinstallPromptMessage.dontAllow.accesskey=D +xpinstallPromptAllowButton=ခွင့်ပြုပါ +# Accessibility Note: +# Be sure you do not choose an accesskey that is used elsewhere in the active context (e.g. main menu bar, submenu of the warning popup button) +# See http://www.mozilla.org/access/keyboard/accesskey for details +xpinstallPromptAllowButton.accesskey=A +xpinstallDisabledMessageLocked=ဆော့ဖ်ဝဲထည့်သွင်းခြင်းကို စနစ်စီမံကြီးကြပ်သူက ပိတ်ထားသည်။ +xpinstallDisabledMessage=ဆော့ဖ်ဝဲထည့်သွင်းမှုကို ယခုခွင့်မပြုထားပါ။ အကယ်လို့များ ထည့်သွင်းလိုပါက လုပ်ဆောင်နိုင်စေမည် ကို နှိပ်ပြီး တစ်ခါဆောင်ရွက်ကြည့်ပါ။ +xpinstallDisabledButton=လုပ်ဆောင်နိုင်စေမည်။ +xpinstallDisabledButton.accesskey=n + +# LOCALIZATION NOTE (webextPerms.header) +# This string is used as a header in the webextension permissions dialog, +# %S is replaced with the localized name of the extension being installed. +# See https://bug1308309.bmoattachments.org/attachment.cgi?id=8814612 +# for an example of the full dialog. +# Note, this string will be used as raw markup. Avoid characters like <, >, & +webextPerms.header=%S ကို ထည့်မည်လား။ + +# LOCALIZATION NOTE (webextPerms.listIntro) +# This string will be followed by a list of permissions requested +# by the webextension. +webextPerms.listIntro=ယခုခွင့်ပြုချက်များ လိုအပ်ပါသည်။ +webextPerms.add.label=ထည့်ရန် +webextPerms.add.accessKey=A +webextPerms.cancel.label=မလုပ်ဆောင်တော့ပါ +webextPerms.cancel.accessKey=C + +# LOCALIZATION NOTE (webextPerms.sideloadMenuItem) +# %1$S will be replaced with the localized name of the sideloaded add-on. +# %2$S will be replace with the name of the application (e.g., Firefox, Nightly) +webextPerms.sideloadMenuItem=%1$S ကို %2$S သို့ ထည့်ထားသည် + +# LOCALIZATION NOTE (webextPerms.sideloadHeader) +# This string is used as a header in the webextension permissions dialog +# when the extension is side-loaded. +# %S is replaced with the localized name of the extension being installed. +# Note, this string will be used as raw markup. Avoid characters like <, >, & +webextPerms.sideloadHeader=%S ကို ထည့်ထားသည် +webextPerms.sideloadText2=အခြားပရိုဂရမ်သည် သင့်ဘရောင်ဇာကို သက်ရောက်မှုဖြစ်စေနိုင်သည့် အတ်အွန်တစ်ခုကို တပ်ဆင်ထားသည်။ ကျေးဇူးပြု၍ ၎င်းအတ်အွန်၏ လုပ်ပိုင်ခွင့်တောင်းဆိုမှုများကို ပြန်လည် ဆန်းစစ်ပါ သို့မဟုတ် ဖွင့်ရန်ကို ရွေးပါ သို့မဟုတ် မလုပ်ဆောင်တော့ပါ ကိုရွေးပါ (၎င်းကို ပိတ်ထားရန်)။ +webextPerms.sideloadTextNoPerms=အခြားပရိုဂရမ်သည် သင့်ဘရောင်ဇာကို သက်ရောက်မှုဖြစ်စေနိုင်သည့် အတ်အွန်တစ်ခုကို တပ်ဆင်ထားသည်။ ကျေးဇူးပြု၍ ဖွင့်ရန် သို့မဟုတ် မလုပ်ဆောင်တော့ပါ (၎င်းကို ပိတ်ထားရန်) ကို ရွေးပါ။ + +webextPerms.sideloadEnable.label=ဖွင့်ပါ +webextPerms.sideloadEnable.accessKey=E +webextPerms.sideloadCancel.label=မလုပ်ဆောင်တော့ပါ +webextPerms.sideloadCancel.accessKey=C + +# LOCALIZATION NOTE (webextPerms.updateMenuItem) +# %S will be replaced with the localized name of the extension which +# has been updated. +webextPerms.updateMenuItem=%S သည် ခွင့်ပြုချက်အသစ်များ လိုအပ်သည် + +# LOCALIZATION NOTE (webextPerms.updateText) +# %S is replaced with the localized name of the updated extension. +# Note, this string will be used as raw markup. Avoid characters like <, >, & +webextPerms.updateText=%S ကို မြှင့်တင်ပြီးပါပြီ။ မြှင့်တင်ထားသည့် ဗားရှင်းကို မတပ်ဆင်မီ ခွင့်ပြုချက်အသစ်များကို သဘောတူရပါမည်။ “မဆောင်ရွက်တော့ပါ” ကို ရွေးချယ်ပါက လက်ရှိဗားရှင်းအတိုင်းပင် ရှိနေပါလိမ့်မည်။ + +webextPerms.updateAccept.label=ပြင်ဆင်ပါ +webextPerms.updateAccept.accessKey=U + +webextPerms.description.bookmarks=စာမှတ်များကို ဖတ်ရန်နှင့် ပြင်ဆင်ရန် +webextPerms.description.clipboardRead=ကလစ်ဘုတ်ထဲမှ ဒေတာကို ရယူပါ +webextPerms.description.clipboardWrite=ကလစ်ဘုတ်ထဲသို့ ဒေတာထည့်ပါ +webextPerms.description.downloads=ဖိုင်များကို ဆွဲယူရန်၊ ဘရောင်ဇာ၏ ဆွဲယူမှတ်တမ်းကို ဖတ်ရန်နှင့် ပြင်ဆင်ရန် +webextPerms.description.geolocation=တည်နေရာကို ရယူအသုံးပြုပါ +webextPerms.description.history=ရှာဖွေကြည့်ရှုခဲ့သည့်မှတ်တမ်းကို အသုံးပြုမည် +# LOCALIZATION NOTE (webextPerms.description.nativeMessaging) +# %S will be replaced with the name of the application +webextPerms.description.nativeMessaging=%S အပြင်အခြား ပရိုဂရမ်များဖြင့် အပြန်အလှန် သတင်ပေးပို့မည် +webextPerms.description.notifications=သင့်အတွက် သတိပေးချက်များ ပြပေးမည် +webextPerms.description.privacy=ကိုယ်ရေးကာကွယ်မှု အပြင်အဆင်များကို ဖတ်ရှုပြင်ဆင်ရန် +webextPerms.description.sessions=လတ်တလော ပိတ်လိုက်သော တပ်ဗ်များအား သုံးမည် +webextPerms.description.tabs=ဘယောက်ဆာတပ်ဗ်များအားသုံးမည် +webextPerms.description.topSites=ဘယောက်ဆာသုံးဆွဲမှု မှတ်တမ်းကိုကြည့်မည် +webextPerms.description.webNavigation=ဘယောက်ဆာ သုံးဆွဲမှု အခြေအနေကိုကြည့်မည် + +webextPerms.hostDescription.allUrls=ဝတ်ဆိုဒ်အားလုံးအတွက်သင့်အချက်အလက်များအား ကြည့်မည် + +# LOCALIZATION NOTE (webextPerms.hostDescription.wildcard) +# %S will be replaced by the DNS domain for which a webextension +# is requesting access (e.g., mozilla.org) +webextPerms.hostDescription.wildcard=%S ဒိုမိန်း အတွက် သင့်အချက်အလက်များကို ကြည့်မည် + +# LOCALIZATION NOTE (webextPerms.hostDescription.tooManyWildcards): +# Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 will be replaced by an integer indicating the number of additional +# domains for which this webextension is requesting permission. +webextPerms.hostDescription.tooManyWildcards=အခြား #1​ ဒိုမိန်း အတွက် သင့်အချက်အလက်ကို ကြည့်မည် - အခြား #1 ဒိုမိန်းများအတွက်သင့်အချက်အလက်ကိုကြည့်မည် + +# LOCALIZATION NOTE (webextPerms.hostDescription.oneSite) +# %S will be replaced by the DNS host name for which a webextension +# is requesting access (e.g., www.mozilla.org) +webextPerms.hostDescription.oneSite=%S အတွက် သင့်အချက်အလက်ကို ကြည့်မည် + +# LOCALIZATION NOTE (webextPerms.hostDescription.tooManySites) +# Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 will be replaced by an integer indicating the number of additional +# hosts for which this webextension is requesting permission. +webextPerms.hostDescription.tooManySites=အခြား #1​ ဆိုက် အတွက် သင့်အချက်အလက်ကို ကြည့်မည် - အခြား #1 ဆိုက်များအတွက်သင့်အချက်အလက်ကိုကြည့်မည် + +# LOCALIZATION NOTE (addonPostInstall.message) +# %1$S is replaced with the localized named of the extension that was +# just installed. +# %2$S is replaced with the localized name of the application. +addonPostInstall.message1=%1$S အား %2$S သို့ ထည့်ပြီး + +# LOCALIZATION NOTE (addonPostInstall.messageDetail) +# %1$S is replaced with the icon for the add-ons menu. +# %2$S is replaced with the icon for the toolbar menu. +# Note, this string will be used as raw markup. Avoid characters like <, >, & +addonPostInstall.messageDetail=%2$S မီနူးထဲရှိ %1$S ကို ကလစ်နှိပ်ပြီး အတ်အွန်များကို စီမံနိုင်သည်။ +addonPostInstall.okay.label=အိုကေ +addonPostInstall.okay.key=O + +# LOCALIZATION NOTE (addonDownloadingAndVerifying): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +# Also see https://bugzilla.mozilla.org/show_bug.cgi?id=570012 for mockups +addonDownloadingAndVerifying=အက်အွန်ကို ဆွဲယူကူးပြီး အတည်ပြုနေသည်…;အက်အွန် #1 ကို ဆွဲကူးယူနေပြီး အတည်ပြုနေသည်… +addonDownloadVerifying=စစ်ဆေးအတည်ပြုနေသည်။ + +addonInstall.unsigned=(အတည်မပြုရသေး) +addonInstall.cancelButton.label=မလုပ်ဆောင်တော့ပါ +addonInstall.cancelButton.accesskey=C +addonInstall.acceptButton.label=တပ်ဆင်ပါ +addonInstall.acceptButton.accesskey=I + +# LOCALIZATION NOTE (addonConfirmInstallMessage,addonConfirmInstallUnsigned): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is brandShortName +# #2 is the number of add-ons being installed +addonConfirmInstall.message=ဒီဆိုက်သည် #1မှ အက်အွန်တစ်ခုကို ထည့်သွင်းလိုသည်။;ဒီဆိုက်သည် #1မှ အက်အွန် #2 ခုကို ထည့်သွင်းလိုသည်။ +addonConfirmInstallUnsigned.message=သတိ။ ဒီဆိုက်သည် #1က အတည်မပြုရသေးသည့် အက်အွန်တစ်ခုကို တပ်ဆင်လိုသည်။ သင်တာဝန်ယူနိုင်လျှင် ဆောင်ရွက်နိုင်သည်။;သတိ။ ဒီဆိုက်သည် #1က အတည်မပြုရသေးသည့် အက်အွန် #2ခုကို တပ်ဆင်လိုသည်။ သင်တာဝန်ယူနိုင်လျှင် ဆောင်ရွက်နိုင်သည်။ + +# LOCALIZATION NOTE (addonConfirmInstallSomeUnsigned.message): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is brandShortName +# #2 is the total number of add-ons being installed (at least 2) +addonConfirmInstallSomeUnsigned.message=;သတိ။ ဒီဆိုက်သည် #1မှ အက်အွန် #2ခုကို တပ်ဆင်လိုသည်၊ ထို့အထဲမှ တချို့သည့် အတည်မပြုရသေးပါ။ သင်တာဝန်ယူနိုင်လျှင် ဆောင်ရွက်နိုင်သည်။ + +addonwatch.slow=%1$S သည် %2$S ကို နှေးကွေးစေနိုင်ပါသည် +addonwatch.disable.label=%S ကို ပိတ် +addonwatch.ignoreSession.label=လောလောဆယ် လျစ်လျူရှုပေးပါ +addonwatch.ignoreSession.accesskey=I +addonwatch.ignorePerm.label=အမြဲတမ်း လျစ်လျူရှုပါ +addonwatch.ignorePerm.accesskey=p +addonwatch.restart.message=%1$S ကို ပိတ်ရန် သင် %2$S ကို ပြန်လည်စတင်ရပါမည် +addonwatch.restart.label=%S ပြန်ဖွင့်ပါ +addonwatch.restart.accesskey=R + +# LOCALIZATION NOTE (addonsInstalled, addonsInstalledNeedsRestart): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 first add-on's name, #2 number of add-ons, #3 application name +addonsInstalled=#1 ကို အောင်မြင်စွာတပ်ဆင်ပြီးပါပြီ။;အတ်အွန် #2 ခုကို အောင်မြင်စွာတပ်ဆင်ပြီးပါပြီ။ +addonsInstalledNeedsRestart=သင် #3 ကို ပြန်ဖွင့်သည့်အချိန်တွင် #1 ကို တပ်ဆင်ပြီး ဖြစ်လိမ့်မည်။;သင် #3 ကို ပြန်ဖွင့်သည့်အချိန်တွင် အတ်အွန် #2 ခုကို တပ်ဆင်ပြီး ဖြစ်လိမ့်မည်။ +addonInstallRestartButton=ယခုပင် ပိတ်ပြီးပြန်ဖွင့်ပါ +addonInstallRestartButton.accesskey=R +addonInstallRestartIgnoreButton=ယခုမဟုတ်သေး +addonInstallRestartIgnoreButton.accesskey=N + +# LOCALIZATION NOTE (addonInstallError-1, addonInstallError-2, addonInstallError-3, addonInstallError-4, addonInstallError-5, addonLocalInstallError-1, addonLocalInstallError-2, addonLocalInstallError-3, addonLocalInstallError-4, addonLocalInstallError-5): +# %1$S is the application name, %2$S is the add-on name +addonInstallError-1=ချိတ်ဆက်မှုအခက်အခဲကြောင့် အတ်အွန်ကို ဒေါင်းလုဒ်ရယူခြင်း မပြုနိုင်ပါ။ +addonInstallError-2=ဤအတ်အွန်ကို တပ်ဆင်ခြင်းမပြုနိုင်ပါ။ အဘယ့်ကြောင့်ဆိုသော် %1$S သည် မျှော်လင့်ထားသည့် ဖိုင်နှင့် မကိုက်ညီသောကြောင့် ဖြစ်သည်။ +addonInstallError-3=ဤဝဘ်ဆိုက်ထံမှ ရရှိသော အတ်အွန်ကို မတပ်ဆင်နိုင်ပါ။ အဘယ့်ကြောင့်ဆိုသော် ဖိုင်ပျက်နေသည့်အတွက် ဖြစ်သည်။ +addonInstallError-4=%2$S ကို တပ်ဆင်ခြင်းမပြုနိုင်ပါ။ အဘယ့်ကြောင့်ဆိုသော် %1$S သည် လိုအပ်သည့်ဖိုင်ကို ပြုပြင်နိုင်စွမ်း မရှိသောကြောင့်ဖြစ်သည်။ +addonInstallError-5=ဒီဆိုက်သည် အတည်မပြုရသေးသည့် အက်အွန်တစ်ခု တပ်ဆင်ခြင်းကို %1$S က ကာကွယ်ထားသည်။ +addonLocalInstallError-1=ဖိုင်စနစ်အမှားအယွင်းတစ်ခုကြောင့် အတ်အွန်ကို တပ်ဆင်ခြင်းမပြုနိုင်ပါ။ +addonLocalInstallError-2=ဒီအက်အွန်ကို တပ်ဆင်ခြင်း မပြုနိုင်ပါ။ အဘယ့်ကြောင့်ဆိုသော် မျှော်မှန်းထားသည့်အတ်အွန် %1$S နှင့် မကိုက်ညီသောကြောင့် ဖြစ်သည်။ +addonLocalInstallError-3=ဤအတ်အွန်ကို တပ်ဆင်ခြင်း မပြုနိုင်ပါ။ အဘယ့်ကြောင့်ဆိုသော် ဖိုင်ပျက်နေသောကြောင့် ဖြစ်သည်။ +addonLocalInstallError-4=%2$S ကို တပ်ဆင်ခြင်း မပြုနိုင်ပါ။ အဘယ့်ကြောင့်ဆိုသော် %1$S သည် လိုအပ်သောဖိုင်ကို ပြုပြင်နိုင်စွမ်းမရှိသောကြောင့်ဖြစ်သည်။ +addonLocalInstallError-5=ဤအတ်အွန်ကို တပ်ဆင်ခြင်းမပြုနိုင်ပါ။ အဘယ့်ကြောင့်ဆိုသော် ၄င်းကို အတည်မပြုရသေးသောကြောင့် ဖြစ်သည်။ + +# LOCALIZATION NOTE (addonInstallErrorIncompatible): +# %1$S is the application name, %2$S is the application version, %3$S is the add-on name +addonInstallErrorIncompatible=%3$S အား %1$S %2$S နှင့်ကိုက်ညီခြင်း မရှိသဖြင့် တပ်ဆင်မရနိုင်ပါ။\u0020 + +# LOCALIZATION NOTE (addonInstallErrorBlocklisted): %S is add-on name +addonInstallErrorBlocklisted=%S အား တည်ငြိမ်မှုနှင့် လုံခြုံရေးပြသာနာများ အရ တပ်ဆင်ခြင်း မပြုနိုင်ပါ + +unsignedAddonsDisabled.message=တပ်ဆင်ထားသည့် အတ်အွန် တစ်ခုမကကို အတည်မပြုနိုင်ပါ။ ထို့ကြောင့် ပိတ်ထားသည်။ +unsignedAddonsDisabled.learnMore.label=ပိုမိုလေ့လာရန် +unsignedAddonsDisabled.learnMore.accesskey=L + +# LOCALIZATION NOTE (compactLightTheme.name): This is displayed in about:addons -> Appearance +compactLightTheme.name=သေးသွယ် ပေါ့ပါး +compactLightTheme.description=ပေါ့ပါးသောအရောင်ဖြင့် သေးသွယ်သော အသွင်အပြင် + +# LOCALIZATION NOTE (compactDarkTheme.name): This is displayed in about:addons -> Appearance +compactDarkTheme.name=သေးသွယ် လေးလံ +compactDarkTheme.description=ခပ်လေးလေး အရောင်ဖြင့် အသွင် အပြင် + +# LOCALIZATION NOTE (lwthemeInstallRequest.message): %S will be replaced with +# the host name of the site. +lwthemeInstallRequest.message=ဤဝဘ်ဆိုက်(%S)သည် သင့်ကွန်ပျူတာအတွင်းသို့ အသွင်အပြင်တစ်ခုကို ထည့်သွင်းရန် ကြိုးပမ်းခဲ့သည်။ +lwthemeInstallRequest.allowButton=ခွင့်ပြုပါ +lwthemeInstallRequest.allowButton.accesskey=a + +lwthemePostInstallNotification.message=အသွင်အပြင်အသစ်ကို တပ်ဆင်ပြီးပါပြီ။ +lwthemePostInstallNotification.undoButton=မလုပ်တော့ပါ +lwthemePostInstallNotification.undoButton.accesskey=U +lwthemePostInstallNotification.manageButton=အသွင်အပြင်များကို စီမံရန်… +lwthemePostInstallNotification.manageButton.accesskey=M + +# LOCALIZATION NOTE (lwthemeNeedsRestart.message): +# %S will be replaced with the new theme name. +lwthemeNeedsRestart.message=ဘရောင်ဇာကို ပိတ်ပြီးပြန်ဖွင့်မှသာလျှင် %S တပ်ဆင်ပါလိမ့်မည်။ +lwthemeNeedsRestart.button=ယခုပင် ပြန်လည်စတင်ပါ +lwthemeNeedsRestart.accesskey=S + +# LOCALIZATION NOTE (popupWarning.message): Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is brandShortName and #2 is the number of pop-ups blocked. +popupWarning.message=#1 သည် ယခုဝဘ်ဆိုက်ထံမှ pop-up ဝင်းဒိုးဖွင့်ခြင်းကို တားဆီးထားသည်။;#1 သည် ယခုဝဘ်ဆိုက်ထံမှ pop-up ဝင်းဒိုး #2 ဖွင့်ခြင်းကို တားဆီးထားသည်။ +popupWarningButton=ရွေးစရာများ +popupWarningButton.accesskey=O +popupWarningButtonUnix=နှစ်သက်ရာအပြင်အဆင်များ +popupWarningButtonUnix.accesskey=P +popupAllow=%S မှ pop-up များကို ခွင့်ပြုမည် +popupBlock=%S မှ pop-up များကို တားဆီးမည် +popupWarningDontShowFromMessage=ဤစာတန်းအား pop-ups ဝင်းဒိုးများပိတ်ထားပါက ထပ်မပြပါနှင့်။ +popupWarningDontShowFromLocationbar=အချက်အလက်ဘားတန်းအား pop-upများပိတ်ထားပါကမပြပါနှင့်။ +popupShowPopupPrefix='%S' ကို ပြပါ + +# Bad Content Blocker Doorhanger Notification +# %S is brandShortName +badContentBlocked.blocked.message=ဒီစာမျက်နှာတွင်ရှိသော အကြောင်းအရာတစ်ခုကို %S က တားဆီးထားသည်။ +badContentBlocked.notblocked.message=ဒီစာမျက်နှာတွင်ရှိသော မည်သည့်အကြောင်းအရာကိုမျှ %S က တားဆီးထားခြင်း မရှိပါ။ + +crashedpluginsMessage.title=ဒီ ပလက်အင်%S သည် ရုတ်တရက် ရပ်ဆိုင်းသွားသည်။ +crashedpluginsMessage.reloadButton.label=စာမျက်နှာကို ပြန်ဖွင့်ပါ +crashedpluginsMessage.reloadButton.accesskey=R +crashedpluginsMessage.submitButton.label=ပျက်ဆီးမှု အစီရင်ခံစာ တင်သွင်းပါ +crashedpluginsMessage.submitButton.accesskey=S +crashedpluginsMessage.learnMore=ဆက်လက်လေ့လာရန်… + +# Keyword fixup messages +# LOCALIZATION NOTE (keywordURIFixup.message): Used when the user tries to visit +# a local host page, by the time the DNS request recognizes it, we have already +# loaded a search page for the given word. An infobar then asks to the user +# whether he rather wanted to visit the host. %S is the recognized host. +keywordURIFixup.message=%S သို့သွားရန် ရည်ရွယ်ပါသလား။ +keywordURIFixup.goTo=ဟုတ်ကဲ့၊ %S သို့ ပို့ပေးပါ +keywordURIFixup.goTo.accesskey=Y +keywordURIFixup.dismiss=နေပါစေ၊ ကျေးဇူးတင်ပါသည် +keywordURIFixup.dismiss.accesskey=N + +## Plugin doorhanger strings +# LOCALIZATION NOTE (pluginActivateNew.message): Used for newly-installed +# plugins which are not known to be unsafe. %1$S is the plugin name and %2$S +# is the site domain. +pluginActivateNew.message=%2$S အား "%1$S" ကိုတွက်ချက်ခိုင်းမည် +pluginActivateMultiple.message=%S အားထပ်ပေါင်းဆော့ဝဲများကို တွက်ချက်ခွင့်ပေးမည် +pluginActivate.learnMore=ဆက်လက်လေ့လာရန်… +# LOCALIZATION NOTE (pluginActivateOutdated.message, pluginActivateOutdated.label): +# These strings are used when an unsafe plugin has an update available. +# %1$S is the plugin name, %2$S is the domain, and %3$S is brandShortName. +pluginActivateOutdated.message=%3$S သည် အဆင့်နိမ့်သော ထပ်ပေါင်း ဆော့ဝဲ "%1$S" ကို %2$S ပေါ်တွင် လုပ်ဆောင်ခွင့်မပေးပါ +pluginActivateOutdated.label=ဟောင်းနွမ်းထပ်ပေါင်းဆော့ဝဲ +pluginActivate.updateLabel=ယခုပင် အဆင့်မြှင့်ပါ… +# LOCALIZATION NOTE (pluginActivateVulnerable.message, pluginActivateVulnerable.label): +# These strings are used when an unsafe plugin has no update available. +# %1$S is the plugin name, %2$S is the domain, and %3$S is brandShortName. +pluginActivateVulnerable.message=%3$S မလုံခြုံသော ထပ်ပေါင်းဆော့ဝဲ "%1$S" အား %2$S ပေါ်တွင်လုပ်ဆောင်ခွင့်မပေး +pluginActivateVulnerable.label=အန္တရာယ်ရှိသော ပလပ်အင်! +pluginActivate.riskLabel=ဘာဆိုးကျိုးတွေ ဖြစ်စေနိုင်ပါသလဲ။ +# LOCALIZATION NOTE (pluginActivateBlocked.message): %1$S is the plugin name, %2$S is brandShortName +pluginActivateBlocked.message=%2$S သည် "%1$S" အားသင့်ကိုယ်ကာကွယ်ရန် ပိတ်ထားသှ် +pluginActivateBlocked.label=သင့်လုံခြုံရေးအတွက် တားဆီးထားသည် +pluginActivateDisabled.message="%S" ကို ပိတ်ထားသည်။ +pluginActivateDisabled.label=ပိတ်ထားတယ် +pluginActivateDisabled.manage=ပလပ်အင်များကို စီမံမည်… +pluginEnabled.message="%S" ကို %S ပေါ်တွင်ဖွင့်ထားသည်။ +pluginEnabledOutdated.message=ခေတ်မမှီတော့သော ပလက်အင် "%S"ကို %S တွင် အသုံးပြုမည်။ +pluginEnabledVulnerable.message=မလုံခြုံသော ပလက်အင် “%S” ကို %S တွင် အသုံးပြုမည်။ +pluginInfo.unknownPlugin=အမည်မသိ + +# LOCALIZATION NOTE (pluginActivateNow.label, pluginActivateAlways.label, pluginBlockNow.label): These should be the same as the matching strings in browser.dtd +# LOCALIZATION NOTE (pluginActivateNow.label): This button will enable the +# plugin in the current session for an short time (about an hour), auto-renewed +# if the site keeps using the plugin. +pluginActivateNow.label=ယခုခွင့်ပြုမည် +pluginActivateNow.accesskey=N +# LOCALIZATION NOTE (pluginActivateAlways.label): This button will enable the +# plugin for a long while (90 days), auto-renewed if the site keeps using the +# plugin. +pluginActivateAlways.label=ခွင့်ပြုပါမည်။ ထိုခွင့်ပြုချက်ကို မှတ်ထားပါ။ +pluginActivateAlways.accesskey=R +pluginBlockNow.label=ပလပ်အင်ကို တားမြစ်ပိတ်ပင်ပါ +pluginBlockNow.accesskey=B +pluginContinue.label=ဆက်လက်ခွင့်ပြုမည် +pluginContinue.accesskey=C + +# in-page UI +PluginClickToActivate=%S ကို စတင်လုပ်ဆောင်စေမည်။ +PluginVulnerableUpdatable=ဤ ပလက်အင်သည် လုံခြုံမှုအားနည်းပြီး ၎င်းကို အဆင့်မြှင့်တင်သင့်သည်။ +PluginVulnerableNoUpdate=ဒီပလက်အင်တွင် လုံခြုံရေးအားနည်းချက်များ ရှိသည်။ + +# infobar UI +pluginContinueBlocking.label=ဆက်လက်ပိတ်ထားမည် +pluginContinueBlocking.accesskey=B +# LOCALIZATION NOTE (pluginActivateTrigger): Use the unicode ellipsis char, \u2026, +# or use "..." if \u2026 doesn't suit traditions in your locale. +pluginActivateTrigger.label=ခွင့်ပြုပါ… +pluginActivateTrigger.accesskey=A + +# Sanitize +# LOCALIZATION NOTE (sanitizeDialog2.everything.title): When "Time range to +# clear" is set to "Everything", the Clear Recent History dialog's title is +# changed to this. See UI mockup and comment 11 at bug 480169 --> +sanitizeDialog2.everything.title=မှတ်တမ်းအားလုံးကို ရှင်းပါမည် +sanitizeButtonOK=ယခု ရှင်းလင်းပါ +# LOCALIZATION NOTE (sanitizeButtonClearing): The label for the default +# button between the user clicking it and the window closing. Indicates the +# items are being cleared. +sanitizeButtonClearing=ရှင်းလင်းနေသည် + +# LOCALIZATION NOTE (sanitizeEverythingWarning2): Warning that appears when +# "Time range to clear" is set to "Everything" in Clear Recent History dialog, +# provided that the user has not modified the default set of history items to clear. +sanitizeEverythingWarning2=မှတ်တမ်းအားလုံးကို ရှင်းလင်းပါမည်။ +# LOCALIZATION NOTE (sanitizeSelectedWarning): Warning that appears when +# "Time range to clear" is set to "Everything" in Clear Recent History dialog, +# provided that the user has modified the default set of history items to clear. +sanitizeSelectedWarning=ရွေးထားသည့်မှတ်တမ်းများကို ရှင်းလင်းပါမည်။ + +# LOCALIZATION NOTE (downloadAndInstallButton.label): %S is replaced by the +# version of the update: "Update to 28.0". +update.downloadAndInstallButton.label=%S ကို အဆင့်မြှင့်ပါ +update.downloadAndInstallButton.accesskey=U + +menuOpenAllInTabs.label=အားလုံးကို တပ်ဗ်များတွင် ဖွင့်ပါ + +# History menu +menuRestoreAllTabs.label=တပ်ဗ်အားလုံးကို ပြန်ဖွင့်ရန် +# LOCALIZATION NOTE (menuRestoreAllTabsSubview.label): like menuRestoreAllTabs.label, +# but used in the history subview in the panel UI, so needs to mention these are *closed* tabs. +menuRestoreAllTabsSubview.label=ပိတ်ထားသောတပ်ဗ်များကို ပြန်ဖွင့်မည် +# LOCALIZATION NOTE (menuRestoreAllWindows, menuUndoCloseWindowLabel, menuUndoCloseWindowSingleTabLabel): +# see bug 394759 +menuRestoreAllWindows.label=ဝင်းဒိုးအားလုံးကို ပြန်ဖွင့်မည် +# LOCALIZATION NOTE (menuRestoreAllWindowsSubview.label): like menuRestoreAllWindows.label, +# but used in the history subview in the panel UI, so needs to mention these are *closed* windows. +menuRestoreAllWindowsSubview.label=ပိတ်ထားသောဝင်းဒိုးကို ပြန်ဖွင့်မည် +# LOCALIZATION NOTE (menuUndoCloseWindowLabel): Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 Window Title, #2 Number of tabs +menuUndoCloseWindowLabel=#1 (နှင့် အခြားတပ်ဗ် #2 ခု);#1 (နှင့် အခြားတပ်ဗ် #2 ခု) +menuUndoCloseWindowSingleTabLabel=#1 + +# Unified Back-/Forward Popup +tabHistory.current=ဤစာမျက်နှာတွင် ဆက်နေမည်။ +tabHistory.goBack=ဤစာမျက်နှာကို ပြန်သွားမည်။ +tabHistory.goForward=ဤစာမျက်နှာကို သွားပါ + +# URL Bar +pasteAndGo.label=ကူးထားခြင်းမှ ပွားပြီး ၎င်းသို့ သွားရောက်ပါ +# LOCALIZATION NOTE(urlbar-zoom-button.label): %S is the current zoom level, +# %% will be displayed as a single % character (% is commonly used to define +# format specifiers, so it needs to be escaped). +urlbar-zoom-button.label = %S%% + +# Block autorefresh +refreshBlocked.goButton=ခွင့်ပြုပါ +refreshBlocked.goButton.accesskey=A +refreshBlocked.refreshLabel=ဤစာမျက်နှာအား အလိုအလျှောက်ပြန်လည်ဖွင့်ခြင်းမှ %S က တားမြစ်ထားသည်။ +refreshBlocked.redirectLabel=%S သည် ဒီစာမျက်နှာမှ အခြားစာမျက်နှာသို့ အလိုအလျောက် ကူးပြောင်းချိတ်ဆက်ခြင်းကို တားဆီးထားသည်။ + +# General bookmarks button +# LOCALIZATION NOTE (bookmarksMenuButton.tooltip): +# %S is the keyboard shortcut for "Show All Bookmarks" +bookmarksMenuButton.tooltip=သင်၏ သိမ်းဆည်းမှတ်သားများကို ပြပါ (%S) +# Star button +starButtonOn.tooltip2=စာအမှတ်အားပြင်မည်(%S) +starButtonOff.tooltip2=စာအမှတ်အားမှတ်သားထားမည်(%S) +starButtonOverflowed.label=စာမျက်နှာ အမှတ်အသားပြုလုပ်မည် +starButtonOverflowedStarred.label=အမှတ်အသားအားပြင်မည် + +# Downloads button tooltip +# LOCALIZATION NOTE (downloads.tooltip): +# %S is the keyboard shortcut for "Downloads" +downloads.tooltip=ဆွဲချနေမှုများ တိုးတက်တဲ့ အနေအထားကို ပြသပါ (%S) + +# Print button tooltip on OS X +# LOCALIZATION NOTE (printButton.tooltip): +# Use the unicode ellipsis char, \u2026, +# or use "..." if \u2026 doesn't suit traditions in your locale. +# %S is the keyboard shortcut for "Print" +printButton.tooltip=ဤစာမျက်နှာအား ပရင့်ထုတ်ပါ (%S) + +# New Window button tooltip +# LOCALIZATION NOTE (newWindowButton.tooltip): +# %S is the keyboard shortcut for "New Window" +newWindowButton.tooltip=(%S)ဝင်းဒိုးသစ် တစ်ခုဖွင့်ပါ + +# New Tab button tooltip +# LOCALIZATION NOTE (newTabButton.tooltip): +# %S is the keyboard shortcut for "New Tab" +newTabButton.tooltip=တပ်ဗ်အသစ် တစ်ခုဖွင့် (%S) + +# Offline web applications +offlineApps.available2=သင့်ကွန်ပျူတာတွင် ဒေတာသိမ်းဆည်းရန် %S ကို ခွင့်ပြုပါမည်လား။ +offlineApps.allowStoring.label=ဒေတာသိမ်းခြင်းကို ခွင့်ပြုပါ +offlineApps.allowStoring.accesskey=A +offlineApps.dontAllow.label=ခွင့်မပြုပါနှင့် +offlineApps.dontAllow.accesskey=n + +offlineApps.usage=ယခုဝဘ်ဆိုက် (%S) သည် ချိတ်ဆက်မဲ့အသုံးပြုနိုင်ရန်အတွက် သင့်ကွန်ပျူတာထဲတွင် အချက်အလက်ပမာဏ %S MB ကျော် သိမ်းဆည်းနေသည်။ +offlineApps.manageUsage=ဆက်တင်များကိုပြပါ။ +offlineApps.manageUsageAccessKey=S + +identity.identified.verifier=%S မှစစ်ဆေးပြီး။ +identity.identified.verified_by_you=ယခုဝဘ်ဆိုက်အတွက် လုံခြုံရေးဆိုင်ရာခြွင်းချက်တစ်ခု ထည့်ပြီးဖြစ်သည်။ +identity.identified.state_and_country=%S, %S + +identity.icon.tooltip=ဝဘ်ဆိုက်အချက်အလက်ကို ပြပါ + +trackingProtection.intro.title=ခြေရာခံ ကာကွယ်မှု အလုပ်လုပ်ပုံ +# LOCALIZATION NOTE (trackingProtection.intro.description2): +# %S is brandShortName. This string should match the one from Step 1 of the tour +# when it starts from the button shown when a new private window is opened. +trackingProtection.intro.description2=သင် ဒိုင်းကို မြင်ရလျှင် %S သည် သင့်လှုပ်ရှားမှုကို နောက်ယောင်ခံနိုင်သည့် ဝဘ်စာမျက်နှာ၏ အချို့သောအစိတ်အပိုင်းများကို ပိတ်ပင်ထားသည်။ +# LOCALIZATION NOTE (trackingProtection.intro.step1of3): Indicates that the intro panel is step one of three in a tour. +trackingProtection.intro.step1of3=အဆင့် ၃ ဆင့်မှ အဆင့် ၁ +trackingProtection.intro.nextButton.label=နောက်ထပ် + +trackingProtection.icon.activeTooltip=ခြေရာခံရန် ကြိုးစားမှု တားဆီးထားသည် +trackingProtection.icon.disabledTooltip=ခြေရာခံသည့်အစိတ်အပိုင်းကို တွေ့ရှိထားသည် + +# Edit Bookmark UI +editBookmarkPanel.pageBookmarkedTitle=စာမျက်နှာကို မှတ်ထားပြီးပြီ +editBookmarkPanel.pageBookmarkedDescription=ဒီစာမျက်နှာကို %S သည် အမြဲတမ်း မှတ်ထားပါလိမ့်မည်။ +editBookmarkPanel.bookmarkedRemovedTitle=မှတ်သားချက်အားပယ်ဖျက်ပြီး။ +editBookmarkPanel.editBookmarkTitle=ဒီစာမှတ်ကို ပြင်ရန် + +# LOCALIZATION NOTE (editBookmark.removeBookmarks.label): Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# Replacement for #1 is the number of bookmarks to be removed. +# If this causes problems with localization you can also do "Remove Bookmarks (#1)" +# instead of "Remove #1 Bookmarks". +editBookmark.removeBookmarks.label=မှတ်သားချက်အားဖယ်ပါ;မှတ်သားချက်#1 အား ဖယ်ပါ။ + +# Post Update Notifications +pu.notifyButton.label=အသေးစိတ်များ... +pu.notifyButton.accesskey=D +# LOCALIZATION NOTE %S will be replaced by the short name of the application. +puNotifyText=%S ကို အဆင့်မြှင့်တင်ပြီးပြီ +puAlertTitle=%S ကို အဆင့်မြှင့်တင်ပြီးပြီ +puAlertText=ဤသေးစိတ်ကြည့်ရှူရန်အတွက်ဒီကိုနှိပ်ပါ။ + +# Geolocation UI + +geolocation.allowLocation=တည်နေရာရယူခြင်းကို ခွင့်ပြုပါ +geolocation.allowLocation.accesskey=A +geolocation.dontAllowLocation=ခွင့်မပြုပါနှင့် +geolocation.dontAllowLocation.accesskey=n +geolocation.shareWithSite3=သင့်တည်နေရာရယူအသုံးပြုရန် %S ကို ခွင့်ပြုပါမည်လား။ +geolocation.shareWithFile3=သင့်တည်နေရာကို ရယူအသုံးပြုရန် ကွန်ပျူတာထဲရှိဖိုင်ကို ခွင့်ပေးမည်လား။ +geolocation.remember=ယခုဆုံးဖြတ်ချက်ကို မှတ်ထားပါ + +webNotifications.remember=ယခုဆုံးဖြတ်ချက်ကို မှတ်ထားပါ +webNotifications.rememberForSession=ယခုအသုံးပြုနေစဉ်အတွင်း ယခုဆုံးဖြတ်ချက်ကို မှတ်ထားပါ +webNotifications.allow=အသိပေးချက်များကို ပြခွင့်ပြုပါ +webNotifications.allow.accesskey=A +webNotifications.dontAllow=ခွင့်မပြုပါနှင့် +webNotifications.dontAllow.accesskey=n +webNotifications.receiveFromSite2=အသိပေးချက်များ ပေးပို့ရန် %S ကို ခွင့်ပေးပါမည်လား။ +# LOCALIZATION NOTE (webNotifications.upgradeTitle): When using native notifications on OS X, the title may be truncated around 32 characters. +webNotifications.upgradeTitle=အဆင့်မြှင့်ထားသည့် အသိပေးချက်များ +# LOCALIZATION NOTE (webNotifications.upgradeBody): When using native notifications on OS X, the body may be truncated around 100 characters in some views. +webNotifications.upgradeBody=သင်သည် ယခုအချိန်ကစပြီး ဝဘ်ဆိုက်များမှ အသိပေးချက်များကို လက်ခံရယူနိုင်ပါပြီ။ ပိုမိုလေ့လာရန် ကလစ်နှိပ်ပါ။ + +# Phishing/Malware Notification Bar. +# LOCALIZATION NOTE (notADeceptiveSite, notAnAttack) +# The two button strings will never be shown at the same time, so +# it's okay for them to have the same access key +safebrowsing.getMeOutOfHereButton.label=Gဒီနေရာမှ ကျွန်ပ်ကကို ဆွဲထုတ်ပါ။ +safebrowsing.getMeOutOfHereButton.accessKey=G +safebrowsing.deceptiveSite=အတုအယောင်ဝဘ်ဆိုက် +safebrowsing.notADeceptiveSiteButton.label=အတုအယောင်ဝဘ်ဆိုက် မဟုတ်ပါ… +safebrowsing.notADeceptiveSiteButton.accessKey=d +safebrowsing.reportedAttackSite=သတိပေးထားခြင်းခံရသောတိုက်ခိုက်ခံရသည့်ဆိုက်! +safebrowsing.notAnAttackButton.label=a ဤဆိုက်သည်တိုက်ခိုက်မခံထားရပါ... +safebrowsing.notAnAttackButton.accessKey=a +safebrowsing.reportedUnwantedSite=အတိုင်ကြားခံထားရသည့် မလိုအပ်သည့်ဆော့ဖ်ဝဲများ ဆိုက်။ + +# Ctrl-Tab +# LOCALIZATION NOTE (ctrlTab.listAllTabs.label): #1 represents the number +# of tabs in the current browser window. It will always be 2 at least. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +ctrlTab.listAllTabs.label=;စာမျက်နှာ #1ခုကို စာရင်းပြုပြီး ပြပါ + +# LOCALIZATION NOTE (addKeywordTitleAutoFill): %S will be replaced by the page's title +# Used as the bookmark name when saving a keyword for a search field. +addKeywordTitleAutoFill=%S အားရှာပါ + +extensions.{972ce4c6-7e08-4474-a285-3208198ce6fd}.name=မူရင်းအခြေအနေ +extensions.{972ce4c6-7e08-4474-a285-3208198ce6fd}.description=နဂိုပါအခင်းအကျင်း + +# safeModeRestart +safeModeRestartPromptTitle=အတ်အွန်မသုံးသောအနေဖြင့်ပြန်စသုံးမည်။ +safeModeRestartPromptMessage=အတ်အွန်အားလုံးအားပိတ်ပြီးမီးမြေခွေးပြန်လည်အသုံးပြုမည်မှာသေချာသွားပြီလား ။ +safeModeRestartButton=ပြန်လည်စတင်မည်။ + +# LOCALIZATION NOTE (browser.menu.showCharacterEncoding): Set to the string +# "true" (spelled and capitalized exactly that way) to show the "Text +# Encoding" menu in the main Firefox button on Windows. Any other value will +# hide it. Regardless of the value of this setting, the "Text Encoding" +# menu will always be accessible via the "Web Developer" menu. +# This is not a string to translate; it just controls whether the menu shows +# up in the Firefox button. If users frequently use the "Text Encoding" +# menu, set this to "true". Otherwise, you can leave it as "false". +browser.menu.showCharacterEncoding=အမှား + +# Mozilla data reporting notification (Telemetry, Firefox Health Report, etc) +dataReportingNotification.message = %1$S သည် %2$S သို့အချို့အချက်အလက်များအား အလိုအလျောက်ပေးပို့ပြီးသင်၏ အတွေ့အကြုံကိုမြှင့်တင်ပေးပါလိမ့်မည် +dataReportingNotification.button.label = မျှဝေနိုင်သည်များကို ရွေးပါ +dataReportingNotification.button.accessKey = C + +# Process hang reporter +processHang.label = ဝဘ်စာမျက်နှာတစ်ခုသည် သင့်ဘရောင်ဇာကို နှေးကွေးစေပါသည်။ သင်ဘာလုပ်ချင်ပါသလဲ။ +processHang.button_stop.label = ရပ်ဆိုင်းပါ +processHang.button_stop.accessKey = S +processHang.button_wait.label = စောင့်ဆိုင်းပါ +processHang.button_wait.accessKey = W +processHang.button_debug.label = Script ကို အမှားရှာရန် +processHang.button_debug.accessKey = D + +# LOCALIZATION NOTE (fullscreenButton.tooltip): %S is the keyboard shortcut for full screen +fullscreenButton.tooltip=%S မြင်ကွင်းအားအပြည့်ချဲ့ကြည့်မည် + +service.toolbarbutton.label=ဝန်ဆောင်မှုများ +service.toolbarbutton.tooltiptext=ဝန်ဆောင်မှုများ + +# LOCALIZATION NOTE (social.install.description): %1$S is the hostname of the social provider, %2$S is brandShortName (e.g. Firefox) +service.install.description=သင်၏ %2$S ဘားနှင့် ဘေးတန်းများတွင် အသုံးပြုရန် %1$S မှ ဝန်ဆောင်မှူများအား အသုံးပြုမည်လား ? +service.install.ok.label=ဝန်ဆောင်မှုများကို ဖွင့်ထားပါ +service.install.ok.accesskey=E + +# LOCALIZATION NOTE (social.markpageMenu.label): %S is the name of the social provider +social.markpageMenu.label=စာမျက်နှာကို %S တွင် သိမ်းပါ +# LOCALIZATION NOTE (social.marklinkMenu.label): %S is the name of the social provider +social.marklinkMenu.label=လင့်ခ်ကို %S တွင် သိမ်းပါ + +# LOCALIZATION NOTE (social.error.message): %1$S is brandShortName (e.g. Firefox), %2$S is the name of the social provider +social.error.message=%1$S ဟာ အခုလောလောဆယ် %2$S နဲ့ ချိတ်ဆက်နိုင်ခြင်းမရှိပါ။ +social.error.tryAgain.label=ထပ်ကြိုးစားပါ +social.error.tryAgain.accesskey=T +social.error.closeSidebar.label=ဒီဘေးဘားတန်းကို ပိတ်ရန် +social.error.closeSidebar.accesskey=C + +# LOCALIZATION NOTE: %1$S is the label for the toolbar button, %2$S is the associated badge numbering that the social provider may provide. +social.aria.toolbarButtonBadgeText=%1$S (%2$S) + +# LOCALIZATION NOTE (getUserMedia.shareCamera2.message, +# getUserMedia.shareMicrophone2.message, +# getUserMedia.shareScreen3.message, +# getUserMedia.shareCameraAndMicrophone2.message, +# getUserMedia.shareCameraAndAudioCapture2.message, +# getUserMedia.shareScreenAndMicrophone3.message, +# getUserMedia.shareScreenAndAudioCapture3.message, +# getUserMedia.shareAudioCapture2.message): +# %S is the website origin (e.g. www.mozilla.org) +getUserMedia.shareCamera2.message = သင့်ကင်မရာကို အသုံးပြုရန် %S ကို ခွင့်ပေးပါမည်လား။ +getUserMedia.shareMicrophone2.message = သင့်မိုက္ကရိုဖုန်းကို အသုံးပြုရန် %S ကို ခွင့်ပြုပါမည်လား။ +getUserMedia.shareScreen3.message = သင့်ကွန်ပျူတာမျက်နှာပြင်ကို မြင်တွေ့စေရန် %S ကို ခွင့်ပြုပါမည်လား။ +getUserMedia.shareCameraAndMicrophone2.message = သင့်ကင်မရာနှင့် မိုက္ကရိုဖုန်းကို အသုံးပြုရန် %S ကို ခွင့်ပေးပါမည်လား။ +getUserMedia.shareCameraAndAudioCapture2.message = သင့်ကင်မရာကို အသုံးပြုရန်နှင့် ယခုတပ်ဗ်၏ အသံကို နားထောင်ရန် %S ကို ခွင့်ပေးပါမည်လား။ +getUserMedia.shareScreenAndMicrophone3.message = သင့်မိုက္ကရိုဖုန်းကို အသုံးပြုရန်နှင့် ကွန်ပျူတာမျက်နှာပြင်ကို မြင်တွေ့ရန် %S ကို ခွင့်ပေးပါမည်လား။ +getUserMedia.shareScreenAndAudioCapture3.message = ယခုတပ်ဗ်၏ အသံကို နားထောင်ရန်နှင့် ကွန်ပျူတာမျက်နှာပြင်ကို မြင်ရရန် %S ကို ဆောင်ရွက်ခွင့် ပြုပါမည်လား။ +getUserMedia.shareAudioCapture2.message = ယခုတပ်ဗ်၏ အသံကို နားထောင်ရန် %S ကို ဆောင်ရွက်ခွင့် ပြုပါမည်လား။ +# LOCALIZATION NOTE (getUserMedia.shareScreenWarning.message): NB: inserted via innerHTML, so please don't use <, > or & in this string. +# %S will be the 'learn more' link +getUserMedia.shareScreenWarning.message = သင်ယုံကြည်ရသော ဆိုက်များနှင့်သာ စကရင်များကို မျှဝေအသုံးပြုပါ။ မျှဝေခြင်းသည် ဆိုက်အတုများကို သင်အနေနှင့် ဝင်ရောက်ကြည့်ရှုနိုင်စေသည့်အပြင် ကိုယ်ရေးအချက်အလက်များကိုလည်း ခိုးယူစေနိုင်သည်။ %S +# LOCALIZATION NOTE (getUserMedia.shareFirefoxWarning.message): NB: inserted via innerHTML, so please don't use <, > or & in this string. +# %1$S is brandShortName (eg. Firefox) +# %2$S will be the 'learn more' link +getUserMedia.shareFirefoxWarning.message = သင်ယုံကြည်ရသော ဆိုက်များနှင့်သာ %1$S ကို မျှဝေအသုံးပြုပါ။ မျှဝေခြင်းသည် ဆိုက်အတုများကို သင်အနေနှင့် ဝင်ရောက်ကြည့်ရှုနိုင်စေသည့်အပြင် ကိုယ်ရေးအချက်အလက်များကိုလည်း ခိုးယူစေနိုင်သည်။ %2$S +# LOCALIZATION NOTE(getUserMedia.shareScreen.learnMoreLabel): NB: inserted via innerHTML, so please don't use <, > or & in this string. +getUserMedia.shareScreen.learnMoreLabel = ပိုမိုလေ့လာရန် +getUserMedia.selectWindow.label=ဝင်းဒိုးကို မျှဝေရန် +getUserMedia.selectWindow.accesskey=W +getUserMedia.selectScreen.label=မျက်နှာပြင်ကို မျှဝေရန် +getUserMedia.selectScreen.accesskey=S +getUserMedia.selectApplication.label=အက်ပလီကေးရှင်းကို မျှဝေရန် +getUserMedia.selectApplication.accesskey=A +getUserMedia.noApplication.label = မည်သည့် အက်ပလီကေးရှင်းမျှ မရှိပါ +getUserMedia.noScreen.label = မည်သည့် မျက်နှာပြင်မျှ မရှိပါ +getUserMedia.noWindow.label = မည်သည့် ဝင်းဒိုးမျှ မရှိပါ +getUserMedia.shareEntireScreen.label = မျက်နှာပြင်တစ်ခုလုံး +# LOCALIZATION NOTE (getUserMedia.shareMonitor.label): +# %S is screen number (digits 1, 2, etc) +# Example: Screen 1, Screen 2,.. +getUserMedia.shareMonitor.label = %S (မျက်နှာပြင်) +# LOCALIZATION NOTE (getUserMedia.shareApplicationWindowCount.label): +# Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# Replacement for #1 is the name of the application. +# Replacement for #2 is the number of windows currently displayed by the application. +getUserMedia.shareApplicationWindowCount.label=#1 (ဝင်းဒိုး #2 ခု);#1 (ဝင်းဒိုး #2 ခု) +# LOCALIZATION NOTE (getUserMedia.allow.label, +# getUserMedia.dontAllow.label): +# These two buttons are the possible answers to the various prompts in the +# "getUserMedia.share{device}.message" strings. +getUserMedia.allow.label = ခွင့်ပြုပါ +getUserMedia.allow.accesskey = A +getUserMedia.dontAllow.label = ခွင့်မပြုပါနှင့် +getUserMedia.dontAllow.accesskey = D +getUserMedia.remember=ယခုဆုံးဖြတ်ချက်ကို မှတ်ထားပါ +# LOCALIZATION NOTE (getUserMedia.reasonForNoPermanentAllow.screen2, +# getUserMedia.reasonForNoPermanentAllow.audio, +# getUserMedia.reasonForNoPermanentAllow.insecure): +# %S is brandShortName +getUserMedia.reasonForNoPermanentAllow.screen2=သင့်ကွန်ပျူတာမျက်နှာပြင် ဘယ်တစ်ခုကို မျှဝေအသုံးပြုရန် မတောင်းဆိုပဲ ရယူအသုံးပြုခြင်းကို %S က ဆောင်ရွက်ခွင့် မပေးနိုင်ပါ။ +getUserMedia.reasonForNoPermanentAllow.audio=သင့်တပ်ဗ် ဘယ်တစ်ခု၏ အသံကို မျှဝေအသုံးပြုရန် မတောင်းဆိုပဲ ရယူအသုံးပြုခြင်းကို %S က ဆောင်ရွက်ခွင့် မပေးနိုင်ပါ။ +getUserMedia.reasonForNoPermanentAllow.insecure=ယခုဝဘ်ဆိုက်သို့ ချိက်ဆက်ထားခြင်းသည် လုံခြုံမှု မရှိပါ။ သင့်ကို ကာကွယ်ရန် %S က ယခုချိတ်ဆက်ထားစဉ် ကာလအတွက်သာ ဆောင်ရွက်ခွင့် ပေးပါမည်။ + +getUserMedia.sharingMenu.label = ကိရိယာများနှင့် မျှသုံးနေသော တပ်ဗ်များ +getUserMedia.sharingMenu.accesskey = d +# LOCALIZATION NOTE (getUserMedia.sharingMenuCamera +# getUserMedia.sharingMenuMicrophone, +# getUserMedia.sharingMenuAudioCapture, +# getUserMedia.sharingMenuApplication, +# getUserMedia.sharingMenuScreen, +# getUserMedia.sharingMenuWindow, +# getUserMedia.sharingMenuBrowser, +# getUserMedia.sharingMenuCameraMicrophone, +# getUserMedia.sharingMenuCameraMicrophoneApplication, +# getUserMedia.sharingMenuCameraMicrophoneScreen, +# getUserMedia.sharingMenuCameraMicrophoneWindow, +# getUserMedia.sharingMenuCameraMicrophoneBrowser, +# getUserMedia.sharingMenuCameraAudioCapture, +# getUserMedia.sharingMenuCameraAudioCaptureApplication, +# getUserMedia.sharingMenuCameraAudioCaptureScreen, +# getUserMedia.sharingMenuCameraAudioCaptureWindow, +# getUserMedia.sharingMenuCameraAudioCaptureBrowser, +# getUserMedia.sharingMenuCameraApplication, +# getUserMedia.sharingMenuCameraScreen, +# getUserMedia.sharingMenuCameraWindow, +# getUserMedia.sharingMenuCameraBrowser, +# getUserMedia.sharingMenuMicrophoneApplication, +# getUserMedia.sharingMenuMicrophoneScreen, +# getUserMedia.sharingMenuMicrophoneWindow, +# getUserMedia.sharingMenuMicrophoneBrowser, +# getUserMedia.sharingMenuAudioCaptureApplication, +# getUserMedia.sharingMenuAudioCaptureScreen, +# getUserMedia.sharingMenuAudioCaptureWindow, +# getUserMedia.sharingMenuAudioCaptureBrowser): +# %S is the website origin (e.g. www.mozilla.org) +getUserMedia.sharingMenuCamera = %S (ကင်မရာ) +getUserMedia.sharingMenuMicrophone = %S (မိုက္ကရိုဖုန်း) +getUserMedia.sharingMenuAudioCapture = %S (စာမျက်နှာခွဲ၏ အော်ဒီယို) +getUserMedia.sharingMenuApplication = %S (အက်ပလီကေးရှင်း) +getUserMedia.sharingMenuScreen = %S (မျက်နှာပြင်) +getUserMedia.sharingMenuWindow = %S (ဝင်းဒိုး) +getUserMedia.sharingMenuBrowser = %S (စာမျက်နှာ) +getUserMedia.sharingMenuCameraMicrophone = %S (ကင်မရာနှင့် မိုက္ကရိုဖုန်း) +getUserMedia.sharingMenuCameraMicrophoneApplication = %S (ကင်မရာ၊ မိုက္ကရိုဖုန်းနှင့် အက်ပလီကေးရှင်း) +getUserMedia.sharingMenuCameraMicrophoneScreen = %S (ကင်မရာ၊ မိုက္ကရိုဖုန်းနှင့် မျက်နှာပြင်) +getUserMedia.sharingMenuCameraMicrophoneWindow = %S (ကင်မရာ၊ မိုက္ကရိုဖုန်းနှင့် ဝင်းဒိုး) +getUserMedia.sharingMenuCameraMicrophoneBrowser = %S (ကင်မရာ၊ မိုက္ကရိုဖုန်းနှင့် စာမျက်နှာခွဲ) +getUserMedia.sharingMenuCameraAudioCapture = %S (ကင်မရာနှင့် စာမျက်နှာခွဲ၏ အော်ဒီယို) +getUserMedia.sharingMenuCameraAudioCaptureApplication = %S (ကင်မရာ၊ စာမျက်နှာခွဲ၏ အော်ဒီယိုနှင့် အက်ပလီကေးရှင်း) +getUserMedia.sharingMenuCameraAudioCaptureScreen = %S (ကင်မရာ၊ စာမျက်နှာခွဲ၏ အော်ဒီယိုနှင့် မျက်နှာပြင်) +getUserMedia.sharingMenuCameraAudioCaptureWindow = %S (ကင်မရာ၊ စာမျက်နှာခွဲ၏ အော်ဒီယိုနှင့် ဝင်းဒိုး) +getUserMedia.sharingMenuCameraAudioCaptureBrowser = %S (ကင်မရာ၊ စာမျက်နှာခွဲ၏ အော်ဒီယိုနှင့် စာမျက်နှာခွဲ) +getUserMedia.sharingMenuCameraApplication = %S (ကင်မရာနှင့် အက်ပလီကေးရှင်း) +getUserMedia.sharingMenuCameraScreen = %S (ကင်မရာနှင့် မျက်နှာပြင်) +getUserMedia.sharingMenuCameraWindow = %S (ကင်မရာနှင့် ဝင်းဒိုး) +getUserMedia.sharingMenuCameraBrowser = %S (ကင်မရာနှင့် စာမျက်နှာခွဲ) +getUserMedia.sharingMenuMicrophoneApplication = %S (မိုက္ကရိုဖုန်းနှင့် အက်ပလီကေးရှင်း) +getUserMedia.sharingMenuMicrophoneScreen = %S (မိုက္ကရိုဖုန်းနှင့် မျက်နှာပြင်) +getUserMedia.sharingMenuMicrophoneWindow = %S (မိုက္ကရိုဖုန်းနှင့် ဝင်းဒိုး) +getUserMedia.sharingMenuMicrophoneBrowser = %S (မိုက္ကရိုဖုန်းနှင့် စာမျက်နှာခွဲ) +getUserMedia.sharingMenuAudioCaptureApplication = %S (စာမျက်နှာခွဲ၏ အော်ဒီယိုနှင့် အက်ပလီကေးရှင်း) +getUserMedia.sharingMenuAudioCaptureScreen = %S (စာမျက်နှာခွဲ၏ အော်ဒီယိုနှင့် မျက်နှာပြင်) +getUserMedia.sharingMenuAudioCaptureWindow = %S (စာမျက်နှာခွဲ၏ အော်ဒီယိုနှင့် ဝင်းဒိုး) +getUserMedia.sharingMenuAudioCaptureBrowser = %S (စာမျက်နှာခွဲ၏ အော်ဒီယိုနှင့် စာမျက်နှာခွဲ) +# LOCALIZATION NOTE(getUserMedia.sharingMenuUnknownHost): this is used for the website +# origin for the sharing menu if no readable origin could be deduced from the URL. +getUserMedia.sharingMenuUnknownHost = မူလရင်းမြစ်ကို မသိပါ + +# LOCALIZATION NOTE(emeNotifications.drmContentPlaying.message2): %S is brandShortName. +emeNotifications.drmContentPlaying.message2 = ဒီဆိုက်ရှိ အော်ဒီယို (သို့) ဗွီဒီယိုအချို့သည် DRM ဆော့ဖ်ဝဲ(%S က သင့်ကို ပေးထားသည့် လုပ်ပိုင်ခွင့်ကို ကန့်သတ်နိုင်သည်)ကို အသုံးပြုထားသည်။ +emeNotifications.drmContentPlaying.button.label = ပြင်ဆင်ချိန်ညှိရန်… +emeNotifications.drmContentPlaying.button.accesskey = C + +emeNotifications.drmContentDisabled.button.label = DRM ကို ဖွင့်ပါ +emeNotifications.drmContentDisabled.button.accesskey = E +# LOCALIZATION NOTE(emeNotifications.drmContentDisabled.learnMoreLabel): NB: inserted via innerHTML, so please don't use <, > or & in this string. +emeNotifications.drmContentDisabled.learnMoreLabel = ပိုမိုလေ့လာရန် + +# LOCALIZATION NOTE(emeNotifications.drmContentCDMInstalling.message): NB: inserted via innerHTML, so please don't use <, > or & in this string. %S is brandShortName +emeNotifications.drmContentCDMInstalling.message = ဒီစာမျက်နှာရှိ အော်ဒီယို သို့မဟုတ် ဗွီဒီယိုကို ဖွင့်ရန် %S သည် လိုအပ်သော အစိတ်အပိုင်းများကို တပ်ဆင်နေသည်။. ကျေးဇူးပြု၍ နောင်တွင် ထပ်မံ ဆောင်ရွက်ကြည့်ပါ။ + +emeNotifications.unknownDRMSoftware = အမည်မသိ + +# LOCALIZATION NOTE - %S is brandShortName +slowStartup.message = %S သည် စတင်ရန်… နှေးကွေးနေပုံရသည်… +slowStartup.helpButton.label = မြန်စေရန်ဆောင်ရွက်နည်းကို လေ့လာရန် +slowStartup.helpButton.accesskey = L +slowStartup.disableNotificationButton.label = နောင်တွင် မပြပါနှင့် +slowStartup.disableNotificationButton.accesskey = A + +# LOCALIZATION NOTE - %S is brandShortName +flashHang.message = %S သည် စွမ်းရည် တိုးမြှင့်ရန် Adobe Flash ၏ အပြင်အဆင်တချို့ကို ပြောင်းလဲခဲ့သည်။ +flashHang.helpButton.label = ပိုမိုလေ့လာရန်… +flashHang.helpButton.accesskey = L + +# LOCALIZATION NOTE(customizeTips.tip0): %1$S will be replaced with the text defined +# in customizeTips.tip0.hint, %2$S will be replaced with brandShortName, %3$S will +# be replaced with a hyperlink containing the text defined in customizeTips.tip0.learnMore. +customizeTips.tip0 = %1$S။ သင်သည် %2$S ကို စိတ်ကြိုက် ပြင်ဆင်နိုင်သည်။ အထက်တွင် ရှိသော မည်သည့်အရာကိုမဆို မီနူး သို့မဟုတ် တန်ဆာပလာဘားထဲသို့ ဖိဆွဲပြီး ထည့်နိုင်သည်။ %3$S စိတ်ကြိုက်ပြင်ဆင်ခြင်း အကြောင်း %2$S. +customizeTips.tip0.hint = နမူနာ +customizeTips.tip0.learnMore = ပိုမိုလေ့လာရန် + +# LOCALIZATION NOTE (customizeMode.tabTitle): %S is brandShortName +customizeMode.tabTitle = %S ကို စိတ်ကြိုက်ပြုပြင်ရန် + +# LOCALIZATION NOTE(appmenu.*.description, appmenu.*.label): these are used for +# the appmenu labels and buttons that appear when an update is staged for +# installation or a background update has failed and a manual download is required. +# %S is brandShortName +appmenu.restartNeeded.description = အဆင့်မြှင့်တင်ရန် %S ကို ပြန်လည်စတင်ပါ +appmenu.updateFailed.description = နောက်ကွယ်၌ အဆင့်မြှင့်တင်ရာတွင် မအောင်မြင်ပါ၊ ကျေးဇူးပြု၍ အဆင့်မြှင့်ဖိုင်ကို ဆွဲယူကူးပါ +appmenu.restartBrowserButton.label = %S ပြန်ဖွင့်ပါ +appmenu.downloadUpdateButton.label = မွမ်းမံချက်ကို ဆွဲယူကူးပါ + +# LOCALIZATION NOTE : FILE Reader View is a feature name and therefore typically used as a proper noun. + +readingList.promo.firstUse.readerView.title = စာဖတ်ပုံစံ +readingList.promo.firstUse.readerView.body = အရှုပ်အပွများကို ဖယ်ရှားပါ။ ထို့ကြောင့် သင်သည် သင်ဖတ်ချင်သည့် အကြောင်းအရာပေါ် အာရုံစိုက်နိုင်ပါမည်။ + +# LOCALIZATION NOTE (appMenuRemoteTabs.mobilePromo.text2): +# %1$S will be replaced with a link, the text of which is +# appMenuRemoteTabs.mobilePromo.android and the link will be to +# https://www.mozilla.org/firefox/android/. +# %2$S will be replaced with a link, the text of which is +# appMenuRemoteTabs.mobilePromo.ios +# and the link will be to https://www.mozilla.org/firefox/ios/. +appMenuRemoteTabs.mobilePromo.text2 = %1$S သို့မဟုတ် %2$S ကို ဆွဲယူပြီး သင့်မီးမြေခွေးအကောင့်နှင့် ချိတ်ဆက်ပါ။ +appMenuRemoteTabs.mobilePromo.android = Android အတွက် Firefox +appMenuRemoteTabs.mobilePromo.ios = iOS အတွက် Firefox + +# LOCALIZATION NOTE (e10s.accessibilityNotice.mainMessage, +# e10s.accessibilityNotice.enableAndRestart.label, +# e10s.accessibilityNotice.enableAndRestart.accesskey): +# These strings are related to the messages we display to offer e10s (Multi-process) to users +# on the pre-release channels. They won't be used in release but they will likely be used in +# beta starting from version 41, so it's still useful to have these strings properly localized. +# %S is brandShortName +e10s.accessibilityNotice.mainMessage2 = စွမ်းဆောင်ရည်အသစ် %S နှင့်ပတ်သက်သည့် လိုက်လျောညီထွေဖြစ်မှု ပြဿနာကြောင့် သုံးစွဲနိုင်စွမ်းအထောက်အပံ့ကို တစ်စိတ်တစ်ပိုင်းအားဖြင့် ပိတ်ထားသည်။ +e10s.accessibilityNotice.acceptButton.label = ကောင်းပြီ +e10s.accessibilityNotice.acceptButton.accesskey = O +e10s.accessibilityNotice.enableAndRestart.label = ဖွင့်ပါ (ပြန်လည်စတင်ရန် လိုအပ်သည်) +e10s.accessibilityNotice.enableAndRestart.accesskey = E + +# LOCALIZATION NOTE (userContextPersonal.label, +# userContextWork.label, +# userContextShopping.label, +# userContextBanking.label, +# userContextNone.label): +# These strings specify the four predefined contexts included in support of the +# Contextual Identity / Containers project. Each context is meant to represent +# the context that the user is in when interacting with the site. Different +# contexts will store cookies and other information from those sites in +# different, isolated locations. You can enable the feature by typing +# about:config in the URL bar and changing privacy.userContext.enabled to true. +# Once enabled, you can open a new tab in a specific context by clicking +# File > New Container Tab > (1 of 4 contexts). Once opened, you will see these +# strings on the right-hand side of the URL bar. +userContextPersonal.label = ကိုယ်ရေးကိုယ်တာ +userContextWork.label = အလုပ် +userContextBanking.label = ဘဏ်လုပ်ငန်းဆိုင်ရာ +userContextShopping.label = စျေးဝယ်ခြင်း +userContextNone.label = ကွန်တိန်နာ မရှိပါ + +userContextPersonal.accesskey = P +userContextWork.accesskey = W +userContextBanking.accesskey = B +userContextShopping.accesskey = S +userContextNone.accesskey = N + +userContext.aboutPage.label = ကွန်တိန်နာများကို စီမံရန် +userContext.aboutPage.accesskey = O + +userContextOpenLink.label = လင့်ခ်ကို စာမျက်နှာအသစ် %S တွင် ဖွင့်ပါ + +muteTab.label = တပ်ဗ်၏ အသံပိုင်းကို ပိတ်ရန် +muteTab.accesskey = M +unmuteTab.label = အသံ ပြန်ဖွင့်ပါ +unmuteTab.accesskey = m +playTab.label = တပ်ဗ်ရှိအသံပိုင်းဆိုင်ရာကို ဖွင့်ပါ +playTab.accesskey = P + +# LOCALIZATION NOTE (certErrorDetails*.label): These are text strings that +# appear in the about:certerror page, so that the user can copy and send them to +# the server administrators for troubleshooting. +certErrorDetailsHSTS.label = HTTP Strict Transport Security: %S +certErrorDetailsKeyPinning.label = HTTP Public Key Pinning: %S +certErrorDetailsCertChain.label = Certificate chain: + +# LOCALIZATION NOTE (pendingCrashReports2.label): Semi-colon list of plural forms +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the number of pending crash reports +pendingCrashReports2.label = သင့်တွင် မပေးပို့ရသေးသော ပျက်စီးမှုအစီရင်ခံစာ တစ်စောင် ရှိသည်။;သင့်တွင် မပေးပို့ရသေးသော ပျက်စီးမှုအစီရင်ခံစာ #1 စောင် ရှိသည်။ +pendingCrashReports.viewAll = ကြည့်ရန် +pendingCrashReports.send = ပို့ပါ +pendingCrashReports.alwaysSend = အမြဲ ပို့ပါ + +decoder.noCodecs.button = ဆောင်ရွက်ပုံကို လေ့လာရန် +decoder.noCodecs.accesskey = L +decoder.noCodecs.message = ဗီဒီယိုကို ဖွင့်ရန် မိုက္ကရိုဆော့ဖ်၏ Media Feature Pack ကို လိုအပ်နိုင်သည်။ +decoder.noCodecsLinux.message = ဗီဒီယိုကို ဖွင့်ရန် လိုအပ်သော ဗီဒီယိုကိုဒက်များကို ထည့်သွင်းထားရန် လိုအပ်သည်။ +decoder.noHWAcceleration.message = ဗီဒီယိုအရည်အသွေးမြင့်မားစေရန် မိုက္ကရိုဆော့ဖ်၏ Media Feature Pack ကို ထည့်သွင်းရန် လိုအပ်နိုင်သည်။ +decoder.noPulseAudio.message = အော်ဒီယိုကို ဖွင့်ရန် PulseAudio ဆော့ဖ်ဝဲလ်ကို တပ်ဆင်ရန် လိုအပ်ကောင်း လိုအပ်နိုင်သည်။ +decoder.unsupportedLibavcodec.message = libavcodec သည် အားနည်းချက်များ ရှိနိုင်သည် သို့မဟုတ် ၎င်းကို မထောက်ပံ့တော့ပါ။ ထို့ပြင် ဗီဒီယိုများကို ဖွင့်နိုင်ရန် ၎င်းကို အဆင့်မြှင့်တင်ထားသင့်သည်။ + +# LOCALIZATION NOTE (captivePortal.infoMessage3): +# Shown in a notification bar when we detect a captive portal is blocking network access +# and requires the user to log in before browsing. +captivePortal.infoMessage3 = အင်တာနက်ကို အသုံးမပြုနိုင်မီ ဒီကွန်ယက်သို့ လက်မှတ်ထိုး ဝင်ရောက်ရပါမည်။ +# LOCALIZATION NOTE (captivePortal.showLoginPage2): +# The label for a button shown in the info bar in all tabs except the login page tab. +# The button shows the portal login page tab when clicked. +captivePortal.showLoginPage2 = ကွန်ယက်သို့ လက်မှတ်ထိုးဝင်ရန် စာမျက်နှာကို ဖွင့်ပါ + +permissions.remove.tooltip = ယခုခွင့်ပြုချက်ကို ပယ်ဖျက်ပြီး နောင်ဆောင်ရွက်သည့်အခါ မေးပါ + +# LOCALIZATION NOTE (aboutDialog.architecture.*): +# The sixtyFourBit and thirtyTwoBit strings describe the architecture of the +# current Firefox build: 32-bit or 64-bit. These strings are used in parentheses +# between the Firefox version and the "What's new" link in the About dialog, +# e.g.: "48.0.2 (32-bit) " or "51.0a1 (2016-09-05) (64-bit)". +aboutDialog.architecture.sixtyFourBit = 64-bit +aboutDialog.architecture.thirtyTwoBit = 32-bit diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/customizableui/customizableWidgets.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/customizableui/customizableWidgets.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/customizableui/customizableWidgets.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/customizableui/customizableWidgets.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,115 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +history-panelmenu.label = မှတ်တမ်း +# LOCALIZATION NOTE(history-panelmenu.tooltiptext2): %S is the keyboard shortcut +history-panelmenu.tooltiptext2 = မှတ်တမ်းကို ပြပါ (%S) + +remotetabs-panelmenu.label = ချိတ်ထားသည့် တပ်ဗ်များ +remotetabs-panelmenu.tooltiptext2 = အခြားကိရိယာများမှ တပ်ဗ်များကို ပြပါ + +privatebrowsing-button.label = သီးသန့်ဝင်းဒိုး အသစ် +# LOCALIZATION NOTE(privatebrowsing-button.tooltiptext): %S is the keyboard shortcut +privatebrowsing-button.tooltiptext = သီးသန့်ဝင်းဒိုးအသစ်တစ်ခုကို ဖွင့်ပါ (%S) + +save-page-button.label = စာမျက်နှာကို သိမ်းရန် +# LOCALIZATION NOTE(save-page-button.tooltiptext3): %S is the keyboard shortcut +save-page-button.tooltiptext3 = စာမျက်နှာကို သိမ်းရန် (%S) + +find-button.label = ရှာဖွေပါ +# LOCALIZATION NOTE(find-button.tooltiptext3): %S is the keyboard shortcut. +find-button.tooltiptext3 = ဤစာမျက်နှာတွင် ရှာပါ (%S) + +open-file-button.label = ဖိုင်ဖွင့်ရန် +# LOCALIZATION NOTE (open-file-button.tooltiptext3): %S is the keyboard shortcut. +open-file-button.tooltiptext3 = ဖိုင်တစ်ဖိုင်ကို ဖွင့်ရန် (%S) + +developer-button.label = Developer +# LOCALIZATION NOTE(developer-button.tooltiptext): %S is the keyboard shortcut +developer-button.tooltiptext2 = ဝဘ်ဖန်တီးသူဆိုင်ရာ ကိရိယာများကို ဖွင့်ပါ (%S) + +sidebar-button.label = ဘေးဘားတန်းများ +sidebar-button.tooltiptext2 = ဘေးဘားတန်းများကို ပြပါ + +add-ons-button.label = အတ်အွန်များ +# LOCALIZATION NOTE(add-ons-button.tooltiptext3): %S is the keyboard shortcut +add-ons-button.tooltiptext3 = အတ်အွန်များကို စီမံရန် (%S) + +preferences-button.label = နှစ်သက်ရာ အပြင်အဆင်များ +preferences-button.tooltiptext2 = နှစ်သက်ရာအပြင်အဆင်များကို ဖွင့်ပါ +preferences-button.tooltiptext.withshortcut = နှစ်သက်ရာ အပြင်အဆင်များကို ဖွင့်ရန် (%S) +# LOCALIZATION NOTE (preferences-button.labelWin): Windows-only label for Options +preferences-button.labelWin = ရွေးချယ်စရာများ +# LOCALIZATION NOTE (preferences-button.tooltipWin): Windows-only tooltip for Options +preferences-button.tooltipWin2 = ရွေးချယ်စရာများကို ဖွင့်ပါ + +zoom-controls.label = ချုံ့/ချဲ့ ထိန်းချုပ်ခလုတ်များ +zoom-controls.tooltiptext2 = ချုံ့/ချဲ့ ထိန်းချုပ်ခလုတ်များ + +zoom-out-button.label = ချုံ့ကြည့်မည် +# LOCALIZATION NOTE(zoom-out-button.tooltiptext2): %S is the keyboard shortcut. +zoom-out-button.tooltiptext2 = ချုံ့ကြည့်မည် (%S) + +# LOCALIZATION NOTE(zoom-reset-button.label): %S is the current zoom level, +# %% will be displayed as a single % character (% is commonly used to define +# format specifiers, so it needs to be escaped). +zoom-reset-button.label = %S%% +# LOCALIZATION NOTE(zoom-reset-button.tooltiptext2): %S is the keyboard shortcut. +zoom-reset-button.tooltiptext2 = ချုံ့/ချဲ့ပြန်လည်ညှိရန် (%S) + +zoom-in-button.label = ချဲ့ကြည့်မည် +# LOCALIZATION NOTE(zoom-in-button.tooltiptext2): %S is the keyboard shortcut. +zoom-in-button.tooltiptext2 = ချဲ့ကြည့်မည် (%S) + +edit-controls.label = ထိန်းချုပ်ခလုတ်များကို ပြင်ဆင်ရန် +edit-controls.tooltiptext2 = ထိန်းချုပ်ခလုတ်များကို ပြင်ဆင်ရန် + +cut-button.label = ဖြတ်ယူပါ +# LOCALIZATION NOTE(cut-button.tooltiptext2): %S is the keyboard shortcut. +cut-button.tooltiptext2 = ဖြတ်ယူပါ (%S) + +copy-button.label = ကူးယူပါ +# LOCALIZATION NOTE(copy-button.tooltiptext2): %S is the keyboard shortcut. +copy-button.tooltiptext2 = ကူးယူပါ (%S) + +paste-button.label = ပွားပါ +# LOCALIZATION NOTE(paste-button.tooltiptext2): %S is the keyboard shortcut. +paste-button.tooltiptext2 = ပွားပါ (%S) + +feed-button.label = စာရင်းသွင်းပါ +feed-button.tooltiptext2 = ဒီစာမျက်နှာမှာ စာရင်းသွင်းပါ + +containers-panelmenu.label = ကွန်တိန်နာတပ်ဗ်ကို ဖွင့်ပါ +containers-panelmenu.tooltiptext = ကွန်တိန်နာတပ်ဗ်ကို ဖွင့်ပါ + +# LOCALIZATION NOTE (characterencoding-button2.label): The \u00ad text at the beginning +# of the string is used to disable auto hyphenation on the button text when it is displayed +# in the menu panel. +characterencoding-button2.label = \u00adစာသားသိမ်းဆည်းမှုစနစ် +characterencoding-button2.tooltiptext = စာသား သိမ်းဆည်းမှု အပြင်အဆင်များကို ပြပါ + +email-link-button.label = လင့်ခ်ကို အီးမေးလ်ပို့ရန် +email-link-button.tooltiptext3 = ဤစာမျက်နှာ၏ လင့်ခ်ကို အီးမေးလ်ပို့ရန် + +# LOCALIZATION NOTE(quit-button.tooltiptext.linux2): %1$S is the brand name (e.g. Firefox), +# %2$S is the keyboard shortcut +quit-button.tooltiptext.linux2 = %1$S မှ ထွက်ရန် (%2$S) +# LOCALIZATION NOTE(quit-button.tooltiptext.mac): %1$S is the brand name (e.g. Firefox), +# %2$S is the keyboard shortcut +quit-button.tooltiptext.mac = %1$S မှ ထွက်ရန် (%2$S) + +social-share-button.label = ယခုစာမျက်နှာကို မျှပါ +social-share-button.tooltiptext = ယခုစာမျက်နှာကို မျှပါ + +panic-button.label = မေ့ထားပါ +panic-button.tooltiptext = ရှာဖွေကြည့်ရှုထားသည့် မှတ်တမ်းအချို့ကို မေ့ဖျောက်ထားပါ + +# LOCALIZATION NOTE(devtools-webide-button.label, devtools-webide-button.tooltiptext): +# widget is only visible after WebIDE has been started once (Tools > Web Developers > WebIDE) +# %S is the keyboard shortcut +devtools-webide-button2.label = WebIDE +devtools-webide-button2.tooltiptext = WebIDE ကို ဖွင့်ပါ (%S) + +e10s-button.label = Non-e10s ဝင်းဒိုးအသစ် +e10s-button.tooltiptext = Non-e10s ဝင်းဒိုးအသစ်ကို ဖွင့်ပါ diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/downloads/downloads.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/downloads/downloads.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/downloads/downloads.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/downloads/downloads.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,157 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/downloads/downloads.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/downloads/downloads.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/downloads/downloads.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/downloads/downloads.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,115 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this file, +# You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (stateStarting): +# Indicates that the download is starting. +stateStarting=စတင်နေသည်… +# LOCALIZATION NOTE (stateScanning): +# Indicates that an external program is scanning the download for viruses. +stateScanning=ဗိုင်းရပ်စ်များကို ရှာဖွေစစ်ဆေးနေသည်… +# LOCALIZATION NOTE (stateFailed): +# Indicates that the download failed because of an error. +stateFailed=မအောင်မြင်ပါ +# LOCALIZATION NOTE (statePaused): +# Indicates that the download was paused by the user. +statePaused=ခေတ္တရပ်ထားသည် +# LOCALIZATION NOTE (stateCanceled): +# Indicates that the download was canceled by the user. +stateCanceled=ဖျက်သိမ်းထားသည် +# LOCALIZATION NOTE (stateCompleted): +# Indicates that the download was completed. +stateCompleted=ပြီးစီးပါပြီ +# LOCALIZATION NOTE (stateBlockedParentalControls): +# Indicates that the download was blocked by the Parental Controls feature of +# Windows. "Parental Controls" should be consistently named and capitalized +# with the display of this feature in Windows. The following article can +# provide a reference for the translation of "Parental Controls" in various +# languages: +# http://windows.microsoft.com/en-US/windows-vista/Set-up-Parental-Controls +stateBlockedParentalControls=အုပ်ထိန်းသူမှ စောင့်ကြည့်ရေးမူဝါဒအားဖြင့် တားဆီးထားသည် +# LOCALIZATION NOTE (stateBlockedPolicy): +# Indicates that the download was blocked on Windows because of the "Launching +# applications and unsafe files" setting of the "security zone" associated with +# the target site. "Security zone" should be consistently named and capitalized +# with the display of this feature in Windows. The following article can +# provide a reference for the translation of "security zone" in various +# languages: +# http://support.microsoft.com/kb/174360 +stateBlockedPolicy=သင့်လုံခြုံရေးဇုံပေါ်လစီက တားဆီးထားသည် +# LOCALIZATION NOTE (stateDirty): +# Indicates that the download was blocked after scanning. +stateDirty=တားဆီးထားသည် - ဗိုင်းရပ်စ် သို့မဟုတ် စပိုင်ဝဲလ် ပါရှိနိုင်သည် + +# LOCALIZATION NOTE (blockedMalware, blockedPotentiallyUnwanted, +# blockedUncommon2): +# These strings are shown in the panel for some types of blocked downloads, and +# are immediately followed by the "Learn More" link, thus they must end with a +# period. You may need to adjust "downloadDetails.width" in "downloads.dtd" if +# this turns out to be longer than the other existing status strings. +# Note: These strings don't exist in the UI yet. See bug 1053890. +blockedMalware=ဒီဖိုင်တွင် ဗိုင်းရပ်စ် သို့မဟုတ် ခိုးယူတိုက်ခိုက်သည့်ဆော့ဖ်ဝဲလ် ပါဝင်နေသည်။ +blockedPotentiallyUnwanted=ဒီဖိုင်သည် သင့်ကွန်ပြူတာကို ထိခိုက်စေနိုင်သည်။ +blockedUncommon2=ဒီဖိုင်ကို အများအားဖြင့် ဆွဲချကူးယူလေ့မရှိပါ။ + +# LOCALIZATION NOTE (fileMovedOrMissing): +# Displayed when a complete download which is not at the original folder. +fileMovedOrMissing=ဖိုင်ကို ရွှေ့ထား သို့မဟုတ် ပျောက်ဆုံးနေသည် + +# LOCALIZATION NOTE (unblockHeaderUnblock, unblockHeaderOpen, +# unblockTypeMalware, unblockTypePotentiallyUnwanted2, +# unblockTypeUncommon2, unblockTip2, unblockButtonOpen, +# unblockButtonUnblock, unblockButtonConfirmBlock): +# These strings are displayed in the dialog shown when the user asks a blocked +# download to be unblocked. The severity of the threat is expressed in +# descending order by the unblockType strings, it is higher for files detected +# as malware and lower for uncommon downloads. +unblockHeaderUnblock=ဒီဆွဲယူမှုကို ဆောင်ရွက်ခွင့်ပြုမည်မှာ သေချာပါသလား။ +unblockHeaderOpen=ဒီဖိုင်ကို ဖွင့်မည်မှာ သေချာပါသလား။ +unblockTypeMalware=ဒီဖိုင်တွင် သင့်ကွန်ပြူတာကို ထိခိုက်စေနိုင်သည့် ဗိုင်းရပ်စ် သို့မဟုတ် အခြား ခိုးယူတိုက်ခိုက်သည့် ဆော့ဖ်ဝဲ ပါဝင်သည်။ +unblockTypePotentiallyUnwanted2=ဒီဖိုင်သည် အသုံးဝင်နိုင်သည်ဟု ဟန်ဆောင်ထားသောဖိုင် ဖြစ်ပါသည်။ ၎င်းသည် သင့်ပရိုဂရမ်များနှင့် အပြင်အဆင်များကို မထင်မှတ်ထားသည့် ပြောင်းလဲမှုများ ပြုလုပ်နိုင်သည်။ +unblockTypeUncommon2=ဒီဖိုင်ကို အများအားဖြင့် ဆွဲချယူလေ့ မရှိကြပါ။ ထို့ပြင် ဖွင့်ရန် ဘေးကင်းမှုမရှိပါ။ ၎င်းဖိုင်တွင် ဗိုင်းရပ်စ် ပါဝင်နိုင်သည် သို့မဟုတ် ပရိုဂရမ်များနှင့် အပြင်အဆင်များကို မထင်မှတ်ထားသည့် ပြောင်းလဲမှုများ ဖြစ်ပေါ်စေနိုင်သည်။ +unblockTip2=သင်သည် အခြားကူးယူနိုင်သည့် အရင်းအမြစ်တွင် ရှာဖွေနိုင်သည်။ သို့မဟုတ် နောက်တွင် ထပ်မံ ဆောင်ရွက်ကြည့်ပါ။ +unblockButtonOpen=ဖွင့်ပါ +unblockButtonUnblock=ဆွဲချကူးခွင့်ပြုပါ +unblockButtonConfirmBlock=ဖိုင်ကို ဖျက်ရန် + +# LOCALIZATION NOTE (sizeWithUnits): +# %1$S is replaced with the size number, and %2$S with the measurement unit. +sizeWithUnits=%1$S %2$S +sizeUnknown=အရွယ်အစား မသိရပါ + +# LOCALIZATION NOTE (shortTimeLeftSeconds, shortTimeLeftMinutes, +# shortTimeLeftHours, shortTimeLeftDays): +# These values are displayed in the downloads indicator in the main browser +# window, where space is available for three characters maximum. %1$S is +# replaced with the time left for the given measurement unit. Even for days, +# the value is never longer than two digits. +shortTimeLeftSeconds=%1$Ss +shortTimeLeftMinutes=%1$Sm +shortTimeLeftHours=%1$Sh +shortTimeLeftDays=%1$Sd + +# LOCALIZATION NOTE (statusSeparator, statusSeparatorBeforeNumber): +# These strings define templates for the separation of different elements in the +# status line of a download item. As a separator, by default we use the Unicode +# character U+2014 'EM DASH' (long dash). Examples of status lines include +# "Canceled - 222.net", "1.1 MB - website2.com", or "Paused - 1.1 MB". Note +# that we use a wider space after the separator when it is followed by a number, +# just to avoid visually confusing it with with a minus sign with some fonts. +# If you use a different separator, this might not be necessary. However, there +# is usually no need to change the separator or the order of the substitutions, +# even for right-to-left languages, unless the defaults are not suitable. +statusSeparator=%1$S — %2$S +statusSeparatorBeforeNumber=%1$S — %2$S + +fileExecutableSecurityWarning="%S" သည် ဆောင်ရွက်နိုင်သောဖိုင် ဖြစ်သည်။ ၎င်းဖိုင်များတွင် သင့်ကွန်ပျူတာကို ဒုက္ခပေးနိုင်သော ဗိုင်းရပ်စ်များ သို့မဟုတ် အခြားအန္တရာယ်ပေးနိုင်သည့်ကုဒ်များ ပါဝင်နိုင်သည်။ ၎င်းဖိုင်များကိုဖွင့်လျှင် သတိထားပါ။ “%S” ကို ဖွင့်မည်မှာ သေချာပါသလား။ +fileExecutableSecurityWarningTitle=ဆောင်ရွက်နိုင်သည့်ဖိုင်ကို ဖွင့်မည်လား။ +fileExecutableSecurityWarningDontAsk=ဤမေးခွန်းကို ထပ်မမေးပါနှင့် + +# LOCALIZATION NOTE (otherDownloads3): +# This is displayed in an item at the bottom of the Downloads Panel when +# there are more downloads than can fit in the list in the panel. Use a +# semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/Localization_and_Plurals +otherDownloads3=%1$S ဖိုင်အားဆွဲချ်နေသှ် - %1$S ဖိုင်များအားဆွဲချနေသည် diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/engineManager.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/engineManager.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/engineManager.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/engineManager.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +duplicateTitle=သော့ချက် စာလုံး ပုံတူပွားပါ +duplicateEngineMsg=လောလောဆယ် "%S" သုံးစွဲနေတဲ့ သော့ချက်တခုကို သင် ရွေးထားပြီးပြီ။ အခြားကို ရွေးပါ။ +duplicateBookmarkMsg=လောလောဆယ် မှတ်သားချက်တခုက သုံးစွဲနေတဲ့ သော့ချက် တခုကို သင်​ ရွေးထားတယ်။ အခြားကို ရွေးပါ။ diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/feeds/subscribe.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/feeds/subscribe.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/feeds/subscribe.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/feeds/subscribe.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/feeds/subscribe.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/feeds/subscribe.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/feeds/subscribe.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/feeds/subscribe.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,52 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +linkTitleTextFormat=%S ကို သွားပါ +addHandler="%S" (%S) ကို ပေးပို့ချက် ဖတ်ရှုသူ တခုအဖြစ် ထည့်သွင်းပါ။ +addHandlerAddButton=ပေးပို့ချက် ဖတ်ရှုသူကို ထည့်သွင်းပါ +addHandlerAddButtonAccesskey=A +handlerRegistered="%S" ဟာ ပေးပို့ချက် ဖတ်ရှုသူ တခုအဖြစ် မှတ်ပုံတင်ထားပြီ +liveBookmarks=သက်၀င် မှတ်သားချက်များ +subscribeNow=ယခု စာရင်းသွင်းပါ +chooseApplicationMenuItem=လုပ်ငန်းသုံး ကိရိယာ ရွေးချယ်ပါ... +chooseApplicationDialogTitle=လုပ်ငန်းသုံး ကိရိယာ ရွေးချယ်ပါ... +alwaysUse=ပေးပို့ချက်များကို စာရင်းသွင်းဖို့ %S ကို အမြဲသုံးစွဲပါ +mediaLabel=မီဒီယာ ဖိုင်များ + +# LOCALIZATION NOTE: The next string is for the size of the enclosed media. +# e.g. enclosureSizeText : "50.23 MB" +# %1$S = size (in bytes or megabytes, ...) +# %2$S = unit of measure (bytes, KB, MB, ...) +enclosureSizeText=%1$S %2$S + +bytes=ဘိုက်များ +kilobyte=KB +megabyte=MB +gigabyte=GB + +# LOCALIZATION NOTE: The next three strings explains to the user what they're +# doing. +# e.g. alwaysUseForVideoPodcasts : "Always use Miro to subscribe to video podcasts." +# %S = application to use (Miro, iTunes, ...) +alwaysUseForFeeds=ပေးပို့ချက်များ စာရင်းသွင်းဖို့ %S ကို အမြဲသုံးပါ။ +alwaysUseForAudioPodcasts=အသံ ထုတ်လွှင့်ချက်များ စာရင်းသွင်းဖို့ %S ကို အမြဲသုံးပါ။ +alwaysUseForVideoPodcasts=ဗွီဒီယို ထုတ်လွှင့်ချက်များ စာရင်းသွင်းဖို့ %S ကို အမြဲသုံးပါ။ + +subscribeFeedUsing=ဒီပေးပို့ချက်ကို စာရင်းသွင်းရာမှာ သုံးစွဲရမဲ့အရာ +subscribeAudioPodcastUsing=ဒီအသံထုတ်လွှင့်ချက်ကို စာရင်းသွင်းရာမှာ သုံးစွဲမဲ့အရာ +subscribeVideoPodcastUsing=ဒီဗွီဒီယို ထုတ်လွှင့်ချက်ကို စာရင်းသွင်းရာမှာ သုံးစွဲမဲ့အရာ + +feedSubscriptionFeed1=ဒါဟာ ဒီကွန်ရက်ပေါ်မှာ မကြာခဏ ပြောင်းနေတဲ့ အကြောင်းအရာ "ပေးပို့ချက်" တခုဖြစ်တယ်။ +feedSubscriptionAudioPodcast1=ဒါဟာ ဒီကွန်ရက်ပေါ်မှာ မကြာခဏ ပြောင်းနေတဲ့ အကြောင်းအရာ "အသံ ထုတ်လွှင့်ချက်" တခုဖြစ်တယ်။ +feedSubscriptionVideoPodcast1=ဒါဟာ ဒီကွန်ရက်ပေါ်မှာ မကြာခဏ ပြောင်းနေတဲ့ အကြောင်းအရာ "ဗွီဒီယို ပေးပို့ချက်" တခုဖြစ်တယ်။ + +feedSubscriptionFeed2=ဒီအကြောင်းအရာ ပြင်ဆင်တဲ့အခါ မွမ်းမံချက်များ ရရှိဖို့ ဒီပေးပို့ချက်ကို သင် စာရင်းသွင်းနိုင်တယ်။ +feedSubscriptionAudioPodcast2=ဒီအကြောင်းအရာ ပြင်ဆင်တဲ့အခါ မွမ်းမံချက်များ ရရှိဖို့ ဒီအသံထုတ်လွှင့်ချက်ကို သင် စာရင်းသွင်းနိုင်တယ်။ +feedSubscriptionVideoPodcast2=ဒီအကြောင်းအရာ ပြင်ဆင်တဲ့အခါ မွမ်းမံချက်များ ရရှိဖို့ ဒီဗွီဒီယို ထုတ်လွှင့်ချက်ကို သင် စာရင်းသွင်းနိုင်တယ်။ + +# Protocol Handling +# "Add %appName (%appDomain) as an application for %protocolType links?" +addProtocolHandler=%S အချိတ်အဆက်အတွက် လုပ်ငန်းသုံးကိရိယာ တခုအဖြစ် %S (%S) ကို ထည့်သွင်းပါ။ +addProtocolHandlerAddButton=လုပ်ငန်းသုံးကိရိယာ ထည့်သွင့်ပါ +addProtocolHandlerAddButtonAccesskey=A diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/lightweightThemes.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/lightweightThemes.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/lightweightThemes.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/lightweightThemes.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,12 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +lightweightThemes.recommended-1.name=ဝဘ်ဘရောင်ဇာ ရီနေးဆွန်း +lightweightThemes.recommended-1.description=ဝဘ်ဘရောင်ဇာ ရီနေးဆွန်းကို (C) Sean.Martell က ဖန်တီးသည်။ CC-BY-SA လိုင်စင်အောက်တွင် ရယူအသုံးပြုနိုင်သည်။ အာမခံ မရှိပါ။ + +lightweightThemes.recommended-2.name=စိတ်ကူးယဉ် အာကာသ +lightweightThemes.recommended-2.description=စိတ်ကူးယဉ် အာကာသကို (C) fx5800p က ဖန်တီးသည်။ CC-BY-SA လိုင်စင်အောက်တွင် ရယူအသုံးပြုနိုင်သည်။ အာမခံ မရှိပါ။ + +lightweightThemes.recommended-4.name=Pastel ရောင်စဉ်တန်း +lightweightThemes.recommended-4.description=Pastel ရောင်စဉ်တန်းကို (C) darrinhenein က ဖန်တီးသည်။ CC-BY လိုင်စင်အောက်တွင် ရယူအသုံးပြုနိုင်သည်။ အာမခံ မရှိပါ။ diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/migration/migration.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/migration/migration.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/migration/migration.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/migration/migration.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,46 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/migration/migration.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/migration/migration.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/migration/migration.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/migration/migration.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,87 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +profileName_format=%S %S + +# Browser Specific +sourceNameIE=Internet Explorer +sourceNameEdge=Microsoft Edge +sourceNameSafari=Safari +sourceNameCanary=Google Chrome Canary +sourceNameChrome=Google Chrome +sourceNameChromium=Chromium +sourceNameFirefox=မော်ဇီလာ မီးမြေခွေး +sourceName360se=360 လုံခြုံသော ဘရောင်ဇာ + +importedBookmarksFolder=%S မှ + +importedSafariReadingList=ဖတ်ရှုစာရင်း (Safari မှ) +importedEdgeReadingList=ဖတ်နေဆဲ စာရင်း (Edge မှ) + +# Import Sources +# Note: When adding an import source for profile reset, add the string name to +# resetProfile.js if it should be listed in the reset dialog. +1_ie=အင်တာနက်ဆိုင်ရာရွေးချယ်စရာများ +1_edge=အပြင်အဆင်များ +1_safari=နှစ်သက်ရာအပြင်အဆင်များ +1_chrome=နှစ်သက်ရာအပြင်အဆင်များ +1_360se=အပြင်အဆင်များ + +2_ie=ကွတ်ကီးများ +2_edge=ကွတ်ကီးများ +2_safari=ကွတ်ကီးများ +2_chrome=ကွတ်ကီးများ +2_firefox=ကွတ်ကီးများ +2_360se=ကွတ်ကီးများ + +4_ie=ရှာဖွေကြည့်ရှုမှု မှတ်တမ်း +4_edge=ရှာဖွေကြည့်ရှုမှု မှတ်တမ်း +4_safari=ရှာဖွေကြည့်ရှုမှု မှတ်တမ်း +4_chrome=ရှာဖွေကြည့်ရှုမှု မှတ်တမ်း +4_firefox_history_and_bookmarks=ကြည့်ရှုမှုမှတ်တမ်းနှင့် စာမှတ်များ +4_360se=ရှာဖွေကြည့်ရှုမှု မှတ်တမ်း + +8_ie=သိမ်းထားသည့် ဖောင်ဖြည့်မှတ်တမ်း +8_edge=သိမ်းထားသည့် ပုံစံဖြည့် မှတ်တမ်း +8_safari=သိမ်းထားသည့် ဖောင်ဖြည့်မှတ်တမ်း +8_chrome=သိမ်းထားသည့် ဖောင်ဖြည့်မှတ်တမ်း +8_firefox=သိမ်းထားသည့် ဖောင်ဖြည့်မှတ်တမ်း +8_360se=သိမ်းထားသည့် ပုံစံဖြည့် မှတ်တမ်း + +16_ie=သိမ်းထားသည့် စကားဝှက်များ +16_edge=သိမ်းထားသည့် စကားဝှက်များ +16_safari=သိမ်းထားသည့် စကားဝှက်များ +16_chrome=သိမ်းထားသည့် စကားဝှက်များ +16_firefox=သိမ်းထားသည့် စကားဝှက်များ +16_360se=သိမ်းထားသည့် စကားဝှက်များ + +32_ie=စိတ်ကြိုက်များ +32_edge=နှစ်သက်ရာများ +32_safari=စာမှတ်များ +32_chrome=စာမှတ်များ +32_360se=စာမှတ်များ + +64_ie=အခြား အချက်အလက်ကြမ်း +64_edge=အခြား အချက်အလက် +64_safari=အခြား အချက်အလက်ကြမ်း +64_chrome=အခြား အချက်အလက်ကြမ်း +64_firefox_other=အခြား အချက်အလက်များ +64_360se=အခြား အချက်အလက် + +128_firefox=၀င်းဒိုးနှင့် တပ်ဗ်များ + +# Automigration undo notification. +# %1$S will be replaced with the name of the browser we imported from, %2$S will be replaced with brandShortName +automigration.undo.message.all = ရပ်ခဲ့သည့် နေရာမှ ပြန်လည်အသုံးပြုပါ။ ဒီဆိုက်များနှင့် သင့်စာမှတ်များ၊ မှတ်တမ်းနှင့် စကားဝှက်များကို %1$S မှ %2$S ထဲသို့ ကူးပြောင်းပြီးပါပြီ။ +automigration.undo.message.bookmarks = ရပ်ခဲ့သည့်နေရာမှ ပြန်လည်အသုံးပြုပါ။ ဒီဆိုက်များနှင့် သင့်စာမှတ်များကို %1$S မှ %2$S ထဲသို့ ကူးပြောင်းပြီးပါပြီ။ +automigration.undo.message.bookmarks.logins = ရပ်ခဲ့သည့်နေရာမှ ပြန်လည်အသုံးပြုပါ။ ဒီဆိုက်များနှင့် သင့်စာမှတ်များ၊ စကားဝှက်များကို %1$S မှ %2$S ထဲသို့ ကူးပြောင်းပြီးပါပြီ။ +automigration.undo.message.bookmarks.visits = ရပ်ခဲ့သည့်နေရာမှ ပြန်လည်အသုံးပြုပါ။ ဒီဆိုက်များနှင့် သင့်စာမှတ်များ၊ မှတ်တမ်းကို %1$S မှ %2$S ထဲသို့ ကူးပြောင်းပြီးပါပြီ။ +automigration.undo.message.logins = ရပ်ခဲ့သည့်နေရာမှ ပြန်လည်အသုံးပြုပါ။ စကားဝှက်များကို %1$S မှ %2$S ထဲသို့ ကူးပြောင်းပြီးပါပြီ။ +automigration.undo.message.logins.visits = ရပ်ခဲ့သည့်နေရာမှ ပြန်လည်အသုံးပြုပါ။ ဒီဆိုက်များနှင့် မှတ်တမ်း၊ စကားဝှက်များကို %1$S မှ %2$S ထဲသို့ ကူးပြောင်းပြီးပါပြီ။ +automigration.undo.message.visits = ရပ်ခဲ့သည့်နေရာမှ ပြန်လည်အသုံးပြုပါ။ ဒီဆိုက်များနှင့် မှတ်တမ်းကို %1$S မှ %2$S ထဲသို့ ကူးပြောင်းပြီးပါပြီ။ +automigration.undo.keep2.label = ကောင်းပြီ၊ ရပါပြီ +automigration.undo.keep2.accesskey = O +automigration.undo.dontkeep2.label = မလိုတော့ပါ၊ ကျေးဇူးတင်ပါသည် +automigration.undo.dontkeep2.accesskey = N +automigration.undo.unknownbrowser = အမည်မသိ ဘရောင်ဇာ diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/newTab.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/newTab.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/newTab.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/newTab.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,18 @@ + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/newTab.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/newTab.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/newTab.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/newTab.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,49 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +newtab.defaultTopSites.heading=ထိပ်တန်းဝဘ်ဆိုက်များ +newtab.userTopSites.heading=သင်ကြည့်နေကြ ထိပ်တန်းဝဘ်ဆိုက်များ + +newtab.pin=ဤဝတ်ဆိုဒ် အား ၎င်း၏ ယခုပုံစံအတိုင်း သိမ်းထားမည် +newtab.unpin=ဝတ်ဆိုဒ် အားဖြုတ်ပစ်မည် +newtab.block=ဒီ ဝဘ်ဆိုက်ကို ဖြုတ်ပါ +# LOCALIZATION NOTE(newtab.sponsored.button): This text appears for sponsored +# and enhanced tiles on the same line as the tile's title, so prefer short +# strings to avoid overlap. This string should be uppercase. +newtab.sponsored.button=ကူညီထောက်ပံ့ထားသူ +# LOCALIZATION NOTE(newtab.suggested.button): This text appears for sponsored +# and suggested tiles on the same line as the tile's title, so prefer short +# strings to avoid overlap. This string should be uppercase. +newtab.suggested.tag=အကြံပြုခံထားရသူ +# LOCALIZATION NOTE(newtab.suggested.button): %1$S will be replaced inline by +# one of the user's top 100 sites that triggered this suggested tile. +# This text appears for suggested tiles under the tile's title, so prefer short +# strings to avoid truncating important text. +newtab.suggested.button=လည်ပတ်သူ %1$S ယောက်အတွက် အကြံပြုထားသည် +# LOCALIZATION NOTE(newtab.sponsored.explain): %1$S will be replaced inline by +# the (X) block icon. %2$S will be replaced by an active link using string +# newtab.learn.link as text. +newtab.sponsored.explain=မော်ဇီလာ၏ အပေါင်းအဖော်ကိုယ်စား ဒီအစိတ်အပိုင်းကို သင့်ထံ ပြသခြင်း ဖြစ်သည်။. သင်သည် %1$S ခလုတ်ကို နှိပ်ခြင်းဖြင့် အချိန်အခါမရွေး ဖယ်ရှားနိုင်သည်။. %2$S +# LOCALIZATION NOTE(newtab.sponsored.explain2): %1$S will be replaced inline by +# the (X) block icon. %2$S will be replaced by an active link using string +# newtab.learn.link as text. +newtab.sponsored.explain2=မော်ဇီလာ၏ အပေါင်းအဖော်ကိုယ်စား ဒီဆိုက်ကို သင့်ထံ အကြံပြုထားခြင်း ဖြစ်သည်။. သင်သည် %1$S ခလုတ်ကို နှိပ်ခြင်းဖြင့် အချိန်အခါမရွေး ဖယ်ရှားနိုင်သည်။. %2$S +# LOCALIZATION NOTE(newtab.suggested.explain): %1$S will be replaced inline by +# the (X) block icon. %2$S will be replaced by an active link using string +# newtab.learn.link as text. +newtab.suggested.explain=ဒီဆိုက်ကို မော်ဇီလာမှ အကြံပြုထားပါသည်။. သင်သည် %1$S ခလုတ်ကို နှိပ်ခြင်းဖြင့် အချိန်အခါမရွေး ဖယ်ရှားနိုင်သည်။. %2$S +# LOCALIZATION NOTE(newtab.enhanced.explain): %1$S will be replaced inline by +# the gear icon used to customize the new tab window. %2$S will be replaced by +# an active link using string newtab.learn.link as text. +newtab.enhanced.explain=မော်ဇီလာ၏အပေါင်းအဖော်သည် မျက်နှာပြင်ဓါတ်ပုံရိုက်ခြင်းကို လဲလှယ်ခြင်းဖြင့် ဒီအစိတ်အပိုင်းကို ပိုမိုကောင်းမွန်လှပအောင် ပြုလုပ်ထားသည်။. သင့် စိတ်ကြိုက်ပြင်ဆင်မှုအတွက် သင်သည် %1$S ခလုတ်ကို နှိပ်ခြင်းဖြင့် အဆင့်မြှင့်ထားသည့် အပိုင်းကို ပိတ်နိုင်သည်။. %2$S +newtab.intro1.paragraph1=ယခု သင် စာမျက်နှာခွဲအသစ် ယူလိုက်လျှင် သင် စိတ်ဝင်စားမည့်ဆိုက်များကို မြင်ရပါလိမ့်မည်။. ဆိုက်တချို့သည် မော်ဇီလာမှ အကြံပြုထားသည် သို့မဟုတ် မော်ဇီလာ၏ အပေါင်းအဖော်မှ ကူညီထောက်ပံ့ထားသည်။ +# LOCALIZATION NOTE(newtab.intro1.paragraph2): %1$S will be replaced inline by +# an active link using string newtab.privacy.link as text. %2$S will be replaced +# inline by the gear icon used to customize the new tab window. +newtab.intro1.paragraph2=ဒီဝန်ဆောင်မှုကို ပေးစွမ်းရန်အတွက် ကျွန်တော်တို့ရဲ့ %1$S အရ ဒေတာအချို့သည် အလိုအလျောက် ကျွန်တော်တို့ထံသို့ ပေးပို့ပါလိမ့်မည်။. ဂီယာပုံငယ်လေး (%2$S)၏ အောက်တွင်ရှိသော ရွေးချယ်မှုကို အမှန်ခြစ် ဖြုတ်ခြင်းဖြင့် သင် အဲဒီပေးပို့မှုကို ပိတ်ထားနိုင်သည်။ +newtab.learn.link=ပိုမို လေ့လာပါ… +newtab.privacy.link=ပရိုက်ဗစ်ဆီ သတိပေးချက် +newtab.learn.link2=စာမျက်နှာခွဲအသစ် အကြောင်း ပိုမိုလေ့လာပါ +newtab.intro.header.update=စာမျက်နှာခွဲအသစ်သည် အဆင့်မြှင့်တင်မှု ရပြီ။! +newtab.intro.gotit=ရပြီ! diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/pageInfo.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/pageInfo.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/pageInfo.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/pageInfo.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,88 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/pageInfo.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/pageInfo.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/pageInfo.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/pageInfo.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,56 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +pageInfo.page.title=စာမျက်နှာ အချက်အလက် - %S +pageInfo.frame.title=ဘောင် အချက်အလက် - %S + +noPageTitle=ခေါင်းစဉ်‌မဲ့ စာမျက်နှာ +unknown=အမည်မသိ +notset=ဖော်ပြမထားပါ +yes=ဟုတ်ကဲ့ +no=မဟုတ်ပါ + +mediaImg=ရုပ်ပုံ +mediaVideo=ဗီဒီယို +mediaAudio=အော်ဒီယို +mediaBGImg=နောက်ခံရုပ်ပုံ +mediaBorderImg=အနားသတ် မျဥ်း +mediaListImg=အမှတ်စဉ်သင်္ကေတ +mediaCursor=ကာဆာ +mediaObject=အရာဝတ္ထု +mediaEmbed=မြှုပ်နှံထားခြင်း +mediaLink=ပုံသင်္ကေတ +mediaInput=ဖြည့်သွင်းခြင်း +mediaFileSize=%S KB +mediaSize=%Spx \u00D7 %Spx +mediaSelectFolder=ရုပ်ပုံများကို သိမ်းဆည်းရန် ဖိုင်တွဲတစ်ခုကို ရွေးပါ +mediaBlockImage=%S ထံမှ ရုပ်ပုံများကို တားဆီးပါ +mediaUnknownNotCached=အမည်မသိ (ယာယီဖိုင် မရှိပါ) +mediaImageType=%S ရုပ်ပုံ +mediaAnimatedImageType=%S ရုပ်ပုံ (သက်ဝင်လှုပ်ရှားသည်၊ %S ဖရိမ်) +mediaDimensions=%Spx \u00D7 %Spx +mediaDimensionsScaled=%Spx × %Spx (%Spx × %Spx သို့ ချိန်ညှိထားသည်။) + +generalQuirksMode=ထူးခြားအပြုအမူပုံစံ +generalStrictMode=စံများနှင့် ကိုက်ညီသောပုံစံ +generalSize=%S KB (%S bytes) +generalMetaTag=Meta (စာအမှတ် 1 ခု) +generalMetaTags=Meta (စာအမှတ် %S ခု) + +feedRss=RSS +feedAtom=Atom +feedXML=XML + +securityNoOwner=ဒီဝဘ်ဆိုက်သည် ပိုင်ဆိုင်မှုအချက်အလက်များကို မဖော်ပြထားပါ။ +securityOneVisit=ဟုတ်ကဲ့၊ တစ်ကြိမ်သာ။ +securityNVisits=ဟုတ်ကဲ့၊ အကြိမ်ပေါင်း %S ကြိမ် ဆောင်ရွက်ပါ။ + +# LOCALIZATION NOTE: The next string is for the disk usage of the +# database +# e.g. indexedDBUsage : "50.23 MB" +# %1$S = size (in bytes or megabytes, ...) +# %2$S = unit of measure (bytes, KB, MB, ...) +indexedDBUsage=ဒီဝဘ်ဆိုက်သည် မှတ်ဉာဏ်ပမာဏ %1$S%2$S သုံးစွဲနေသည် + +permissions.useDefault=မူလသတ်မှတ်ထားသည့်အတိုင်း အသုံးပြုပါ diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/places/bookmarkProperties.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/places/bookmarkProperties.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/places/bookmarkProperties.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/places/bookmarkProperties.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,19 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +dialogAcceptLabelAddItem=ပေါင်းထည့်ပါ +dialogAcceptLabelSaveItem=သိမ်းဆည်းပါ +dialogAcceptLabelAddLivemark=စာရင်းသွင်းပါ +dialogAcceptLabelAddMulti=စာမှတ်များကို ထည့်သွင်းပါ +dialogAcceptLabelEdit=သိမ်းဆည်းပါ +dialogTitleAddBookmark=စာမှတ်အသစ် +dialogTitleAddLivemark=နောက်ဆုံးပေါ်စာမှတ်နှင့်အတူ စာရင်းသွင်းပါ +dialogTitleAddFolder=ဖိုင်တွဲ အသစ် +dialogTitleAddMulti=စာမှတ်အသစ်များ +dialogTitleEdit="%S" ဂုဏ်အင်္ဂါရပ်များ + +bookmarkAllTabsDefault=[ဖိုင်တွဲ အမည်] +newFolderDefault=ဖိုင်တွဲ အသစ် +newBookmarkDefault=စာမှတ်အသစ် +newLivemarkDefault=အလိုအလျောက်ရယူသော စာမှတ်အသစ် diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/places/editBookmarkOverlay.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/places/editBookmarkOverlay.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/places/editBookmarkOverlay.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/places/editBookmarkOverlay.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,28 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/places/moveBookmarks.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/places/moveBookmarks.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/places/moveBookmarks.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/places/moveBookmarks.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,9 @@ + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/places/places.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/places/places.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/places/places.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/places/places.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,120 @@ + + + + + + + + + + + + + + + + + + + + + + + အ အစဉ်လိုက် မျိုးတူစု "> + + က အစဉ်လိုက် မျိုးတူစု "> + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/places/places.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/places/places.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/places/places.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/places/places.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,102 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +load-js-data-url-error=လုံခြုံရေးအရ မှတ်တမ်းဝင်းဒိုး သို့မဟုတ် ဘေးတန်းမှ ဖွင့်သော javascript သို့မဟုတ် အချက်အလက် url များကို ဆောင်ရွက်ခွင့်မပေးပါ။ +noTitle=(ခေါင်းစဉ်မရှိ) + +bookmarksMenuEmptyFolder=(ဘာမျှမရှိ) + +bookmarksBackupTitle=စာမှတ်များကို အရန်သိမ်းဆည်းရန် ဖိုင်အမည် + +bookmarksRestoreAlertTitle=စာမှတ်များကို မူလအတိုင်း ပြန်ထားမည် +bookmarksRestoreAlert=လက်ရှိစာမှတ်များကို အရန်ပြုလုပ်ထားသော စာမှတ်များနှင့် အစားထိုးလဲလှယ်ပါမည်။ ဆောင်ရွက်ရန် သေချာပါသလား။ +bookmarksRestoreTitle=အရန်သိမ်းဆည်းထားသော စာမှတ်များ ဖိုင်ကို ရွေးပါ +bookmarksRestoreFilterName=JSON + +bookmarksRestoreFormatError=ထောက်ပံ့ပေးမထားသော ဖိုင်အမျိုးအစား +bookmarksRestoreParseError=အရန်ဖိုင်ကို ဆက်လက်ဆောင်ရွက်ခြင်း မပြုလုပ်နိုင်တော့ပါ။ + +bookmarksLivemarkLoading=Live စာမှတ်များကို ရယူနေသည်… +bookmarksLivemarkFailed=Live စာမှတ်သတင်းစဉ် ရယူခြင်း မအောင်မြင်ပါ။ + +menuOpenLivemarkOrigin.label=“%S” ကို ဖွင့်ပါ + +sortByName=‘%S’ ကို အမည်ဖြင့် စီပါ +sortByNameGeneric=အမည်အားဖြင့်​ စီပါ +# LOCALIZATION NOTE (view.sortBy.1.name.label): sortBy properties are versioned. +# When any of these changes, all of the properties must be bumped, and the +# change must be annotated here. Both label and accesskey must be updated. +# - version 1: changed view.sortBy.1.date. +view.sortBy.1.name.label=အမည်အားဖြင့် စီပါ +view.sortBy.1.name.accesskey=N +view.sortBy.1.url.label=တည်နေရာအားဖြင့် စီပါ +view.sortBy.1.url.accesskey=L +view.sortBy.1.date.label=လတ်တလောကြည့်ရှုမှု အများဆုံးအားဖြင့် စီပါ +view.sortBy.1.date.accesskey=V +view.sortBy.1.visitCount.label=ကြည့်ရှုမှု အရေအတွက်အားဖြင့် စီပါ +view.sortBy.1.visitCount.accesskey=C +view.sortBy.1.description.label=ဖော်ပြချက်အားဖြင့် စီပါ +view.sortBy.1.description.accesskey=D +view.sortBy.1.dateAdded.label=ထည့်ခဲ့သည့်အချိန်ဖြင့် စီပါ +view.sortBy.1.dateAdded.accesskey=e +view.sortBy.1.lastModified.label=ပြုပြင်ထားသည့်အချိန်ဖြင့် စီပါ +view.sortBy.1.lastModified.accesskey=M +view.sortBy.1.tags.label=အမှတ်အသားဖြင့် စီပါ +view.sortBy.1.tags.accesskey=T + +searchBookmarks=စာမှတ်များကို ရှာရန် +searchHistory=မှတ်တမ်း ရှာရန် +searchDownloads=ဆွဲချထားသည့် ဖိုင်များကို ရှာရန် + +tabs.openWarningTitle=ဖွင့်ရန် အတည်ပြုပါ +tabs.openWarningMultipleBranded=တပ်ဗ် %S ခုကို ဖွင့်ပါတော့မည်။  စာမျက်နှာများ ခေါ်ယူနေချိန်အတွင်း %S ကို နှေးကွေးစေနိုင်သည်။  ဆက်လက်ဆောင်ရွက်ရန် သေချာပါသလား။ +tabs.openButtonMultiple=တပ်ဗ်များကို ဖွင့်ရန် +tabs.openWarningPromptMeBranded=တပ်ဗ်အများအပြားကို ဖွင့်သောအခါ %S ကို နှေးကွေးစေလျှင် အသိပေးပါ + +SelectImport=စာမှတ်များဖိုင်ကို တင်သွင်းပါ +EnterExport=စာမှတ်များကို ဖိုင်အနေဖြင့် ထုတ်ယူရန် + +detailsPane.noItems=မည်သည့်အရာမျှ မရှိပါ +# LOCALIZATION NOTE (detailsPane.itemsCountLabel): Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 number of items +# example: 111 items +detailsPane.itemsCountLabel=မှတ်တမ်း တစ်ခု;မှတ်တမ်း #1 ခု + +mostVisitedTitle=သွားရောက်ကြည့်ရှုမှု အများဆုံး +recentTagsTitle=လတ်တလော အမှတ်အသားများ + +OrganizerQueryHistory=မှတ်တမ်း +OrganizerQueryDownloads=ဆွဲချချက်များ +OrganizerQueryAllBookmarks=စာမှတ်များ အားလုံး +OrganizerQueryTags=အမှတ်အသားများ + +# LOCALIZATION NOTE (tagResultLabel, bookmarkResultLabel, switchtabResultLabel, +# keywordResultLabel, searchengineResultLabel) +# Noun used to describe the location bar autocomplete result type +# to users with screen readers +# See createResultLabel() in urlbarBindings.xml +tagResultLabel=အမှတ်အသား +bookmarkResultLabel=စာမှတ် +switchtabResultLabel=တပ်ဗ် +keywordResultLabel=သော့ချက် စာလုံး +searchengineResultLabel=ရှာဖွေပါ + + +# LOCALIZATION NOTE (lockPrompt.text) +# %S will be replaced with the application name. +lockPrompt.title=ဘရောင်ဇာ စတင်မှု အမှား +lockPrompt.text=%S ၏ ဖိုင်များထဲမှ တစ်ခုကို အက်ပလီကေးရှင်းတစ်ခုက အသုံးပြုနေသောကြောင့် စာမှတ်များနှင့် မှတ်တမ်းစနစ်သည် ကောင်းစွာ လုပ်ဆောင်နိုင်မည် မဟုတ်ပါ။ အချို့ လုံခြုံရေးဆိုင်ရာ ဆော့ဖ်ဝဲသည် ယခုပြဿနာကို ဖြစ်စေနိုင်သည်။ +lockPromptInfoButton.label=ပိုမို လေ့လာရန် +lockPromptInfoButton.accessKey=L + +# LOCALIZATION NOTE (deletePagesLabel): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +cmd.deletePages.label=စာမျက်နှာကို ဖျက်ရန်;စာမျက်နှာများကို ဖျက်ရန် +cmd.deletePages.accesskey=D + +# LOCALIZATION NOTE (bookmarkPagesLabel): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +cmd.bookmarkPages.label=စာမျက်နှာကို မှတ်ထားပါ;စာမျက်နှာများကို မှတ်ထားပါ +cmd.bookmarkPages.accesskey=B diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/advanced.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/advanced.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/advanced.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/advanced.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,127 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/applicationManager.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/applicationManager.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/applicationManager.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/applicationManager.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,8 @@ + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/applicationManager.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/applicationManager.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/applicationManager.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/applicationManager.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,14 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE +# in descriptionApplications, %S will be replaced by one of the 3 following strings +descriptionApplications=ယခု %S ကို ကိုင်တွယ်ရန် အောက်ပါ အက်ပလီကေးရှင်းများကို အသုံးပြုနိုင်သည်။ + +handleProtocol=%S လင့်ခ်များ +handleWebFeeds=ဝဘ်ဆိုက်သတင်းတိုများ +handleFile=%S အကြောင်းအရာ + +descriptionWebApp=ယခုဝဘ်အက်ပလီကေးရှင်း တည်ရှိရာနေရာ +descriptionLocalApp=ယခုအက်ပလီကေးရှင်းသည် ၎င်းတွင် တည်ရှိသည် diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/applications.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/applications.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/applications.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/applications.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,14 @@ + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/blocklists.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/blocklists.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/blocklists.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/blocklists.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,14 @@ + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/colors.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/colors.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/colors.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/colors.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,30 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/connection.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/connection.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/connection.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/connection.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,49 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/containers.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/containers.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/containers.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/containers.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,26 @@ + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/containers.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/containers.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/containers.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/containers.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,24 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +containers.labelMinWidth = 4rem +containers.updateContainerTitle = %S ကွန်တိန်နာ အပြင်အဆင်များ + +containers.blue.label = အပြာရောင် +containers.turquoise.label = စိမ်းပြာရောင် +containers.green.label = အစိမ်းရောင် +containers.yellow.label = အဝါရောင် +containers.orange.label = လိမ္မော်ရောင် +containers.red.label = အနီရောင် +containers.pink.label = ပန်းရောင် +containers.purple.label = ခရမ်းရောင် + +containers.fingerprint.label = လက်ဗွေ +containers.briefcase.label = လက်ဆွဲအိတ် +# LOCALIZATION NOTE (containers.dollar.label) +# String represents a money sign but currently uses a dollar sign so don't change to local currency +# See Bug 1291672 +containers.dollar.label = ဒေါ်လာသင်္ကေတ +containers.cart.label = ဈေးဝယ်ဆွဲခြင်း +containers.circle.label = အစက် diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/content.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/content.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/content.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/content.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,60 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/cookies.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/cookies.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/cookies.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/cookies.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,28 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/donottrack.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/donottrack.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/donottrack.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/donottrack.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,13 @@ + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/fonts.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/fonts.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/fonts.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/fonts.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,107 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/languages.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/languages.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/languages.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/languages.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,18 @@ + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/main.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/main.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/main.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/main.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,45 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/permissions.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/permissions.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/permissions.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/permissions.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,27 @@ + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/preferences.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/preferences.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/preferences.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/preferences.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,29 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/preferences.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/preferences.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/preferences.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/preferences.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,253 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#### Security + +# LOCALIZATION NOTE: phishBefore uses %S to represent the name of the provider +# whose privacy policy must be accepted (for enabling +# check-every-page-as-I-load-it phishing protection). +phishBeforeText=ဒီအပြင်အဆင်ကို ရွေးချယ်ခြင်းသည် သင်ကြည့်ရှုနေသော ဝဘ်ဆိုက် %S ၏ လိပ်စာကို ပေးပို့မည် ဖြစ်သည်။ ဆက်လက်ဆောင်ရွက်ရန် ကျေးဇူးပြု၍ အောက်ပါ အသုံးပြုမှုဆိုင်ရာ စည်းကမ်းများကို ဖတ်ရှုပြီး လက်ခံပေးပါ။ + +#### Fonts + +labelDefaultFont=မူလ (%S) + +veryLargeMinimumFontTitle=စာလုံးအကြီးဆုံးအတွက် အနိမ့်ဆုံးသတ်မှတ်ချက် +veryLargeMinimumFontWarning=သင်သည် စာလုံးအကြီးများအတွက် အနိမ့်ဆုံးသတ်မှတ်ချက်ကို ရွေးထားသည် (24 pixels ထက်များသည်)။ ယခုရွေးချယ်မှုသည် ဒီစာမျက်နှာကဲ့သို့သော အရေးကြီးသည့် အပြင်အဆင် စာမျက်နှာအချို့အတွက် အသုံးပြုရန် ခက်ခဲစေနိုင်ပါသည်။ +acceptVeryLargeMinimumFont=ဘယ်လိုပင်ဖြစ်နေပါစေ ပြောင်းလဲမှုများကို သိမ်းပါ + +#### Permissions Manager + +trackingprotectionpermissionstext=သင်သည် ဒီဆိုက်များအတွက် လိုက်လံမှတ်သားမှုကာကွယ်သည့်စနစ်ကို ပိတ်ထားသည်။ +trackingprotectionpermissionstitle=ခြွင်းချက်များ - လိုက်လံမှတ်သားမှုကာကွယ်ခြင်း +cookiepermissionstext=သင်သည်မည်သည့်၀တ်ဆိုက်အားကွတ်ကီးများသိမ်းဆည်းစေမည်ကိုခန့်ခွဲနိုင်ပါသည်။တိကျသော၀တ်ဆိုက်လိပ်စာအားရိုက်ကာ ပိတ်မည်(သို့)ခွင့်ပြုမည်တစ်ခုခုလုပ်နိုင်သည်။ +cookiepermissionstitle=ချွင်းချက် - ကွတ်ကီးများ +addonspermissionstext=သင်သည်မည်သည့်၀တ်ဆိုက်အားအတ်အွန်များသွင်းခွင့်ပေးမည်ကို ခန့်ခွဲနိုင်သည်။သင်ခွင့်ပြုလိုသော၀တ်ဆိုက်အားတိကျစွာရိုက်ကာ ခွင့်ပြုမည်ကိုနှိပ်ပါ။ +addons_permissions_title=ခွင့်ပြုထားသောဆိုက်များ=အတ်အွန်တပ်ဆင်ခြင်း +popuppermissionstext=သင်သည်မည်သည့်၀တ်ဆိုက်အားပေါ့အပ်၀င်းဒိုးခွင့်ပြုမည်ကိုခန့်ခွဲနိုင်သည်။သင်ခွင့်ပြုလိုသော၀တ်ဆိုက်လိပ်စာအတိအကျအားရိုက်ကာ ခွင့်ပြုမည်ကိုနှိပ်ပါ။ +popuppermissionstitle=ခွင့်ပြုထားသောဆိုက်များ=တိုးဖွင့်၀င်းဒိုး +notificationspermissionstext4=မည်သည့်ဝဘ်ဆိုက်များသည် သင့်ထံ အသိပေးချက်များကို အမြဲပို့မည် (သို့မဟုတ်) မပို့မည်ကို ထိန်းချုပ်ပါ။ ဝဘ်ဆိုက်တစ်ခုကို စာရင်းထဲမှ ဖျက်လျှင် ထိုဆိုက်အတွက် ခွင့်ပြုချက် ထပ်မံတောင်းဆိုရန် လိုအပ်သည်။ +notificationspermissionstitle=အသိပေးချက်များဆိုင်ရာ ခွင့်ပြုချက်များ +invalidURI=အလုပ်လုပ်သောတည်ရှိနေရာကိုထည့်ပါ +invalidURITitle=မှားယွင်းနေသောဟိုစ့်ဖြစ်နေသည် +savedLoginsExceptions_title=ခြွင်းချက်များ - သိမ်းဆည်းထားသည့် ဝင်ရောက်မှု အချက်အလက်များ +savedLoginsExceptions_desc=အောက်ပါဝဘ်ဆိုက်များအတွက် ဝင်ရောက်မှုအချက်အလက်များကို သိမ်းဆည်းမည်မဟုတ်ပါ။ + +#### Block List Manager + +blockliststext=သင့်ရှာဖွေမှုကို ခြေရာခံကောင်းခံနိုင်သည့် ဝဘ်အဲလိမန့်ကို မီးမြေခွေးက ပိတ်ရမည့်စာရင်းကို သင်ရွေးချယ်နိုင်ပါသည်။ +blockliststitle=ပိတ်ပင်ထားသည့် စာရင်းများ +# LOCALIZATION NOTE (mozNameTemplate): This template constructs the name of the +# block list in the block lists dialog. It combines the list name and +# description. +# e.g. mozNameTemplate : "Standard (Recommended). This list does a pretty good job." +# %1$S = list name (fooName), %2$S = list descriptive text (fooDesc) +mozNameTemplate=%1$S %2$S +# LOCALIZATION NOTE (mozstdName, etc.): These labels appear in the tracking +# protection block lists dialog, mozNameTemplate is used to create the final +# string. Note that in the future these two strings (name, desc) could be +# displayed on two different lines. +mozstdName=Disconnect.me အခြေခံ ကာကွယ်မှု (အကြံပြုထားသည်)။ +mozstdDesc=လိုက်လံမှတ်သားသည့်စနစ်အချို့ကို ခွင့်ပြုပါ။ သို့မှသာ ဝဘ်ဆိုက်များသည် ကောင်းမွန်စွာ လုပ်ဆောင်ပါမည်။ +mozfullName=Disconnect.me တင်းကျပ်သော ကာကွယ်မှု။ +mozfullDesc=သိရှိထားသည့် ခြေရာခံစနစ်များကို ပိတ်ပင်ပါ။ အချို့သော ဝဘ်ဆိုက်များ ကောင်းမွန်စွာ လုပ်ဆောင်လိမ့်မည် မဟုတ်ပါ။ +# LOCALIZATION NOTE (blocklistChangeRequiresRestart): %S = brandShortName +blocklistChangeRequiresRestart=ပိတ်ပင်ထားသည့်စာရင်းများကို ပြောင်းလဲရန် %S ကို ပြန်လည်စတင်ရပါမည်။ + +#### Master Password + +pw_change2empty_in_fips_mode=လတ်တလော FIPS အသွင်အတွင်း ရှိသည်။ FIPSသည် ‌ဗလာမဖြစ်သော ပင်မစကားဝှက်တစ်ခု လိုအပ်နေသည်။ +pw_change_failed_title=စကားဝှက်ပြောင်းလဲမှု မအောင်မြင်ပါ + +#### Fonts + +# LOCALIZATION NOTE: Next two strings are for language name representations with +# and without the region. +# e.g. languageRegionCodeFormat : "French/Canada [fr-ca]" languageCodeFormat : "French [fr]" +# %1$S = language name, %2$S = region name, %3$S = language-region code +languageRegionCodeFormat=%1$S/%2$S [%3$S] +# %1$S = language name, %2$S = language-region code +languageCodeFormat=%1$S [%2$S] + +#### Downloads + +desktopFolderName=ဒက်စ်တော့ +downloadsFolderName=ဆွဲယူထားသော ဖိုင်များ +chooseDownloadFolderTitle=ဆွဲယူထားသည့် ဖိုင်များထားရာနေရာကို ရွေးပါ + +#### Applications + +fileEnding=%S ဖိုင် +saveFile=ဖိုင်ကို သိမ်းဆည်းပါ + +# LOCALIZATION NOTE (useApp, useDefault): %S = Application name +useApp=%S ကို အသုံးပြုပါ +useDefault=%S ကို အသုံးပြုပါ (မူလသတ်မှတ်ချက်) + +useOtherApp=အခြားအက်ပ်ကို အသုံးပြုရန်… +fpTitleChooseApp=အကူအညီပေး အက်ပလီကေးရှင်းအားရွေးပါ +manageApp=အက်ပလီကေ:ရှင်းအသေးစိတ်... +webFeed=ဝဘ်ဆိုက်သတင်းတို +videoPodcastFeed=ဗီဒီယိုပေါ့ဒ်ကတ်စ် +audioPodcastFeed=ပေါ့ဒ်ကတ်စ် +alwaysAsk=အမြဲမေးပါ +portableDocumentFormat=သယ်ယူရလွယ်ကူသော စာတမ်းပုံစံ (PDF) + +# LOCALIZATION NOTE (usePluginIn): +# %1$S = plugin name (for example "QuickTime Plugin-in 7.2") +# %2$S = brandShortName from brand.properties (for example "Minefield") +usePluginIn=(%S တွင်) %S ကို အသုံးပြုပါ + +# LOCALIZATION NOTE (previewInApp, addLiveBookmarksInApp): %S = brandShortName +previewInApp=%S တွင် အစမ်းကြည့်ရန် +addLiveBookmarksInApp=%S သို့၀တ်စာမျက်နှာမှတ်သားချက်များထည့်မည် + +# LOCALIZATION NOTE (typeDescriptionWithType): +# %1$S = type description (for example "Portable Document Format") +# %2$S = type (for example "application/pdf") +typeDescriptionWithType=%S (%S) + + +#### Cookie Viewer + +hostColon=လွှင့်တင်ထားရာ နေရာ +domainColon=ဒိုမိန်း +forSecureOnly=လျှို့ဝှက် ချိတ်ဆက်မှုများသာလျှင် +forAnyConnection=မည်သည့် ချိတ်ဆက်မှုမျိုးမဆို +expireAtEndOfSession=အသုံးပြုကာလ ပြီးဆုံးသည့်အခါ +can=ခွင့်ပြုပါ +canAccessFirstParty=ပါဝင်သူကိုသာ ခွင့်ပြုပါ +canSession=ယခုအသုံးပြုကာလအတွက် ခွင့်ပြုပါ +cannot=ပိတ်ဆို့ပါ +noCookieSelected=<မည်သည့်ကွတ်ကီးမျှ မရွေးထားပါ> +cookiesAll=အောက်ပါကွတ်ကီးများကို သင့်ကွန်ပျူတာတွင် သိမ်းဆည်းထားသည် +cookiesFiltered=ရှာဖွေမှုနှင့် ကိုက်ညီသော ကွတ်ကီးများ + +# LOCALIZATION NOTE (removeAllCookies, removeAllShownCookies): +# removeAllCookies and removeAllShownCookies are both used on the same one button, +# never displayed together and can share the same accesskey. +# When only partial cookies are shown as a result of keyword search, +# removeAllShownCookies is displayed as button label. +# removeAllCookies is displayed when no keyword search and all cookies are shown. +removeAllCookies.label=အားလုံးကို ဖယ်ရှားရန် +removeAllCookies.accesskey=A +removeAllShownCookies.label=ပြသထားသည့် အရာအားလုံးကို ဖယ်ရှားပါ +removeAllShownCookies.accesskey=A + +# LOCALIZATION NOTE (removeSelectedCookies): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +# If you need to display the number of selected elements in your language, +# you can use #1 in your localization as a placeholder for the number. +# For example this is the English string with numbers: +# removeSelectedCookied=Remove #1 Selected;Remove #1 Selected +removeSelectedCookies.label=ရွေးထားသည့်အရာကို ဖယ်ရှားရန်;ရွေးထားသည့်အရာကို ဖယ်ရှားရန် +removeSelectedCookies.accesskey=R + +defaultUserContextLabel=ဘာမျှမဟုတ် + +#### Offline apps +offlineAppsList.height=7em +offlineAppRemoveTitle=အော်ဖ့်လိုင်း၀တ်ဆိုက်အချက်အလက်များကိုဖယ်ရှားပစ်မည်။ +offlineAppRemovePrompt=ဤအချက်အလက်များအားဖျက်ပြီးပါက %S အားအင်တာနက်မရှိပါကသုံးမရပါ သင်ယခုဆိုဒ်အား ဖျက်မည်မှာသေချာပြီလား။ +offlineAppRemoveConfirm=ချိတ်ဆက်မဲ့ အချက်အလက်ကြမ်းကို ဖယ်ရှားပါ + +# LOCALIZATION NOTE: The next string is for the disk usage of the +# offline application +# e.g. offlineAppUsage : "50.23 MB" +# %1$S = size (in bytes or megabytes, ...) +# %2$S = unit of measure (bytes, KB, MB, ...) +offlineAppUsage=%1$S %2$S + +offlinepermissionstext=ဤ၀တ်ဆိုက်များအားအင်တာနက်မရှိပဲသုံးရန်အချက်အလက်သိမ်းထားခွင့်မပြု။ +offlinepermissionstitle=အင်တာနက်မဲ့ဒေတာများ + +####Preferences::Advanced::Network +#LOCALIZATION NOTE: The next string is for the disk usage of the web content cache. +# e.g., "Your web content cache is currently using 200 MB" +# %1$S = size +# %2$S = unit (MB, KB, etc.) +actualDiskCacheSize=ဝဘ်ယာယီဖိုင်သည် လက်ရှိတွင် သိုလှောင်ပမာဏ %1$S %2$S ကို အသုံးပြုနေသည် +actualDiskCacheSizeCalculated=ဝဘ်ယာယီဖိုင်၏ အရွယ်အစားကို တွက်ချက်နေသည်… + +####Preferences::Advanced::Network +#LOCALIZATION NOTE: The next string is for the disk usage of the application cache. +# e.g., "Your application cache is currently using 200 MB" +# %1$S = size +# %2$S = unit (MB, KB, etc.) +actualAppCacheSize=အက်ပလီကေးရှင်း ယာယီဖိုင်သည် လက်ရှိတွင် သိုလှောင်ပမာဏ %1$S %2$S ကို အသုံးပြုနေသည် + +####Preferences::Advanced::Network +#LOCALIZATION NOTE: The next string is for the total usage of site data. +# e.g., "The total usage is currently using 200 MB" +# %1$S = size +# %2$S = unit (MB, KB, etc.) +totalSiteDataSize=သင့်ဝတ်ဆိုဒ်သိမ်းဒေတာများဟာ လောလောဆယ် %1$S %2$S ပမာဏနေရာယူထားတယ် +clearSiteDataPromptTitle=ကွတ်ကီးများနှင့် ဝဘ်ဆိုက် အချက်အားလုံးကို ရှင်းလင်းပါ +clearSiteDataPromptText=‘ယခုရှင်းပါ’ အားရွေးချယ်ခြင်းသည် ကွတ်ကီးများနှင့် ဆိုက်ဒေတာများအား ဖျက်ပစ်မည်ဖြစ်သည်။ သင့်အား ဝတ်ဆိုက်များ နှင့် အင်တာနက်မဲ့သုံး အရာများ မှ ထွက်သွားစေနိုင်ပါသည်။ +clearSiteDataNow=ယခုပင် ရှင်းလင်းပါ +important=အရေးကြီး +default=မူလသတ်မှတ်ချက် +siteUsage=%1$S %2$S +# LOCALIZATION NOTE (removeAllSiteData, removeAllSiteDataShown): +# removeAllSiteData and removeAllSiteDataShown are both used on the same one button, +# never displayed together and can share the same accesskey. +# When only partial sites are shown as a result of keyword search, +# removeAllShown is displayed as button label. +# removeAll is displayed when no keyword search and all sites are shown. +removeAllSiteData.label=အားလုံးကို ဖယ်ရှားရန် +removeAllSiteData.accesskey=e +removeAllSiteDataShown.label=ပြသထားသည့် အရာအားလုံးကို ဖယ်ရှားပါ +removeAllSiteDataShown.accesskey=e +spaceAlert.learnMoreButton.label=ပိုမိုလေ့လာရန် +spaceAlert.learnMoreButton.accesskey=L +spaceAlert.over5GB.prefButton.label=နှစ်သက်ရာအပြင်အဆင်များကို ဖွင့်ပါ +spaceAlert.over5GB.prefButton.accesskey=O +# LOCALIZATION NOTE (spaceAlert.over5GB.prefButtonWin.label): On Windows Preferences is called Options +spaceAlert.over5GB.prefButtonWin.label=အပြင်အဆင်များကို ဖွင့်ပါ +spaceAlert.over5GB.prefButtonWin.accesskey=O +# LOCALIZATION NOTE (spaceAlert.over5GB.message): %S = brandShortName +spaceAlert.over5GB.message=%S ကို အသုံးပြုရန် နေရာလွတ်မရှိတော့ပါ။ ဝဘ်ဆိုက်ရှိ အကြောင်းအရာများကို ကောင်းမွန်စွာ ပြသနိုင်မည် မဟုတ်ပါ။ သိမ်းဆည်းထားသည့် ဝဘ်ဆိုက်အချက်အလက်များကို နှစ်သက်ရာအပြင်အဆင်များ > အဆင့်မြင့် > ဝဘ်ဆိုက်ဒေတာ တွင် ရှင်းလင်းနိုင်သည်။ +# LOCALIZATION NOTE (spaceAlert.over5GB.messageWin): +# - On Windows Preferences is called Options +# - %S = brandShortName +spaceAlert.over5GB.messageWin=%S ကို အသုံးပြုရန် နေရာလွတ်မရှိတော့ပါ။ ဝဘ်ဆိုက်ရှိ အကြောင်းအရာများကို ကောင်းမွန်စွာ ပြသနိုင်မည် မဟုတ်ပါ။ သိမ်းဆည်းထားသည့် ဝဘ်ဆိုက်အချက်အလက်များကို အပြင်အဆင်များ > အဆင့်မြင့် > ဝဘ်ဆိုက်ဒေတာ တွင် ရှင်းလင်းနိုင်သည်။ +spaceAlert.under5GB.okButton.label=ကောင်းပြီ၊ ရပါပြီ +spaceAlert.under5GB.okButton.accesskey=K +# LOCALIZATION NOTE (spaceAlert.under5GB.message): %S = brandShortName +spaceAlert.under5GB.message=%S ကို အသုံးပြုရန် နေရာလွတ်မရှိတော့ပါ။ ဝဘ်ဆိုက်ရှိအကြောင်းအရာများကို ကောင်းမွန်စွာ ပြသနိုင်မည် မဟုတ်ပါ။ ပိုမိုကောင်းမွန်သော အင်တာနက်ကြည့်ရှုမှု ရရှိရန်အတွက် နေရာလွတ်အသုံးပြုမှုကို ပိုမိုကျစ်လစ်ကောင်းမွန်စေရန် “ပိုမိုလေ့လာရန်” သို့ သွားရောက်ကြည့်ရှုပါ။ + +# LOCALIZATION NOTE (featureEnableRequiresRestart, featureDisableRequiresRestart, restartTitle): %S = brandShortName +featureEnableRequiresRestart=ယခု လုပ်ဆောင်ချက်ကို အသုံးပြုရန် %S ကို ပြန်ဖွင့်ရမည်။ +featureDisableRequiresRestart=ယခု လုပ်ဆောင်ချက်ကို ပိတ်ရန် %S ကို ပြန်ဖွင့်ရမည်။ +shouldRestartTitle=%S ကို ပြန်ဖွင့်ပါ +okToRestartButton=ယခုပင် %S ကို ပြန်လည်စတင်ပါ +revertNoRestartButton=မူလအတိုင်း ပြန်ထားရန် + +restartNow=ယခုပင် ပြန်လည်စတင်ပါ +restartLater=နောက်မှ ပြန်ဖွင့်ပါ + +disableContainersAlertTitle=ကွန်တိန်နာတပ်ဗ်အားလုံးကို ပိတ်ပါမည်လား။ + +# LOCALIZATION NOTE (disableContainersMsg): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #S is the number of container tabs +disableContainersMsg=ယခု ကွန်တိန်နာတပ်ဗ်များ အသုံးပြုခြင်းကို ပိတ်မည်ဆိုပါက ကွန်တိန်နာတပ်ဗ် #S ခုသည် ပိတ်သွားပါလိမ့်မည်။ ကွန်တိန်နာတပ်ဗ်များ အသုံးပြုခြင်းကို ပိတ်မည်မှာ သေချာပါသလား။;ယခု ကွန်တိန်နာတပ်ဗ်များ အသုံးပြုခြင်းကို ပိတ်မည်ဆိုပါက ကွန်တိန်နာတပ်ဗ် #S ခုသည် ပိတ်သွားပါလိမ့်မည်။ ကွန်တိန်နာတပ်ဗ်များ အသုံးပြုခြင်းကို ပိတ်မည်မှာ သေချာပါသလား။ + +# LOCALIZATION NOTE (disableContainersOkButton): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #S is the number of container tabs +disableContainersOkButton=ကွန်တိန်နာတပ်ဗ် #S ခုကို ပိတ်ရန်;ကွန်တိန်နာတပ်ဗ် #S ခုကို ပိတ်ရန် + +disableContainersButton2=ဆက်လက်ဖွင့်ထားပါ + +removeContainerAlertTitle=ယခုကွန်တိုင်နာအား ဖယ်ပါ + +# LOCALIZATION NOTE (removeContainerMsg): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #S is the number of container tabs +removeContainerMsg=ယခု ကွန်တိုင်နာအား ဖယ်လိုက်ပါက #S ကွန်တိုင်နာ ပိတ်သွားမည်ဖြစ်သည်။ သင်ယခုကွန်တိုင်နာ အားဖယ်မည်မှာ သေချာပြီလား? ယခု ကွန်တိုင်နာအား ဖယ်လိုက်ပါက #S ကွန်တိုင်နာများ ပိတ်သွားမည်ဖြစ်သည်။ သင်ယခုကွန်တိုင်နာများ အားဖယ်မည်မှာ သေချာပြီလား? + +removeContainerOkButton=ကွန်တိုင်အား ဖယ်ပါ +removeContainerButton2=ကွန်တိုင်အား မဖယ်ပါနှင့် diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/privacy.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/privacy.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/privacy.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/privacy.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,113 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/search.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/search.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/search.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/search.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,29 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/security.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/security.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/security.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/security.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,40 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/selectBookmark.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/selectBookmark.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/selectBookmark.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/selectBookmark.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/siteDataSettings.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/siteDataSettings.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/siteDataSettings.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/siteDataSettings.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,20 @@ + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/sync.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/sync.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/sync.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/sync.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,86 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/tabs.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/tabs.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/tabs.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/tabs.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,22 @@ + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/translation.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/translation.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/preferences/translation.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/preferences/translation.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,24 @@ + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/quitDialog.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/quitDialog.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/quitDialog.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/quitDialog.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,13 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +quitDialogTitle=%S မှ ထွက်ခွါပါ + +quitTitle=ထွက်ခွါပါ +cancelTitle=ပယ်​ဖျက်ပါ +saveTitle=သိမ်းဆည်းပြီး ထွက်ခွါပါ +neverAsk2=(&D)နောက်တခါမမေးပါနဲ့ +message=နောက်တခါ စဖွင့်တဲ့အခါအတွက် %S က သင့်စာအမှတ်များနဲ့ ၀င်းဒိုးများကို သင် သိမ်းဆည်းစေလိုသလား။ +messageNoWindows=နောက်တခါ စဖွင့်တဲ့အခါအတွက် %S က သင့်စာအမှတ်များကို သင် သိမ်းဆည်းစေလိုသလား။ +messagePrivate=သင်သည် သီးသန့် ရှာဖွေခြင်း အခြေအနေတွင် ဖြစ်နေသည်။. %S မှ ထွက်လိုက်ခြင်းသည် သင်ဖွင့်ထားသည့် စာမျက်နှာများနှင့် ဝင်းဒိုးများကို ပိတ်လိုက်ပါမည်။ diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/safebrowsing/phishing-afterload-warning-message.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/safebrowsing/phishing-afterload-warning-message.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/safebrowsing/phishing-afterload-warning-message.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/safebrowsing/phishing-afterload-warning-message.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,32 @@ + + + + + + + + + + + + +သည်တိုက်ခိုက်နိုင်ဖွယ်ရှိသောစာမျက်နှာဟုသတင်းပေးခြင်းခံရပြီးသင်၏လုံခြုံရေးအပြင်အဆင်များအရပိတ်ပင်ထားခြင်းခံရသည်။"> +တိုက်ခိုက်သောဝတ်စာမျက်နှာများသည်ကွန်ပျူတာအတွင်းအချို့ပရိုဂရမ်များထည့်သွင်းပြီးသင့်အားအခြားတစ်နေရာမှတိုက်ခိုက်ရန်ကြိုးပမ်းနေသည်

အချို့တိုက်ခိုက်ဝတ်စာမျက်နှာများသည်နိုင်ငံတကာ အဆင့်အန္တရာယ်ရှိသောဆော့ဝဲများအားဖြန်ချီလျှက်ရှိသည်။

"> + + + +ရှိ ဒီဝဘ်စာမျက်နှာသည် မလိုအပ်သော ဆော့ဖ်ဝဲများ ပါဝင်ကြောင်း အကြောင်းကြားခံထားရပြီး သင့်လုံခြုံရေး အပြင်အဆင်များပေါ်မူတည်ပြီး ထိုဆိုက်ကို တားဆီးထားသည်။"> +မလိုအပ်သည့် ဆော့ဖ်ဝဲ စာမျက်နှာများသည် သင့်စနစ်ကို ပုံမှန်မလည်ပတ်စေရန် ဆောင်ရွက်စေသည့် ဆော့ဖ်ဝဲများ တပ်ဆင်ရန် ကြိုးစားကြသည်။

"> + + + +သည် တိုက်ခိုက်နိုင်ဖွယ်ရှိသောစာမျက်နှာဟု သတင်းပေးခြင်းခံရပြီး သင်၏လုံခြုံရေးအပြင်အဆင်များအရ ပိတ်ပင်ထားသည်။"> +လှည့်စားသည့်ဆိုဒ်များသည် သင့်ကို လှည့်ဖြားပြီး မလိုအပ်သည့်ဆော့ဖ်ဝဲများတပ်ဆင်ခြင်း၊ စကားဝှက်များ၊ ဖုန်းနံပါတ်များ သို့မဟုတ် အကြွေးဝယ်ကဒ်ကဲ့သို့ ကိုယ်ရေးအချက်အလက်ကို ဖော်ထုတ်ခြင်း၊ စသည့် အန္တရာယ်ဖြစ်နိုင်သည့်အပြုအမူကို ဆောင်ရွက်စေရန်အတွက် ဖန်တီးထားခြင်း ဖြစ်သည်။

ဒီဝဘ်စာမျက်နှာတွင် အချက်အလက်များဖြည့်သွင်းခြင်းသည် အချက်အလက်ခိုးယူမှု သို့မဟုတ် အခြားမသမာမှုကို ဖြစ်စေနိုင်သည်။

"> + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/safebrowsing/report-phishing.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/safebrowsing/report-phishing.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/safebrowsing/report-phishing.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/safebrowsing/report-phishing.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,13 @@ + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/safeMode.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/safeMode.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/safeMode.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/safeMode.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,17 @@ + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/sanitize.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/sanitize.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/sanitize.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/sanitize.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,69 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/searchbar.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/searchbar.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/searchbar.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/searchbar.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,6 @@ + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/search.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/search.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/search.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/search.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,50 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +searchtip=%Sအားအသုံးပြုပြီးရှာမည်။ + +# LOCALIZATION NOTE (searchPlaceholder): this is shown in the searchbox when +# the user hasn't typed anything yet. +searchPlaceholder=ရှာဖွေပါ + +# LOCALIZATION NOTE (searchHeader): this is displayed at the top of the panel +# showing search suggestions. +# %S is replaced with the name of the current default search engine. +searchHeader=%S နှင့် ရှာဖွေပါ + +# LOCALIZATION NOTE (cmd_pasteAndSearch): "Search" is a verb, this is the +# search bar equivalent to the url bar's "Paste & Go" +cmd_pasteAndSearch=ကူးချပြီးနောက်ရှာပါ + +cmd_clearHistory=ရှာဖွေရေးမှတ်တမ်းများအားရှင်းလင်းပါ +cmd_clearHistory_accesskey=H + +cmd_showSuggestions=အကြံပေးချက်များကိုပြပါ +cmd_showSuggestions_accesskey=S + +# LOCALIZATION NOTE (cmd_addFoundEngine): %S is replaced by the name of +# a search engine offered by a web page. Each engine is displayed as a +# menuitem at the bottom of the search panel. +cmd_addFoundEngine="%S"အားပေါင်းထည့်ပါ။ +# LOCALIZATION NOTE (cmd_addFoundEngineMenu): When more than 5 engines +# are offered by a web page, instead of listing all of them in the +# search panel using the cmd_addFoundEngine string, they will be +# grouped in a submenu using cmd_addFoundEngineMenu as a label. +cmd_addFoundEngineMenu=ရှာဖွေရေး အင်ဂျင်ကို ထပ်ထည့်ပါ + +# LOCALIZATION NOTE (searchForSomethingWith): +# This string is used to build the header above the list of one-click +# search providers: "Search for with:" +# NB: please leave the and its class exactly as it is in English. +searchForSomethingWith=ရှာဖွေမည် : + +# LOCALIZATION NOTE (searchWithHeader): +# The wording of this string should be as close as possible to +# searchForSomethingWith. This string will be used when the user +# has not typed anything. +searchWithHeader=ရှာဖွေရန်။: + +# LOCALIZATION NOTE (searchSettings): +# This is the label for the button that opens Search preferences. +searchSettings=ရှာဖွေရေး အပြင်အဆင်များကို ပြောင်းလဲရန် diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/setDesktopBackground.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/setDesktopBackground.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/setDesktopBackground.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/setDesktopBackground.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,15 @@ + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/shellservice.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/shellservice.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/shellservice.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/shellservice.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,31 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +optionsLabel=%S ရွေးစရာများ +safeModeLabel=%S အန္တရယ်ကင်း စနစ် + +# LOCALIZATION NOTE (setDefaultBrowserMessage2, setDefaultBrowserConfirm.label): +# %S will be replaced by brandShortName +setDefaultBrowserMessage2 = သင့် မူသေ ဘရောင်ဇာအဖြစ် သတ်မှတ်ခြင်းဖြင့် %S ၏ အကောင်းဆုံးများကို ရယူပါ +setDefaultBrowserConfirm.label = %S ကို ကျွန်တော်/မ၏ မူသေ ဘရောင်ဇာအဖြစ် Uအသုံးပြုမည် +setDefaultBrowserConfirm.accesskey = U +setDefaultBrowserOptions.label = ရွေးစရာများ +setDefaultBrowserOptions.accesskey = O +setDefaultBrowserNotNow.label = ယခု Nမဟုတ်သေးပါ +setDefaultBrowserNotNow.accesskey = N +setDefaultBrowserNever.label = Dနောက်တစ်ကြိမ်မမေးပါနှင့် +setDefaultBrowserNever.accesskey = D + +# LOCALIZATION NOTE (setDefaultBrowserTitle, setDefaultBrowserMessage, setDefaultBrowserDontAsk, setDefaultBrowserAlertConfirm.label, setDefaultBrowserAlertNotNow.label): +# These strings are used as an alternative to the ones above, in a modal dialog. +# %S will be replaced by brandShortName +setDefaultBrowserTitle=စံထား ကွန်ရက်ကြည့် ယန္တာရား +setDefaultBrowserMessage=လောလောဆယ် %S ကို သင့်ရဲ့ စံထား ကွန်ရက်ကြည့် ယန္တရား အ​ဖြစ် မချမှတ် မထားဘူး။ ၄င်းကို သင်ရဲ့ စံထား ကွန်ရက်ကြည့် ယန္တရား သတ်မှတ်လို သလား။ +setDefaultBrowserDontAsk=%S ကို စတင်တဲ့အခါတိုင်း ဒီစစ်ဆေးမှုကို ပြုလုပ်ပါ။ +setDefaultBrowserAlertConfirm.label=%S ကို ကျွန်တော်/မ၏ မူသေ ဘရောင်ဇာအဖြစ် အသုံးပြုမည် +setDefaultBrowserAlertNotNow.label=ယခု မဟုတ်သေးပါ + +desktopBackgroundLeafNameWin=စားပွဲတင် နောက်ခံ .bmp +DesktopBackgroundDownloading=ရုပ်ပုံ သိမ်းဆည်းနေဆဲ... +DesktopBackgroundSet=စားပွဲတင် နောက်ခံ ချမှတ်ပါ diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/sitePermissions.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/sitePermissions.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/sitePermissions.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/sitePermissions.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,37 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (state.current.allowed, +# state.current.allowedForSession, +# state.current.allowedTemporarily, +# state.current.blockedTemporarily, +# state.current.blocked): +# This label is used to display active permission states in the site +# identity popup (which does not have a lot of screen space). +state.current.allowed = ခွင့်ပြုထားသော +state.current.allowedForSession = ယခုအချိန်အတွက်ခွင့်ပြုထားသော +state.current.allowedTemporarily = ခတ္တခွင့်ပြုထားသော +state.current.blockedTemporarily = ခတ္တ ပိတ်ထားသည် +state.current.blocked = ပိတ်ထားသော + +# LOCALIZATION NOTE (state.multichoice.alwaysAsk, +# state.multichoice.allow, +# state.multichoice.allowForSession, +# state.multichoice.block): +# Used to label permission state checkboxes in the page info dialog. +state.multichoice.alwaysAsk = အမြဲမေးပါ +state.multichoice.allow = ခွင့်ပြုပါ +state.multichoice.allowForSession = ယခုအချိန်အတွက် ခွင့်ပြုပါ +state.multichoice.block = ပိတ်ထားပါ + +permission.cookie.label = ကွတ်ကီးများအားထားမည် +permission.desktop-notification2.label = အသိပေးချက်များကို လက်ခံရန် +permission.image.label = ပုံများအား ပြသရန်ရယူနေသည် +permission.camera.label = ကင်မရာအားသုံးပါ +permission.microphone.label = မိုက်ကရိုဖုန်းအားသုံးပါ +permission.screen.label = မျက်နှာပြင်ကို မျှဝေရန် +permission.install.label = အတ်အွန် အားတပ်ဆင် +permission.popup.label = ပေါ့အပ်ဝင်းဒိုးအားဖွင့်ပါ +permission.geo.label = သင့်တည်နေရာအားအသိပေးမည် +permission.indexedDB.label = အင်တာနက်မရှိစဉ်သုံးမှတ်ဉာဏ်အားပြုပြင်ထိန်းသိမ်းမည် diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/syncBrand.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/syncBrand.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/syncBrand.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/syncBrand.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/syncSetup.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/syncSetup.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/syncSetup.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/syncSetup.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,22 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# Several other strings are used (via Weave.Status.login), but they come from +# /services/sync + +# Firefox Accounts based setup. +continue.label = ဆက်လုပ်ပါ + +# LOCALIZATION NOTE (disconnect.label, disconnect.verify.title, disconnect.verify.bodyHeading, disconnect.verify.bodyText): +# These strings are used in the confirmation dialog shown when the user hits the disconnect button +# LOCALIZATION NOTE (disconnect.label): This is the label for the disconnect button +disconnect.label = ချိတ်ဆက်ထားခြင်း ဖြုတ်ရန် +disconnect.verify.title = ချိတ်ဆက်ထားခြင်း ဖြုတ်ရန် +disconnect.verify.bodyHeading = Sync နှင့် ချိတ်ဆက်ထားခြင်းမှ ဖြုတ်မည်လား။ +disconnect.verify.bodyText = ရှာဖွေကြည့်ရှုမှုအချက်အလက်များသည် ဒီကွန်ပျူတာတွင် ကျန်ရှိနေပါမည်။ သို့သော် သင့်အကောင့်နှင့် ထပ်တူပြုပြိုင်တူ မဖြစ်စေတော့ပါ။ + +relinkVerify.title = ကူးယူမှူသတိပေးချက် +relinkVerify.heading = ချိတ်ဆက်မှူ ထဲသို့ ဝင်ရောက်ရန် သေချာပြီလား။ +# LOCALIZATION NOTE (relinkVerify.description): Email address of a user previously signed into sync. +relinkVerify.description = A different user was previously signed in to Sync on this computer. Signing in will merge this browser’s bookmarks, passwords and other settings with %S diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/tabbrowser.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/tabbrowser.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/tabbrowser.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/tabbrowser.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,57 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE: the following strings can be used in the tab title or +# location bar to represent various states as a web page loads: +# tabs.connecting = Firefox is sending a HTTP connection request +# tabs.encryptingConnection = Firefox is sending a HTTPS connection request +# tabs.searching = Firefox is searching for something (Awesomebar or Web search) +# tabs.loading = Firefox is loading the web page +# tabs.waiting = Firefox is waiting for a web resource to load +# tabs.downloading = Firefox is downloading a file for a helper application (PDF) +tabs.connecting=ချိတ်ဆက်နေသည်… +tabs.encryptingConnection=ချိတ်ဆက်မှုကို လုံခြုံစေရန် ဆောင်ရွက်နေသည်… +tabs.searching=ရှာနေသည်… +tabs.loading=ဆောင်ရွက်နေသည်… +tabs.waiting=စောင့်နေသည်... +tabs.downloading=ဆွဲချနေသည်… + +tabs.restoreLastTabs=နောက်ဆုံးအသုံးပြုခဲ့သည့်အချိန်မှ တပ်ဗ်များကို ပြန်ဖွင့်ပါ +tabs.emptyTabTitle=တပ်ဗ်အသစ် +tabs.closeTab=တပ်ဗ်ကို ပိတ်ပါ +tabs.close=ပိတ်ပါ +tabs.closeWarningTitle=ပိတ်ရန် အတည်ပြုပါ +# LOCALIZATION NOTE (tabs.closeWarningMultiple): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +# The singular form is not considered since this string is used only for +# multiple tabs. +tabs.closeWarningMultiple=သင်သည် တပ်ဗ် #1 ခုကို ပိတ်တော့မည်။ ပိတ်ရန် သေချာပါသလား။ +tabs.closeButtonMultiple=တပ်ဗ်များကို ပိတ်ပါ +tabs.closeWarningPromptMe=တပ်ဗ်များကို ပိတ်ရန် ဆောင်ရွက်သည့်အခါတိုင်း သတိပေးပါ + +tabs.closeTab.tooltip=တပ်ဗ်ကို ပိတ်ရန် +# LOCALIZATION NOTE (tabs.closeSelectedTab.tooltip): +# %S is the keyboard shortcut for closing the current tab +tabs.closeSelectedTab.tooltip=တပ်ဗ် (%S) ကို ပိတ်ရန် +# LOCALIZATION NOTE (tabs.muteAudio.tooltip): +# %S is the keyboard shortcut for "Mute tab" +tabs.muteAudio.tooltip=တပ်ဗ် (%S) ၏ အသံပိုင်းကို ပိတ်ရန် +# LOCALIZATION NOTE (tabs.unmuteAudio.tooltip): +# %S is the keyboard shortcut for "Unmute tab" +tabs.unmuteAudio.tooltip=တပ်ဗ် (%S) ၏ အသံပိုင်းကို ပြန်ဖွင့်ရန် +tabs.muteAudio.background.tooltip=တပ်ဗ်၏ အသံပိုင်းကို ပိတ်ရန် +tabs.unmuteAudio.background.tooltip=တပ်ဗ်၏ အသံပိုင်းကို ပြန်ဖွင့်ရန် + +tabs.unblockAudio.tooltip=တပ်ဗ်ရှိအသံပိုင်းဆိုင်ရာကို ဖွင့်ပါ + +# LOCALIZATION NOTE (tabs.allowTabFocusByPromptForSite): +# %S is the hostname of the site where dialogs are allowed to switch tabs +tabs.allowTabFocusByPromptForSite=၎င်းတို့၏ တပ်ဗ်ထံ ခေါ်ဆောင်သွားမည့် %S မှ ပွင့်လာသည့် ဒိုင်ယာလော့ဂ်ဝင်းဒိုးများကို ခွင့်ပြုပါ။ + +# LOCALIZATION NOTE (tabs.containers.tooltip): +# Displayed as a tooltip on container tabs +# %1$S is the title of the current tab +# %2$S is the name of the current container +tabs.containers.tooltip=%1$S - %2$S diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/taskbar.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/taskbar.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/taskbar.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/taskbar.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,12 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +taskbar.tasks.newTab.label=Tabအသစ်ဖွင့်ပါ။ +taskbar.tasks.newTab.description=ဘရောက်ဆာတပ်ဗ်တစ်ခုအသစ်ဖွင့်ပါ။ +taskbar.tasks.newWindow.label=၀င်းဒိုးအသစ်တစ်ခုဖွင့်ပါ။ +taskbar.tasks.newWindow.description=ဘရောက်ဆာ၀င်းဒိုးတစ်ခုအသစ်ဖွင့်ပါ။ +taskbar.tasks.newPrivateWindow.label=တကိုယ်ရေသုံး ဝင်းဒိုးအသစ် +taskbar.tasks.newPrivateWindow.description=သီးသန့်ကြည့်ရန် ဝင်းဒိုးအသစ်ဖွင့် +taskbar.frequent.label=မကြာခဏကြည့်သော +taskbar.recent.label=မကြားသေးမှီကကြည့်ခဲ့သော diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/translation.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/translation.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/translation.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/translation.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,75 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/translation.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/translation.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/translation.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/translation.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,12 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (translation.options.neverForLanguage.label): +# %S is a language name coming from the global/languageNames.properties file. +translation.options.neverForLanguage.label=%S ကို Nဘယ်တော့မှ ဘာသာမပြန်ပါနှင့် + +# LOCALIZATION NOTE (translation.options.neverForLanguage.accesskey): +# The accesskey value used here should not clash with the values used for +# translation.options.*.accesskey in translation.dtd +translation.options.neverForLanguage.accesskey=N diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/webrtcIndicator.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/webrtcIndicator.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser/webrtcIndicator.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser/webrtcIndicator.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,61 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE : FILE This file contains the webrtc global indicator strings + +# LOCALIZATION NOTE (webrtcIndicator.windowtitle): %S is the brand name (e.g. Firefox). +# This string is used so that the window has a title in tools that enumerate/look for window +# titles. It is not normally visible anywhere. +webrtcIndicator.windowtitle = မျှဝေခြင်းဆိုင်ရာ ညွှန်ပြကိရိယာ - %S + +webrtcIndicator.sharingCameraAndMicrophone.tooltip = သင့် ကင်မရာနှင့် မိုက္ကရိုဖုန်းကို မျှဝေထားသည်။ မျှဝေခြင်းကို ထိန်းချုပ်ရန် ကလစ်နှိပ်ပါ။ +webrtcIndicator.sharingCamera.tooltip = သင့် ကင်မရာကို မျှဝေထားသည်။ မျှဝေခြင်းကို ထိန်းချုပ်ရန် ကလစ်နှိပ်ပါ။ +webrtcIndicator.sharingMicrophone.tooltip = သင့် မိုက္ကရိုဖုန်းကို မျှဝေထားသည်။ မျှဝေခြင်းကို ထိန်းချုပ်ရန် ကလစ်နှိပ်ပါ။ +webrtcIndicator.sharingApplication.tooltip = အက်ပလီကေးရှင်း တစ်ခုကို မျှဝေထားသည်။ မျှဝေခြင်းကို ထိန်းချုပ်ရန် ကလစ်နှိပ်ပါ။ +webrtcIndicator.sharingScreen.tooltip = သင့် မျက်နှာပြင်ကို မျှဝေထားသည်။ မျှဝေခြင်းကို ထိန်းချုပ်ရန် ကလစ်နှိပ်ပါ။ +webrtcIndicator.sharingWindow.tooltip = ဝင်းဒိုးတစ်ခုကို မျှဝေထားသည်။ မျှဝေခြင်းကို ထိန်းချုပ်ရန် ကလစ်နှိပ်ပါ။ +webrtcIndicator.sharingBrowser.tooltip = စာမျက်နှာတစ်ခုကို မျှဝေထားသည်။ မျှဝေခြင်းကို ထိန်းချုပ်ရန် ကလစ်နှိပ်ပါ။ + + +# LOCALIZATION NOTE : The following strings are only used on Mac for +# menus attached to icons near the clock on the mac menubar. + +# LOCALIZATION NOTE (webrtcIndicator.sharing*With.menuitem): +# %S is the title of the tab using the share. +webrtcIndicator.sharingCameraWith.menuitem = ကင်မရာကို "%S"ထံ မျှဝေထားသည် +webrtcIndicator.sharingMicrophoneWith.menuitem = မိုက္ကရိုဖုန်းကို "%S"ထံ မျှဝေထားသည် +webrtcIndicator.sharingApplicationWith.menuitem = အက်ပလီကေးရှင်းကို "%S"ထံ မျှဝေထားသည် +webrtcIndicator.sharingScreenWith.menuitem = မျက်နှာပြင်ကို "%S"ထံ မျှဝေထားသည် +webrtcIndicator.sharingWindowWith.menuitem = ဝင်းဒိုးကို "%S"ထံ မျှဝေထားသည် +webrtcIndicator.sharingBrowserWith.menuitem = စာမျက်နှာကို "%S"ထံ မျှဝေထားသည် +webrtcIndicator.controlSharing.menuitem = မျှဝေခြင်းကို ထိန်းချုပ်ရန် +# LOCALIZATION NOTE (webrtcIndicator.sharingCameraWithNTabs.menuitem): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +webrtcIndicator.sharingCameraWithNTabs.menuitem = ကင်မရာကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည်;ကင်မရာကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည် +# LOCALIZATION NOTE (webrtcIndicator.sharingMicrophoneWithNTabs.menuitem): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +webrtcIndicator.sharingMicrophoneWithNTabs.menuitem = မိုက္ကရိုဖုန်းကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည်;မိုက္ကရိုဖုန်းကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည် +# LOCALIZATION NOTE (webrtcIndicator.sharingApplicationWithNTabs.menuitem): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +webrtcIndicator.sharingApplicationWithNTabs.menuitem = အက်ပလီကေးရှင်းတစ်ခုကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည်;အက်ပလီကေးရှင်းများကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည် +# LOCALIZATION NOTE (webrtcIndicator.sharingScreenWithNTabs.menuitem): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +webrtcIndicator.sharingScreenWithNTabs.menuitem = မျက်နှာပြင်ကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည်;မျက်နှာပြင်ကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည် +# LOCALIZATION NOTE (webrtcIndicator.sharingWindowWithNTabs.menuitem): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +webrtcIndicator.sharingWindowWithNTabs.menuitem = ဝင်းဒိုးတစ်ခုကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည်;ဝင်းဒိုးများကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည် +# LOCALIZATION NOTE (webrtcIndicator.sharingBrowserWithNTabs.menuitem): +# Semicolon-separated list of plural forms. See: +# http://developer.mozilla.org/en/docs/Localization_and_Plurals +# This message is shown when the contents of a tab is shared during a WebRTC +# session, which currently is only possible with Loop/Hello. +webrtcIndicator.sharingBrowserWithNTabs.menuitem = စာမျက်နှာခွဲတစ်ခုကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည်;စာမျက်နှာခွဲများကို စာမျက်နှာ #1ခုနှင့်အတူ မျှဝေအသုံးပြုနေသည် +# LOCALIZATION NOTE (webrtcIndicator.controlSharingOn.menuitem): +# %S is the title of the tab using the share. +webrtcIndicator.controlSharingOn.menuitem = "%S" ရှိ မျှဝေခြင်းကို ထိန်းချုပ်ရန် diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/browser-region/region.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/browser-region/region.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/browser-region/region.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/browser-region/region.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,44 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE: REVIEW_REQUIRED +# Please do not commit any changes to this file without a review from the +# l10n-drivers team (this includes en-US). In order to get one, please file +# a bug, add the "productization" keyword and CC l10n@mozilla.com. + +# Default search engine +browser.search.defaultenginename=Google + +# Search engine order (order displayed in the search bar dropdown) +browser.search.order.1=Google +browser.search.order.2=Yahoo +browser.search.order.3=Bing + +# This is the default set of web based feed handlers shown in the reader +# selection UI +browser.contentHandlers.types.0.title=My Yahoo! +browser.contentHandlers.types.0.uri=https://add.my.yahoo.com/rss?url=%s +browser.contentHandlers.types.1.title=Netvibes +browser.contentHandlers.types.1.uri=http://www.netvibes.com/subscribe.php?url=%s + +# Increment this number when anything gets changed in the list below. This will +# cause Firefox to re-read these prefs and inject any new handlers into the +# profile database. Note that "new" is defined as "has a different URL"; this +# means that it's not possible to update the name of existing handler, so don't +# make any spelling errors here. +gecko.handlerService.defaultHandlersVersion=4 + +# The default set of protocol handlers for mailto: +gecko.handlerService.schemes.mailto.0.name=Yahoo! Mail +gecko.handlerService.schemes.mailto.0.uriTemplate=https://compose.mail.yahoo.com/?To=%s +gecko.handlerService.schemes.mailto.1.name=Gmail +gecko.handlerService.schemes.mailto.1.uriTemplate=https://mail.google.com/mail/?extsrc=mailto&url=%s + +# The default set of protocol handlers for irc: +gecko.handlerService.schemes.irc.0.name=Mibbit +gecko.handlerService.schemes.irc.0.uriTemplate=https://www.mibbit.com/?url=%s + +# The default set of protocol handlers for ircs: +gecko.handlerService.schemes.ircs.0.name=Mibbit +gecko.handlerService.schemes.ircs.0.uriTemplate=https://www.mibbit.com/?url=%s diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/overrides/appstrings.properties firefox-54.0~b2+build1/l10n/my/browser/chrome/overrides/appstrings.properties --- firefox-54.0~b1+build1/l10n/my/browser/chrome/overrides/appstrings.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/overrides/appstrings.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,41 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +malformedURI=ဤဝတ်လိပ်စာ URL သည် ရှိမနေပါသဖြင့်မဖွင့်နိုင်ပါ။ +fileNotFound=%S ဖိုင်ကို ရှာလို့ မရဘူး။ တည်နေရာကို စစ်ဆေးပြီး ထပ်ကြိုးစားပါ။ +fileAccessDenied=%S ရှိ ဖိုင်ကို မဖွင့်ဖတ်နိုင်ပါ။ +dnsNotFound=%S ဖိုင်ကို ရှာလို့ မရဘူး။ အမည်ကို စစ်ဆေးပြီး ထပ်ကြိုးစားပါ။ +unknownProtocolFound=ယခုလိပ်စာအားဘယ်လိုဖွင့်ရန် မီးမြေခွေး မသိပါ၊ အဘယ့် ကြောင့်ဆိုသော အောက်ပါ ပေးထားသော (%S) ပရိုတိုကောသည် မည်သည့် ပရိုဂရမ်နှင့်မျှ ဆက်သွယ်နေခြင်းမရှိသောကြောင့်ဖြစ်သည်။ +connectionFailure=မီးမြေခွေးဟာ ဆာဗာ %S ကို ဆက်သွယ်​ဖို့ ကြိုးစားသော အခါ ချိတ်ဆက်မှု ငြင်းပယ်ခံရတယ်။ +netInterrupt=မ​မျှော်လင့်ပဲ %S ဆီ ချိတ်ဆက်မှု သည် စာမျက်နှာအား ရယူနေစဉ် အဆုံးသတ်သွားတယ်။ +netTimeout=%S ကို ချိတ်ဆက်ခြင်းသည် ပုံမှန်ထက် ပိုမိုပြီး အချိန်ကြာမြင့်နေသည်။ +redirectLoop=ဒီကွန်ရက် တည်နေရာအတွက် လမ်းလွှဲမှု အကန့်အသတ် ကျော်လွန်သွားတယ်။ တောင်းဆိုထားတဲ့ စာမျက်နှာကို မဖွင့်နိုင်ဘူး။ ဒါဟာ ပိတ်ဆို့ထားတဲ့ ကွတ်ကီးများကြောင့် ဖြစ်နိုင်တယ်။ +## LOCALIZATION NOTE (confirmRepostPrompt): In this item, don’t translate "%S" +confirmRepostPrompt=ဤဝတ်စာမျက်နှာ အားဖော်ပြရန် အတွက် အက်ပလီကေးရှင်း%S သည်လုပ်ဆောက်ချက် အချို့(ဥပမာရှာဖွေခြင်း သို့အော်ဒါ အတည်ပြုခြင်း) အားထပ်မံ လုပ်ဆောင်စေမည့် အချက်အလက် အချို့ပို့ရမည်။ +resendButton.label=ပြန်ပို့ပါ +unknownSocketType=မီးမြေခွေးဟာ ယခုဆာဗာဖြင့် မည်သို့ဆက်သွယ်ဆက်ဆံရမည် ကိုမသိပါ။ +netReset=အင်တာနက်ဆက်သွယ်မှူ သည် စာမျက်နှာအား ရယူနေစဉ် ပြတ်တောက်သွားသည်။ +notCached=ဒေါ့ကူမန့်အားထပ်မံရယူလို့မရပါ။ +netOffline=မီးမြေခွေးသည် အင်တာနက်ချိတ်ဆက်မှူမရှိသဖြင့် ဝတ်စာမျက်နှာအား မဖွင့်ပြနိုင်ပါ။ +isprinting=The document cannot change while Printing or in Print Preview. +deniedPortAccess=လုံခြုံရေး ကိစ္စများကြောင့် ဒီထုတ်တိုင် ဂဏန်းဆီ ၀င်ရောက်မှုကို ပိတ်ထားတယ်။ +proxyResolveFailure=သင် ပြုပြင်ဖန်တီးထားတဲ့ ကြားခံ ဆာဗာကို မတွေ့နိုင်ဘူး။ သင့်ရဲ့ ကြားခံ အပြင်အဆင်များကို စစ်ဆေးပြီး ထပ်ကြိုးစားပါ။ +proxyConnectFailure=ချိတ်ဆက်မှုဟာ သင်ပြုပြင်ဖန်တီးထားတဲ့ ကြားခံ ​ဆာဗာကို ဆက်သွယ်ဖို့ ကြိုးစားတဲ့အခါ ငြင်းပယ်ခံရတယ်။ သင့်ရဲ့ ကြားခံ အပြင်အဆင်များကို စစ်ဆေးပြီး ထပ်ကြိုးစားပါ။ +contentEncodingError=The page you are trying to view cannot be shown because it uses an invalid or unsupported form of compression. +unsafeContentType=သင် ရှုမြင်ဖို့ ကြိုးစားနေတဲ့ စာမျက်နှာဟာ ဖွင့်ဖို့ အန္တရယ် မကင်းတဲ့ ဖိုင် အမျိုးအစားတခု ပါရှိတဲ့အတွက် မဖေါ်ပြနိုင်ဘူး။ ဒီပြဿနာကို အသိပေးဖို့ ကွန်ရက် စာမျက်နှာ ပိုင်ရှင်များကို ဆက်သွယ်ပါ။ +externalProtocolTitle=ပြင်ပ နည်းလမ်း တောင်းဆိုချက် +externalProtocolPrompt=ပြင်ပ လုပ်ငန်းသုံး ကိရိယာ တခုဟာ %1$S: အချိတ်အဆက်များကို ကိုင်တွယ်ဖို့ စတင်ရမယ်။\n\n\nတောင်းဆိုထားတဲ့ အချိတ်အဆက်၊\n\n%2$S\n\nလုပ်ငန်းသုံး ကိရိယာ၊ %3$S\n\n\nဒီတောင်းဆိုချက်ကို သင်မျှော်လင့်မထားရင် အခြား ပရိုဂရမ်ထဲက အားနည်းချက်တခုကို အမြတ်ထုတ်ဖို့ ကြိုးစားတာ ဖြစ်နိုင်တယ်။ ဒါကို အန္တရယ်ကင်းမှု မသေချာရင် ဒီတောင်းဆိုချက်ကို ပယ်ဖျက်ပါ။\n +#LOCALIZATION NOTE (externalProtocolUnknown): The following string is shown if the application name can't be determined +externalProtocolUnknown=<အမည်မသိ> +externalProtocolChkMsg=ဒီအမျိုးအစားရဲ့ အချိတ်အဆက်များ အားလုံးအတွက် ကျွန်ပ် ရွေးချယ်ချက်ကို မှတ်ထားပါ။ +externalProtocolLaunchBtn=လုပ်ငန်းသုံး ကိရိယာကို စဖွင့်ပါ +malwareBlocked=%S နေရာမှ ကွန်ရက်ကို တိုက်ခိုက်တဲ့ ကွန်ရက်အဖြစ် ထုတ်ပြန်ခံရတဲ့အတွက် သင့်ရဲ့ လုံခြုံရေး ဦး​စားပေးချက်များ အတိုင်း ပိတ်ဆို့ထားတယ်။ +unwantedBlocked=%S ရှိ ဆိုက်သည် မလိုအပ်သည့် ဆော့ဖ်ဝဲများ ဖြန့်သည်ဟု တိုင်ကြားခံထားရသည်။ ထို့ကြောင့် သင့် လုံခြုံရေးအပြင်အဆင်များ အရ ထိုဆိုက်ကို ပိတ်ပင်တားဆီးထားသည်။ +deceptiveBlocked=ဤဝဘ်ဆိုက်၏ %S သည် တိုက်ခိုက်နိုင်ဖွယ်ရှိသောစာမျက်နှာဟု သတင်းပေးခြင်းခံရပြီး သင်၏လုံခြုံရေးအပြင်အဆင်များအရ ပိတ်ပင်ထားသည်။ +cspBlocked=ဤစာမျက်နှာတွင် ယခုလိုပုံစံဖြင့် ဖော်ပြခြင်းကို တားမြစ်သည့် အကြောင်းအရာ လုံခြုံရေး မူဝါဒတစ်ခု ရှိပါသည်။ +corruptedContentErrorv2=%S ရှိ ဝဘ်ဆိုက်သည် ပြင်ဆင်မှုမပြုနိုင်သည့် နက်ဝေါ့စည်းမျဉ်းဖောက်ဖျက်မှုတစ်ခုကို ပြုလုပ်ထားသည်။ +remoteXUL=ယခု၀တ်ဆိုက်သည်ထောက်ပံ့ပေးမထားသောနည်းပညာအားသုံးထားပြီးမီးမြေခွေးတွင်ပုံမှန်မပြသပါ။ +## LOCALIZATION NOTE (sslv3Used) - Do not translate "%S". +sslv3Used=မီးမြေခွေးသည် %S ရှိ သင့် အချက်အလက်များ၏ လုံခြုံစိတ်ချရမှုကို အာမ မခံနိုင်ပါ။ အဘယ့်ကြောင့်ဆိုသော လုံခြုံမှု အားနည်းသည့် ပရိုတိုကောလ် SSLv3 ကို အသုံးပြုထားသောကြောင့် ဖြစ်သည်။ +inadequateSecurityError=ဒီဝဘ်ဆိုက်သည် လုံခြုံမှုအဆင့်အားနည်းခြင်းကို အခွင့်ကောင်းယူပြီး ကျော်လွှားရန် ကြိုးစားခဲ့သည်။ diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/overrides/netError.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/overrides/netError.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/overrides/netError.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/overrides/netError.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,181 @@ + + + +%brandDTD; + + + + + + + + + + + + + + + + +
  • စာလုံးပေါင်းမှားခြင်း စသည် ဖြစ်နိုင်သည့်အတွက် လိပ်စာကို စစ်ဆေးပါ + www.example.com ဖြစ်ရမည့်အစား + ww.example.com ဟု မှားရိုက်ထားခြင်း
  • +
  • မည်သည့်စာမျက်နှာမျှ မကြည့်ရှုနိုင်ပါက ကွန်ပျူတာတွင် ချိတ်ထားသော + ကွန်ယက်ချိတ်ဆက်မှုကို စစ်ဆေးပါ။
  • +
  • ကွန်ပျူတာ သို့မဟုတ် ကွန်ယက်ကို မီးနံရံ သို့မဟုတ် ကြားခံဆာဗာဖြင့် ကာကွယ်ထားပါက + ထို &brandShortName; သည် ဝက်ဘ်ကို အသုံးပြုနိုင်မှု ရှိ/မရှိ စစ်ဆေးပါ။
  • +"> + + + +
  • အကြီးအသေး မှားရိုက်ခြင်း သို့မဟုတ် အခြား စာလုံးပေါင်းအမှားများ ဖြစ်နိုင်သည့်အတွက် ဖိုင်အမည်ကို စစ်ဆေးပါ။
  • +
  • ဖိုင်ကို ရွှေ့ထားခြင်း၊ အမည်ပြောင်းထားခြင်း သို့မဟုတ် ဖျက်ထားခြင်း ရှိ/မရှိ စစ်ဆေးပါ။
  • + +"> + + +
  • ၎င်းကို ဖျက်ထားခြင်း၊ ရွှေ့ထားခြင်း သို့မဟုတ် ဖိုင်အသုံးပြုမှုဆိုင်ရာမူဝါဒများက အသုံးမပြုနိုင်စေရန် တားမြစ်နေခြင်း ဖြစ်နိုင်ပါသည်။
  • "> + + +&brandShortName; သည် အကြောင်းတစ်ခုခုကြောင့် ယခုစာမျက်နှာကို မဖွင့်နိုင်ပါ။

    "> + + +အင်တာနက်ကို အသုံးမပြုနိုင်မီ ဒီကွန်ယက်သို့ လက်မှတ်ထိုး ဝင်ရောက်ရပါမည်။

    "> + + + + + +
  • ဝဘ်လိပ်စာများကို အောက်ပါအတိုင်း ရေးလေ့ရှိကြသည် + http://www.example.com/
  • +
  • ရှေ့ယိုင်မျဉ်းစောင်းကို အသုံးပြုထားခြင်း ဟုတ်/မဟုတ် စစ်ဆေးပါ (i.e. + /).
  • + +"> + + + + + +တောင်းဆိုထားသောဒေါ့ကုမန့်သည် &brandShortName;၏ခေတ္တသိမ်းမှတ်ဉာဏ်ထဲတွင်မရှိတော့ပါ

    • လုံခြုံရေးကာကွယ်မှူအရ &brandShortName; သည် အချို့သောဒေါ့ကုမန့်များအားသိမ်းထားလေ့မရှိပါ.
    • ဝတ်ဆိုဒ်မှပြန်လည်တောင်းဆိုရန်အတွက် နောက်ထပ် ကိုနှိပ်ပါ။
    "> + + +
  • "Try Again" အားနှိပ်ပြီး အင်တာနက်ပြန်လည်ချိတ်ဆက်ကာ စာမျက်နှာအားဖွင့်.
  • "> + + + +
  • ယခုပြဿနာကို အသိပေးရန် ကျေးဇူးပြု၍ ဝဘ်ဆိုက်ပိုင်ရှင်ကို ဆက်သွယ်ပါ။
  • + +"> + + + +
  • ယခုပြဿနာကို အသိပေးရန် ကျေးဇူးပြု၍ ဝဘ်ဆိုက်ပိုင်ရှင်ကို ဆက်သွယ်ပါ။
  • + +"> + + + + + + + + + +
  • ယခုလိပ်စာကို ဖွင့်ရန် အခြားဆော့ဖ်ဝဲလ်တစ်ခုကို လိုအပ်ကောင်း လိုအပ်ပါလိမ့်မည်။
  • + +"> + + + +
  • ကြားခံဆာဗာအပြင်အဆင်များ မှန်ကန်မှုရှိ/မရှိ စစ်ဆေးပါ။
  • +
  • ကြားခံဆာဗာများ ကောင်းစွာ ဆောင်ရွက်ခြင်း ရှိ/မရှိ စစ်ဆေးရန် + ကွန်ယက်စီမံသူနှင့် ဆက်သွယ်ပါ။
  • + +"> + + + +
  • ကြားခံဆာဗာအပြင်အဆင်များ မှန်ကန်မှု ရှိ/မရှိ စစ်ဆေးပါ။
  • +
  • ကွန်ပျူတာသည် အင်တာနက်ရှိသော ကွန်ယက်တွင် ချိတ်ထားခြင်း ရှိ/မရှိ စစ်ဆေးပါ။
  • +
  • အကယ်၍ ကွန်ပျူတာ သို့မဟုတ် ကွန်ယက်သည် မီးနံရံ သို့မဟုတ် ကြားခံဆာဗာဖြင့် ကာကွယ်ထားပါက + ၎င်း &brandShortName; ကို အင်တာနက် အသုံးပြုခွင့် ပေးထားခြင်း ရှိ/မရှိ စစ်ဆေးပါ။
  • + +"> + + + +
  • ကွတ်ကီးအသုံးပြုမှုကို ငြင်းဆန်ခြင်း သို့မဟုတ် ပိတ်ထားခြင်းတို့ကြောင့် ယခုပြဿနာကဲ့သို့ + ဖြစ်ပေါ်စေနိုင်သည်။
  • + +"> + + + +
  • သင့်ကွန်ပျူတာစနစ်တွင် Personal Security Manager တပ်ဆင်ထားခြင်း ရှိ/မရှိ + စစ်ဆေးပါ။
  • +
  • ဆာဗာတွင် စံမဟုတ်သော ပြင်ဆင်ပြုပြင်မှုများကြောင့် ယခုပြဿနာကဲ့သို့ ဖြစ်ပေါ်စေနိုင်သည်။
  • + +"> + + +
  • လက်ခံရရှိလိုက်သော ခွင့်ပြုချက်အား အတည်မပြုနိုင်သဖြင့် ဝတ်စာမျက်နှာအား မပြနိုင်ပါ
  • ယခု ပြသာနာအတွက် ဝတ်ဆိုဒ် ပိုင်ရှင်အား ဆက်သွယ်ပါ
  • "> + + + +၏ ပိုင်ရှင်သည် သူတို့၏ ဒီဝဘ်ဆိုက်ကို သင့်လျော်မှန်ကန်စွာ ချိန်ညှိထားခြင်း မရှိပါ။ သင့်အချက်အလက်များ ခိုးယူခံရခြင်းမှ ကာကွယ်ရန် &brandShortName; သည် ဒီဝဘ်ဆိုက်ကို မချိတ်ဆက်ထားပါ။"> + +
  • သင်ကြည့်ရှုလိုသောဝတ်ဆိုက်သည်လောလောဆယ်ကြည့်ရှူမရနိုင်ပါ။ အလွန်အလုပ်များနေသောကြောင့်ဖြစ်ပါလိမ့်မည်။
  • အကယ်လိုပြန်လည်ကြည့်ရှူမရပါကသင်၏ကွန်ပျူတာနက်ဝပ် ချိတ်ဆက်မှူကိုစစ်ကြည့်ပါ။.
  • အကယ်လို့သင့်ကွန်ပျူတာအား ဖိုင်းယားဝေါလ်တစ်ခုခုဖြင့်ကာကွယ်တာပါက &brandShortName; အားအင်တာနက်သို့ဆက်သွယ်မှူ ပါမစ်ခွင့်ပြုပေးထားလားစစ်ပါ။
  • "> + + +&brandShortName; သည်ယခု၀တ်ဆိုက်အားပါ၀င်နေသောအရာတစ်ခု၏လုံခြုံရေး ကြောင့်ရယူခြင်းကိုခွင့်မပြုပါ.

    "> + + +အချက်အလက်ကူးယူပြောင်းခြင်းပြသာနာကြောင့်၀တ်ဆိုက်အားမပြသနိုင်ပါ။

    • ၀တ်ဆိုက်ပိုင်ရှင်များဤပြသာနာအားအသိပေးရန်ကျေးဇူးပြုပြီးဆက်သွယ်ပေးပါ။
    "> + + + + + + + + +
    • ၀တ်ဆိုက်ပိုင်ရှင်အားဤပြသာနားအားတင်ပြရန်ဆက်သွယ်ပါ

    "> + + + + + + + &brandShortName; သည် ကို မချိတ်ဆက်နိုင်ပါ။ သင့်ကွန်ပျူတာရှိနာရီသည် အချိန်မှားယွင်းနေသောကြောင့် ဖြစ်သည်။ ထို့ပြင် ၎င်းသည် လုံခြုံသောချိတ်ဆက်မှု မဖြစ်နိုင်စေပါ။

    အချိန်သည် ဖြစ်သင့်သော်လည်း သင့်ကွန်ပျူတာသည် ကို သတ်မှတ်ထားသည်။ ယခုအမှားကို ဖြေရှင်းရန် သင့်ရက်စွဲနှင့်အချိန် အပြင်အဆင်များကို မှန်ကန်သောအချိန်သို့ ပြောင်းလဲသတ်မှတ်ပါ။

    "> +&brandShortName; သည် သို့ မချိတ်ဆက်နိုင်ပါ။ အဘယ်ကြောင့်ဆိုသော် သင့်ကွန်ပျူတာ၏နာရီသည် မှားယွင်းနေပုံရသောကြောင့် ဖြစ်သည်။ ထို့ပြင် ၎င်းသည် လုံခြုံသောချိတ်ဆက်မှု မဖြစ်နိုင်စေပါ။

    သင့်ကွန်ပျူတာသည် ကို မှားယွင်းသတ်မှတ်ထားသည်။ ယခုပြဿနာကို ဖြေရှင်းရန် သင့်ရက်စွဲနှင့်အချိန် အပြင်အဆင်များကို မှန်ကန်သောအချိန်သို့ ပြောင်းလဲသတ်မှတ်ပါ။

    "> + + + + + + + +သည် အိုဟောင်းပြီး တိုက်ခိုက်ရန်လွယ်ကူသည့် လုံခြုံရေးနည်းပညာကို အသုံးပြုထားသည်။ တိုက်ခိုက်သူသည် သင်လုံခြုံသည်ဟုထင်သည့် အချက်အလက်များကို လွယ်ကူစွာ ဖော်ထုတ်နိုင်ပါလိမ့်မည်။ သင်လာရောက်မလည်ပတ်မီ ဝဘ်ဆိုဒ်စီမံခန့်ခွဲသူသည် ဆာဗာကို အရင်ဆုံး ပြုပြင်ဖြေရှင်းရန် လိုအပ်သည်။

    Error code: NS_ERROR_NET_INADEQUATE_SECURITY

    "> + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/chrome/overrides/settingsChange.dtd firefox-54.0~b2+build1/l10n/my/browser/chrome/overrides/settingsChange.dtd --- firefox-54.0~b1+build1/l10n/my/browser/chrome/overrides/settingsChange.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/chrome/overrides/settingsChange.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/browser/crashreporter/crashreporter-override.ini firefox-54.0~b2+build1/l10n/my/browser/crashreporter/crashreporter-override.ini --- firefox-54.0~b1+build1/l10n/my/browser/crashreporter/crashreporter-override.ini 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/crashreporter/crashreporter-override.ini 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,8 @@ +; This Source Code Form is subject to the terms of the Mozilla Public +; License, v. 2.0. If a copy of the MPL was not distributed with this +; file, You can obtain one at http://mozilla.org/MPL/2.0/. +; This file is in the UTF-8 encoding +[Strings] +; LOCALIZATION NOTE (CrashReporterProductErrorText2): The %s is replaced with a string containing detailed information. +CrashReporterProductErrorText2=မီးမြေခွေးသည်ပြသာနာတစ်ခုကြောင့်ရပ်တန့်သွားသည်။\n\nတပ်ဗ်များအား ပြန်လည်အသုံးပြုချိန်တွင်ရရှိအောင်ကြိုးစားထားမည် \n \nအသေးစိတ်မှာ: %s +CrashReporterDescriptionText2=မီးမြေခွေးသည်ပြသာနာတစ်ခုကြောင့်ရပ်တန့်သွားသည်။တပ်ဗ်များအား ပြန်လည် အသုံးပြုချိန်တွင်\n\nရရှိအောင်ကြိုးစားထားမည်။ ကျေးဇူးပြုပြီး ပြသာနာအားကူညီသောအားဖြင့်တင်ပြပေးပါ။ diff -Nru firefox-54.0~b1+build1/l10n/my/browser/defines.inc firefox-54.0~b2+build1/l10n/my/browser/defines.inc --- firefox-54.0~b1+build1/l10n/my/browser/defines.inc 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/defines.inc 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,14 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. +#filter emptyLines + +#define MOZ_LANGPACK_CREATOR မော်ဇီလာ ဖောင်ဒေးရှင်း + +# If non-English locales wish to credit multiple contributors, uncomment this + +# variable definition and use the format specified. + +#define MOZ_LANGPACK_CONTRIBUTORS တင်အောင်လင်း ဝေဖြိုးဟန်ရက်ပ်ဆဲကျော်ကျော်စွာသန့် + +#unfilter emptyLines diff -Nru firefox-54.0~b1+build1/l10n/my/browser/extensions/webcompat-reporter/webcompat.properties firefox-54.0~b2+build1/l10n/my/browser/extensions/webcompat-reporter/webcompat.properties --- firefox-54.0~b1+build1/l10n/my/browser/extensions/webcompat-reporter/webcompat.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/extensions/webcompat-reporter/webcompat.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,11 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE(wc-reporter.label): This string will be used in the +# Firefox menu panel below its button. Localized length should be considered. +# \u00ad is included at the beginning of the string to disable auto-hyphens. +wc-reporter.label=\u00adဝဘ်ဆိုက်ပြဿနာကို အကြောင်းကြားရန် +# LOCALIZATION NOTE(wc-reporter.tooltip): A site compatibility issue is +# a website bug that exists in one browser (Firefox), but not another. +wc-reporter.tooltip=ဝဘ်ဆိုက် လိုက်လျောညီထွေဖြစ်မှုဆိုင်ရာ ပြဿနာကို အကြောင်းကြားရန် diff -Nru firefox-54.0~b1+build1/l10n/my/browser/firefox-l10n.js firefox-54.0~b2+build1/l10n/my/browser/firefox-l10n.js --- firefox-54.0~b1+build1/l10n/my/browser/firefox-l10n.js 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/firefox-l10n.js 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#filter substitution + +pref("general.useragent.locale", "@AB_CD@"); diff -Nru firefox-54.0~b1+build1/l10n/my/browser/installer/custom.properties firefox-54.0~b2+build1/l10n/my/browser/installer/custom.properties --- firefox-54.0~b1+build1/l10n/my/browser/installer/custom.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/installer/custom.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,85 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE: + +# This file must be saved as UTF8 + +# Accesskeys are defined by prefixing the letter that is to be used for the +# accesskey with an ampersand (e.g. &). + +# Do not replace $BrandShortName, $BrandFullName, or $BrandFullNameDA with a +# custom string and always use the same one as used by the en-US files. +# $BrandFullNameDA allows the string to contain an ampersand (e.g. DA stands +# for double ampersand) and prevents the letter following the ampersand from +# being used as an accesskey. + +# You can use \n to create a newline in the string but only when the string +# from en-US contains a \n. + +REG_APP_DESC=$BrandShortName တွင်လုံခြုံစိတ်ချ၊လွယ်ကူမြန်ဆန်သောအင်တာနက်အသုံးပြုခြင်းများပါဝင်လာ။ရိုးရှင်းလွယ်ကူသော အသုံးပြုသူအပြင်အဆင်များ၊အွန်လိုင်းမှ အိုင်ဒီသူခိုးများရန်မှကာကွယ်ပေးခြင်းပါဝင်သောလုံခြုံရေးဆိုင်ရာ အဆင့်မြှင့်တင်ခြင်းများ နှင့်အချက်အလက်ရှာဖွေခြင်းဆိုင်ရာအထောက်အပံ့များ. +CONTEXT_OPTIONS=$BrandShortName &Options +CONTEXT_SAFE_MODE=$BrandShortName ဘေးကင်းစနစ် +OPTIONS_PAGE_TITLE=တပ်ဆင်ခြင်းအမျိုးအစား +OPTIONS_PAGE_SUBTITLE=တပ်ဆင်ခြင်းအပြင်အဆင်ရွေးချယ်မည်။ +SHORTCUTS_PAGE_TITLE=တပ်ဆင်ရာတွင်အသုံးပြုရန်လမ်းတိုခလုပ်များ +SHORTCUTS_PAGE_SUBTITLE=ပရိုဂရမ်အိုင်ကွန်အားဖန်တီးမည် +COMPONENTS_PAGE_TITLE=တပ်ဆင်ခြင်း ရွေးချယ်ချက် အစိတ်အပိုင်းများ +COMPONENTS_PAGE_SUBTITLE=ရွေးချယ်ရန်ညွှန်းဆိုထားသောအစိတ်အပိုင်းများ +OPTIONAL_COMPONENTS_DESC=ထိန်းသိမ်းပြုပြင်ခြင်း၀န်ဆောင်မှူသည်သင့်အား $BrandShortName ကိုတိတ်ဆိတ်စွာ အဆင့်မြှင့်တင်နိုင်ပါစေလိမ့်မည်။ +MAINTENANCE_SERVICE_CHECKBOX_DESC=&Maintenance ဝန်ဆောင်မှူအားတပ်ဆင်မည် +SUMMARY_PAGE_TITLE=အကျဉ်းချုပ် +SUMMARY_PAGE_SUBTITLE=$BrandShortName ကို စတင်တပ်ဆင်ရန် အသင့်ဖြစ်နေပါပြီ +SUMMARY_INSTALLED_TO=$BrandShortName အား အောက်ပါတည်နေရာသို့တပ်ဆင်လိုက်မည်ဖြစ်သည် +SUMMARY_REBOOT_REQUIRED_INSTALL=တပ်ဆင်ခြင်းပြီးမြောက်ရန် ကွန်ပျူတာအားပြန်လည်စတင်ရန်လိုအပ်ပါသည်။ +SUMMARY_REBOOT_REQUIRED_UNINSTALL=ပြန်လည်ဖြုတ်ခြင်းပြီးမြောက်စေရန်အတွက် ကွန်ပျူတာအားပြန်လည်စတင်ရန်လိုအပ်နေပါသည်။ +SUMMARY_TAKE_DEFAULTS=$BrandShortName အား &s အမြဲသုံးအင်တာနက်ကြည့်အဖြစ်သုံးမည်။ +SUMMARY_INSTALL_CLICK=ဆက်လက်လုပ်ဆောင်ရန်အတွက် အင်စတောအားနှိပ်ပါ။ +SUMMARY_UPGRADE_CLICK=ဆက်လက်လုပ်ဆောင်ရန်အဆင့်တိုးမြှင့်မည်ကိုနှိပ်ပါ။ +SURVEY_TEXT=$BrandShortName ကို အသုံးပြုရာတွင် သင့်ထင်မြင်ချက်ကို ပြောပြပါ +LAUNCH_TEXT=$BrandShortName ကို ယခုပင် ဖွင့်မည် +CREATE_ICONS_DESC=$BrandShortName: အတွက် အိုင်ကွန်များဖန်တီးမည် +ICONS_DESKTOP=ဒက်စ်တော့ပ်မျက်နှာပြင်ပေါ်တွင် +ICONS_STARTMENU=Start Menu Programs ဖိုင်တွဲထဲတွင်\u0020 +ICONS_QUICKLAUNCH=အမြန်ဖွင့်ဘားတန်းထဲတွင် +WARN_MANUALLY_CLOSE_APP_INSTALL=တပ်ဆင်ခြင်းဆောင်ရွက်ရန် $BrandShortName ကို ပိတ်ထားရပါမည်။\n\nဆက်လက်ဆောင်ရွက်ရန် ကျေးဇူးပြု၍ $BrandShortName ကို ပိတ်ပါ။ +WARN_MANUALLY_CLOSE_APP_UNINSTALL=ဖြုတ်ခြင်းလုပ်ငန်းဆောင်ရွက်ရန် $BrandShortName ကို ပိတ်ထားရပါမည်။\n\nဆက်လက်ဆောင်ရွက်ရန် ကျေးဇူးပြု၍ $BrandShortName ကို ပိတ်ပါ။ +WARN_MANUALLY_CLOSE_APP_LAUNCH=$BrandShortName သည်အလုပ်လုပ်နေပြီးဖြစ်သည်။\n\nကျေးဇူးပြုပြီးသင်ယခုတပ်ဆင်လိုက်သော ဗားရှင်းထက်ရှေးကျသော $BrandShortName အားပိတ်လိုက်ပါ။ +WARN_WRITE_ACCESS=တပ်ဆင်သောနေရာအား အသုံးပြုခွင့်မရပါ။ \n\nကျေးဇူးပြုပြီး OK အားနှိပ်ပြီးအခြားနေရာအားရွေးပါ။ +WARN_DISK_SPACE=သင့်တွင်လုံလောက်သော အကျယ်ပမာဏမရှိပါ။\n\nကျေးဇူးပြုပြီး OK ကိုနှိပ်ပြီးပါကအခြားနေရာအားရွေးပါ။ +WARN_MIN_SUPPORTED_OSVER_MSG=ဝမ်းနည်းပါတယ်၊ $BrandShortName ကို မတပ်ဆင်နိုင်ခဲ့ပါ။ $BrandShortName၏ လက်ရှိဗားရှင်းသည် ${MinSupportedVer} သို့မဟုတ် ဒီထက်မြင့်သည့်ဗားရှင်းကို လိုအပ်ပါသည်။ အခြားဖြည့်စွက်အချက်လက်များအတွက် ကျေးဇူးပြု၍ ကောင်းပြီခလုတ်ကို ကလစ်နှိပ်ပါ။ +WARN_MIN_SUPPORTED_CPU_MSG=ဝမ်းနည်းပါတယ်၊ $BrandShortName ကို မတပ်ဆင်နိုင်ခဲ့ပါ။ $BrandShortName၏ လက်ရှိဗားရှင်းသည် ${MinSupportedCPU} အထောက်အပံ့ပါသော ပရော်ဆက်ဆာကို လိုအပ်ပါသည်။ အခြားဖြည့်စွက်အချက်လက်များအတွက် ကျေးဇူးပြု၍ ကောင်းပြီခလုတ်ကို ကလစ်နှိပ်ပါ။ +WARN_MIN_SUPPORTED_OSVER_CPU_MSG=ဝမ်းနည်းပါတယ်၊ $BrandShortName ကို မတပ်ဆင်နိုင်ခဲ့ပါ။ $BrandShortName ၏ လက်ရှိဗားရှင်းသည် ${MinSupportedVer} သို့မဟုတ် ဒီထက်ပိုမြင့်သောဗားရှင်းနှင့် ${MinSupportedCPU}အထောက်အပံ့ပါသော ပရော်ဆက်ဆာကို လိုအပ်ပါသည်။ အခြားဖြည့်စွက်အချက်အလက်အတွက် ကျေးဇူးပြု၍ ကောင်းပြီခလုတ်ကို နှိပ်ပါ။ +WARN_RESTART_REQUIRED_UNINSTALL=$BrandShortName တပ်ဆင်ခြင်းအလုံးစုံပြီးဆုံးစေရန်ကွန်ပျူတာအားပြန်စရန်လိုအပ်နေပါသည်။သင်အခုချက်ခြင်းလုပ်မည်လား? +WARN_RESTART_REQUIRED_UPGRADE=$BrandShortName အားအဆင့်မြှင့်တင်ရန်အတွက်ကွန်ပျူတာအား ရီဘွတ်ပြန်လုပ်ရန်လိုအပ်ပါသည်။အခုကိုရီဘွတ်ပြုလုပ်ပါမည်လား? +ERROR_CREATE_DIRECTORY_PREFIX=တည်နေရာတည်ဆောက်ရာတွင်ပြသာနာရှိနေသည်၊ +ERROR_CREATE_DIRECTORY_SUFFIX=နောက်ဆုတ်မည်ကိုနှိပ်ကာ တပ်ဆင်ခြင်းကို ရပ်တန့််မည်သို့\nထပ်ကြိုးစားမည်ကိုနှိပ်ကာ ပြန်ပြုလုပ်မည်။ + +UN_CONFIRM_PAGE_TITLE=$BrandFullName ဖြုတ်မည်။ +UN_CONFIRM_PAGE_SUBTITLE=$BrandFullName အား သင့်ကွန်ပျူတာမှဖြုတ်မည်။ +UN_CONFIRM_UNINSTALLED_FROM=$BrandShortName အား အောက်ပါ တည်နေရာမှာဖြုတ်ပစ်မည်ဖြစ်သည်။ +UN_CONFIRM_CLICK=ဆက်လက်လုပ်ဆောင်ရန်ဖြုတ်မည်ကိုနှိပ်ပါ။ + +BANNER_CHECK_EXISTING=တည်ရှိပြီးသားတပ်ဆင်မှုအားစစ်ဆေးမည်။ + +STATUS_INSTALL_APP=$BrandShortName တပ်ဆင်နေပါသည်။ +STATUS_INSTALL_LANG=ဘာသာစကားဖိုင်များအား တပ်ဆင်နေပါသည် (${AB_CD})... +STATUS_UNINSTALL_MAIN=$BrandShortName အားဖြုတ်နေသည်... +STATUS_CLEANUP=ရှင်းလင်းစရာအနည်းငယ်ကို ဆောင်ရွက်နေသည်… + +# _DESC strings support approximately 65 characters per line. +# One line +OPTIONS_SUMMARY=သင်ကြိုက်နှစ်သက်သောတပ်ဆင်ခြင်းအမျိုးအစားကိုရွေးပါ၊ထို့နောက် ရှေ့သို့ အားကလစ်ပါ။ +# One line +OPTION_STANDARD_DESC=$BrandShortName အား အသုံးများသာ အပြင်အဆင်များဖြင့်တပ်ဆင်မည်ဖြစ်သည်။ +OPTION_STANDARD_RADIO=မူလစံအတိုင်း +# Two lines +OPTION_CUSTOM_DESC=သင့်တစ်ကိုယ်ရေ အမြင်အပြင်အဆင်များဖြင့်တပ်ဆင်နိုင်ပါသည်။အတွေ့အကြုံရှိသောသုံးဆွဲသူများကိုရည်ရွယ်ပါသည်။ +OPTION_CUSTOM_RADIO=မိမိစိတ်ကြိုက် + +# LOCALIZATION NOTE: +# The following text replaces the Install button text on the summary page. +# Verify that the access key for InstallBtn (in override.properties) and +# UPGRADE_BUTTON is not already used by SUMMARY_TAKE_DEFAULTS. +UPGRADE_BUTTON=အဆင့်မြှင့်ခြင်း diff -Nru firefox-54.0~b1+build1/l10n/my/browser/installer/mui.properties firefox-54.0~b2+build1/l10n/my/browser/installer/mui.properties --- firefox-54.0~b1+build1/l10n/my/browser/installer/mui.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/installer/mui.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,61 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# To make the l10n tinderboxen see changes to this file you can change a value +# name by adding - to the end of the name followed by chars (e.g. Branding-2). + +# LOCALIZATION NOTE: + +# This file must be saved as UTF8 + +# Accesskeys are defined by prefixing the letter that is to be used for the +# accesskey with an ampersand (e.g. &). + +# Do not replace $BrandShortName, $BrandFullName, or $BrandFullNameDA with a +# custom string and always use the same one as used by the en-US files. +# $BrandFullNameDA allows the string to contain an ampersand (e.g. DA stands +# for double ampersand) and prevents the letter following the ampersand from +# being used as an accesskey. + +# You can use \n to create a newline in the string but only when the string +# from en-US contains a \n. + +MUI_TEXT_WELCOME_INFO_TITLE=$BrandFullNameDA တပ်ဆင်ခြင်းလုပ်ငန်းစဉ်က ကြိုဆိုပါသည် +MUI_TEXT_WELCOME_INFO_TEXT=ဒီလုပ်ငန်းစဉ်သည် $BrandFullNameDA ကို တပ်ဆင်ခြင်းလုပ်ငန်းတစ်လျှောက် သင့်ကို ကူညီလမ်းပြပေးပါမည်။\n\nတပ်ဆင်ခြင်းမစတင်မီ အခြားအက်ပလီကေးရှင်းအားလုံးကို ပိတ်ထားရန် အကြံပြုလိုပါသည်။ သင့်ကွန်ပျူတာကို ပိတ်ပြီးပြန်ဖွင့်ရန်မလိုအပ်စေဘဲ ဆက်စပ်သည့်စနစ်ဖိုင်များကို အဆင့်မြှင့်နိုင်စေပါသည်။\n\n$_CLICK +MUI_TEXT_COMPONENTS_TITLE=အစိတ်အပိုင်းများကို ရွေးချယ်ပါ +MUI_TEXT_COMPONENTS_SUBTITLE=$BrandFullNameDA ၏ တပ်ဆင်လိုသည့် လုပ်ဆောင်ချက်များကို ရွေးပါ။ +MUI_INNERTEXT_COMPONENTS_DESCRIPTION_TITLE=ဖေါ်ပြချက် +MUI_INNERTEXT_COMPONENTS_DESCRIPTION_INFO=အစိတ်အပိုင်း၏ဖော်ပြချက်ကို ဖတ်ရှုရန် မောက်စ်ကို ၎င်းအစိတ်အပိုင်းပေါ်သို့ ရွှေ့တင်ပါ။ +MUI_TEXT_DIRECTORY_TITLE=တပ်ဆင်လိုသည့် တည်နေရာကို ရွေးချယ်ပါ +MUI_TEXT_DIRECTORY_SUBTITLE=$BrandFullNameDA ကို တပ်ဆင်ထားလိုသည့် ဖိုင်တွဲကို ရွေးပါ။ +MUI_TEXT_INSTALLING_TITLE=တပ်ဆင်နေသည် +MUI_TEXT_INSTALLING_SUBTITLE=ကျေးဇူးပြု၍ $BrandFullNameDA ကို တပ်ဆင်နေစဉ် ခေတ္တစောင့်ဆိုင်းပါ။ +MUI_TEXT_FINISH_TITLE=တပ်ဆင်မှု ပြီးစီးပါပြီ +MUI_TEXT_FINISH_SUBTITLE=တပ်ဆင်မှု အောင်မြင်စွာ ပြီးဆုံးပါပြီ။ +MUI_TEXT_ABORT_TITLE=တပ်ဆင်မှုကို ဖျက်သိမ်းလိုက်သည် +MUI_TEXT_ABORT_SUBTITLE=တပ်ဆင်မှု မအောင်ခဲ့ပါ။ +MUI_BUTTONTEXT_FINISH=ပြီးဆုံးပါပြီ +MUI_TEXT_FINISH_INFO_TITLE=$BrandFullNameDA တပ်ဆင်ခြင်းလုပ်ငန်းစဉ်ကို ပြီးစီးသည်အထိ ဆောင်ရွက်နေသည် +MUI_TEXT_FINISH_INFO_TEXT=$BrandFullNameDA ကို သင့်ကွန်ပျူတာတွင် တပ်ဆင်ပြီးပါပြီ။\n\nဒီလုပ်ငန်းစဉ်ကို ပိတ်ရန် ပြီးဆုံးပါပြီကို နှိပ်ပါ။ +MUI_TEXT_FINISH_INFO_REBOOT=$BrandFullNameDA တပ်ဆင်ခြင်းကို ပြီးစီးစေရန် သင့်ကွန်ပျူတာကို ပိတ်ပြီးပြန်ဖွင့်ရန် လိုအပ်ပါသည်။ ယခုပင် ပိတ်ပြီးပြန်ဖွင့်လိုပါသလား။ +MUI_TEXT_FINISH_REBOOTNOW=ယခုပင် စက်ပိတ်ပြီးပြန်ဖွင့်ပါ +MUI_TEXT_FINISH_REBOOTLATER=နောက်မှ ကိုယ်တိုင် စက်ပိတ်ပြီးပြန်ဖွင့်ချင်ပါသည် +MUI_TEXT_STARTMENU_TITLE=အစမီနူးဖိုင်တွဲကို ရွေးချယ်ပါ +MUI_TEXT_STARTMENU_SUBTITLE=$BrandFullNameDA အမြန်သုံးအတွက် အစပြုမီနူးဖိုင်တွဲကို ရွေးပါ။ +MUI_INNERTEXT_STARTMENU_TOP=ပရိုဂရမ်ဖြတ်လမ်းအသုံးပြုခလုပ်ထားရင်အစမီနူးဖိုဒါကိုရွေးပါ။ဖိုဒါတစ်ခုတည်ဆောက်ပြီးထားရန်အတွက်လဲ နာမည်တစ်ခုထည့်ပေးနိုင်ပါသည်။ +MUI_TEXT_ABORTWARNING=သင် $BrandFullName တပ်ဆင်ခြင်းအားထွက်မည်မှာသေချာပြီလား။ +MUI_UNTEXT_WELCOME_INFO_TITLE=$BrandFullNameDA ကို ဖြုတ်သည့်လုပ်ငန်းစဉ်က ကြိုဆိုပါသည် +MUI_UNTEXT_WELCOME_INFO_TEXT=ဒီလုပ်ငန်းစဉ်သည် $BrandFullNameDA ကို ဖြုတ်သည့်လုပ်ငန်းတစ်လျှောက် သင့်ကို ကူညီလမ်းပြပါမည်။\n\nဖြုတ်သည့်လုပ်ငန်းစဉ် မစတင်မီ $BrandFullNameDA ကို ဖွင့်ထားခြင်း ရှိ/မရှိ စစ်ဆေးပါ။\n\n$_CLICK +MUI_UNTEXT_CONFIRM_TITLE=$BrandFullNameDA ကို ဖြုတ်ပါမည် +MUI_UNTEXT_CONFIRM_SUBTITLE=$BrandFullNameDA ကို သင့်ကွန်ပျူတာမှ ဖယ်ရှားပါမည်။ +MUI_UNTEXT_UNINSTALLING_TITLE=ဖြုတ်နေပါသည် +MUI_UNTEXT_UNINSTALLING_SUBTITLE=$BrandFullNameDA ကို ဖယ်ရှားနေစဉ် ကျေးဇူးပြု၍ ခေတ္တစောင့်ဆိုင်းပေးပါ။ +MUI_UNTEXT_FINISH_TITLE=ဖြုတ်သည့်လုပ်ငန်း ပြီးစီးပါပြီ +MUI_UNTEXT_FINISH_SUBTITLE=ဖြုတ်သည့်လုပ်ငန်း အောင်မြင်စွာ ပြီးစီးခဲ့သည်။ +MUI_UNTEXT_ABORT_TITLE=ဖြုတ်သည့်လုပ်ငန်းကို ဖျက်သိမ်းလိုက်သည် +MUI_UNTEXT_ABORT_SUBTITLE=ဖြုတ်သည့်လုပ်ငန်းစဉ် မအောင်မြင်ခဲ့ပါ။ +MUI_UNTEXT_FINISH_INFO_TITLE=$BrandFullNameDA ကို ဖြုတ်သည့်လုပ်ငန်းစဉ် ပြီးစီးသည်အထိ ဆောင်ရွက်နေသည် +MUI_UNTEXT_FINISH_INFO_TEXT=$BrandFullNameDA ကို သင့်ကွန်ပျူတာမှ ဖယ်ရှားပြီးပါပြီ။\n\nဒီလုပ်ငန်းစဉ်ကို ပိတ်ရန် ပြီးဆုံးပါပြီကို နှိပ်ပါ။ +MUI_UNTEXT_FINISH_INFO_REBOOT=$BrandFullNameDA ဖြုတ်ပစ်ခြင်းအားလုံး၀ပြီးမြောက်စေရန်အတွက် သင့်ကွန်ပျူတာအားရီဘွတ်ပြန်လုပ်ရန်လိုအပ်နေပါသည်။သင်ယခုလုပ်ပါမည်လား? +MUI_UNTEXT_ABORTWARNING=$BrandFullName ဖြုတ်ပစ်ခြင်းမှထွက်ပစ်မည်မှာသေချာပြီလား? diff -Nru firefox-54.0~b1+build1/l10n/my/browser/installer/nsisstrings.properties firefox-54.0~b2+build1/l10n/my/browser/installer/nsisstrings.properties --- firefox-54.0~b1+build1/l10n/my/browser/installer/nsisstrings.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/installer/nsisstrings.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,67 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE: + +# This file must be saved as UTF8 + +# Accesskeys are defined by prefixing the letter that is to be used for the +# accesskey with an ampersand (e.g. &). + +# Do not replace $BrandShortName, $BrandFullName, or $BrandFullNameDA with a +# custom string and always use the same one as used by the en-US files. +# $BrandFullNameDA allows the string to contain an ampersand (e.g. DA stands +# for double ampersand) and prevents the letter following the ampersand from +# being used as an accesskey. + +# You can use \n to create a newline in the string but only when the string +# from en-US contains a \n. + +WIN_CAPTION=$BrandShortName ကို တပ်ဆင်ခြင်း + +INTRO_BLURB1=အခြားဘယောက်ဆာများထဲမှာ $BrandFullName အားရွေးချယ်ခြင်းကို အထူးကျေးဇူးတင်ပါတယ်။ +INSTALL_BLURB1=သင်သည် မြန်ဆန်တိကျပြုပြင်လွယ်ပြီး လုံခြုံမှုအပိုင်းတွင် ထိန်းချုပ်မှုပြည့်၀စွာ နောက်ဆုံးပေါ်နည်းပညာများကို ပျော်ရွှင်စွာအသုံးပြုနိုင်ပါသည်။ +INSTALL_BLURB2=အဘယ်ကြောင့်ဆိုသော်$BrandShortName သည်အကျိုးအမြတ်ယူပဲ သင့်အတွက် Internet အသုံးပြုမှုကို အကောင်းဆုံးဝန်ဆောင်မှုပေးပါသည်။ +INSTALL_BLURB3=သင်သည် အသုံးပြုသူများ ၊ ထောက်ပံ့သူများ၊Developer များ မှ ကမ္ဘာပေါ်တွင်အကောင်းဆုံး Browser ဖြစ်ရန် ကြိုးစားနေသော ကမ္ဘာလုံးဆိုင်ရာ ချိတ်ဆက်မှုတွင် ပါဝင်နိုင်ပါသည်။ + +WARN_MIN_SUPPORTED_OSVER_MSG=ဝမ်းနည်းပါတယ်၊ $BrandShortName ကို မတပ်ဆင်နိုင်ခဲ့ပါ။ $BrandShortName၏ လက်ရှိဗားရှင်းသည် ${MinSupportedVer} သို့မဟုတ် ဒီထက်မြင့်သည့်ဗားရှင်းကို လိုအပ်ပါသည်။ အခြားဖြည့်စွက်အချက်လက်များအတွက် ကျေးဇူးပြု၍ ကောင်းပြီခလုတ်ကို ကလစ်နှိပ်ပါ။ +WARN_MIN_SUPPORTED_CPU_MSG=ဝမ်းနည်းပါတယ်၊ $BrandShortName ကို မတပ်ဆင်နိုင်ခဲ့ပါ။ $BrandShortName၏ လက်ရှိဗားရှင်းသည် ${MinSupportedCPU} အထောက်အပံ့ပါသော ပရော်ဆက်ဆာကို လိုအပ်ပါသည်။ အခြားဖြည့်စွက်အချက်လက်များအတွက် ကျေးဇူးပြု၍ ကောင်းပြီခလုတ်ကို ကလစ်နှိပ်ပါ။ +WARN_MIN_SUPPORTED_OSVER_CPU_MSG=ဝမ်းနည်းပါတယ်၊ $BrandShortName ကို မတပ်ဆင်နိုင်ခဲ့ပါ။ $BrandShortName ၏ လက်ရှိဗားရှင်းသည် ${MinSupportedVer} သို့မဟုတ် ဒီထက်ပိုမြင့်သောဗားရှင်းနှင့် ${MinSupportedCPU}အထောက်အပံ့ပါသော ပရော်ဆက်ဆာကို လိုအပ်ပါသည်။ အခြားဖြည့်စွက်အချက်အလက်အတွက် ကျေးဇူးပြု၍ ကောင်းပြီခလုတ်ကို နှိပ်ပါ။ +WARN_WRITE_ACCESS=တပ်ဆင်သည့်လမ်းကြောင်းကို အသုံးပြုခွင့် သင့်မှာမရှိပါ။\n\nအခြားလမ်းကြောင်းကို ရွေးချယ်ရန် ကောင်းပြီကို နှိပ်ပါ။ +WARN_DISK_SPACE=ဒီနေရာတွင် တပ်ဆင်ရန် လုံလောက်သောနေရာလွတ် မရှိပါ။\n\nအခြားနေရာကို ရွေးချယ်ရန် ကောင်းပြီကို နှိပ်ပါ။ +WARN_ROOT_INSTALL=သင့်ကွန်ပျူတာဟတ်ဒ်ဒစ်စ်၏ ဦးဆုံးလမ်းကြောင်းအောက်တွင် မထည့်သွင်းနိုင်ပါ။\n\nအခြားတစ်နေရာကို ရွေးရန် ကျေးဇူးပြု၍ ကောင်းပြီကို နှိပ်ပါ။ +WARN_MANUALLY_CLOSE_APP_LAUNCH=$BrandShortName သည်အလုပ်လုပ်နေပြီးဖြစ်သည်။\n\nကျေးဇူးပြုပြီးသင်ယခုတပ်ဆင်လိုက်သော ဗားရှင်းထက်ရှေးကျသော $BrandShortName အားပိတ်လိုက်ပါ။ + +ERROR_DOWNLOAD=သင့်ကူးယူမှသည် နှောက်ယှက်ခံရပါသည်။\n\nကျေးဇူးပြု၍ ဆက်လက်ရန် Ok ခလုပ်ကိုနှိပ်ပေးပါ။ + +INSTALL_BUTTON=တပ်ဆင်ရန် +UPGRADE_BUTTON=အဆင့်မြှင့်ရန် +CANCEL_BUTTON=မလုပ်ဆောင်တော့ပါ +OPTIONS_BUTTON=ရွေးစရာများ + +MAKE_DEFAULT=$BrandShortName ကို အမြဲသုံးဘရောက်ဇာအနေနဲ့ ထားပါ +ADD_SC_DESKTOP_TASKBAR=$BrandShortName အတွက် ဒက်စတော့နှင့် တက်စ်ဘား အမြန်သုံးလင့်များကို ဖန်တီးပါ +ADD_SC_DESKTOP_QUICKLAUNCHBAR=$BrandShortName အတွက် ဒက်စတော့နှင့် အမြန်ဖွင့် အမြန်သုံးလင့်များကို ဖန်တီးပါ +VERSION_32BIT=32-bit $BrandShortName +VERSION_64BIT=64-bit $BrandShortName +ARCH_DROPLIST_LABEL=&Version ကို တပ်ဆင်ရန် +SPACE_REQUIRED=လိုအပ်သော နေရာလွတ်ပမာဏ။: +SPACE_AVAILABLE=အသုံးပြုနိုင်သော နေရာလွတ်ပမာဏ။: +ONE_MOMENT_INSTALL=အချိန်အနည်းအတွင်းတွင် $BrandShortName အား ထည့်သွင်းမှ အလုံးစုံပြီးဆုံးသွားပါက မကြာမီ အသုံးပြုနိုင်ပါသည်။ +ONE_MOMENT_UPGRADE=ခေတ္တစောင့်ပါ၊ $BrandShortName ကို အဆင့်မြှင့်ခြင်း ပြီးဆုံးသည်နှင့် ၎င်းကို ဖွင့်ပါမည်… +INSTALL_MAINT_SERVICE=နောက်ကွယ်အဆင့်မြှင့်ခြင်းလုပ်ငန်း $BrandShortName ကို တပ်ဆင်ရန် +SEND_PING=ဒီတပ်ဆင်မှုအချက်အလက်များကို မော်ဇီလာသို့ ပေးပို့မည် +BROWSE_BUTTON=ရှာဖွင့်ရန်… +DEST_FOLDER=တပ်ဆင်လိုသည့် ဖိုင်တွဲလမ်းကြောင်း + +DOWNLOADING_LABEL=$BrandShortName ကို ဒေါင်းလုဒ်ပြုလုပ်နေသည်… +INSTALLING_LABEL=$BrandShortName ကို တပ်ဆင်နေပါသည်… +UPGRADING_LABEL=$BrandShortName ကို အဆင့်မြှင့်နေပါသည်… + +SELECT_FOLDER_TEXT=$BrandShortName ကို တပ်ဆင်မဲ့ ဖိုင်တွဲကို ရွေးချယ်ရန် - + +BYTE=B +KILO=K +MEGA=M +GIGA=G diff -Nru firefox-54.0~b1+build1/l10n/my/browser/installer/override.properties firefox-54.0~b2+build1/l10n/my/browser/installer/override.properties --- firefox-54.0~b1+build1/l10n/my/browser/installer/override.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/installer/override.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,86 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE: + +# This file must be saved as UTF8 + +# Accesskeys are defined by prefixing the letter that is to be used for the +# accesskey with an ampersand (e.g. &). + +# Do not replace $BrandShortName, $BrandFullName, or $BrandFullNameDA with a +# custom string and always use the same one as used by the en-US files. +# $BrandFullNameDA allows the string to contain an ampersand (e.g. DA stands +# for double ampersand) and prevents the letter following the ampersand from +# being used as an accesskey. + +# You can use \n to create a newline in the string but only when the string +# from en-US contains a \n. + +# Strings that require a space at the end should be enclosed with double +# quotes and the double quotes will be removed. To add quotes to the beginning +# and end of a strong enclose the add and additional double quote to the +# beginning and end of the string (e.g. ""This will include quotes""). + +SetupCaption=$BrandFullName တပ်ဆင်ခြင်း +UninstallCaption=$BrandFullName ဖယ်ရှားခြင်း +BackBtn=< နောက်သို့ +NextBtn=ရှေ့သို့ > +AcceptBtn=လိုင်စင်သဘောတူညီချက်တွင် ဖော်ပြထားသည့် စကားရပ်များကို သဘောတူပါသည် +DontAcceptBtn=လိုင်စင်သဘောတူညီချက်တွင် ဖော်ပြထားသည့် စကားရပ်များကို သဘောမတူပါ +InstallBtn=တပ်ဆင်ပါ +UninstallBtn=ဖြုတ်ပါ +CancelBtn=မလုပ်ဆောင်တော့ပါ +CloseBtn=ပိတ်ရန် +BrowseBtn=ရှာဖွင့်ရန်… +ShowDetailsBtn=အသေးစိတ်များကို ပြပါ +ClickNext=ဆက်လက်ဆောင်ရွက်ရန် ရှေ့သို့ကို နှိပ်ပါ။ +ClickInstall=ထည့်သွင်းတပ်ဆင်မှုကို စတင်ရန် တပ်ဆင်ပါကို နှိပ်ပါ။ +ClickUninstall=ဖယ်ရှားခြင်း စတင်ရန် ဖြုတ်ပါကို နှိပ်ပါ။ +Completed=ပြီးစီးပါပြီ +LicenseTextRB=$BrandFullNameDA တပ်ဆင်ခြင်းမပြု မှီ လိုင်စင် လက်ခံသဘောတူညီချက် အားကျေးဇူးပြုပြီးဖတ်ပေးပါရန်။ အကယ်လို့သင်သည် သဘောတူညီချက်အားလုံးအားလက်ခံပါက အောက်တွင်ရှိသော ရွေးချက်ချက်အားရွေးပေးပါရန်။ $_CLICK +ComponentsText=သင်တပ်ဆင်ခြင်းတွင်ပါဝင်လိုသော အစိတ်အပိုင်းများ အားရွေးချယ်ပြီး မလိုအပ်သည်များကို ဖယ်ထားခဲ့ပေးပါ။ $_CLICK +ComponentsSubText2_NoInstTypes=တပ်ဆင်မဲ့ အစိတ်အပိုင်းများကို ရွေးချယ်ရန် - +DirText=$BrandFullNameDA အားအောက်တွင်ဖော်ပြထားသော်ဖိုလ်ဒါ ထဲတွင်တပ်ဆင်လိမ့်မည်ဖြစ်သည်။အခြားဖိုလ်ဒါအများ အောက်တွင်တပ်ဆင်လိုပါက ဖိုင်ရှာမည် ကို တစ်ချက်နှိပ်ပြီး အခြားဖိုလ်ဒါတစ်ခုရွေးပေးပါ။ $_CLICK +DirSubText=တပ်ဆင်လိုသည့် ဖိုင်တွဲလမ်းကြောင်း +DirBrowseText=$BrandFullNameDA ကို တပ်ဆင်မဲ့ ဖိုင်တွဲကို ရွေးချယ်ရန် - +SpaceAvailable="အသုံးပြုနိုင်သော နေရာလွတ်ပမာဏ။:" +SpaceRequired="လိုအပ်သော နေရာလွတ်ပမာဏ။:" +UninstallingText=$BrandFullNameDA ကို အောက်ပါ ဖိုင်တွဲထဲမှ ဖယ်ရှားသွားလိမ့်မယ်။ $_CLICK +UninstallingSubText=ဖယ်ရှားတဲ့ နေရာ - +FileError=ဖိုင်အားရေးသားရန်ဖွင့်စဉ်မှားယွင်းမှူ ၊ \r\n\r\n$0\r\n\r\nရပ်တန့်လိုက်မည် ကိုနှိပ်ပြီး တပ်ဆင်ခြင်းအားရပ်တန့်မည်၊\r\nပြန်လည်စတင်မည် ကိုနှိပ်ပြီးတင်ဆင်ခြင်းပြန်လုပ်မည် ၊\r\nဥပက္ခာပြုမည် ကိုနှိပ်ပြီးအဆိုပါဖိုင်အားကျော်သွားမည် +FileError_NoIgnore=ဖိုင်အားရေးသားရန်ဖွင့်စဉ်မှားယွင်းမှူ၊ \r\n\r\n$0\r\n\r\n ပြန်လည်စတင်မည် ကိုနှိပ်ပြီးတပ်ဆင်ခြင်းအားပြန်စမည်၊ သို့မဟုတ် \r\n မလုပ်တော့ အား နှိပ်ပြီး တပ်ဆင်ခြင်းအားရပ်တန့်မည်။ +CantWrite="ရေးလို့မရပါ။:" +CopyFailed=ကူးယူမှု မအောင်မြင်ခဲ့ပါ +CopyTo="သို့ ကူးယူပါ" +Registering="စာရင်းသွင်းနေသည်။: " +Unregistering="စာရင်းသွင်းထားခြင်းမှ ပယ်ဖျက်နေသည်။: " +SymbolNotFound="သ​င်္ကေတကို ရှာမတွေ့ပါ။: " +CouldNotLoad="ဖွင့်လို့မရပါ။: " +CreateFolder="ဖိုင်တွဲကို ဖန်တီးရန်။: " +CreateShortcut="ဖိုင်ဖြတ်လမ်း ဖန်တီးရန် - " +CreatedUninstaller="ဆော့ဗ်ဝဲ ဖယ်ရှားကိရိယာ ဖန်တီးချက် - " +Delete="ဖိုင် ပယ်ဖျက်ရန် - " +DeleteOnReboot="စက်ပြန်ဖွင့်ပြီးပယ်ဖျက်ရန်-" +ErrorCreatingShortcut="ဖိုင်ဖြတ်လမ်း ဖန်တီးမှု မှားယွင်းနေတယ် - " +ErrorCreating="မှားယွင်းမှု ဖြစ်ပေါ်နေတယ် - " +ErrorDecompressing=ဒေတာ ဖြည်ချမှု မှားယွင်းနေတယ်။ အင်​စတော်လာ ချို့ယွင်းနေသလား။ +ErrorRegistering=DLL စာရင်းသွင်းချက် မှားယွင်းနေတယ် +ExecShell="ExecShell: " +Exec="စီမံလုပ်ဆောင်ရန် - " +Extract="ထုတ်ယူရန် - " +ErrorWriting="ဖြည်ချရန် - ဖိုင်ရေးသားမှု မှားယွင်းနေတယ်" +InvalidOpcode=အင်စတော်လာ အဟန့်အထား ခံရတယ် - opcode မှားယွင်းနေတယ် +NoOLE="OLE မရှိပါ - " +OutputFolder="ရလဒ် ဖိုင်တွဲ - " +RemoveFolder="ဖိုဒါအားဖယ်ရှားပစ်ပါ- " +RenameOnReboot="စက်ပြန်ဖွင့်ပြီး နာမည်ပြောင်းရန် - " +Rename="နာမည်ပြောင်းရန် - " +Skipped="ကျော်သွားရန် - " +CopyDetails=အသေးစိတ်များကို ဂလစ်ဘော့ဒ်ဖြင့် ကော်ပီယူရန် +LogInstall=တပ်ဆင်မှု လုပ်ငန်းစဉ်ကို မှတ်တမ်းတင်ရန် +Byte=B +Kilo=K +Mega=M +Giga=G diff -Nru firefox-54.0~b1+build1/l10n/my/browser/pdfviewer/chrome.properties firefox-54.0~b2+build1/l10n/my/browser/pdfviewer/chrome.properties --- firefox-54.0~b1+build1/l10n/my/browser/pdfviewer/chrome.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/pdfviewer/chrome.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,19 @@ +# Copyright 2012 Mozilla Foundation +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + +# Chrome notification bar messages and buttons +unsupported_feature=ယခု PDF ဖိုင်အား ကောင်းစွာ ပြသနိုင်မည်မဟုတ် ။ +unsupported_feature_forms=ဤ PDF ဖိုင်တွင် Form များပါဝင်ပါသှ် ။ Form တွေဖြည့်ခြင်းအား ထောက်ပံ့မထားသေးပါ +open_with_different_viewer=တခြားမြင်ကွင်း နဲ့ဖွင့်ပါ +open_with_different_viewer.accessKey=o diff -Nru firefox-54.0~b1+build1/l10n/my/browser/pdfviewer/viewer.properties firefox-54.0~b2+build1/l10n/my/browser/pdfviewer/viewer.properties --- firefox-54.0~b1+build1/l10n/my/browser/pdfviewer/viewer.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/pdfviewer/viewer.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,183 @@ +# Copyright 2012 Mozilla Foundation +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + +# Main toolbar buttons (tooltips and alt text for images) +previous.title=အရင် စာမျက်နှာ +previous_label=အရင်နေရာ +next.title=ရှေ့ စာမျက်နှာ +next_label=နောက်တခု + +# LOCALIZATION NOTE (page.title): The tooltip for the pageNumber input. +page.title=စာမျက်နှာ +# LOCALIZATION NOTE (of_pages): "{{pagesCount}}" will be replaced by a number +# representing the total number of pages in the document. +of_pages={{pagesCount}} ၏ +# LOCALIZATION NOTE (page_of_pages): "{{pageNumber}}" and "{{pagesCount}}" +# will be replaced by a number representing the currently visible page, +# respectively a number representing the total number of pages in the document. +page_of_pages=({{pagesCount}} ၏ {{pageNumber}}) + +zoom_out.title=ချုံ့ပါ +zoom_out_label=ချုံ့ပါ +zoom_in.title=ချဲ့ပါ +zoom_in_label=ချဲ့ပါ +zoom.title=ချုံ့/ချဲ့ပါ +presentation_mode.title=ဆွေးနွေးတင်ပြစနစ်သို့ ကူးပြောင်းပါ +presentation_mode_label=ဆွေးနွေးတင်ပြစနစ် +open_file.title=ဖိုင်အားဖွင့်ပါ။ +open_file_label=ဖွင့်ပါ +print.title=ပုံနှိုပ်ပါ +print_label=ပုံနှိုပ်ပါ +download.title=ကူးဆွဲ +download_label=ကူးဆွဲ +bookmark.title=လက်ရှိ မြင်ကွင်း (ဝင်းဒိုးအသစ်မှာ ကူးပါ သို့မဟုတ် ဖွင့်ပါ) +bookmark_label=လက်ရှိ မြင်ကွင်း + +# Secondary toolbar and context menu +tools.title=ကိရိယာများ +tools_label=ကိရိယာများ +first_page.title=ပထမ စာမျက်နှာသို့ +first_page.label=ပထမ စာမျက်နှာသို့ +first_page_label=ပထမ စာမျက်နှာသို့ +last_page.title=နောက်ဆုံး စာမျက်နှာသို့ +last_page.label=နောက်ဆုံး စာမျက်နှာသို့ +last_page_label=နောက်ဆုံး စာမျက်နှာသို့ +page_rotate_cw.title=နာရီလက်တံ အတိုင်း +page_rotate_cw.label=နာရီလက်တံ အတိုင်း +page_rotate_cw_label=နာရီလက်တံ အတိုင်း +page_rotate_ccw.title=နာရီလက်တံ ပြောင်းပြန် +page_rotate_ccw.label=နာရီလက်တံ ပြောင်းပြန် +page_rotate_ccw_label=နာရီလက်တံ ပြောင်းပြန် + +hand_tool_enable.title=လက်ကိုင် ကိရိယာအားသုံး +hand_tool_enable_label=လက်ကိုင် ကိရိယာဖွင့် +hand_tool_disable.title=လက်ကိုင် ကိရိယာအားပိတ် +hand_tool_disable_label=လက်ကိုင်ကိရိယာ အားပိတ် + +# Document properties dialog box +document_properties.title=မှတ်တမ်းမှတ်ရာ ဂုဏ်သတ္တိများ +document_properties_label=မှတ်တမ်းမှတ်ရာ ဂုဏ်သတ္တိများ +document_properties_file_name=ဖိုင် : +document_properties_file_size=ဖိုင်ဆိုဒ် : +# LOCALIZATION NOTE (document_properties_kb): "{{size_kb}}" and "{{size_b}}" +# will be replaced by the PDF file size in kilobytes, respectively in bytes. +document_properties_kb={{size_kb}} ကီလိုဘိုတ် ({size_kb}}ဘိုတ်) +# LOCALIZATION NOTE (document_properties_mb): "{{size_mb}}" and "{{size_b}}" +# will be replaced by the PDF file size in megabytes, respectively in bytes. +document_properties_mb={{size_mb}} MB ({{size_b}} bytes) +document_properties_title=ခေါင်းစဉ်‌ - +document_properties_author=ရေးသားသူ: +document_properties_subject=အကြောင်းအရာ:\u0020 +document_properties_keywords=သော့ချက် စာလုံး: +document_properties_creation_date=ထုတ်လုပ်ရက်စွဲ: +document_properties_modification_date=ပြင်ဆင်ရက်စွဲ: +# LOCALIZATION NOTE (document_properties_date_string): "{{date}}" and "{{time}}" +# will be replaced by the creation/modification date, and time, of the PDF file. +document_properties_date_string={{date}}, {{time}} +document_properties_creator=ဖန်တီးသူ: +document_properties_producer=PDF ထုတ်လုပ်သူ: +document_properties_version=PDF ဗားရှင်း: +document_properties_page_count=စာမျက်နှာအရေအတွက်: +document_properties_close=ပိတ် + +print_progress_message=Preparing document for printing… +# LOCALIZATION NOTE (print_progress_percent): "{{progress}}" will be replaced by +# a numerical per cent value. +print_progress_percent={{progress}}% +print_progress_close=ပယ်​ဖျက်ပါ + +# Tooltips and alt text for side panel toolbar buttons +# (the _label strings are alt text for the buttons, the .title strings are +# tooltips) +toggle_sidebar.title=ဘေးတန်းဖွင့်ပိတ် +toggle_sidebar_notification.title=ဘေးဘားတန်းကို အဖွင့်/အပိတ် လုပ်ရန် (စာတမ်းတွင် outline/attachments ပါဝင်နိုင်သည်) +toggle_sidebar_label=ဖွင့်ပိတ် ဆလိုက်ဒါ +document_outline.title=စာတမ်းအကျဉ်းချုပ်ကို ပြပါ (စာရင်းအားလုံးကို ချုံ့/ချဲ့ရန် ကလစ်နှစ်ချက်နှိပ်ပါ) +document_outline_label=စာတမ်းအကျဉ်းချုပ် +attachments.title=တွဲချက်များ ပြပါ +attachments_label=တွဲထားချက်များ +thumbs.title=ပုံရိပ်ငယ်များကို ပြပါ +thumbs_label=ပုံရိပ်ငယ်များ +findbar.title=Find in Document +findbar_label=ရှာဖွေပါ + +# Thumbnails panel item (tooltip and alt text for images) +# LOCALIZATION NOTE (thumb_page_title): "{{page}}" will be replaced by the page +# number. +thumb_page_title=စာမျက်နှာ {{page}} +# LOCALIZATION NOTE (thumb_page_canvas): "{{page}}" will be replaced by the page +# number. +thumb_page_canvas=စာမျက်နှာရဲ့ ပုံရိပ်ငယ် {{page}} + +# Find panel button title and messages +find_label=ရှာဖွေပါ - +find_previous.title=စကားစုရဲ့ အရင် ​ဖြစ်ပွားမှုကို ရှာဖွေပါ +find_previous_label=နောက်သို့ +find_next.title=စကားစုရဲ့ နောက်ထပ် ​ဖြစ်ပွားမှုကို ရှာဖွေပါ +find_next_label=ရှေ့သို့ +find_highlight=အားလုံးကို မျဉ်းသားပါ +find_match_case_label=စာလုံး တိုက်ဆိုင်ပါ +find_reached_top=စာမျက်နှာထိပ် ရောက်နေပြီ၊ အဆုံးကနေ ပြန်စပါ +find_reached_bottom=စာမျက်နှာအဆုံး ရောက်နေပြီ၊ ထိပ်ကနေ ပြန်စပါ +find_not_found=စကားစု မတွေ့ရဘူး + +# Error panel labels +error_more_info=နောက်ထပ်အချက်အလက်များ +error_less_info=အနည်းငယ်မျှသော သတင်းအချက်အလက် +error_close=ပိတ် +# LOCALIZATION NOTE (error_version_info): "{{version}}" and "{{build}}" will be +# replaced by the PDF.JS version and build ID. +error_version_info=PDF.js v{{version}} (build: {{build}}) +# LOCALIZATION NOTE (error_message): "{{message}}" will be replaced by an +# english string describing the error. +error_message=မက်ဆေ့ - {{message}} +# LOCALIZATION NOTE (error_stack): "{{stack}}" will be replaced with a stack +# trace. +error_stack=အထပ် - {{stack}} +# LOCALIZATION NOTE (error_file): "{{file}}" will be replaced with a filename +error_file=ဖိုင် {{file}} +# LOCALIZATION NOTE (error_line): "{{line}}" will be replaced with a line number +error_line=လိုင်း - {{line}} +rendering_error=စာမျက်နှာကို ပုံဖော်နေချိန်မှာ အမှားတစ်ခုတွေ့ရပါတယ်။ + +# Predefined zoom values +page_scale_width=စာမျက်နှာ အကျယ် +page_scale_fit=စာမျက်နှာ ကွက်တိ +page_scale_auto=အလိုအလျောက် ချုံ့ချဲ့ +page_scale_actual=အမှန်တကယ်ရှိတဲ့ အရွယ် +# LOCALIZATION NOTE (page_scale_percent): "{{scale}}" will be replaced by a +# numerical scale value. +page_scale_percent={{scale}}% + +# Loading indicator messages +loading_error_indicator=အမှား +loading_error=PDF ဖိုင် ကိုဆွဲတင်နေချိန်မှာ အမှားတစ်ခုတွေ့ရပါတယ်။ +invalid_file_error=မရသော သို့ ပျက်နေသော PDF ဖိုင် +missing_file_error=PDF ပျောက်ဆုံး +unexpected_response_error=မမျှော်လင့်ထားသော ဆာဗာမှ ပြန်ကြားချက် + +# LOCALIZATION NOTE (text_annotation_type.alt): This is used as a tooltip. +# "{{type}}" will be replaced with an annotation type from a list defined in +# the PDF spec (32000-1:2008 Table 169 – Annotation types). +# Some common types are e.g.: "Check", "Text", "Comment", "Note" +text_annotation_type.alt=[{{type}} အဓိပ္ပာယ်ဖွင့်ဆိုချက်] +password_label=PDF အားဖွင့်ရန် ပတ်စ်ဝတ်အားထည့်ပါ +password_invalid=စာဝှက် မှားသည်။ ထပ်ကြိုးစားကြည့်ပါ။ +password_ok=OK +password_cancel=ပယ်​ဖျက်ပါ + +printing_not_supported=သတိပေးချက်၊ပရင့်ထုတ်ခြင်းကိုဤဘယောက်ဆာသည် ပြည့်ဝစွာထောက်ပံ့မထားပါ ။ +printing_not_ready=သတိပေးချက်: ယခု PDF ဖိုင်သည် ပုံနှိပ်ရန် မပြည့်စုံပါ +web_fonts_disabled=Web fonts are disabled: unable to use embedded PDF fonts. +document_colors_not_allowed=PDF ဖိုင်အား ၎င်းဤ ကိုယ်ပိုင်အရောင်များကို အသုံးပြုခွင့်မပေးထားပါ ။ 'စာမျက်နှာအားလုံးအားအရောင်ရွေးချယ်ခွင့်' အား ယခု ဘယောက်ဆာတွင် ပိတ်ထားခြင်းကြောင့်ဖြစ် သှ် diff -Nru firefox-54.0~b1+build1/l10n/my/browser/profile/bookmarks.inc firefox-54.0~b2+build1/l10n/my/browser/profile/bookmarks.inc --- firefox-54.0~b1+build1/l10n/my/browser/profile/bookmarks.inc 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/profile/bookmarks.inc 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,72 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. +#filter emptyLines + +# LOCALIZATION NOTE: The 'en-US' strings in the URLs will be replaced with +# your locale code, and link to your translated pages as soon as they're +# live. + +#define bookmarks_title မှတ်သားချက်များ +#define bookmarks_heading မှတ်သား လိပ်စာများ + +#define bookmarks_toolbarfolder မှတ်သားလိပ်စာ အစုဖိုင် +#define bookmarks_toolbarfolder_description မှတ်သားလိပ်စာများအား မှတ်သားလိပ်စာဘားတန်းမှာပေါ်စေရန် ဤဖိုင်ထဲသို့ထည့်ပါ။ + +# LOCALIZATION NOTE (getting_started): +# link title for https://www.mozilla.org/en-US/firefox/central/ +#define getting_started စတင်အသုံးပြုခြင်း + +# LOCALIZATION NOTE (firefox_heading): +# Firefox links folder name +#define firefox_heading မော်ဇီလာမီးမြေခွေး + +# LOCALIZATION NOTE (firefox_help): +# link title for https://www.mozilla.org/en-US/firefox/help/ +#define firefox_help အကူအညီများနှင့်ကျူတိုရီရယ်များ + +# LOCALIZATION NOTE (firefox_customize): +# link title for https://www.mozilla.org/en-US/firefox/customize/ +#define firefox_customize မီးမြေးခွေးအားပြုပြင်သုံးစွဲမည် + +# LOCALIZATION NOTE (firefox_community): +# link title for https://www.mozilla.org/en-US/contribute/ +#define firefox_community ဝင်ရောက်လှူပ်ရှားမည်။ + +# LOCALIZATION NOTE (firefox_about): +# link title for https://www.mozilla.org/en-US/about/ +#define firefox_about ကျွန်ုပ်တို့အကြောင်း + +# LOCALIZATION NOTE (nightly_heading): +# Firefox Nightly links folder name +#define nightly_heading Firefox Nightly ရင်းမြစ်များ + +# LOCALIZATION NOTE (nightly_blog): +# Nightly builds only, link title for https://blog.nightly.mozilla.org/ +#define nightly_blog Firefox Nightly ဘလောဂ့် + +# LOCALIZATION NOTE (bugzilla): +# Nightly builds only, link title for https://bugzilla.mozilla.org/ +#define bugzilla Mozilla Bug Tracker + +# LOCALIZATION NOTE (mdn): +# Nightly builds only, link title for https://developer.mozilla.org/ +#define mdn Mozilla Developer Network + +# LOCALIZATION NOTE (nightly_tester_tools): +# Nightly builds only, link title for https://addons.mozilla.org/en-US/firefox/addon/nightly-tester-tools/ +#define nightly_tester_tools Nightly စမ်းသပ်သူများသုံး ကိရိယာများ + +# LOCALIZATION NOTE (crashes): +# Nightly builds only, link title for about:crashes +#define crashes ပျက်စီးမှုများအားလုံး + +# LOCALIZATION NOTE (irc): +# Nightly builds only, link title for ircs://irc.mozilla.org/nightly +#define irc Nightly ဆိုင်ရာများကို IRC ပေါ်တွင် ဆွေးနွေးပါ + +# LOCALIZATION NOTE (planet): +# Nightly builds only, link title for https://planet.mozilla.org/ +#define planet Planet Mozilla + +#unfilter emptyLines diff -Nru firefox-54.0~b1+build1/l10n/my/browser/updater/updater.ini firefox-54.0~b2+build1/l10n/my/browser/updater/updater.ini --- firefox-54.0~b1+build1/l10n/my/browser/updater/updater.ini 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/browser/updater/updater.ini 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,9 @@ +; This Source Code Form is subject to the terms of the Mozilla Public +; License, v. 2.0. If a copy of the MPL was not distributed with this +; file, You can obtain one at http://mozilla.org/MPL/2.0/. +; This file is in the UTF-8 encoding +; All strings must be less than 600 chars. +[Strings] +TitleText=%MOZ_APP_DISPLAYNAME% အဆင့်မြှင့်တင်ခြင်း +InfoText=%MOZ_APP_DISPLAYNAME% သည်သင်၏အဆင့်မြှင့်တင်ခြင်းအားလုပ်ဆောင်နေပြီး သိပ်မကြာခင် ပြီးစီးမည်ဖြစ်သည်။ +MozillaMaintenanceDescription=မော်ဇီလာ ထိန်သိမ်းရေး ဝန်ဆောင်မှုက သင့်ကွန်ပျူတာမှာ မော်ဇီလာ မီးမြေခွေးရဲ့ နောက်ဆုံးနဲ့ လုံခြုံမှုအရှိဆုံး ဗားရှင်း ရှိတယ်ဆိုတာ သေချာစေပါတယ်။ မီးမြေခွေး ရဲ့ နောက်ဆုံးထွက်ဗားရှင်း ကိုအသုံးပြုခြင်းဟာ သင့်ရဲ့ အွန်လိုင်းလုံခြုံရေး ကောင်းမွန်ဖို့အတွက် အလွန်အရေးပါပါတယ်။ မော်ဇီလာက ဒီဝန်ဆောင်မှုကို ဖွင့်ထားဖို့ လေးလေးနက်နက် အကြံပြုပါတယ်။ diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/aboutdebugging.dtd firefox-54.0~b2+build1/l10n/my/devtools/client/aboutdebugging.dtd --- firefox-54.0~b1+build1/l10n/my/devtools/client/aboutdebugging.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/aboutdebugging.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,4 @@ + + diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/aboutdebugging.properties firefox-54.0~b2+build1/l10n/my/devtools/client/aboutdebugging.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/aboutdebugging.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/aboutdebugging.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,67 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (debug): +# This string is displayed as a label of the button that starts +# debugging a service worker. + +# LOCALIZATION NOTE (push): +# This string is displayed as a label of the button that pushes a test payload +# to a service worker. + +# LOCALIZATION NOTE (start): +# This string is displayed as a label of the button that starts a service worker. + + + +# LOCALIZATION NOTE (addons): +# This string is displayed as a header of the about:debugging#addons page. + +# LOCALIZATION NOTE (addonDebugging.label): +# This string is displayed next to a check box that enables the user to switch +# addon debugging on/off. + +# LOCALIZATION NOTE (addonDebugging.tooltip): +# This string is displayed in a tooltip that appears when hovering over a check +# box that switches addon debugging on/off. + +# LOCALIZATION NOTE (moreInfo): +# This string is displayed next to addonDebugging.label as a link to a page +# with documentation. + +# LOCALIZATION NOTE (loadTemporaryAddon): +# This string is displayed as a label of a button that allows the user to +# load additional add-ons. + +# LOCALIZATION NOTE (extensions): +# This string is displayed as a header above the list of loaded add-ons. + +# LOCALIZATION NOTE (selectAddonFromFile2): +# This string is displayed as the title of the file picker that appears when +# the user clicks the 'Load Temporary Add-on' button + +# LOCALIZATION NOTE (reload): +# This string is displayed as a label of the button that reloads a given addon. + +# LOCALIZATION NOTE (reloadDisabledTooltip): +# This string is displayed in a tooltip that appears when hovering over a +# disabled 'reload' button. + +# LOCALIZATION NOTE (workers): +# This string is displayed as a header of the about:debugging#workers page. + + +# LOCALIZATION NOTE (tabs): +# This string is displayed as a header of the about:debugging#tabs page. + +# LOCALIZATION NOTE (pageNotFound): +# This string is displayed as the main message at any error/invalid page. + +# LOCALIZATION NOTE (doesNotExist): +# This string is displayed as an error message when navigating to an invalid page +# %S will be replaced by the name of the page at run-time. + +# LOCALIZATION NOTE (nothing): +# This string is displayed when the list of workers is empty. + diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/animationinspector.properties firefox-54.0~b2+build1/l10n/my/devtools/client/animationinspector.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/animationinspector.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/animationinspector.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,169 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE These strings are used inside the Animation inspector +# which is available as a sidebar panel in the Inspector. +# The correct localization of this file might be to keep it in +# English, or another language commonly spoken among web developers. +# You want to make that choice consistent across the developer tools. +# A good criteria is the language in which you'd find the best +# documentation on web development on the web. + +# LOCALIZATION NOTE (panel.invalidElementSelected): +# This is the label shown in the panel when an invalid node is currently +# selected in the inspector (i.e. a non-element node or a node that is not +# animated). +panel.invalidElementSelected=လက်ရှိ အစိတ်အပိုင်းအတွက် သက်ဝင်လှုပ်ရှားမှုများ မတွေ့ပါ + +# LOCALIZATION NOTE (panel.selectElement): This is the label shown in the panel +# when an invalid node is currently selected in the inspector, to invite the +# user to select a new node by clicking on the element-picker icon. + +# LOCALIZATION NOTE (panel.allAnimations): This is the label shown at the bottom of +# the panel, in a toolbar, to let the user know the toolbar applies to all +# animations, not just the ones applying to the current element. + +# LOCALIZATION NOTE (player.animationDurationLabel): +# This string is displayed in each animation player widget. It is the label +# displayed before the animation duration. +player.animationDurationLabel=ကြာမြင့်ချိန် : + +# LOCALIZATION NOTE (player.animationDelayLabel): +# This string is displayed in each animation player widget. It is the label +# displayed before the animation delay. +player.animationDelayLabel=နှောင့်နှေးချိန် - + +# LOCALIZATION NOTE (player.animationEndDelayLabel): +# This string is displayed in each animation player widget. It is the label +# displayed before the animation endDelay. +player.animationEndDelayLabel=အဆုံးသတ် ကြာချိန်။: + +# LOCALIZATION NOTE (player.animationRateLabel): +# This string is displayed in each animation player widget. It is the label +# displayed before the animation playback rate. +player.animationRateLabel=ပလေးဘက် သွားနှုန်း။ ။ + +# LOCALIZATION NOTE (player.animationIterationCountLabel): +# This string is displayed in each animation player widget. It is the label +# displayed before the number of times the animation is set to repeat. +player.animationIterationCountLabel=ထပ်လုပ်ပါ - + +# LOCALIZATION NOTE (player.infiniteIterationCount): +# In case the animation repeats infinitely, this string is displayed next to the +# player.animationIterationCountLabel string, instead of a number. +player.infiniteIterationCount=∞ + +# LOCALIZATION NOTE (player.infiniteIterationCountText): +# See player.infiniteIterationCount for a description of what this is. +# Unlike player.infiniteIterationCount, this string isn't used in HTML, but in +# a tooltip. +player.infiniteIterationCountText=∞ + +# LOCALIZATION NOTE (player.animationIterationStartLabel): +# This string is displayed in a tooltip that appears when hovering over +# animations in the timeline. It is the label displayed before the animation +# iterationStart value. +# %1$S will be replaced by the original iteration start value +# %2$S will be replaced by the actual time of iteration start +player.animationIterationStartLabel=ထပ်ဆင့်ကြော့ဆောင်ရွက်မှု စတင်ရန်။: %1$S (%2$Ss) + +# LOCALIZATION NOTE (player.animationOverallEasingLabel): +# This string is displayed in a tooltip that appears when hovering over +# animations in the timeline. It is the label displayed before the easing +# that applies to a whole iteration of an animation as opposed to the +# easing that applies between animation keyframes. + +# LOCALIZATION NOTE (player.animationFillLabel): +# This string is displayed in a tooltip that appears when hovering over +# animations in the timeline. It is the label displayed before the animation +# fill mode value. + +# LOCALIZATION NOTE (player.animationDirectionLabel): +# This string is displayed in a tooltip that appears when hovering over +# animations in the timeline. It is the label displayed before the animation +# direction value. + +# LOCALIZATION NOTE (player.timeLabel): +# This string is displayed in each animation player widget, to indicate either +# how long (in seconds) the animation lasts, or what is the animation's current +# time (in seconds too); +player.timeLabel=%Sစက္ကန့် + +# LOCALIZATION NOTE (player.playbackRateLabel): +# This string is displayed in each animation player widget, as the label of +# drop-down list items that can be used to change the rate at which the +# animation runs (1× being the default, 2× being twice as fast). +player.playbackRateLabel=%S× + +# LOCALIZATION NOTE (player.runningOnCompositorTooltip): +# This string is displayed as a tooltip for the icon that indicates that the +# animation is running on the compositor thread. +player.runningOnCompositorTooltip=This animation is running on compositor thread + +# LOCALIZATION NOTE (player.allPropertiesOnCompositorTooltip): +# This string is displayed as a tooltip for the icon that indicates that +# all of animation is running on the compositor thread. +player.allPropertiesOnCompositorTooltip=သက်ဝင်လှုပ်ရှားမှုအားလုံး၏တန်ဖိုးများကို အကောင်းဆုံးဖြစ်စေရန် ပြင်ဆင်ထားသည် + +# LOCALIZATION NOTE (player.somePropertiesOnCompositorTooltip): +# This string is displayed as a tooltip for the icon that indicates that +# all of animation is not running on the compositor thread. +player.somePropertiesOnCompositorTooltip=သက်ဝင်လှုပ်ရှားမှုအချို့၏တန်ဖိုးများကို အကောင်းဆုံးဖြစ်စေရန် ပြင်ဆင်ထားသည် + +# LOCALIZATION NOTE (timeline.rateSelectorTooltip): +# This string is displayed in the timeline toolbar, as the tooltip of the +# drop-down list that can be used to change the rate at which the animations +# run. +timeline.rateSelectorTooltip=သက်ဝင်လှုပ်ရှားမှုဖွင့်သည့်နှုန်းကို သတ်မှတ်ပါ + +# LOCALIZATION NOTE (timeline.pauseResumeButtonTooltip): +# This string is displayed in the timeline toolbar, as the tooltip of the +# pause/resume button that can be used to pause or resume the animations +timeline.pausedButtonTooltip=လှုပ်ရှားသက်ဝင်မှုများကို ဆက်လက်ဆောင်ရွက်ပါ + +# LOCALIZATION NOTE (timeline.pauseResumeButtonTooltip): +# This string is displayed in the timeline toolbar, as the tooltip of the +# pause/resume button that can be used to pause or resume the animations +timeline.resumedButtonTooltip=လှုပ်ရှားသက်ဝင်မှုများကို ခေတ္တရပ်နားပါ + +# LOCALIZATION NOTE (timeline.rewindButtonTooltip): +# This string is displayed in the timeline toolbar, as the tooltip of the +# rewind button that can be used to rewind the animations +timeline.rewindButtonTooltip=လှုပ်ရှားသက်၀င်မှုများကို နောက်သို့ပြန်ရစ်ပါ + +# LOCALIZATION NOTE (timeline.timeGraduationLabel): +# This string is displayed at the top of the animation panel, next to each time +# graduation, to indicate what duration (in milliseconds) this graduation +# corresponds to. +timeline.timeGraduationLabel=%Sမီလီစက္ကန့် + +# LOCALIZATION NOTE (timeline.cssanimation.nameLabel): +# This string is displayed in a tooltip of the animation panel that is shown +# when hovering over the name of a CSS Animation in the timeline UI. +# %S will be replaced by the name of the animation at run-time. +timeline.cssanimation.nameLabel=%S - CSS လှုပ်ရှားပုံရိပ် + +# LOCALIZATION NOTE (timeline.csstransition.nameLabel): +# This string is displayed in a tooltip of the animation panel that is shown +# when hovering over the name of a CSS Transition in the timeline UI. +# %S will be replaced by the name of the transition at run-time. +timeline.csstransition.nameLabel=%S - CSS သက်ဝင်လှုပ်ရှားမှု + +# LOCALIZATION NOTE (timeline.scriptanimation.nameLabel): +# This string is displayed in a tooltip of the animation panel that is shown +# when hovering over the name of a script-generated animation in the timeline UI. +# %S will be replaced by the name of the animation at run-time. +timeline.scriptanimation.nameLabel=%S - Script Animation + +# LOCALIZATION NOTE (timeline.scriptanimation.unnamedLabel): +# This string is displayed in a tooltip of the animation panel that is shown +# when hovering over an unnamed script-generated animation in the timeline UI. +timeline.scriptanimation.unnamedLabel=Script Animation + +# LOCALIZATION NOTE (timeline.unknown.nameLabel): +# This string is displayed in a tooltip of the animation panel that is shown +# when hovering over the name of an unknown animation type in the timeline UI. +# This can happen if devtools couldn't figure out the type of the animation. +# %S will be replaced by the name of the transition at run-time. +timeline.unknown.nameLabel=%S diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/appcacheutils.properties firefox-54.0~b2+build1/l10n/my/devtools/client/appcacheutils.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/appcacheutils.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/appcacheutils.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,119 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE These strings are used inside the Web Console +# command line which is available from the Web Developer sub-menu +# -> 'Web Console'. +# These messages are displayed when an attempt is made to validate a +# page or a cache manifest using AppCacheUtils.jsm + +# The correct localization of this file might be to keep it in +# English, or another language commonly spoken among web developers. +# You want to make that choice consistent across the developer tools. +# A good criteria is the language in which you'd find the best +# documentation on web development on the web. + +# LOCALIZATION NOTE (noManifest): the specified page has no cache manifest. +noManifest=ညွှန်းထားသော စာမျက်နှာတွင် မည်သည့် ကြေငြာချက်မျှမရှိပါ ။ + +# LOCALIZATION NOTE (notUTF8): the associated cache manifest has a character +# encoding that is not UTF-8. Parameters: %S is the current encoding. +notUTF8=ကြေညာချက်တွင် ပါဝင်သော အက္ခရာဖော်ပြမှူ၏ %S ကြေညာချက်တွင် utf-8 အက္ခရာဖော်ပြမှူသာ ဖြစ်ရမည် ။ + +# LOCALIZATION NOTE (badMimeType): the associated cache manifest has a +# mimetype that is not text/cache-manifest. Parameters: %S is the current +# mimetype. +badMimeType=Manifest has a mimetype of %S. Manifests must have a mimetype of text/cache-manifest. + +# LOCALIZATION NOTE (duplicateURI): the associated cache manifest references +# the same URI from multiple locations. Parameters: %1$S is the URI, %2$S is a +# list of references to this URI. +duplicateURI=URI %1$S is referenced in multiple locations. This is not allowed: %2$S. + +# LOCALIZATION NOTE (networkBlocksURI, fallbackBlocksURI): the associated +# cache manifest references the same URI in the NETWORK (or FALLBACK) section +# as it does in other sections. Parameters: %1$S is the line number, %2$S is +# the resource name, %3$S is the line number, %4$S is the resource name, %5$S +# is the section name. +networkBlocksURI=NETWORK section line %1$S (%2$S) prevents caching of line %3$S (%4$S) in the %5$S section. +fallbackBlocksURI=FALLBACK section line %1$S (%2$S) prevents caching of line %3$S (%4$S) in the %5$S section. + +# LOCALIZATION NOTE (fileChangedButNotManifest): the associated cache manifest +# references a URI that has a file modified after the cache manifest. +# Parameters: %1$S is the resource name, %2$S is the cache manifest, %3$S is +# the line number. +fileChangedButNotManifest=The file %1$S was modified after %2$S. Unless the text in the manifest file is changed the cached version will be used instead at line %3$S. + +# LOCALIZATION NOTE (cacheControlNoStore): the specified page has a header +# preventing caching or storing information. Parameters: %1$S is the resource +# name, %2$S is the line number. +cacheControlNoStore=%1$S has cache-control set to no-store. This will prevent the application cache from storing the file at line %2$S. + +# LOCALIZATION NOTE (notAvailable): the specified resource is not available. +# Parameters: %1$S is the resource name, %2$S is the line number. +notAvailable=%1$S points to a resource that is not available at line %2$S. + +# LOCALIZATION NOTE (invalidURI): it's used when an invalid URI is passed to +# the appcache. +invalidURI=The URI passed to AppCacheUtils is invalid. + +# LOCALIZATION NOTE (noResults): it's used when a search returns no results. +noResults=သင့်ရှာဖွေမှူတွင် အဖြေမရှိ \u0020 + +# LOCALIZATION NOTE (cacheDisabled): it's used when the cache is disabled and +# an attempt is made to view offline data. +cacheDisabled=Your disk cache is disabled. Please set browser.cache.disk.enable to true in about:config and try again. + +# LOCALIZATION NOTE (firstLineMustBeCacheManifest): the associated cache +# manifest has a first line that is not "CACHE MANIFEST". Parameters: %S is +# the line number. +firstLineMustBeCacheManifest=The first line of the manifest must be "CACHE MANIFEST" at line %S. + +# LOCALIZATION NOTE (cacheManifestOnlyFirstLine2): the associated cache +# manifest has "CACHE MANIFEST" on a line other than the first line. +# Parameters: %S is the line number where "CACHE MANIFEST" appears. +cacheManifestOnlyFirstLine2="CACHE MANIFEST" is only valid on the first line but was found at line %S. + +# LOCALIZATION NOTE (asteriskInWrongSection2): the associated cache manifest +# has an asterisk (*) in a section other than the NETWORK section. Parameters: +# %1$S is the section name, %2$S is the line number. +asteriskInWrongSection2=Asterisk (*) incorrectly used in the %1$S section at line %2$S. If a line in the NETWORK section contains only a single asterisk character, then any URI not listed in the manifest will be treated as if the URI was listed in the NETWORK section. Otherwise such URIs will be treated as unavailable. Other uses of the * character are prohibited. + +# LOCALIZATION NOTE (escapeSpaces): the associated cache manifest has a space +# in a URI. Spaces must be replaced with %20. Parameters: %S is the line +# number where this error occurs. +escapeSpaces=Spaces in URIs need to be replaced with %20 at line %S. + +# LOCALIZATION NOTE (slashDotDotSlashBad): the associated cache manifest has a +# URI containing /../, which is invalid. Parameters: %S is the line number +# where this error occurs. +slashDotDotSlashBad=/../ is not a valid URI prefix at line %S. + +# LOCALIZATION NOTE (tooManyDotDotSlashes): the associated cache manifest has +# a URI containing too many ../ operators. Too many of these operators mean +# that the file would be below the root of the site, which is not possible. +# Parameters: %S is the line number where this error occurs. +tooManyDotDotSlashes=Too many dot dot slash operators (../) at line %S. + +# LOCALIZATION NOTE (fallbackUseSpaces): the associated cache manifest has a +# FALLBACK section containing more or less than the standard two URIs +# separated by a single space. Parameters: %S is the line number where this +# error occurs. +fallbackUseSpaces=Only two URIs separated by spaces are allowed in the FALLBACK section at line %S. + +# LOCALIZATION NOTE (fallbackAsterisk2): the associated cache manifest has a +# FALLBACK section that attempts to use an asterisk (*) as a wildcard. In this +# section the URI is simply a path prefix. Parameters: %S is the line number +# where this error occurs. +fallbackAsterisk2=Asterisk (*) incorrectly used in the FALLBACK section at line %S. URIs in the FALLBACK section simply need to match a prefix of the request URI. + +# LOCALIZATION NOTE (settingsBadValue): the associated cache manifest has a +# SETTINGS section containing something other than the valid "prefer-online" +# or "fast". Parameters: %S is the line number where this error occurs. +settingsBadValue=The SETTINGS section may only contain a single value, "prefer-online" or "fast" at line %S. + +# LOCALIZATION NOTE (invalidSectionName): the associated cache manifest +# contains an invalid section name. Parameters: %1$S is the section name, %2$S +# is the line number. +invalidSectionName=Invalid section name (%1$S) at line %2$S. diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/app-manager.properties firefox-54.0~b2+build1/l10n/my/devtools/client/app-manager.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/app-manager.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/app-manager.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,29 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +validator.nonExistingFolder=စီမံကိန်းဖိုင်တွဲမရှိပါ +validator.expectProjectFolder=စီမံကိန်းဖိုင်တွဲသည် ဖိုင်တစ်ဖိုင် ဖြစ်နေသည် +validator.noManifestFile=မူဝါဒဖိုင်သည် စီမံကိန်းရှိရာနေရာအောက်တွင် ရှိရန် လိုအပ်သည်။ ထို့ပြင် ထုပ်ပိုးထားသည့် အက်ပ်များအတွက် 'manifest.webapp' သို့မဟုတ် အတ်အွန်များအတွက် 'manifest.json' ဟု ထိုဖိုင်ကို အမည်ပေးပါ။ +validator.invalidManifestURL=မူဝါဒဖိုင် URL '%S' သည် မှားနေသည် +# LOCALIZATION NOTE (validator.invalidManifestJSON, validator.noAccessManifestURL): +# %1$S is the error message, %2$S is the URI of the manifest. +validator.invalidManifestJSON=ဝဘ်အက်ပ် မူဝါဒဖိုင်သည် မှန်ကန်ညီညွတ်သည့် JSON ဖိုင် မဟုတ်ပါ၊ %2$S ရှိ %1$S +validator.noAccessManifestURL=မူဝါဒဖိုင်ကို မဖတ်နိုင်ပါ၊ %2$S ရှိ %1$S +# LOCALIZATION NOTE (validator.invalidHostedManifestURL): %1$S is the URI of +# the manifest, %2$S is the error message. +validator.invalidHostedManifestURL=အထိုင်ချထားသည့် မူဝါဒဖိုင် URL မှားယွင်းနေသည် '%1$S': %2$S +validator.invalidProjectType=စီမံကိန်း အမျိုးအစား မသိရပါ '%S' +# LOCALIZATION NOTE (validator.missNameManifestProperty, validator.missIconsManifestProperty): +# don't translate 'icons' and 'name'. +validator.missNameManifestProperty=မဖြစ်မနေပါရမည့် 'name' သည် မူဝါဒဖိုင်တွင် မရှိပါ။ +validator.missIconsManifestProperty=ပါဝင်ရမည့် 'icons' သည် မူဝါဒဖိုင်တွင် မရှိပါ။ +validator.missIconMarketplace2=Marketplace သို့ အက်ပ်တင်ပို့ရာတွင် 128px အရွယ်ရှိ ရုပ်ပုံငယ် လိုအပ်သည် +validator.invalidAppType=အက်ပ် အမျိုးအစား မသိရပါ '%S' +validator.invalidHostedPriviledges=Hosted App can't be type '%S'. +validator.noCertifiedSupport='certified' apps are not fully supported on the App manager. +validator.nonAbsoluteLaunchPath=Launch path has to be an absolute path starting with '/': '%S' +validator.accessFailedLaunchPath=Unable to access the app starting document '%S' +# LOCALIZATION NOTE (validator.accessFailedLaunchPathBadHttpCode): %1$S is the URI of +# the launch document, %2$S is the http error code. +validator.accessFailedLaunchPathBadHttpCode=Unable to access the app starting document '%1$S', got HTTP code %2$S diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/boxmodel.properties firefox-54.0~b2+build1/l10n/my/devtools/client/boxmodel.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/boxmodel.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/boxmodel.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,24 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE : FILE This file contains the Layout View strings. +# The Layout View is a panel displayed in the computed view tab of the Inspector sidebar. + +# LOCALIZATION NOTE : FILE The correct localization of this file might be to +# keep it in English, or another language commonly spoken among web developers. +# You want to make that choice consistent across the developer tools. +# A good criteria is the language in which you'd find the best +# documentation on web development on the web. + +# LOCALIZATION NOTE (boxmodel.title) This is the title of the box model panel and is +# displayed as a label. +boxmodel.title=Box Model + +# LOCALIZATION NOTE (boxmodel.margin) This refers to the margin in the box model and +# might be displayed as a label or as a tooltip. +boxmodel.margin=မာဂျင် + +# LOCALIZATION NOTE (boxmodel.content) This refers to the content in the box model and +# might be displayed as a label or as a tooltip. +boxmodel.content=ပါဝင်မှု diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/canvasdebugger.dtd firefox-54.0~b2+build1/l10n/my/devtools/client/canvasdebugger.dtd --- firefox-54.0~b1+build1/l10n/my/devtools/client/canvasdebugger.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/canvasdebugger.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,45 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/canvasdebugger.properties firefox-54.0~b2+build1/l10n/my/devtools/client/canvasdebugger.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/canvasdebugger.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/canvasdebugger.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,70 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE These strings are used inside the Canvas Debugger +# which is available from the Web Developer sub-menu -> 'Canvas'. +# The correct localization of this file might be to keep it in +# English, or another language commonly spoken among web developers. +# You want to make that choice consistent across the developer tools. +# A good criteria is the language in which you'd find the best +# documentation on web development on the web. + +# LOCALIZATION NOTE (noSnapshotsText): The text to display in the snapshots menu +# when there are no recorded snapshots yet. +noSnapshotsText=There are no snapshots yet. + +# LOCALIZATION NOTE (snapshotsList.itemLabel): +# This string is displayed in the snapshots list of the Canvas Debugger, +# identifying a set of function calls of a recorded animation frame. +snapshotsList.itemLabel=Snapshot #%S + +# LOCALIZATION NOTE (snapshotsList.loadingLabel): +# This string is displayed in the snapshots list of the Canvas Debugger, +# for an item that has not finished loading. +snapshotsList.loadingLabel=ပွင့်လာနေတယ်... + +# LOCALIZATION NOTE (snapshotsList.saveLabel): +# This string is displayed in the snapshots list of the Canvas Debugger, +# for saving an item to disk. +snapshotsList.saveLabel=သိမ်းဆည်းပါ + +# LOCALIZATION NOTE (snapshotsList.savingLabel): +# This string is displayed in the snapshots list of the Canvas Debugger, +# while saving an item to disk. +snapshotsList.savingLabel=သိမ်းဆည်းနေသည်… + +# LOCALIZATION NOTE (snapshotsList.loadedLabel): +# This string is displayed in the snapshots list of the Canvas Debugger, +# for an item which was loaded from disk +snapshotsList.loadedLabel=Disk ထဲမှ ခေါ်ယူထားသည် + +# LOCALIZATION NOTE (snapshotsList.saveDialogTitle): +# This string is displayed as a title for saving a snapshot to disk. +snapshotsList.saveDialogTitle=Save animation frame snapshot… + +# LOCALIZATION NOTE (snapshotsList.saveDialogJSONFilter): +# This string is displayed as a filter for saving a snapshot to disk. +snapshotsList.saveDialogJSONFilter=JSON ဖိုင်များ + +# LOCALIZATION NOTE (snapshotsList.saveDialogAllFilter): +# This string is displayed as a filter for saving a snapshot to disk. +snapshotsList.saveDialogAllFilter=ဖိုင်များ အားလုံး + +# LOCALIZATION NOTE (snapshotsList.drawCallsLabel): +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# This string is displayed in the snapshots list of the Canvas Debugger, +# as a generic description about how many draw calls were made. +snapshotsList.drawCallsLabel=#1 draw;#1 draws + +# LOCALIZATION NOTE (snapshotsList.functionCallsLabel): +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# This string is displayed in the snapshots list of the Canvas Debugger, +# as a generic description about how many function calls were made in total. +snapshotsList.functionCallsLabel=ခေါ်ဆိုမှု #1 ကြိမ်;ခေါ်ဆိုမှု #1 ကြိမ် + +# LOCALIZATION NOTE (recordingTimeoutFailure): +# This notification alert is displayed when attempting to record a requestAnimationFrame +# cycle in the Canvas Debugger and no cycles detected. This alerts the user that no +# loops were found. +recordingTimeoutFailure=Canvas Debugger could not find a requestAnimationFrame or setTimeout cycle. diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/components.properties firefox-54.0~b2+build1/l10n/my/devtools/client/components.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/components.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/components.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,15 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE These strings are used in the shared React components, +# so files in `devtools/client/shared/components/*`. + +# LOCALIZATION NOTE (frame.unknownSource): When we do not know the source filename of +# a frame, we use this string instead. +frame.unknownSource=(အမည်မသိ) + +# LOCALIZATION NOTE (viewsourceindebugger): The label for the tooltip when hovering over +# a source link that links to the debugger. +# %S represents the URL to match in the debugger. +frame.viewsourceindebugger=View source in Debugger → %S diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/connection-screen.dtd firefox-54.0~b2+build1/l10n/my/devtools/client/connection-screen.dtd --- firefox-54.0~b1+build1/l10n/my/devtools/client/connection-screen.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/connection-screen.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,30 @@ + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/connection-screen.properties firefox-54.0~b2+build1/l10n/my/devtools/client/connection-screen.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/connection-screen.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/connection-screen.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,9 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE : FILE This file contains the Remote Connection strings. +# The Remote Connection window can reached from the "connect…" menuitem +# in the Web Developer menu. + +mainProcess=အဓိကလုပ်ငန်းစဉ် diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/debugger.dtd firefox-54.0~b2+build1/l10n/my/devtools/client/debugger.dtd --- firefox-54.0~b1+build1/l10n/my/devtools/client/debugger.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/debugger.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,212 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/debugger.properties firefox-54.0~b2+build1/l10n/my/devtools/client/debugger.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/debugger.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/debugger.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,507 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE These strings are used inside the Debugger +# which is available from the Web Developer sub-menu -> 'Debugger'. +# The correct localization of this file might be to keep it in +# English, or another language commonly spoken among web developers. +# You want to make that choice consistent across the developer tools. +# A good criteria is the language in which you'd find the best +# documentation on web development on the web. + +# LOCALIZATION NOTE (collapsePanes): This is the tooltip for the button +# that collapses the left and right panes in the debugger UI. +collapsePanes=Pane များကို ပိတ်ရန် + +# LOCALIZATION NOTE (copySourceUrl): This is the text that appears in the +# context menu to copy the source URL of file open. + +# LOCALIZATION NOTE (copySourceUrl.accesskey): Access key to copy the source URL of a file from +# the context menu. + +# LOCALIZATION NOTE (expandPanes): This is the tooltip for the button +# that expands the left and right panes in the debugger UI. +expandPanes=Pane များကို ဖွင့်ရန် + +# LOCALIZATION NOTE (pauseButtonTooltip): The tooltip that is displayed for the pause +# button when the debugger is in a running state. +pauseButtonTooltip=ခေတ္တရပ်ရန် ကလစ်နှိပ်ပါ (%S) + +# LOCALIZATION NOTE (pausePendingButtonTooltip): The tooltip that is displayed for +# the pause button after it's been clicked but before the next JavaScript to run. +pausePendingButtonTooltip=နောက်လာမည့်လုပ်ဆောင်မှုကို စောင့်နေသည် + +# LOCALIZATION NOTE (resumeButtonTooltip): The label that is displayed on the pause +# button when the debugger is in a paused state. +resumeButtonTooltip=ဆက်လက်ပြုလုပ်ရန် ကလစ်နှိပ်ပါ (%S) + +# LOCALIZATION NOTE (stepOverTooltip): The label that is displayed on the +# button that steps over a function call. +stepOverTooltip=Step Over (%S) + +# LOCALIZATION NOTE (stepInTooltip): The label that is displayed on the +# button that steps into a function call. +stepInTooltip=Step In (%S) + +# LOCALIZATION NOTE (stepOutTooltip): The label that is displayed on the +# button that steps out of a function call. +stepOutTooltip=Step Out (%S) + +# LOCALIZATION NOTE (noWorkersText): The text to display in the workers list +# when there are no workers. +noWorkersText=ဒီစာမျက်နှာတွင် worker များ မရှိပါ။ + +# LOCALIZATION NOTE (noSourcesText): The text to display in the sources list +# when there are no sources. +noSourcesText=ဒီစာမျက်နှာတွင် မည်သည့်ရင်းမြစ်မျှ မရှိပါ။ + +# LOCALIZATION NOTE (noEventListenersText): The text to display in the events tab +# when there are no events. +noEventListenersText=No event listeners to display + +# LOCALIZATION NOTE (eventListenersHeader): The text to display in the events +# header. + +# LOCALIZATION NOTE (noStackFramesText): The text to display in the call stack tab +# when there are no stack frames. +noStackFramesText=No stack frames to display + +# LOCALIZATION NOTE (eventCheckboxTooltip): The tooltip text to display when +# the user hovers over the checkbox used to toggle an event breakpoint. +eventCheckboxTooltip=Toggle breaking on this event + +# LOCALIZATION NOTE (eventOnSelector): The text to display in the events tab +# for every event item, between the event type and event selector. +eventOnSelector=on + +# LOCALIZATION NOTE (eventInSource): The text to display in the events tab +# for every event item, between the event selector and listener's owner source. +eventInSource=in + +# LOCALIZATION NOTE (eventNodes): The text to display in the events tab when +# an event is listened on more than one target node. +eventNodes=%S nodes + +# LOCALIZATION NOTE (eventNative): The text to display in the events tab when +# a listener is added from plugins, thus getting translated to native code. +eventNative=[native code] + +# LOCALIZATION NOTE (*Events): The text to display in the events tab for +# each group of sub-level event entries. +animationEvents=သက်၀င်လှုပ်ရှားမှု +audioEvents=အော်ဒီယို(အသံပိုင်းဆိုင်ရာ) +batteryEvents=ဘတ္ထရီ +clipboardEvents=ကလစ်ဘုတ် +compositionEvents=Composition +deviceEvents=စက်ကိရိယာ +displayEvents=မြင်ကွင်း +dragAndDropEvents=Drag and Drop +gamepadEvents=Gamepad +indexedDBEvents=IndexedDB +interactionEvents=Interaction +keyboardEvents=ကီးဘုတ် +mediaEvents=HTML5 Media +mouseEvents=မောက်(စ်) +mutationEvents=Mutation +navigationEvents=လမ်းညွှန် +pointerLockEvents=Pointer Lock +sensorEvents=Sensor +storageEvents=အချက်အလက် သိမ်းရန်နေရာ +timeEvents=အချိန် +touchEvents=Touch +otherEvents=အခြား + +# LOCALIZATION NOTE (blackBoxCheckboxTooltip): The tooltip text to display when +# the user hovers over the checkbox used to toggle black boxing its associated +# source. +blackBoxCheckboxTooltip=Toggle black boxing + +# LOCALIZATION NOTE (sources.search.key): Key shortcut to open the search for +# searching all the source files the debugger has seen. + +# LOCALIZATION NOTE (sources.searchAlt.key): Alternate key shortcut to open +# the search for searching all the source files the debugger has seen. + +# LOCALIZATION NOTE (sourceSearch.search.key): Key shortcut to open the search +# for searching within a the currently opened files in the editor + +# LOCALIZATION NOTE (sourceSearch.search.placeholder): placeholder text in +# the source search input bar + +# LOCALIZATION NOTE (sourceSearch.search.again.key): Key shortcut to re-open +# the search for re-searching the same search triggered from a sourceSearch + +# LOCALIZATION NOTE (sourceSearch.resultsSummary1): Shows a summary of +# the number of matches for autocomplete + +# LOCALIZATION NOTE (noMatchingStringsText): The text to display in the +# global search results when there are no matching strings after filtering. +noMatchingStringsText=No matches found + +# LOCALIZATION NOTE (emptySearchText): This is the text that appears in the +# filter text box when it is empty and the scripts container is selected. +emptySearchText=Search scripts (%S) + +# LOCALIZATION NOTE (emptyVariablesFilterText): This is the text that +# appears in the filter text box for the variables view container. +emptyVariablesFilterText=Filter variables + +# LOCALIZATION NOTE (emptyPropertiesFilterText): This is the text that +# appears in the filter text box for the editor's variables view bubble. +emptyPropertiesFilterText=Filter properties + +# LOCALIZATION NOTE (searchPanelFilter): This is the text that appears in the +# filter panel popup for the filter scripts operation. +searchPanelFilter=Filter scripts (%S) + +# LOCALIZATION NOTE (searchPanelGlobal): This is the text that appears in the +# filter panel popup for the global search operation. +searchPanelGlobal=ဖိုင်အားလုံးတွင်ရှာပါ (%S) + +# LOCALIZATION NOTE (searchPanelFunction): This is the text that appears in the +# filter panel popup for the function search operation. +searchPanelFunction=Search for function definition (%S) + +# LOCALIZATION NOTE (searchPanelToken): This is the text that appears in the +# filter panel popup for the token search operation. +searchPanelToken=Find in this file (%S) + +# LOCALIZATION NOTE (searchPanelGoToLine): This is the text that appears in the +# filter panel popup for the line search operation. +searchPanelGoToLine=လိုင်းအမှတ် (%S)သို့ သွားပါ + +# LOCALIZATION NOTE (searchPanelVariable): This is the text that appears in the +# filter panel popup for the variables search operation. +searchPanelVariable=Filter variables (%S) + +# LOCALIZATION NOTE (breakpointMenuItem): The text for all the elements that +# are displayed in the breakpoints menu item popup. +breakpointMenuItem.setConditional=Configure conditional breakpoint +breakpointMenuItem.enableSelf=Enable breakpoint +breakpointMenuItem.disableSelf=Disable breakpoint +breakpointMenuItem.deleteSelf=breakpoint အားဖယ်ထုတ်ပါ +breakpointMenuItem.enableOthers=Enable others +breakpointMenuItem.disableOthers=Disable others +breakpointMenuItem.deleteOthers=Remove others +breakpointMenuItem.enableAll=Enable all breakpoints +breakpointMenuItem.disableAll=Disable all breakpoints +breakpointMenuItem.deleteAll=Remove all breakpoints + +# LOCALIZATION NOTE (breakpoints.header): Breakpoints right sidebar pane header. + +# LOCALIZATION NOTE (breakpoints.none): The text that appears when there are +# no breakpoints present + +# LOCALIZATION NOTE (breakpoints.enable): The text that may appear as a tooltip +# when hovering over the 'disable breakpoints' switch button in right sidebar + +# LOCALIZATION NOTE (breakpoints.disable): The text that may appear as a tooltip +# when hovering over the 'disable breakpoints' switch button in right sidebar + +# LOCALIZATION NOTE (breakpoints.removeBreakpointTooltip): The tooltip that is displayed +# for remove breakpoint button in right sidebar + +# LOCALIZATION NOTE (callStack.header): Call Stack right sidebar pane header. + +# LOCALIZATION NOTE (callStack.notPaused): Call Stack right sidebar pane +# message when not paused. + +# LOCALIZATION NOTE (callStack.collapse): Call Stack right sidebar pane +# message to hide some of the frames that are shown. + +# LOCALIZATION NOTE (callStack.expand): Call Stack right sidebar pane +# message to show more of the frames. + +# LOCALIZATION NOTE (editor.searchResults): Editor Search bar message +# for the summarizing the selected search result. e.g. 5 of 10 results. + +# LOCALIZATION NOTE (editor.noResults): Editor Search bar message +# for when no results found. + +# LOCALIZATION NOTE (editor.addBreakpoint): Editor gutter context menu item +# for adding a breakpoint on a line. + +# LOCALIZATION NOTE (editor.disableBreakpoint): Editor gutter context menu item +# for disabling a breakpoint on a line. + +# LOCALIZATION NOTE (editor.enableBreakpoint): Editor gutter context menu item +# for enabling a breakpoint on a line. + +# LOCALIZATION NOTE (editor.removeBreakpoint): Editor gutter context menu item +# for removing a breakpoint on a line. + +# LOCALIZATION NOTE (editor.editBreakpoint): Editor gutter context menu item +# for setting a breakpoint condition on a line. + +# LOCALIZATION NOTE (editor.addConditionalBreakpoint): Editor gutter context +# menu item for adding a breakpoint condition on a line. + +# LOCALIZATION NOTE (editor.conditionalPanel.placeholder): Placeholder text for +# input element inside ConditionalPanel component + +# LOCALIZATION NOTE (editor.conditionalPanel.placeholder): Tooltip text for +# close button inside ConditionalPanel component + +# LOCALIZATION NOTE (editor.jumpToMappedLocation1): Context menu item +# for navigating to a source mapped location + +# LOCALIZATION NOTE (generated): Source Map term for a server source location + +# LOCALIZATION NOTE (original): Source Map term for a debugger UI source location + +# LOCALIZATION NOTE (expressions.placeholder): Placeholder text for expression +# input element + +# LOCALIZATION NOTE (sourceTabs.closeTab): Editor source tab context menu item +# for closing the selected tab below the mouse. + +# LOCALIZATION NOTE (sourceTabs.closeTab.accesskey): Access key to close the currently select +# source tab from the editor context menu item. + +# LOCALIZATION NOTE (sourceTabs.closeOtherTabs): Editor source tab context menu item +# for closing the other tabs. + +# LOCALIZATION NOTE (sourceTabs.closeOtherTabs.accesskey): Access key to close other source tabs +# from the editor context menu. + +# LOCALIZATION NOTE (sourceTabs.closeTabsToEnd): Editor source tab context menu item +# for closing the tabs to the end (the right for LTR languages) of the selected tab. + +# LOCALIZATION NOTE (sourceTabs.closeTabsToEnd.accesskey): Access key to close source tabs +# after the selected tab from the editor context menu. + +# LOCALIZATION NOTE (sourceTabs.closeAllTabs): Editor source tab context menu item +# for closing all tabs. + +# LOCALIZATION NOTE (sourceTabs.closeAllTabs.accesskey): Access key to close all tabs from the +# editor context menu. + +# LOCALIZATION NOTE (sourceTabs.revealInTree): Editor source tab context menu item +# for revealing source in tree. + +# LOCALIZATION NOTE (sourceTabs.revealInTree.accesskey): Access key to reveal a source in the +# tree from the context menu. + +# LOCALIZATION NOTE (sourceTabs.copyLink): Editor source tab context menu item +# for copying a link address. + +# LOCALIZATION NOTE (sourceTabs.copyLink.accesskey): Access key to copy a link addresss from the +# editor context menu. + +# LOCALIZATION NOTE (sourceTabs.prettyPrint): Editor source tab context menu item +# for pretty printing the source. + +# LOCALIZATION NOTE (sourceTabs.prettyPrint.accesskey): Access key to pretty print a source from +# the editor context menu. + +# LOCALIZATION NOTE (sourceTabs.closeTabButtonTooltip): The tooltip that is displayed +# for close tab button in source tabs. + +# LOCALIZATION NOTE (sourceTabs.newTabButtonTooltip): The tooltip that is displayed for +# new tab button in source tabs. + +# LOCALIZATION NOTE (scopes.header): Scopes right sidebar pane header. + +# LOCALIZATION NOTE (scopes.notAvailable): Scopes right sidebar pane message +# for when the debugger is paused, but there isn't pause data. + +# LOCALIZATION NOTE (scopes.notPaused): Scopes right sidebar pane message +# for when the debugger is not paused. + +# LOCALIZATION NOTE (scopes.block): Refers to a block of code in +# the scopes pane when the debugger is paused. + +# LOCALIZATION NOTE (sources.header): Sources left sidebar header + +# LOCALIZATION NOTE (sources.search): Sources left sidebar prompt +# e.g. Cmd+P to search. On a mac, we use the command unicode character. +# On windows, it's ctrl. + +# LOCALIZATION NOTE (watchExpressions.header): Watch Expressions right sidebar +# pane header. + +# LOCALIZATION NOTE (watchExpressions.refreshButton): Watch Expressions header +# button for refreshing the expressions. + +# LOCALIZATION NOTE (welcome.search): The center pane welcome panel's +# search prompt. e.g. cmd+p to search for files. On windows, it's ctrl, on +# a mac we use the unicode character. + +# LOCALIZATION NOTE (sourceSearch.search): The center pane Source Search +# prompt for searching for files. + +# LOCALIZATION NOTE (sourceSearch.search): The center pane Source Search +# prompt for searching for files. +# Used in the old debugger fronted + +# LOCALIZATION NOTE (sourceSearch.noResults): The center pane Source Search +# message when the query did not match any of the sources. + +# LOCALIZATION NOTE (sourceFooter.debugBtnTooltip): Tooltip text associated +# with the pretty-print button + +# LOCALIZATION NOTE (ignoreExceptions): The pause on exceptions button tooltip +# when the debugger will not pause on exceptions. + +# LOCALIZATION NOTE (pauseOnUncaughtExceptions): The pause on exceptions button +# tooltip when the debugger will pause on uncaught exceptions. + +# LOCALIZATION NOTE (pauseOnExceptions): The pause on exceptions button tooltip +# when the debugger will pause on all exceptions. + +# LOCALIZATION NOTE (loadingText): The text that is displayed in the script +# editor when the loading process has started but there is no file to display +# yet. +loadingText=ပွင့်လာနေတယ်... + +# LOCALIZATION NOTE (errorLoadingText2): The text that is displayed in the debugger +# viewer when there is an error loading a file +errorLoadingText2=Error loading this URL: %S + +# LOCALIZATION NOTE (addWatchExpressionText): The text that is displayed in the +# watch expressions list to add a new item. +addWatchExpressionText=Add watch expression + +# LOCALIZATION NOTE (addWatchExpressionButton): The button that is displayed in the +# variables view popup. +addWatchExpressionButton=စောင့်ကြည့်ရန် + +# LOCALIZATION NOTE (emptyVariablesText): The text that is displayed in the +# variables pane when there are no variables to display. +emptyVariablesText=No variables to display + +# LOCALIZATION NOTE (scopeLabel): The text that is displayed in the variables +# pane as a header for each variable scope (e.g. "Global scope, "With scope", +# etc.). +scopeLabel=%S scope + +# LOCALIZATION NOTE (watchExpressionsScopeLabel): The name of the watch +# expressions scope. This text is displayed in the variables pane as a header for +# the watch expressions scope. +watchExpressionsScopeLabel=Watch expressions + +# LOCALIZATION NOTE (globalScopeLabel): The name of the global scope. This text +# is added to scopeLabel and displayed in the variables pane as a header for +# the global scope. +globalScopeLabel=ဂလိုဘယ် + +# LOCALIZATION NOTE (variablesViewErrorStacktrace): This is the text that is +# shown before the stack trace in an error. +variablesViewErrorStacktrace=Stack trace: + +# LOCALIZATION NOTE (variablesViewMoreObjects): the text that is displayed +# when you have an object preview that does not show all of the elements. At the end of the list +# you see "N more..." in the web console output. +# This is a semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 number of remaining items in the object +# example: 3 more… +variablesViewMoreObjects=#1 ခု ပို၍ရှိ…;#1 ခု ပို၍ရှိ… + +# LOCALIZATION NOTE (variablesEditableNameTooltip): The text that is displayed +# in the variables list on an item with an editable name. +variablesEditableNameTooltip=Double click to edit + +# LOCALIZATION NOTE (variablesEditableValueTooltip): The text that is displayed +# in the variables list on an item with an editable value. +variablesEditableValueTooltip=Click to change value + +# LOCALIZATION NOTE (variablesCloseButtonTooltip): The text that is displayed +# in the variables list on an item which can be removed. +variablesCloseButtonTooltip=Click to remove + +# LOCALIZATION NOTE (variablesEditButtonTooltip): The text that is displayed +# in the variables list on a getter or setter which can be edited. +variablesEditButtonTooltip=Click to set value + +# LOCALIZATION NOTE (variablesEditableValueTooltip): The text that is displayed +# in a tooltip on the "open in inspector" button in the the variables list for a +# DOMNode item. +variablesDomNodeValueTooltip=အင်စပတ်တာထဲရှိ နုတ်ဒ် ကို ရွေးချယ်ကြည့်ရှုရန် ကလစ်နှိပ်ပါ + +# LOCALIZATION NOTE (configurable|...|Tooltip): The text that is displayed +# in the variables list on certain variables or properties as tooltips. +# Expanations of what these represent can be found at the following links: +# https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Object/defineProperty +# https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Object/isExtensible +# https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Object/isFrozen +# https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Object/isSealed +# It's probably best to keep these in English. +configurableTooltip=configurable +enumerableTooltip=enumerable +writableTooltip=writable +frozenTooltip=frozen +sealedTooltip=sealed +extensibleTooltip=extensible +overriddenTooltip=overridden +WebIDLTooltip=WebIDL + +# LOCALIZATION NOTE (variablesSeparatorLabel): The text that is displayed +# in the variables list as a separator between the name and value. +variablesSeparatorLabel=: + +# LOCALIZATION NOTE (watchExpressionsSeparatorLabel2): The text that is displayed +# in the watch expressions list as a separator between the code and evaluation. +watchExpressionsSeparatorLabel2=\u0020→ + +# LOCALIZATION NOTE (functionSearchSeparatorLabel): The text that is displayed +# in the functions search panel as a separator between function's inferred name +# and its real name (if available). +functionSearchSeparatorLabel=← + +# LOCALIZATION NOTE (resumptionOrderPanelTitle): This is the text that appears +# as a description in the notification panel popup, when multiple debuggers are +# open in separate tabs and the user tries to resume them in the wrong order. +# The substitution parameter is the URL of the last paused window that must be +# resumed first. +resumptionOrderPanelTitle=There are one or more paused debuggers. Please resume the most-recently paused debugger first at: %S + +variablesViewOptimizedOut=(optimized away) +variablesViewUninitialized=(uninitialized) +variablesViewMissingArgs=(unavailable) + +anonymousSourcesLabel=အမည်မသိရင်းမြစ်များ + +experimental=ဒီအရာသည် စမ်းသပ်ဆဲ လုပ်ဆောင်ချက် ဖြစ်ပါသည် + +# LOCALIZATION NOTE (whyPaused.debuggerStatement): The text that is displayed +# in a info block explaining how the debugger is currently paused due to a `debugger` +# statement in the code + +# LOCALIZATION NOTE (whyPaused.breakpoint): The text that is displayed +# in a info block explaining how the debugger is currently paused on a breakpoint + +# LOCALIZATION NOTE (whyPaused.exception): The text that is displayed +# in a info block explaining how the debugger is currently paused on an exception + +# LOCALIZATION NOTE (whyPaused.resumeLimit): The text that is displayed +# in a info block explaining how the debugger is currently paused while stepping +# in or out of the stack + +# LOCALIZATION NOTE (whyPaused.pauseOnDOMEvents): The text that is displayed +# in a info block explaining how the debugger is currently paused on a +# dom event + +# LOCALIZATION NOTE (whyPaused.breakpointConditionThrown): The text that is displayed +# in an info block when evaluating a conditional breakpoint throws an error + +# LOCALIZATION NOTE (whyPaused.xhr): The text that is displayed +# in a info block explaining how the debugger is currently paused on an +# xml http request + +# LOCALIZATION NOTE (whyPaused.promiseRejection): The text that is displayed +# in a info block explaining how the debugger is currently paused on a +# promise rejection + +# LOCALIZATION NOTE (whyPaused.assert): The text that is displayed +# in a info block explaining how the debugger is currently paused on an +# assert + +# LOCALIZATION NOTE (whyPaused.debugCommand): The text that is displayed +# in a info block explaining how the debugger is currently paused on a +# debugger statement + +# LOCALIZATION NOTE (whyPaused.other): The text that is displayed +# in a info block explaining how the debugger is currently paused on an event +# listener breakpoint set diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/device.properties firefox-54.0~b2+build1/l10n/my/devtools/client/device.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/device.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/device.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,20 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE These strings are used inside Device Emulation developer +# tools. The correct localization of this file might be to keep it in English, +# or another language commonly spoken among web developers. You want to make +# that choice consistent across the developer tools. A good criteria is the +# language in which you'd find the best documentation on web development on the +# web. + +# LOCALIZATION NOTE: +# These strings are category names in a list of devices that a user can choose +# to simulate (e.g. "ZTE Open C", "VIA Vixen", "720p HD Television", etc). +device.phones=ဖုန်းများ +device.tablets=တပ်ဗလက်များ +device.laptops=လပ်တော့ပ်များ +device.televisions=တီဗွီများ +device.consoles=ဂိမ်းကစားစက်များ +device.watches=နာရီများ diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/dom.properties firefox-54.0~b2+build1/l10n/my/devtools/client/dom.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/dom.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/dom.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,19 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE These strings are used inside the DOM panel +# which is available from the Web Developer sub-menu -> 'DOM'. +# The correct localization of this file might be to keep it in +# English, or another language commonly spoken among web developers. +# You want to make that choice consistent across the developer tools. +# A good criteria is the language in which you'd find the best +# documentation on web development on the web. + +# LOCALIZATION NOTE (dom.filterDOMPanel): A placeholder text used for +# DOM panel search box. +dom.filterDOMPanel=DOM အချက်အလက်ပြားတွင် စစ်ထုတ်ရန် + +# LOCALIZATION NOTE (dom.refresh): A label for Refresh button in +# DOM panel toolbar +dom.refresh=ပြန်ရယူရန် \ No newline at end of file diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/eyedropper.properties firefox-54.0~b2+build1/l10n/my/devtools/client/eyedropper.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/eyedropper.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/eyedropper.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,14 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE These strings are used in the Eyedropper color tool. +# LOCALIZATION NOTE The correct localization of this file might be to keep it +# in English, or another language commonly spoken among web developers. +# You want to make that choice consistent across the developer tools. +# A good criteria is the language in which you'd find the best documentation +# on web development on the web. + +# LOCALIZATION NOTE (colorValue.copied): This text is displayed when the user selects a +# color with the eyedropper and it's copied to the clipboard. +colorValue.copied=ကူးပြီးပြီ diff -Nru firefox-54.0~b1+build1/l10n/my/devtools/client/filterwidget.properties firefox-54.0~b2+build1/l10n/my/devtools/client/filterwidget.properties --- firefox-54.0~b1+build1/l10n/my/devtools/client/filterwidget.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/devtools/client/filterwidget.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,59 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE These strings are used in the CSS Filter Editor Widget +# which can be found in a tooltip that appears in the Rule View when clicking +# on a filter swatch displayed next to CSS declarations like 'filter: blur(2px)'. + +# LOCALIZATION NOTE (emptyFilterList): +# This string is displayed when filter's list is empty +# (no filter specified / all removed) +emptyFilterList=မည်သည့်စစ်ထုတ်သည့်လုပ်ဆောင်မှုကိုမျှ မဖော်ပြထားပါ + +# LOCALIZATION NOTE (emptyPresetList): +# This string is displayed when preset's list is empty +emptyPresetList=သင့်တွင် ကြိုတင်သတ်မှတ်ထားသော စစ်ထုတ်ချက်များ မရှိပါ။ ကြိုတင်သတ်မှတ်ထားသည့် စစ်ထုတ်ချက်များကို နာမည်တစ်ခုရွေးပြီး သိမ်းဆည်းခြင်းဖြင့် ရနိုင်ပါသည်။ ထိုကြိုတင်သတ်မှတ်ထားသည့် စစ်ထုတ်ချက်များကို လွယ်လင့်တကူနှင့် ထပ်ခါထပ်ခါ အသုံးပြုနိုင်သည်။ + +# LOCALIZATION NOTE (addUsingList): +# This string is displayed under [emptyFilterList] when filter's +# list is empty, guiding user to add a filter using the list below it +addUsingList=အောက်ပါစာရင်းကို အသုံးပြု၍ စစ်ထုတ်ချက်တစ်ခု ထည့်ပါ + +# LOCALIZATION NOTE (dropShadowPlaceholder): +# This string is used as a placeholder for drop-shadow's input +# in the filter list (shown when is empty) +dropShadowPlaceholder=x y အချင်းဝက် အရောင် + +# LOCALIZATION NOTE (dragHandleTooltipText): +# This string is used as a tooltip text (shown on mouse hover) on the +# drag handles of filters which are used to re-order filters +dragHandleTooltipText=စစ်ထုတ်သည့်လုပ်ဆောင်ချက်ကို ပြန်လည်စီရန် ကလစ်ဖိပြီးဆွဲတင် သို့မဟုတ် ဆွဲချပါ + +# LOCALIZATION NOTE (labelDragTooltipText): +# This string is used as a tooltip text (shown on mouse hover) on the +# filters' labels which can be dragged left/right to increase/decrease +# the filter's value (like photoshop) +labelDragTooltipText=တန်ဖိုးအတိုးအလျှော့ ပြုလုပ်ရန် ကလစ်ဖိပြီး ဘယ်ညာရွှေ့ပါ + +# LOCALIZATION NOTE (filterListSelectPlaceholder): +# This string is used as a preview option in the list of possible filters +# ကို မစစ်ဆေးနိုင်ပါ။ +# LOCALIZATION NOTE: Do not translate "postMessage" or DOMWindow. %S values are origins, like https://domain.com:port +TargetPrincipalDoesNotMatch=‘DOMWindow’ ရှိ ‘postMessage’ ကို ဆောင်ရွက်ရာတွင် မအောင်မြင်ခဲ့ပါ။ ပေးထားသည့် မူလပုံစံ (‘%S’) သည် လက်ခံဝင်းဒိုး၏ မူလပုံစံ (‘%S’) နှင့် ကိုက်ညီမှုမရှိပါ။ +# LOCALIZATION NOTE: Do not translate 'YouTube'. %S values are origins, like https://domain.com:port +RewriteYouTubeEmbed=ပုံစံဟောင်း YouTube Flash embed (%S) ကို iframe embed (%S) သို့ ပြောင်းလဲရေးသားနေပါသည်။ embed/object, အစား iframe ကို အသုံးပြုရန် ဖြစ်နိုင်လျှင် ကျေးဇူးပြု၍ စာမျက်နှာကို ပြုပြင်ပါ။ +# LOCALIZATION NOTE: Do not translate 'YouTube'. %S values are origins, like https://domain.com:port +RewriteYouTubeEmbedPathParams=ပုံစံဟောင်း YouTube Flash embed (%S) ကို iframe embed (%S) သို့ ပြောင်းလဲရေးသားနေပါသည်။ Param များကို iframe embed များက မထောက်ပံ့သည့်အပြင် ပြောင်းလဲထားသည်။ embed/object, အစား iframe ကို အသုံးပြုရန် ဖြစ်နိုင်လျှင် စာမျက်နှာကို ပြုပြင်ပါ။ +# LOCALIZATION NOTE: This error is reported when the "Encryption" header for an +# incoming push message is missing or invalid. Do not translate "ServiceWorker", +# "Encryption", and "salt". %1$S is the ServiceWorker scope URL. +PushMessageBadEncryptionHeader=The ServiceWorker for scope ‘%1$S’ failed to decrypt a push message. The ‘Encryption’ header must include a unique ‘salt‘ parameter for each message. See https://tools.ietf.org/html/draft-ietf-httpbis-encryption-encoding-02#section-3.1 for more information. +# LOCALIZATION NOTE: This error is reported when the "Crypto-Key" header for an +# incoming push message is missing or invalid. Do not translate "ServiceWorker", +# "Crypto-Key", and "dh". %1$S is the ServiceWorker scope URL. +PushMessageBadCryptoKeyHeader=The ServiceWorker for scope ‘%1$S’ failed to decrypt a push message. The ‘Crypto-Key‘ header must include a ‘dh‘ parameter containing the app server’s public key. See https://tools.ietf.org/html/draft-ietf-httpbis-encryption-encoding-02#section-4 for more information. +# LOCALIZATION NOTE: This error is reported when a push message fails to decrypt because the deprecated +# "Encryption-Key" header for an incoming push message is missing or invalid. +# Do not translate "ServiceWorker", "Encryption-Key", "dh", "Crypto-Key", and +# "Content-Encoding: aesgcm". %1$S is the ServiceWorker scope URL. +PushMessageBadEncryptionKeyHeader=The ServiceWorker for scope ‘%1$S’ failed to decrypt a push message. The ‘Encryption-Key’ header must include a ‘dh‘ parameter. This header is deprecated and will soon be removed. Please use ‘Crypto-Key‘ with ‘Content-Encoding: aesgcm‘ instead. See https://tools.ietf.org/html/draft-ietf-httpbis-encryption-encoding-02#section-4 for more information. +# LOCALIZATION NOTE: This error is reported when a push message fails to decrypt +# because the "Content-Encoding" header is missing or contains an +# unsupported encoding. Do not translate "ServiceWorker", "Content-Encoding", +# "aesgcm", and "aesgcm128". %1$S is the ServiceWorker scope URL. +PushMessageBadEncodingHeader=The ServiceWorker for scope ‘%1$S’ failed to decrypt a push message. The ‘Content-Encoding‘ header must be ‘aesgcm‘. ‘aesgcm128‘ is allowed, but deprecated and will soon be removed. See https://tools.ietf.org/html/draft-ietf-httpbis-encryption-encoding-02#section-2 for more information. +# LOCALIZATION NOTE: This error is reported when a push message fails to decrypt +# because the "dh" parameter is not valid base64url. Do not translate +# "ServiceWorker", "dh", "Crypto-Key", and "base64url". %1$S is the +# ServiceWorker scope URL. +PushMessageBadSenderKey=The ServiceWorker for scope ‘%1$S’ failed to decrypt a push message. The ‘dh‘ parameter in the ‘Crypto-Key‘ header must be the app server’s Diffie-Hellman public key, base64url-encoded (https://tools.ietf.org/html/rfc7515#appendix-C) and in “uncompressed” or “raw” form (65 bytes before encoding). See https://tools.ietf.org/html/draft-ietf-httpbis-encryption-encoding-02#section-4 for more information. +# LOCALIZATION NOTE: This error is reported when a push message fails to decrypt +# because the "salt" parameter is not valid base64url. Do not translate +# "ServiceWorker", "salt", "Encryption", and "base64url". %1$S is the +# ServiceWorker scope URL. +PushMessageBadSalt=The ServiceWorker for scope ‘%1$S’ failed to decrypt a push message. The ‘salt‘ parameter in the ‘Encryption‘ header must be base64url-encoded (https://tools.ietf.org/html/rfc7515#appendix-C), and be at least 16 bytes before encoding. See https://tools.ietf.org/html/draft-ietf-httpbis-encryption-encoding-02#section-3.1 for more information. +# LOCALIZATION NOTE: This error is reported when a push message fails to decrypt +# because the "rs" parameter is not a number, or is less than the pad size. +# Do not translate "ServiceWorker", "rs", or "Encryption". %1$S is the +# ServiceWorker scope URL. %2$S is the minimum value (1 for aesgcm128, 2 for +# aesgcm). +PushMessageBadRecordSize=The ServiceWorker for scope ‘%1$S’ failed to decrypt a push message. The ‘rs‘ parameter of the ‘Encryption‘ header must be between %2$S and 2^36-31, or omitted entirely. See https://tools.ietf.org/html/draft-ietf-httpbis-encryption-encoding-02#section-3.1 for more information. +# LOCALIZATION NOTE: This error is reported when a push message fails to decrypt +# because an encrypted record is shorter than the pad size, the pad is larger +# than the record, or any of the padding bytes are non-zero. Do not translate +# "ServiceWorker". %1$S is the ServiceWorker scope URL. %2$S is the pad size +# (1 for aesgcm128, 2 for aesgcm). +PushMessageBadPaddingError=The ServiceWorker for scope ‘%1$S’ failed to decrypt a push message. A record in the encrypted message was not padded correctly. See https://tools.ietf.org/html/draft-ietf-httpbis-encryption-encoding-02#section-2 for more information. +# LOCALIZATION NOTE: This error is reported when push message decryption fails +# and no specific error info is available. Do not translate "ServiceWorker". +# %1$S is the ServiceWorker scope URL. +PushMessageBadCryptoError=The ServiceWorker for scope ‘%1$S’ failed to decrypt a push message. For help with encryption, please see https://developer.mozilla.org/docs/Web/API/Push_API/Using_the_Push_API#Encryption +# LOCALIZATION NOTE: %1$S is the type of a DOM event. 'passive' is a literal parameter from the DOM spec. +PreventDefaultFromPassiveListenerWarning=Ignoring ‘preventDefault()’ call on event of type ‘%1$S’ from a listener registered as ‘passive’. +FileLastModifiedDateWarning=File.lastModifiedDate ကို အသုံးပြု၍ မရတော့ပါ။ ၎င်းအစား File.lastModified ကို အသုံးပြုပါ။ +# LOCALIZATION NOTE: 'ImageBitmapRenderingContext.transferImageBitmap' and 'ImageBitmapRenderingContext.transferFromImageBitmap' should not be translated +ImageBitmapRenderingContext_TransferImageBitmap=ImageBitmapRenderingContext.transferImageBitmap is deprecated and will be removed soon. Use ImageBitmapRenderingContext.transferFromImageBitmap instead. +ChromeScriptedDOMParserWithoutPrincipal=ပရင်စီပယ်မပါပဲ DOMParser ဖန်တီးခြင်းကို ဆောင်ရွက်နိုင်တော့မည် မဟုတ်ပါ။ +IIRFilterChannelCountChangeWarning=IIRFilterNode ချန်နယ်ရေတွက်ခြင်း အပြောင်းအလဲသည် အသံပိုင်းဆိုင်ရာ ပြဿနာကို ဖြစ်ပေါ်စေနိုင်သည်။ +BiquadFilterChannelCountChangeWarning=BiquadFilterNode ချန်နယ်ရေတွက်ခြင်း အပြောင်းအလဲသည် အသံပိုင်းဆိုင်ရာ ပြဿနာကို ဖြစ်ပေါ်စေနိုင်သည်။ +# LOCALIZATION NOTE: %1$S is the unanimatable paced property. +UnanimatablePacedProperty=Paced property ‘%1$S’ သည် လှုပ်ရှားသက်ဝင်စေနိုင်သော property မဟုတ်ပါ။ +# LOCALIZATION NOTE: Do not translate ".jpeg" +GenericImageNameJPEG=image.jpeg +# LOCALIZATION NOTE: Do not translate ".gif" +GenericImageNameGIF=image.gif +# LOCALIZATION NOTE: Do not translate ".png" +GenericImageNamePNG=image.png +GenericFileName=ဖိုင် +# LOCALIZATION NOTE: Do not translate "Large-Allocation", as it is a literal header name +LargeAllocationSuccess=Large-Allocation header ဖြစ်နေသဖြင့် ယခုစာမျက်နှာကို ပရောဆက်ဆာအသစ်တွင် ဆောင်ရွက်စေလိုက်သည်။ +# LOCALIZATION NOTE: Do not translate "Large-Allocation", as it is a literal header name. Do not translate GET. +LargeAllocationNonGetRequest=GET မဟုတ်သော request တစ်ခုသည် ဒေတာခေါ်တင်မှု ဆောင်ရွက်စေသည့်အတွက် Large-Allocation header ကို လျစ်လျူရှုထားပါသည်။ +# LOCALIZATION NOTE: Do not translate "Large-Allocation", as it is a literal header name. Do not translate `window.opener`. +LargeAllocationNotOnlyToplevelInTabGroup=ယခုကြည့်ရှုနေသော context ၏ ရည်ညွှန်းချက်တစ်ခုမှ frame hierarchy သို့မဟုတ် window.opener ကြောင့် ဖြစ်စေသည့် ဝင်းဒိုးများ ပွင့်နေသည့်အတွက် Large-Allocation header ကို လျစ်လျူရှုထားသည်။ +# LOCALIZATION NOTE: Do not translate "Large-Allocation", as it is a literal header name +LargeAllocationNonE10S=ပရောက်ဆက်အကန့်အသတ်ရှိသဖြင့် လက်ရှိစာတမ်းကို မခေါ်ယူ၊ မဆောင်ရွက်နိုင်သောကြောင့် Large-Allocation header ကို လျစ်လျူရှုထားသည်။ +GeolocationInsecureRequestIsForbidden=ပထဝီဝင်တည်နေရာ တောင်းဆိုမှုကို လုံခြုံသော ချိတ်ဆက်မှုရှိမှသာ လုပ်ဆောင်နိုင်ပါမည်။ +# LOCALIZATION NOTE: Do not translate "Large-Allocation", as it is a literal header name. +LargeAllocationNonWin32=Large-Allocation header ဖြစ်နေသောကြောင့် ဒီစာမျက်နှာကို ပရောဆက်အသစ်တွင် ဆောင်ရွက်စေပါမည်။ သို့သော် Large-Allocation ပရောဆက်ဖန်တီးခြင်းကို non-Win32 ပလက်ဖောင်းများတွင် ပိတ်ထားသည်။ +# LOCALIZATION NOTE: Do not translate URL.createObjectURL(MediaStream). +URLCreateObjectURL_MediaStream=URL.createObjectURL(MediaStream) သည် နောင်တွင် ပါဝင်တော့မည်မဟုတ်ပါ။ ထို့ပြင် ၎င်းကို မကြာပြီ ဖယ်ရှားပါမည်။ +# LOCALIZATION NOTE: Do not translate xml:base. +XMLBaseAttributeWarning=xml:base အထြီဗြုအသုံးပြုခြင်းကို အထောက်အပံ့မပြုတော့ကြောင်း ကြေငြာထားသည်။ ထို့ပြင် ၎င်းကို မကြာမီကာလတွင် ဖယ်ရှားပါမည်။ ၎င်းကို အသုံးပြုထားလျှင် ကျေးဇူးပြု၍ ဖယ်ရှားပါ။ diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/global.dtd firefox-54.0~b2+build1/l10n/my/dom/chrome/global.dtd --- firefox-54.0~b1+build1/l10n/my/dom/chrome/global.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/global.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,5 @@ + + + diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/global-strres.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/global-strres.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/global-strres.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/global-strres.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,5 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +16389=အမည်မသိတဲ့ အမှားတခု (%1$S) ​ဖြစ်ပေါ်နေတယ် diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/css.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/css.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/css.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/css.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,182 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +MimeNotCss=stylesheet %1$S ဟာ ၄င်းရဲ့ MIME အမျိုးအစား - "text/css", ဟာ "%2$S" မဟုတ်ဘူး - ကြောင့် ဖွင့်လို့ ​မရဘူး။ +MimeNotCssWarn=stylesheet %1$S ဟာ ၄င်းရဲ့ MIME အမျိုးအစား - "text/css", ဟာ "%2$S" မဟုတ်ဘူး - ဖြစ်နေပေမဲ့ CSS လို ဖွင့်ပေးတယ်။ + +PEUnexpEOF2=%1$S ကို ရှာဖွေရင်း မမျှော်လင့်တဲ့ ဖိုင်အဆုံးသတ်။ +PEParseRuleWSOnly=နေရာလပ် စာတန်းကိုသာ စည်းကမ်းအဖြစ် သတ်မှတ်ထားတယ်။ +PEDeclDropped=ကြေညာချက် ရုပ်သိမ်းပြီ။ +PEDeclSkipped=နောက်ထပ် ကြေညာချက်ဆီ ခုန်သွားပါ။ +PEUnknownProperty=အမည်မသိ ဂုဏ်အင်္ဂါရပ် '%1$S'။ +PEValueParsingError='%1$S' ဖေါ်ပြတဲ့ တန်ဖိုး မှားနေတယ်။ +PEExpectEndValue=တန်ဖိုး အဆုံးသတ်ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PERuleTrailing=တန်ဖိုး အဆုံးသတ်ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PESkipAtRuleEOF2=at-rule ၏ အဆုံး +PEUnknownAtRule=Unrecognized at-rule or error parsing at-rule '%1$S'. +PECharsetRuleEOF=@charset မှ အက္ခရာ စာတန်း စည်းကမ်း +PECharsetRuleNotString=အက္ခရာ စာတန်းကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEGatherMediaEOF=end of media list in @import or @media rule +PEGatherMediaNotComma=မီဒီယာ စာရင်းထဲက ',' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEGatherMediaNotIdent=မီဒီယာ စာရင်းထဲက ထုတ်ဖေါ်သူကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEGatherMediaReservedMediaType=မီဒီယာအမျိုးအစားများကို ရှာဖွေနေစဉ် အသုံးမပြုနိုင်သော သော့ချက်စာလုံး ‘%1$S’ ကို တွေ့ရှိခဲ့သည်။ +PEParseSourceSizeListEOF=ကိုက်ညီလိုသော မီဒီယာတိုက်စစ်မှုအတွက် စာလုံးအရေအတွက်တန်ဖိုး +PEParseSourceSizeListNotComma=တန်ဖိုး အဆုံးသတ်ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEImportNotURI=@import စည်းကမ်းထဲမှ URI ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEImportBadURI=@import စည်းမျဉ်းရဲ့ '%1$S' နေရာမှာ URI မှားနေတယ်။ +PEImportUnexpected=@import ထဲမှ ​ မျှော်လင့် မထားတဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEGroupRuleEOF2=@media, @supports သို့မဟုတ် @-moz-document စည်းမျဉ်းအဆုံးသတ် +PEGroupRuleNestedAtRule=%1$S အား @media or @-moz-document စည်မျဉ်းများတွင်ခွင့်မပြုပါ။ +PEMozDocRuleBadFunc2=@-moz-document စည်းကမ်းထဲမှ url(), url-prefix(), or domain() ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEMozDocRuleNotURI=@-moz-document စည်းကမ်းထဲမှ URI ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEMozDocRuleNotString=@-moz-document စည်းမျဉ်း regexp() function တွင် စာသားကို မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကိုသာ တွေ့ရသည်။ +PEMozDocRuleEOF=@-moz-document စည်းမျဉ်း ထဲက နောက် URI +PEAtNSPrefixEOF=@namespace စည်းကမ်းထဲမှ ရှေ့ဆက် အမည်ပေးစနစ် +PEAtNSURIEOF=@namespace စည်းကမ်းထဲမှ အမည်ပေးစနစ် URI +PEAtNSUnexpected=@namespace ထဲမှ မမျှော်လင့်ထားတဲ့ အမှတ်အသား '%1$S'. +PEKeyframeNameEOF=@keyframes စည်ကမ်း နာမည်။ +PEKeyframeBadName=@keyframes စည်းမျဉ်းအမည်အတွက် identifier ကို မျှော်မှန်းထားသည်။ +PEKeyframeBrace=@keyframes စည်းမျဉ်းအတွက် အဖွင့် { ကို မျှော်မှန်းထားသည်။ +PESkipDeclBraceEOF=ကြေငြာချက် အကွက်ရဲ့ အပိတ် } +PESkipRSBraceEOF=မမှန်ကန်တဲ့ စည်းကမ်း ချမှတ်ချက်ရဲ့ အပိတ် } +PEBadSelectorRSIgnored=ဆိုးတဲ့ ရွေးချယ်သူကြောင့် စည်းကမ်း ချမှတ်ချက်ကို ​လျစ်လျူရှုထားတယ်။ +PEBadSelectorKeyframeRuleIgnored=selector အမှားကြောင့် Keyframe စည်းမျဉ်းကို လျစ်လျူရှုထားသည်။ +PESelectorListExtraEOF=‘,’ သို့မဟုတ် ‘{’ +PESelectorListExtra=Expected ',' or '{' but found '%1$S'. +PESelectorGroupNoSelector=မျှော်လင့်ထားတဲ့ ရွေးချယ်သူ။ +PESelectorGroupExtraCombinator=တွဲလွဲကျ ပေါင်းစပ်ပေးသူ။ +PECounterStyleNotIdent=@counter-style စည်းမျဉ်း၏ အမည်အတွက် identifier ကို မျှော်မှန်းထားသည်။ +PECounterStyleBadName=@counter-style စည်းမျဉ်း၏ အမည်သည် ‘%1$S’ မဖြစ်ရပါ။ +PECounterStyleBadBlockStart=@font-face စည်းမျဉ်း စတင်ဖို့ '{' ရှိရမဲ့အစား '%1$S' ကို တွေ့ရတယ်။ +PECounterStyleEOF=@counter-style စာပိုဒ်၏ အပိတ် ‘}’ +PECounterDescExpected=ဖောင့် ဖေါ်ပြ ကိရိယာကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEUnknownCounterDesc=@font-face စည်းကမ်းထဲမှ အမည်မသိ ဖေါ်ပြကိရိယာ '%1$S'။ +PECounterExtendsNotIdent=အမျိုးအစား ​ရွေးချယ်သူ အတွက် ထုတ်ဖေါ်သူကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PECounterASWeight=အဖြည့်သင်္ကေတ ဖော်ပြချက်ရှိ အလေး(weight) တစ်ခုချင်းစီသည် အရင်အလေး(weight)အောက် ငယ်ရပါမည်။ +PEClassSelEOF=အမျိုးအစား အမည် +PEClassSelNotIdent=အမျိုးအစား ​ရွေးချယ်သူ အတွက် ထုတ်ဖေါ်သူကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PECoordinatePair=ကိန်းပြည့်တခု မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PETypeSelEOF=အစိတ်အပိုင်း အမျိုးအစား +PETypeSelNotType=Expected element name or '*' but found '%1$S'. +PEUnknownNamespacePrefix=အမည်မသိ အမည်ပေးစနစ် ရှေ့ဆက် '%1$S'။ +PEAttributeNameEOF=ပင်ကိုယ်အရည်အသွေး အမည် +PEAttributeNameExpected=ပင်ကိုယ်အရည်အသွေး အမည်အတွက် ထုတ်ဖေါ်သူကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့​ရှိတယ်။ +PEAttributeNameOrNamespaceExpected=ပင်ကိုယ်အရည်အသွေး အမည် (သို့) အမည်ပေးစနစ်ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့​ရှိတယ်။ +PEAttSelNoBar='|' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့​ရှိတယ်။ +PEAttSelInnerEOF=ပင်ကိုယ်အရည်အသွေး ရွေးချယ်သူရဲ့ အစိတ်အပိုင်း +PEAttSelUnexpected=ပင်ကိုယ်အရည်အသွေး ရွေးချယ်​သူဆီမှ မမျှော်လင့်ထားတဲ့ အမှတ်အသား - : '%1$S'။ +PEAttSelValueEOF=ပင်ကိုယ်အရည်အသွေး တန်ဖိုး +PEAttSelCloseEOF=ပင်ကိုယ်အရည်အသွေး ရွေးချယ်သူ အဆုံးသတ်ဖို့ ']' +PEAttSelNoClose=ပင်ကိုယ်အရည်အသွေး ရွေးချယ်သူ အဆုံးသတ်ဖို့ ']' ကို မျှော်လင့်ထားပေးမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEAttSelBadValue=Expected identifier or string for value in attribute selector but found '%1$S'. +PEPseudoSelEOF=pseudo-class (သို့) pseudo-element အမည် +PEPseudoSelBadName=pseudo-class (သို့) pseudo-element အတွက် ထုတ်ဖေါ်သူကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEPseudoSelNonFunc=non-function pseudo-class (သို့) pseudo-element (သို့) အခြားတဖက်မှာ၊ '%1$S' ဖတ်ရှုနေချိန်အတွက် လုပ်ဆောင်ချက် အမှတ်အသား၊ +PEPseudoSelNotPE=pseudo-element မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEPseudoSelDoubleNot=ဆန့်ကျင်ဖက် pseudo-class က '%1$S' ကို မဆန့်ကျင်နိုင်ဘူး။ +PEPseudoSelPEInNot=Pseudo-elements က '%1$S' ကို မဆန့်ကျင်နိုင်ဘူး။ +PEPseudoSelNewStyleOnly=This pseudo-element must use the "::" form: '%1$S'. +PEPseudoSelEndOrUserActionPC=pseudo-element ၏ နောက်တွင် selector သို့မဟုတ် user action pseudo-class ၏ အပိတ်ကို မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကိုသာ တွေ့ရသည်။ +PEPseudoSelNoUserActionPC=user action pseudo-class များကို အသုံးမပြုနိုင်သော pseudo-element နောက်တွင် selector အပိတ်ကို မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကိုသာ တွေ့ရသည်။ +PEPseudoSelMultiplePE=အပို pseudo-element '%1$S'။ +PEPseudoSelUnknown=အမည်မသိ pseudo-class or pseudo-element '%1$S'။ +PENegationEOF=ဆန့်ကျင်ဖက်အတွင်းမှ ရွေးချယ်သူ +PENegationBadInner=ဆန့်ကျင်ဖက် pseudo-class ဆွေးနွေးချက် '%1$S' ကဲ့သို့ ရိုးရိုး ရွေးချယ်သူ ပုံပျက်သွားတယ်။ +PENegationNoClose=ဆန့်ကျင်ဖက် pseudo-class '%1$S' မှာ ')' အပိတ် ပျောက်နေတယ်။ +PENegationBadArg=pseudo-class '%1$S' ကို ဆန့်ကျင်ပြီး ဆွေးနွေးချက် ပျောက်နေတယ်။ +PEPseudoClassArgEOF=pseudo-class ရွေးချယ်သူ ဆွေးနွေးချက် +PEPseudoClassArgNotIdent=pseudo-class အကန့်အသတ် အတွက် ထုတ်ဖေါ်သူကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEPseudoClassArgNotNth=pseudo-class နဲ့ ပါတ်သက်ပြီး ​ဆွေးနွေးချက် အစိတ်အပိုင်းကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို ​မတွေ့ဘူး။ +PEPseudoClassNoClose=pseudo-class ထဲက ပျောက်ဆုံးသွားတဲ့ အပိတ် ')' အစား '%1$S' ကို တွေ့ရှိတယ်။ +PEPseudoClassNoArg=pseudo-class '%1$S' ထဲမှ ပျောက်ဆုံးနေတဲ့ ဆွေးနွေးချက် +PEPseudoClassNotUserAction=pseudo-element ၏ နောက်တွင် selector သို့မဟုတ် user action pseudo-class ၏ အပိတ်ကို မျှော်မှန်းထားသော်လည်း pseudo-class ‘%1$S’ ကိုသာ တွေ့ရသည်။ +PESelectorEOF=ရွေးချယ်သူ +PEBadDeclBlockStart=ကြေညာချက် အကွက် စတင်ဖို့ '{' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEColorEOF=အရောင် +PEColorNotColor=အရောင်ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEColorComponentEOF=အရောင် အစိတ်အပိုင်း +PEExpectedPercent=ရာခိုင်နှုန်းတခုကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEExpectedInt=ကိန်းပြည့်တခု မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEExpectedNumberOrAngle=ကိန်းဂဏန်း သို့မဟုတ် ထောင့်တန်ဖိုး မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကိုသာ တွေ့ရသည်။ +PEExpectedNumberOrPercent=ကိန်းဂဏန်း သို့မဟုတ် ရာခိုင်နှုန်းတန်ဖိုး မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကိုသာ တွေ့ရသည်။ +PEColorBadRGBContents=ဂဏန်း (သို့) rgb() နဲ့ ရာခိုင်နှုန်းကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEColorComponentBadTerm='%2$S' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEColorHueEOF=အရောင်အသွေး +PEExpectedComma=',' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEColorSaturationEOF=ပျော်၀င်ခြင်း +PEColorLightnessEOF=ပါးလွှာမှု +PEColorOpacityEOF=အရောင် တန်ဖိုးထဲမှ အလင်းပိတ်မှု +PEExpectedNumber=ဂဏန်း တခုကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEPositionEOF= +PEExpectedPosition=ကို မျှော်လင့်ထားသော်လည်း '%1$S' ကိုသာ တွေ့ခဲ့သည်။ +PEExpectedRadius='|' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့​ရှိတယ်။ +PEExpectedCloseParen=')' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEDeclEndEOF=ကြေငြာချက်ကို အဆုံးသတ်ဖို့ ';' (သို့) '}' +PEParseDeclarationNoColon=':' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEParseDeclarationDeclExpected=ကြေ​ညာချက်ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEEndOfDeclEOF=ကြေညာချက် အဆုံးသတ် +PEImportantEOF=အရေးကြီး +PEExpectedImportant='​အရေးကြီး' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEBadDeclEnd=ကြေညာချက်ကို အဆုံးသတ်ဖို့ ';' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEBadDeclOrRuleEnd2=ကြေညာချက်ကို အဆုံးသတ်ဖို့ ';' (သို့) '}' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEInaccessibleProperty2=အတွင်းပိုင်း ဂုဏ်အင်္ဂါရပ်အတွက် တန်ဖိုးကို မသတ်မှတ်နိုင်ဘူး။ +PECommentEOF=မှတ်ချက်ပေးမှု အဆုံးသတ် +SEUnterminatedString=ပိတ်မထားတဲ့ '%1$S' စာတန်းကို တွေ့ရှိတယ်။ +PEFontDescExpected=ဖောင့် ဖေါ်ပြ ကိရိယာကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEUnknownFontDesc=@font-face စည်းကမ်းထဲမှ အမည်မသိ ဖေါ်ပြကိရိယာ '%1$S'။ +PEMQExpectedExpressionStart=မီဒီယာ မေးမြန်းမှု ဖေါ်ပြချက် စတင်ဖို့ '(' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို​ တွေ့ရှိတယ်။ +PEMQExpressionEOF=မီဒီယာ မေးမြန်းမှု ဖေါ်ပြချက် အကြောင်းအရာများ +PEMQExpectedFeatureName=မီဒီယာ အင်္ဂါရပ်အမည်ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEMQExpectedFeatureNameEnd=မီဒီယာ အင်္ဂါရပ်အမည်နောက်မှာ ':' (သို့) ')' ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEMQNoMinMaxWithoutValue=အနည်း- (သို့) အများ- တန်ဖိုး တခု ရှိနေရမဲ့ မီဒီယာ အင်္ဂါရပ်များ +PEMQExpectedFeatureValue=မီဒီယာ အင်္ဂါရပ်အတွက် မမှန်တဲ့ တန်ဖိုးကို တွေ့ရှိတယ်။ +PEBadFontBlockStart=@font-face စည်းမျဉ်း စတင်ဖို့ '{' ရှိရမဲ့အစား '%1$S' ကို တွေ့ရတယ်။ +PEBadFontBlockEnd=@font-face စည်းမျဉ်း အဆုံးသတ်ဖို့ '}' ရှိရမဲ့အစား '%1$S' ကို တွေ့ရတယ်။ +PEAnonBoxNotAlone=နာမည်မပါတဲ့ ဇယားကွက် မရှိရ။ +PEFFVUnexpectedEOF=မမျှော်မှန်းထားသော @font-feature-values စည်းမျဉ်း၏ အပိတ် +PEFFVBlockStart=@font-face စည်းမျဉ်း အဆုံးသတ်ဖို့ '}' ရှိရမဲ့အစား '%1$S' ကို တွေ့ရတယ်။ +PEFFVValueSetStart=@font-face စည်းမျဉ်း အဆုံးသတ်ဖို့ '}' ရှိရမဲ့အစား '%1$S' ကို တွေ့ရတယ်။ +PEFFVNoFamily=@font-face စည်းမျဉ်း အဆုံးသတ်ဖို့ '}' ရှိရမဲ့အစား '%1$S' ကို တွေ့ရတယ်။ +PEFFVUnexpectedBlockEnd=@font-face စည်းမျဉ်း အဆုံးသတ်ဖို့ '}' ရှိရမဲ့အစား '%1$S' ကို တွေ့ရတယ်။ +PEFFVUnknownFontVariantPropValue=အမည်မသိရသော font-variant property တန်ဖိုး ‘%1$S’ +PEFFVExpectedIdent=ဂဏန်း တခုကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEFFVExpectedValue=အနုတ်မဟုတ်သော ကိန်းပြည့်ကို မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကို တွေ့ရှိခဲ့သည်။ +PEFFVTooManyValues=feature အမျိုးအစား ‘%1$S’ အတွက် တန်ဖိုးအရေအတွက် များလွန်းနေသည်။ +PEFFVGenericInFamilyList=ဖောင့်မိသားစုစာရင်းတွင် ယေဘုယျ ဖောင့်မိသားစုအမည် မပါဝင်ရပါ။ +PEFFVValueDefinitionTrailing=တန်ဖိုး အဆုံးသတ်ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +PEBadDirValue=direction selector တွင် ‘ltr’ သို့မဟုတ် ‘rtl’ ကို မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကို တွေ့ရှိခဲ့သည်။ +PESupportsConditionStartEOF2=‘not’, ‘(’, သို့မဟုတ် function +PESupportsConditionInParensEOF=‘)’ +PESupportsConditionNotEOF=‘not’ +PESupportsWhitespaceRequired=‘not’, ‘and’, သို့မဟုတ် ‘or’ တို့၏နောက်တွင် ဝှိုက်စပေ့ကို မျှော်မှန်းထားသည်။ +PESupportsConditionExpectedOpenParenOrFunction=supports condition ကို parse ဆောင်ရွက်နေစဉ် ‘(’ သို့မဟုတ် function ကို မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကို တွေ့ရှိခဲ့သည်။ +PESupportsConditionExpectedCloseParen=supports condition ကို parse ဆောင်ရွက်နေစဉ် ‘)’ ကို မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကို တွေ့ရှိခဲ့သည်။ +PESupportsConditionExpectedStart2=supports condition ကို parse ဆောင်ရွက်နေစဉ် ‘not’၊ ‘(’ သို့မဟုတ် function တို့ကို မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကို တွေ့ရှိခဲ့သည်။ +PESupportsConditionExpectedNot=supports condition ကို parse ဆောင်ရွက်နေစဉ် ‘not’ ကို မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကို တွေ့ရှိခဲ့သည်။ +PESupportsGroupRuleStart=@font-face စည်းမျဉ်း စတင်ဖို့ '{' ရှိရမဲ့အစား '%1$S' ကို တွေ့ရတယ်။ +PEFilterEOF=စစ်ထုတ်ရန် +PEExpectedNoneOrURL=Expected ',' or '{' but found '%1$S'. +PEExpectedNoneOrURLOrFilterFunction=‘none’၊ URL သို့မဟုတ် filter function ကို မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကို တွေ့ရှိခဲ့သည်။ +PEExpectedNonnegativeNP=အနုတ်မဟုတ်သော ကိန်းပြည့် သို့မဟုတ် ရာခိုင်နှုန်းကို မျှော်မှန်းထားသည်။ +PEFilterFunctionArgumentsParsingError=filter function အတွက် argument များကို parse လုပ်နေစဉ် အမှားဖြစ်ပေါ်ခဲ့သည်။ +PEVariableEOF=ကိန်းရှင်များ +PEVariableEmpty=တန်ဖိုး အဆုံးသတ်ကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့ရှိတယ်။ +# LOCALIZATION NOTE(PEValueWithVariablesParsingErrorInValue): %1$S is replaced +# with the property name and %2$S is replaced with the property value. +PEValueWithVariablesParsingErrorInValue=variable များကို အစားထိုးပြီးသည့်နောက်တွင် ‘%1$S’ အတွက် တန်ဖိုးကို parse လုပ်နေစဉ် အမှားဖြစ်ပေါ်ခဲ့သည်။ ထွက်ပေါ်လာသော တန်ဖိုးမှာ ‘%2$S’ ဖြစ်သည်။ +PEValueWithVariablesFallbackInherit=‘inherit’ သို့ ပြန်ပြောင်းထားသည်။ +PEValueWithVariablesFallbackInitial=‘initial’ သို့ ပြန်ပြောင်းထားသည်။ +PEInvalidVariableReference=Property တန်ဖိုးတွင် Variable အမှားကို ရည်ညွှန်းထားသည့် ရည်ညွှန်းတစ်ခု ပါဝင်နေသည်။ +PEInvalidVariableTokenFallback=variable reference fallback ၏ ထိပ်ဆုံးအဆင့်တွင် မှားနေသောအဖြတ် ‘%1$S’ ကို တွေ့ရသည်။ +PEExpectedVariableNameEOF=ကိန်းရှင်အမည်အတွက် identifier +PEExpectedVariableName=ပင်ကိုယ်အရည်အသွေး အမည်အတွက် ထုတ်ဖေါ်သူကို မျှော်လင့်ထားပေမဲ့ '%1$S' ကို တွေ့​ရှိတယ်။ +PEExpectedVariableFallback=‘,’ နောက်တွင် မှီငြမ်းကိန်းရှင်ကို မျှော်မှန်းထားသည်။ +PEExpectedVariableCommaOrCloseParen=မှီငြမ်းကိန်းရှင်ရှိ ကိန်းရှင်အမည်နောက်တွင် ‘,’ သို့မဟုတ် ‘)’ တို့ကို မျှော်မှန်းထားသော်လည်း ‘%1$S’ ကိုသာ တွေ့ခဲ့သည်။ +PESubgridNotSupported=CSS ဂရစ်ကွက်၏ အဓိကစာလုံး ‘subgrid’ အသုံးပြုမှုကို မဖွင့်ပေးထားပါ။ +PEMoreThanOneGridRepeatAutoFillInNameList=Only one repeat(auto-fill, …) is allowed in a name list for a subgrid. +PEMoreThanOneGridRepeatAutoFillFitInTrackList=Only one repeat(auto-fill, …) or repeat(auto-fit, …) is allowed in a track list. +PEMoreThanOneGridRepeatTrackSize=Only one track size is allowed inside repeat(auto-fit/auto-fill, …). + +TooLargeDashedRadius=Border radius is too large for ‘dashed’ style (the limit is 100000px). Rendering as solid. +TooLargeDottedRadius=Border radius is too large for ‘dotted’ style (the limit is 100000px). Rendering as solid. diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/HtmlForm.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/HtmlForm.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/HtmlForm.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/HtmlForm.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,49 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +Reset=ပြန်ချိန်ပါ +Submit=မေးမြန်းချက် တင်သွင်းပါ +Browse=လှော်​လှန်ပါ... +FileUpload=ဖိုင် တင်ပို့ပါ +DirectoryUpload=တင်ပို့ရန် ဖိုဒါ အားရွေးပါ +DirectoryPickerOkButtonLabel=တင်ပါ +# LOCALIZATION NOTE (IsIndexPromptWithSpace): The last character of the string +# should be a space (U+0020) in most locales. The prompt is followed by an +# input field. The space needs be escaped in the property file to avoid +# trimming. +IsIndexPromptWithSpace=ရှာဖွေနိုင်သောနေရာတစ်ခုဖြစ်သည်ထို့ကြောင့်စာလိုသောစာလုံးထည့်ကာရှာပါ:\u0020 +ForgotPostWarning=Form contains enctype=%S, but does not contain method=post. Submitting normally with method=GET and no enctype instead. +ForgotFileEnctypeWarning=ဖြည့်စွတ်ပုံစံမှာ ထည့်သွင်း ဖိုင်တခု ပါရှိတယ်၊ ဒါပေမဲ့ ​ဖြည့်စွတ်ပုံစံပေါ်မှာmethod=POST နဲ့ enctype=multipart/form-data ပျောက်ဆုံးနေတယ်။ ဖိုင်ကို ပို့လို့ မရဘူး။ +# LOCALIZATION NOTE (DefaultFormSubject): %S will be replaced with brandShortName +DefaultFormSubject=%S မှ ဖြည့်စွတ် ပေးပို့ချက် +CannotEncodeAllUnicode=A form was submitted in the %S encoding which cannot encode all Unicode characters, so user input may get corrupted. To avoid this problem, the page should be changed so that the form is submitted in the UTF-8 encoding either by changing the encoding of the page itself to UTF-8 or by specifying accept-charset=utf-8 on the form element. +AllSupportedTypes=အထောက်အပံ့ ပေးသော အမျိုးအစား အားလုံး +# LOCALIZATION NOTE (NoFileSelected): this string is shown on a +# when there is no file selected yet. +NoFileSelected=တစ်ဖိုင်မှမရွေးရသေးပါ +# LOCALIZATION NOTE (NoFilesSelected): this string is shown on a +# when there is no file selected yet. +NoFilesSelected=တစ်ဖိုင်မှမရွေးရသေးပါ +# LOCALIZATION NOTE (NoDirSelected): this string is shown on a +# when there is no directory +# selected yet. +NoDirSelected=မည်သည့် လမ်းကြောင်းမှ မရွေးထားပါ +# LOCALIZATION NOTE (XFilesSelected): this string is shown on a +# when there are more than one selected file. +# %S will be a number greater or equal to 2. +XFilesSelected=ဖိုင်ပေါင်း %S ဖိုင်ရွေးပြီး +ColorPicker=အရောင်ရွေးပါ +DatePicker=ရက်တစ်ရက်ရွေးပါ +# LOCALIZATION NOTE (AndNMoreFiles): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# This string is shown at the end of the tooltip text for when there are more than 21 files selected (when we will only list +# the first 20, plus an "and X more" line). #1 represents the number of files +# minus 20 and will always be a number equal to or greater than 2. So the +# singular case will never be used. +AndNMoreFiles=and one more;and #1 more +# LOCALIZATION NOTE (DefaultSummary): this string is shown on a
    when +# it has no direct child. Google Chrome should already have this +# string translated. +DefaultSummary=အသေးစိတ်များ diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/htmlparser.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/htmlparser.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/htmlparser.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/htmlparser.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,58 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# Encoding warnings and errors +EncNoDeclarationFrame=ဘောင်အတွင်းရှိစာတမ်းတွင် အက္ခရာအန်ကုဒ်ဒင်းကို မဖော်ပြထားပါ။ ဘောင်မပါပဲ စာတမ်းကို ကြည့်ပါက ၎င်းစာတမ်းသည် မတူညီပဲ ဖော်ပြပါလိမ့်မည်။ +EncNoDeclarationPlain=ယခု စာပြောင်များအတွက် character encoding ကြေညာမထားပါ။ US-ASCII ပြင်ပမှ စာများပါလာခဲ့ပါက ပုံမမှန်သောစာများ အဖြစ် ပြသကောင်းပြသနိုင်ပါသည်။ သယ်ယူလာသော ပရိုတိုကော တွင် character encoding ထည့်ပေးလိုက်မှသာ ကောင်းမွန်သော encoding ဖြစ်မြောက်ပြီး စာများ မှန်ကန်စွာ ပေါ်နေမည်ဖြစ်သည်။ +EncNoDeclaration=HTML စာတမ်း၏ အက္ခရာအန်ကုဒ်ဒင်းစနစ်ကို မကြေညာထားပါ။ အကယ်၍ စာတမ်းတွင် US-ASCII အပြင်ရှိ အက္ခရာများ ပါဝင်နေလျှင် အချို့ဘရောင်ဆာများ၏အပြင်အဆင်ကြောင့် စာတမ်းကို စာအမှားများနှင့် ဖော်ပြပါလိမ့်မည်။ စာတမ်းတွင် သို့မဟုတ် transfer protocol တွင် စာမျက်နှာ၏ အက္ခရာအန်ကုဒ်ဒင်းကို ကြေညာရပါမည်။ +EncLateMetaFrame=ဖိုင်၏ ပထမဆုံး 1024 ဘိုက်ကို ကြိုတင်ရှာဖွေကြည့်သောအခါ ဘောင်အတွင်းရှိ HTML စာတမ်း၏ အက္ခရာအန်ကုဒ်ဒင်းကြေငြာချက်ကို မတွေ့ရပါ။ စာတမ်းကို ဘောင်မထည့်ပဲ ကြည့်ရှုပါက စာမျက်နှာကို အလိုအလျောက် ပြန်ဖွင့်ပါမည်။ အန်ကုဒ်ဒင်းကြေငြာချက်သည် ဖိုင်၏ ပထမဆုံး 1024 ဘိုက်အတွင်း ရှိနေစေရန် လိုအပ်သည်။ +EncLateMeta=ဖိုင်၏ ပထမဆုံး 1024 ဘိုက်ကို ကြိုတင်ရှာဖွေကြည့်သောအခါ HTML စာတမ်း၏ အက္ခရာအန်ကုဒ်ဒင်းကြေငြာချက်ကို မတွေ့ရပါ။ မတူညီသော အပြင်အဆင်များ သတ်မှတ်ထားသည့် ဘရောင်ဇာတွင် ကြည့်ရှုပါက စာမျက်နှာကို အလိုအလျောက် ပြန်ဖွင့်ပါမည်။ အန်ကုဒ်ဒင်းကြေငြာချက်သည် ဖိုင်၏ ပထမဆုံး 1024 ဘိုက်အတွင်း ရှိနေစေရန် လိုအပ်သည်။ +EncLateMetaReload=ဖိုင်၏ ပထမဆုံး 1024 ဘိုက်ကို ကြိုတင်ရှာဖွေကြည့်သောအခါ HTML စာတမ်း၏ အက္ခရာအန်ကုဒ်ဒင်းကြေငြာချက်ကို မတွေ့ရသောကြောင့် စာမျက်နှာကို ပြန်ဖွင့်ထားသည်။ အန်ကုဒ်ဒင်းကြေငြာချက်သည် ဖိုင်၏ ပထမဆုံး 1024 ဘိုက်အတွင်း ရှိနေစေရန် လိုအပ်သည်။ +EncLateMetaTooLate=အက္ခရာအန်ကုဒ်ဒင်းကြေငြာချက်သည် သက်ရောက်မှုဖြစ်ရန် ကြာနေကြောင်း တွေ့ရသည်။ အန်ကုဒ်ဒင်းကြေငြာချက်သည် ဖိုင်၏ ပထမဆုံး 1024 ဘိုက်အတွင်း ရှိနေစေရန် လိုအပ်သည်။ +EncMetaUnsupported=HTML စာတမ်းအတွက် meta တက်ဂ်ကို အသုံးပြုပြီး အထောက်အပံ့မပြုထားသည့် အက္ခရာအန်ကုဒ်ဒင်းကို ကြေငြာထားသည်။ ကြေငြာချက်ကို လျစ်လျူရှုထားသည်။ +EncProtocolUnsupported=transfer protocol နေရာတွင် အထောက်အပံ့မပြုထားသည့် အက္ခရာအန်ကုဒ်ဒင်းကို ကြေငြာထားသည်။ ကြေငြာချက်ကို လျစ်လျူရှုထားသည်။ +EncBomlessUtf16=ပို့ဆောင်ရေး ပရိုတိုကောနှင့်ဘိုက် အစီအစဉ် မပါသော UTF-16-encoded လက်တင်(သီးသန့်) စာများတွေ့ရသှ်။ UTF-16 ဖြင့် encoding လုပ်ခြင်းသှ် မလုံလောက် သဖြင့် character encoding အား မည်သို့ပင်မဆို ကြေညာထားသင့်သှ်။ +EncMetaUtf16=character encoding အား UTF-16 အဖြစ်ကြေညာရန်အတွက် meta tag တစ်ခုအား သုံးထားသှ်။၎င်းအား UTF-8 အဖြစ်သာ ယူဆထားပါသှ်။ + +# The bulk of the messages below are derived from +# https://hg.mozilla.org/projects/htmlparser/file/1f633cef7de7/src/nu/validator/htmlparser/impl/ErrorReportingTokenizer.java +# which is available under the MIT license. + +# Tokenizer errors +errGarbageAfterLtSlash=“”။ +errGtInPublicId=အများဆိုင်သတ်မှတ်ချက်ရှိ “>”။ +errNamelessDoctype=အမည်မဲ့ စာတမ်းအမျိုးအစား။ +errBogusComment=မှတ်ချက်အမှား။ +errSlashNotFollowedByGt=မျဉ်းစောင်းသည် “>” နောက်တွင် ကပ်လျက် ရှိမနေပါ။ +errNoSpaceBetweenAttributes=တန်ဖိုးနှစ်ခုကြားတွင် ကွက်လပ်မရှိရပါ။ +errAttributeValueMissing=တန်ဖိုးမဖြည့်ထားပါ။ +errExpectedPublicId=အများဆိုင် identifier ကို မျှော်မှန်းထားသော်လည်း doctype နှင့် အဆုံးသတ်ထားသည်။ +errBogusDoctype=စာတမ်းအမျိုးအစား အမှား။ +maybeErrAttributesOnEndTag=တက်ဂ်အဆုံးတွင် အတ္ထရိဗြုတန်ဖိုးများ ရှိသည်။ +errEofInPublicId=အများဆိုင်အိုင်ဒန်တီဖိုင်ယာအတွင်းရှိ ဖိုင်အဆုံးသင်္ကေတ။ +errEofInComment=မှတ်ချက်အတွင်းရှိ ဖိုင်အဆုံးသင်္ကေတ။ +errEofInDoctype=စာတမ်းအမျိုးအစားထဲရှိ ဖိုင်အဆုံးသင်္ကေတ။ +errEofAfterLt=“<” နောက်ရှိ ဖိုင်အဆုံးသင်္ကေတ။ +errDuplicateAttribute=တန်ဖိုးရှိပြီးဖြစ်နေသည်။ +errEofInSystemId=စနစ်သတ်မှတ်ချက် အတွင်းရှိ ဖိုင်အဆုံးသင်္ကေတ။ +errMissingSpaceBeforeDoctypeName=စာတမ်းအမျိုးအစား အမည် မတိုင်မီ ကွက်လပ်ရှိနေရပါမည်။ +errHyphenHyphenBang=မှတ်ချက်ထဲတွင် “--!” ကို တွေ့ရသည်။ + +# Tree builder errors +errStrayStartTag2=မှားနေသော အဖွင့်တက်ဂ် “%1$S”။ +errStrayEndTag=မှားနေသော အပိတ်တက်ဂ် “%1$S”။ +errStrayDoctype=မှားယွင်းနေသော စာတမ်းအမျိုးအစား။ +errNonSpaceAfterFrameset=“frameset” နောက်တွင် ကွက်လပ်မရှိရပါ။ +errNonSpaceInFrameset=“frameset” တွင် ကွက်လပ်မပါဝင်ရပါ။ +errNonSpaceAfterBody=စာကိုယ်နောက်တွင် ကွက်လပ်မဟုတ်သော စာလုံး ဖြစ်ရပါမည်။ +errIsindex=“isindex” ကို တွေ့ရပြီးဖြစ်သည်။ +errFramesetStart=“frameset” အစတက်ဂ်ကို တွေ့ခဲ့ရသည်။ +errNoCellToClose=ပိတ်ရန် ဆဲလ်ကွက် မရှိပါ။ +errStartTagInTable=အစတက်ဂ် “%1$S” ကို “table” ထဲတွင် တွေ့ခဲ့ရသည်။ +errStartTagInTableBody=ဇယားကွက်စာကိုယ်ထဲရှိ “%1$S” အဖွင့်တက်ဂ်။ +errEndTagBr=အပိတ်တက်ဂ် “br”။ +errNoTableRowToClose=ပိတ်ရန် ဇယားကွက်အတန်း မရှိပါ။ diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/layout_errors.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/layout_errors.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/layout_errors.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/layout_errors.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,36 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +ImageMapRectBoundsError= စာအမှတ်ရဲ့ "coords" တွက်ချက်မှုဟာ "left,top,right,bottom" အမျိုးအစားထဲမှာ မပါဘူး။ +ImageMapCircleWrongNumberOfCoords= စာအမှတ်ရဲ့ "coords" တွက်ချက်မှုဟာ "center-x,center-y,radius" အမျိုးအစားထဲမှာ မပါဘူး။ +ImageMapCircleNegativeRadius= စာအမှတ်ရဲ့ "coords" တွက်ချက်မှုမှာ ဆန့်ကျင်ဖက် အချင်း၀က်တခု ရှိတယ်။ +ImageMapPolyWrongNumberOfCoords= စာအမှတ်ရဲ့ "coords" တွက်ချက်မှုဟာ "x1,y1,x2,y2 …" အမျိုးအစားထဲမှာ မရှိဘူး။ +ImageMapPolyOddNumberOfCoords= စာအမှတ်ရဲ့ "coords" တွက်ချက်မှုမှာ နောက်ဆုံး "y" ဆုံချက် ပျောက်ဆုံးနေတယ် (အမျိုးအစား အမှန်က "x1,y1,x2,y2 …" ဖြစ်တယ်)။ + +TablePartRelPosWarning=ဇယားအတန်းများနှင့် အတန်းအုပ်စုများ ဆက်စပ်နေရာချခြင်းကို လက်ရှိတွင် မဆောရွက်နိုင်ပါ။ ယခုဝဘ်ဆိုက်ကို အဆင့်မြှင့်ရန် လိုအပ်သည်။ အဘယ့်ကြောင့်ဆိုသော လက်ရှိတွင် ဘာမျှမဆောင်ရွက်သော ဒီလုပ်ဆောင်ချက်ပေါ် မှီခိုနေသောကြောင့် ဖြစ်သည်။ +ScrollLinkedEffectFound2=ဒီဆိုက်သည် scroll-linked နေရာချခြင်းသက်ရောက်မှုကို အသုံးပြုထားပုံရသည်။ ၎င်းသက်ရောက်မှုသည် အဆန်းခရိုနပ်စ် ပြောင်းရွေ့ပြသခြင်းနှင့် ကောင်းစွာ ဆောင်ရွက်နိုင်လိမ့်မည် မဟုတ်ပါ။ အခြားအသေးစိတ်များနှင့် ဆက်စပ်ကိရိယာများ၊ လုပ်ဆောင်ချက်များနှင့် ပတ်သက်ပြီး ဆွေးနွေးချက်တွင် ပါဝင်ရန် https://developer.mozilla.org/docs/Mozilla/Performance/ScrollLinkedEffects တွင် ကြည့်ရှုပါ။ + +## LOCALIZATION NOTE(CompositorAnimationWarningContentTooLarge2): +## (%1$S, %2$S) is a pair of integer values of the frame size +## (%3$S, %4$S) is a pair of integer values of a limit based on the viewport size +## (%5$S, %6$S) is a pair of integer values of an absolute limit +CompositorAnimationWarningContentTooLarge2=Animation cannot be run on the compositor because the frame size (%1$S, %2$S) is too large relative to the viewport (larger than (%3$S, %4$S)) or larger than the maximum allowed value (%5$S, %6$S) +## LOCALIZATION NOTE(CompositorAnimationWarningTransformBackfaceVisibilityHidden): +## 'backface-visibility: hidden' is a CSS property, don't translate it. +CompositorAnimationWarningTransformBackfaceVisibilityHidden=‘backface-visibility: hidden’ ကို အသုံးပြုထားသည့် သက်ဝင်ပြောင်းလဲမှုများသည် ကွန်ပိုစစ်တာပေါ်တွင် မဆောင်ရွက်နိုင်ပါ။ +## LOCALIZATION NOTE(CompositorAnimationWarningTransformPreserve3D): +## 'transform-style: preserve-3d' is a CSS property, don't translate it. +CompositorAnimationWarningTransformPreserve3D=‘transform-style: preserve-3d’ ကို အသုံးပြုထားသော သက်ဝင်ပြောင်းလဲမှုများသည် ကွန်ပိုစစ်တာပေါ်တွင် မဆောင်ရွက်နိုင်ပါ။ +## LOCALIZATION NOTE(CompositorAnimationWarningTransformSVG, +## CompositorAnimationWarningTransformWithGeometricProperties, +## CompositorAnimationWarningTransformWithSyncGeometricAnimations, +## CompositorAnimationWarningTransformFrameInactive, +## CompositorAnimationWarningOpacityFrameInactive): +## 'transform' and 'opacity' mean CSS property names, don't translate it. +CompositorAnimationWarningTransformSVG=SVG နှင့်အတူ အယ်လိမန့်များပေါ် ‘transform’ ကို အသုံးပြုထားသော သက်ဝင်ပြောင်းလဲမှုများသည် ကွန်ပိုစစ်တာပေါ်တွင် မဆောင်ရွက်နိုင်ပါ။ +CompositorAnimationWarningTransformWithGeometricProperties=ဂျီဩမေတြီတန်ဖိုးများ အသုံးပြုပြီး တူညီသော အယ်လိမန့်တွင် တစ်ချိန်တည်း သက်ဝင်လှုပ်ရှားမှု ပြုသောအခါ ‘transform’ ကို အသုံးပြုထားသော သက်ဝင်လှုပ်ရှားမှုများသည် ကွန်ပိုစစ်တာပေါ်တွင် မဆောင်ရွက်နိုင်ပါ။ +CompositorAnimationWarningTransformWithSyncGeometricAnimations=Animation of ‘transform’ cannot be run on the compositor because it should be synchronized with animations of geometric properties that started at the same time +CompositorAnimationWarningTransformFrameInactive=လှုပ်ရှားမှုသည် ကွန်ပိုစစ်တာပေါ်တွင် မဆောင်ရွက်နိုင်ပါ။ အဘယ့်ကြောင့်ဆိုသော် ‘transform’ ကို အသုံးပြုထားသော လှုပ်ရှားမှုအတွက် ယခုဘောင်သည် အသုံးပြုနေသည်ဟု မမှတ်သားထားသောကြောင့် ဖြစ်သည်။ +CompositorAnimationWarningOpacityFrameInactive=လှုပ်ရှားမှုသည် ကွန်ပိုစစ်တာပေါ်တွင် မဆောင်ရွက်နိုင်ပါ။ အဘယ့်ကြောင့်ဆိုသော် ‘opacity’ ကို အသုံးပြုထားသော လှုပ်ရှားမှုအတွက် ယခုဘောင်သည် အသုံးပြုနေသည်ဟု မမှတ်သားထားသောကြောင့် ဖြစ်သည်။ +CompositorAnimationWarningHasRenderingObserver=လှုပ်ရှားမှုသည် ကွန်ပိုစစ်တာပေါ်တွင် မဆောင်ရွက်နိုင်ပါ။ အဘယ့်ကြောင့်ဆိုသော် အယ်လိမန့်သည် လေ့လာစောင့်ကြည့်အရာများ (-moz-element သို့မဟုတ် SVG clipping/masking) ကို ချယ်မှုန်းထားသောကြောင့် ဖြစ်သည်။ diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/MediaDocument.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/MediaDocument.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/MediaDocument.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/MediaDocument.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,21 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#LOCALIZATION NOTE (ImageTitleWithDimensions2AndFile): first %S is filename, second %S is type, third %S is width and fourth %S is height +#LOCALIZATION NOTE (ImageTitleWithoutDimensions): first %S is filename, second %S is type +#LOCALIZATION NOTE (ImageTitleWithDimensions2): first %S is type, second %S is width and third %S is height +#LOCALIZATION NOTE (ImageTitleWithNeitherDimensionsNorFile): first %S is type +#LOCALIZATION NOTE (MediaTitleWithFile): first %S is filename, second %S is type +#LOCALIZATION NOTE (MediaTitleWithNoInfo): first %S is type +ImageTitleWithDimensions2AndFile=%S (%S ရုပ်ပုံ, %S × %S pixels) +ImageTitleWithoutDimensions=%S (%S ရုပ်ပုံ) +ImageTitleWithDimensions2=(%S ရုပ်ပုံ, %S × %S pixels) +ImageTitleWithNeitherDimensionsNorFile=(%S ရုပ်ပုံ) +MediaTitleWithFile=%S (%S ၀တ္ထု) +MediaTitleWithNoInfo=(%S ၀တ္ထု) + +InvalidImage=ရုပ်ပုံ “%S” ကို ၄င်းမှာ အမှား​များ ပါတဲ့အတွက် ပြသလို့ မရဘူး။ +ScaledImage=အချိုးကျသော (%S%%) + +TitleWithStatus=%S - %S diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/printing.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/printing.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/printing.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/printing.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,60 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# Page number formatting +## @page_number The current page number +#LOCALIZATION NOTE (pageofpages): Do not translate %ld in the following line. +# Place the word %ld where the page number and number of pages should be +# The first %ld will receive the the page number +pagenumber=%1$d + +# Page number formatting +## @page_number The current page number +## @page_total The total number of pages +#LOCALIZATION NOTE (pageofpages): Do not translate %ld in the following line. +# Place the word %ld where the page number and number of pages should be +# The first %ld will receive the the page number +# the second %ld will receive the total number of pages +pageofpages=%2$d ရဲ့ %1$d + +noprinter=ပုံနှိုပ်စက်များမရှိတော့ဘူး +PrintToFile=ဖိုင်ကို ပုံနှိုပ်ပါ +noPrintFilename.title=ဖိုင်အမည် ပျောက်ဆုံးနေတယ် +noPrintFilename.alert=သင်ဟာ "Print To: File" ကို ရွေးချယ်ထားတယ်၊ ဖိုင်အမည် ဗလာဖြစ်နေတယ်။ +fileConfirm.exists=%S တည်ရှိနေပြီးသား။\n၄င်းကို အစားထိုး လိုသလား။ +print_error_dialog_title=ပုံနှိုပ်စက် အမှား +printpreview_error_dialog_title=ပုံနှိုပ်ရန် အစမ်းမြင်ကွင်း အမှား + +# Printing error messages. +#LOCALIZATION NOTE: Some of these messages come in pairs, one +# for printing and one for print previewing. You can remove that +# distinction in your language by removing the entity with the _PP +# suffix; then the entity without a suffix will be used for both. +# You can also add that distinction to any of the messages that don't +# already have it by adding a new entity with a _PP suffix. +# +# For instance, if you delete PERR_GFX_PRINTER_DOC_IS_BUSY_PP, then +# the PERR_GFX_PRINTER_DOC_IS_BUSY message will be used for that error +# condition when print previewing as well as when printing. If you +# add PERR_FAILURE_PP, then PERR_FAILURE will only be used when +# printing, and PERR_FAILURE_PP will be used under the same conditions +# when print previewing. +# +PERR_FAILURE=ပုံနှိပ်နေစဉ်အတွင်းမှားယွင်းမှုတစ်စုံတစ်ရာဖြစ်ပေါ်ခဲ့တယ် + +PERR_ABORT=ပုံနှိုပ်တဲ့အလုပ်ကို ဖျက်သိမ်း (သို့) ပယ်ဖျက်လိုက်တယ်။ +PERR_NOT_AVAILABLE=ပုံနှိပ်မှုတွင်ပါဝင်သောလုပ်ဆောင်ချက်အချို့အားယခုလောလောဆယ်တွင်မရရှိနိုင်သေးပါ +PERR_NOT_IMPLEMENTED=အချို့ ပုံနှိုပ်ခြင်း လုပ်ဆောင်ချက်ကို အသုံးမပြုသေးဘူး။ +PERR_OUT_OF_MEMORY=ပုံနှိပ်ရန်အတွက်မန်မိုရီလုံလောက်မှုမရှိပါ +PERR_UNEXPECTED=မမျှော်လင့် သောပြဿနာပုံနှိပ်နေစဉ်ဖြစ်ပွားခဲ့သည် + +PERR_GFX_PRINTER_NO_PRINTER_AVAILABLE=ပုံနှိပ်စက်မရှိပါ +PERR_GFX_PRINTER_NO_PRINTER_AVAILABLE_PP=ပုံနှိပ်စက်မရှိသည့် အတွက်နမူနာပြသနိုင်ခြင်းမရှိပါ +PERR_GFX_PRINTER_NAME_NOT_FOUND=ရွေးထားသောပုံနှိပ်စက်အားရှာမတွေ့ပါ +PERR_GFX_PRINTER_COULD_NOT_OPEN_FILE=ထွက်လာသောဖိုင်အား ဖိုင်မှပုံနှိပ်ထုတ်ရန် မရပါ +PERR_GFX_PRINTER_STARTDOC=စာမျက်နှာကို စတင်တဲ့အခါ ပုံနှိုပ်ခြင်း ပျက်သွားတယ်။ +PERR_GFX_PRINTER_ENDDOC=ပုံနှိပ်ရန်ပြင်နေစဉ်အတွင်းပျက်သွားသည် +PERR_GFX_PRINTER_STARTPAGE=စာမျက်နှာအသစ်တစ်ခုအားပုံနှိပ်နေစဉ်ပျက်သွားသှ် +PERR_GFX_PRINTER_DOC_IS_BUSY=ယခုစာရွက်စာတမ်းအား ပုံနှိပ်မရသေးပါ ၊ ၎င်းအားရယူနေစဉ်ဖြစ်နေသှ် ။ +PERR_GFX_PRINTER_DOC_IS_BUSY_PP=ပုံနှိပ်အစမ်းကြည့်မြင်ကွင်းအားယခု စာရွက်စာတမ်းအတွက်မရသေးပါ ၊ ဖိုင်ရယူနေတုန်းဖြစ်သှ်။ diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/xbl.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/xbl.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/xbl.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/xbl.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,15 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +UnexpectedElement=မျှော်လင့်မထားတဲ့ <%1$S> အစိတ်အပိုင်း။ +# LOCALIZATION NOTE: do not localize key=“%S” modifiers=“%S” id=“%S” +GTK2Conflict2=Key event not available on GTK2: key=“%S” modifiers=“%S” id=“%S” +WinConflict2=Key event not available on some keyboard layouts: key=“%S” modifiers=“%S” id=“%S” +TooDeepBindingRecursion=XBL ချည်နှောင်ချက် "%S" ဟာ များစွာသော ရှေ့ပြေး အစိတ်အပိုင်းများက သုံးစွဲနေပြီး၊ မဆုံးနိုင်တဲ့ ထပ်ခါ ဖြစ်ပေါ်မှုကို တားဆီးပေးဖို့ မသက်ဆိုင်ဘူး။ +CircularExtendsBinding=XBL ချည်နှောင်မှု "%S" ကို "%S" နဲ့ တိုးချဲ့ရာမှ ၄င်းကိုယ်တိုင် တိုးချဲ့မှုကို ဖြစ်ပေါ်စေတယ် +# LOCALIZATION NOTE: do not localize +CommandNotInChrome= သုံးစွဲမှုကို ခရွန်းအပြင်ဘက်မှာ ခွင့်မပြုဘူး။ +MalformedXBL = XBL ဖိုင်တစ်ခု ပုံမှန်ဖြစ်နေသှ်. သင် XBL namespace အား bindings tag တွင် မေ့ခဲ့သလား? +InvalidExtendsBinding="%S" ကို တိုးချဲ့ခြင်းဟာ မမှန်ကန်ဘူး။ ယေဘုယျ အားဖြင့်၊ တိုးချဲ့ စာအမှတ် အမည်များကို မတိုးချဲ့ပါနဲ့။ +MissingIdAttr = “id” attribute တစ်ခု binding tag တွင်ပျောက်နေသှ် diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/xmlparser.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/xmlparser.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/xmlparser.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/xmlparser.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,48 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# Map Expat error codes to error strings +1 = မှတ်ဉာဏ် ကုန်သွားတယ် +2 = ဝါကျဖွဲ့ထုံး အမှား +3 = အစိတ်အပိုင်း မတွေ့ရဘူး +4 = ကောင်းကောင်း မဖွဲ့စည်းထားဘူး +5 = ဖွင့်ထားတဲ့ အမှတ်အသား +6 = စရိုက် တပိုင်းတစ +7 = မကိုက်ညီတဲ့ စာအမှတ် +8 = ပုံတူပွားတဲ့ အရည်အသွေး +9 = စာရွတ်စာတမ်း အစိတ်အပိုင်း နောက်မှ မလိုအပ်မှု +10 = တရားမ၀င် အကန့်အသတ် ရပ်တည်မှု ကိုးကားချက် +11 = သတ်မှတ်မထားတဲ့ ရပ်တည်မှု +12 = ထပ်ဆင့် ရပ်တည်မှု ကိုးကားချက် +13 = asynchronous ရပ်တည်မှု +14 = မမှန်ကန်တဲ့ အက္ခရာ နံပါတ်ကို ကိုးကားချက် +15 = ဒွိစုံကိန်း ရပ်တည်မှုကို ကိုးကားချက် +16 = အရေအသွေးထဲမှ ပြင်ပဆိုင်ရာ ရပ်တည်မှုကို ကိုးကားချက် +17 = XML (သို့) စာသား ကြေညာချက်ကို ရပ်တည်မှုအစမှာ မလုပ်ဘူး +18 = အမည်မသိ စာဝုက် ရေးသားခြင်း +19 = XML ကြေညာချက်မှာ သတ်မှတ်ထားတဲ့ စာဝှက် ရေးသားခြင်းဟာ မမှန်ကန်ဘူး +20 = ဖွင့်ထားတဲ့ CDATA အပိုင်း +21 = ပြင်ပ ရပ်တည်မှု ကိုးကားချက် လုပ်ဆောင်နေစဉ် အမှား +22 = စာရွတ်စာတမ်းက တည်းခြားရပ်တည်တာ မဟုတ်ဘူး +23 = မမျှော်လင့်တဲ့ ခွဲခြားဖေါ်ပြမှု အခြေအနေ +24 = အကန့်အသတ် ရပ်တည်မှုထဲ ဖေါ်ပြထားတဲ့ ရပ်တည်မှု +27 = အမည်ပေးစနစ် တခုနဲ့ မဆိုင်တဲ့ ရှေ့ဆက် +28 = ရှေ့ဆက်ကို မပိတ်ပင်ရဘူး +29 = အကန့်အသတ် ရပ်တည်မှုထဲမှ မပြည့်စုံတဲ့ မြှင့်တင်မှု +30 = XML ကြေညာချက် ကောင်းကောင်း ဖွဲ့စည်းမထားဘူး +31 = စာသား ကြေညာချက် ကောင်းကောင်း ဖွဲ့စည်းမထားဘူး +32 = မမှန်ကန်တဲ့ အက္ခရာများ(s) +38 = reserved prefix (xml) must not be undeclared or bound to another namespace name +39 = reserved prefix (xmlns) must not be declared or undeclared +40 = ရှေ့ဆက်ကို ထိန်းသိမ်းထားတဲ့ အမည်ပေးစနစ် အမည်များထဲမှ တခုနဲ့ မသက်ဆိုင်စေရဘူး + +# %1$S is replaced by the Expat error string, may be followed by Expected (see below) +# %2$S is replaced by URL +# %3$u is replaced by line number +# %4$u is replaced by column number +XMLParsingError = XML အမှား ခွဲခြား ဖေါ်ပြခြင်း - %1$S\nတည်နေရာ - %2$S\nလိုင်း အရေအတွက် %3$u, ကော်လံ %4$u: + +# %S is replaced by a tag name. +# This gets appended to the error string if the error is mismatched tag. +Expected = ။ မျှော်လင့်ထားချက် - . diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/xul.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/xul.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/layout/xul.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/layout/xul.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,8 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +MissingOverlay=အိုဗာလေးလုပ်ရန် %1$S မှာပျက်သွားသည်။ +PINotInProlog= လုပ်ဆောင်နေတဲ့ ညွှန်ကြားချက်မှာ ရှေ့ပြေးအပြင် တခြား သက်ရောက်မှု မရှိတော့ဘူ။ (ကြည်ရှုရန် bug 360119)။ +NeededToWrapXUL=%1$S အတွက် XUL သေတ္တာမှာ မျဉ်းပေါ်မှ %2$S ကလေးငယ် တခု ပါရှိပြီး၊ ၄င်းရဲ့ ​ကလေးငယ်များ အားလုံးကို အကွက်တခုထဲမှာ အတင်း ထုပ်ပိုးစေတယ်။ +NeededToWrapXULInlineBox=XUL box for %1$S element contained an inline %2$S child, forcing all its children to be wrapped in a block. This can often be fixed by replacing "display: -moz-inline-box" with "display: -moz-inline-box; display: inline-block". diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/mathml/mathml.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/mathml/mathml.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/mathml/mathml.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/mathml/mathml.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,17 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +InvalidChild=မက္ကပ်အရေးအသား မှားနေသည်။ <%1$S> သည် <%2$S> အောက်တွင် ရှိမနေရပါ။ +ChildCountIncorrect=Invalid markup: Incorrect number of children for <%1$S/> tag. +DuplicateMprescripts=Invalid markup: More than one in . +# LOCALIZATION NOTE: The first child of is the base, that is the element to which scripts are attached. +NoBase=Invalid markup: Expected exactly one Base element in . Found none. +SubSupMismatch=Invalid markup: Incomplete subscript/superscript pair in . + +# LOCALIZATION NOTE: When localizing the single quotes ('), follow the conventions in css.properties for your target locale. +AttributeParsingError=Error in parsing the value ‘%1$S’ for ‘%2$S’ attribute of <%3$S/>. Attribute ignored. +AttributeParsingErrorNoTag=Error in parsing the value ‘%1$S’ for ‘%2$S’ attribute. Attribute ignored. +LengthParsingError=Error in parsing MathML attribute value ‘%1$S’ as length. Attribute ignored. +DeprecatedSupersededBy=‘%1$S’ is deprecated in MathML 3, superseded by ‘%2$S’. +UnitlessValuesAreDeprecated=Unitless values are deprecated in MathML 3. diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/netErrorApp.dtd firefox-54.0~b2+build1/l10n/my/dom/chrome/netErrorApp.dtd --- firefox-54.0~b1+build1/l10n/my/dom/chrome/netErrorApp.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/netErrorApp.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,23 @@ + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/netError.dtd firefox-54.0~b2+build1/l10n/my/dom/chrome/netError.dtd --- firefox-54.0~b1+build1/l10n/my/dom/chrome/netError.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/netError.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,88 @@ + + + + + + + + +Though the site seems valid, the browser was unable to establish a connection.

    • Could the site be temporarily unavailable? Try again later.
    • Are you unable to browse other sites? Check the computer's network connection.
    • Is your computer or network protected by a firewall or proxy? Incorrect settings can interfere with Web browsing.
    "> + + +ဖွင့်ကြည့်လိုသောလိပ်စာသည် Port တစ်ခုအား ညွှန်းနေသည် (ဥပမာ mozilla.org:80 သည် port 80ဖြင့်မော်ဇီလာဝတ်ဆိုဒ်အားဖွင့်ရန်ဖြစ်ပြီး) များသောအားဖြင့်၎င်းသည် ဝတ်ဆိုဒ်ကြည့်ရှူခြင်းထက်ပိုသောအသုံးချခြင်းအတွက်သုံးသည်။ဘယောင်ဆာသည်သင်၏ တောင်းဆိုလိပ်စာအား လုံခြုံရေးနှင့်စိတ်ချရရေးအတွက်ပြုလုပ်မပေးနိုင်ပါ

    "> + + +The browser could not find the host server for the provided address.

    • Did you make a mistake when typing the domain? (e.g. ww.mozilla.org instead of www.mozilla.org)
    • Are you certain this domain address exists? Its registration may have expired.
    • Are you unable to browse other sites? Check your network connection and DNS server settings.
    • Is your computer or network protected by a firewall or proxy? Incorrect settings can interfere with Web browsing.
    "> + + +
  • သင်ရှည်သည့်ပစ္စည်းအားအမည်ပြောင်းလိုက်ခြင်းသော်လည်ကောင်းရွေးလိုက်ခြင်းသော်လည်းကောင်းလုပ်လိုက်သေးလား။
  • လိပ်စာရေးရာတွင်စာလုံးပေါင်းအကြီးအသေးသို့မဟုတ်တိုက်ပိုအမှားများရှိနေလား
  • သို့မဟုတ်သင့်မှာ လုံလောက်သောခွင့်ပြုချက်ရရှိထားပါသလား
  • "> + + +
  • ၎င်းကို ဖျက်ထားခြင်း၊ ရွှေ့ထားခြင်း သို့မဟုတ် ဖိုင်အသုံးပြုမှုဆိုင်ရာမူဝါဒများက အသုံးမပြုနိုင်စေရန် တားမြစ်နေခြင်း ဖြစ်နိုင်ပါသည်။
  • "> + + +ယခုပြဿနာအတွက် နောက်ထပ် ဆက်လက်လေ့လာရန် အချက်အလက်များ မရှိသေးပါ။

    "> + + +ပေးထားသောလိပ်စာသည်သတ်မှတ်ထားသော ပုံစံမျိုးဖြင့်မဟုတ်ပါ။ကျေးဇူးပြုပြီးတည်နေရာပြဘားအားအမှားများရှာရန်အတွက်စစ်ဆေးပါ

    "> + + +ဘယောင်ဆာသည်အောင်မြင်စွာချိတ်ဆက်သွားနိုင်သော်လည်းအချက်အလက်များ ကူးပြောင်းယူနေစဉ်အတွင်းချိတ်ဆက်မှူနှောက်ယှက်ခံရသည်။ကျေးဇူးပြုပြီးထပ်လုပ်ပါ

    • ဝတ်ဆိုက်အားကြည့်ရှူမရပါကသင်၏ကွန်ပျူတာ နက်ဝပ်ချိတ်ဆက်မှူအားစစ်ဆေးကြည့်ပါ
    • ပြသာနကြုံနေဆဲလား။ကျေးဇူးပြုပြီးသင်၏နက်ဝပ် အတ်ဒမင်သို့မဟုတ်အင်တာနက်ဆားဗစ်ပေးသူထံသို့အကူအညီတောင်းဆိုပါ
    "> + + +The requested document is not available in the browser's cache.

    • As a security precaution, the browser does not automatically re-request sensitive documents.
    • Click Try Again to re-request the document from the website.
    "> + + +ဘယောင်ဆာသည်အင်တာနက်မဲ့အခြေအနေဖြင့်လုပ်ဆောင်နေသဖြင့်တောင်းဆိုထားသောအရာအားမရယူနိုင်ပါ။

    • ဤကွန်ပျူတာအား ကွန်ယက်တစ်ခုသို့ချိတ်ဆက်ထားပါသလား။
    • "Try Again" အားနှိပ်ပြီး ချိတ်ဆက်လုပ်ဆောင်မှူစတင်ပြီးစာမျက်နှာအားပြန်ခေါ်ပါ။
    "> + + +သင်ကြည့်ရှူရန်ကြိုးစားနေသောစာမျက်နှာသည်ထောက့်ပံ့ပေးမထားသောပုံစံအားအသုံးပြုထားသဖြင့်ကြည့်ရှူမရနိုင်ပါ

    • ကျေးဇူးပြုပြီးဝတ်ဆိုဒ်ပိုင်ရှင်အားဤပြသာနာနှင့်ပတ်သတ်ပြီးဆက်သွယ်အကြောင်းကြားပေးပါ
    "> + + +
  • Please contact the website owners to inform them of this problem.
  • "> + + +ဆက်သွယ်ရေးလိုင်း တခု တည်ဆောက်နေစဉ် ကွန်ရက် အချိတ်အဆက် အဟန့်အတား ရှိနေတယ်။ ထပ်ကြိုးစားကြည့်ပါ။

    "> + + +တောင်းဆိုထားသောစာမျက်နှာသည် ဘယောင်ဆာမှ တုန့်ပြန်မှူစောင့်နေရင်းချိတ်ဆက်မှူပြုတ်သွားသောကြောင့် ရယူနိုင်ခြင်းမရှိပါ။

    • ဆာဗာများတောင်းဆိုမှူများနေသောကြောင့်လေးလံနေခြင်းများလား ? နောက်ထပ် ထပ်ပြီးတော့ကြိုးစားကြည့်ပါ။
    • အခြားဝတ်ဆိုက်များအားကြည့်ရှူလို့ရပါသလား?မရပါက ကွန်ပျူတာ ချိတ်ဆက်မှူကို စစ်ဆေးကြည့်ပါ။
    • သင့်ကွန်ပျူတာအား ဖိုင်းယားဝေါသို့တစ်ခုခုဖြင့်ကာကွယ်ထားပါသလား?သို့အင်တာနက်ကြည့်ရှူအပြင်အဆင်မှားယွင်းနေပါသလား။
    • ဆက်ပြီးပြသာနက်တွေ့နေရပါသေးလား?သင့်ချိတ်ဆက်မှူကွန်ယက်ထိန်းချုပ်သူအား အကြောင်းကြားခြင်းသို့အင်တာနက်ဆားဗစ်ပေးသူအားဆက်သွယ်ခြင်းပြုလုပ်ပါ။
    "> + + +လိပ်စာသည်ပရိုတိုကောအတိအကျ(e.g. wxyz://)အား မသတ်မှတ်ထားပါ ထို့ကြောင့်ဘယောင်ဆာသည်ဝတ်ဆိုက်အားကောင်းစွာမချိတ်ဆက်နိုင်ပါ။

    • သင်အခြားမီဒီယာတွေ စာမပါ ဆားဗစ်တွေအား တောင်းဆိုနေတာလား ? ဝတ်ဆိုက်အားအခြားလိုအပ်ချက်များအတွက်စစ်ဆေးပါ။
    • အချို့သောပရိုတိုကောများသည် Third-party ဆော့ဝဲများထည့်သွင်းပြီးမှ ဘယောက်ဆာတွင်အလုပ်လုပ်နိုင်မည်ဖြစ်သည်။
    "> + + +ဘယောက်ဆာအားပရောစီဆာဗာသုံးရန်ပြင်ဆင်ထားသော်လည်းချိတ်ဆက်မှူငြင်းဆိုနေပါသည်။

    • ပရောဆီအပြင်အဆင်မှားနေသလား?အပြင်အဆင်အားနောက်တစ်ကြိမ်ထပ်ကြိုးစားကြည့်ပါ။
    • ပရောဆီဆားဗစ်သည်ကွန်ယက်အားချိတ်ဆက်ထားပါသလား?
    • ပြသာနာဆက်တွေ့သေးပါလား?သင့်အင်တာနက်ဆားဗစ်ပေးသူအားဆက်သွယ်ပါ။
    "> + + +ဤဘယောက်ဆာသည် ပရောက်ဆီသုံးရန်ပြုပြင်ထားသော်လည်း ပရောက်ဆီအားရှာမတွေ့ပါ။

    • ပရောက်ဆီအပြင်အဆင်တွေမှန်ပါသလား?အပြင်အဆင်များကိုစစ်ဆေးပြီးတစ်ခေါက်ပြန်လုပ်ကြည့်ပါ။
    • ကွန်ပျူတာအားကွန်ယက်တစ်ခုသို့ချိတ်ဆက်ထားပါသလား?
    • စစ်ဆေးပြီးသော်လည်းအခက်အခဲရှိနေပါကသင်၏ကွန်ယက် ခန့်ခွဲသူထံသို့အကူအညီတောင်းရန်ဆက်သွယ်ပါ။
    "> + + +The browser has stopped trying to retrieve the requested item. The site is redirecting the request in a way that will never complete.

    • Have you disabled or blocked cookies required by this site?
    • NOTE: If accepting the site's cookies does not resolve the problem, it is likely a server configuration issue and not your computer.
    "> + + +ဤယခုဝတ်ဆိုဒ်သည်မျှော်လင့်ထားသောနည်းလမ်းဖြင့် ပြန်လည်မတုန့်ပြန်လာသဖြင့်ဘယောက်ဆာမှဆက်လက်မလုပ်ဆောင်နိုင်တော့ပါ။

    "> + + +The page you are trying to view can not be shown because the authenticity of the received data could not be verified.

    • Please contact the website owners to inform them of this problem.
    "> + + +
  • This could be a problem with the server's configuration, or it could be someone trying to impersonate the server.
  • If you have connected to this server successfully in the past, the error may be temporary, and you can try again later.
  • "> + + +သင်အသုံးပြုနေသော အင်တာနက်ချိတ်ဆက်မှုကို လုံးဝယုံကြည်စိတ်ချမှု မရှိပါက သို့မဟုတ် ဒီဆာဗာမှ သတိပေးချက်ပေးချက်ကို မြင်တွေ့ရလေ့မရှိပါက သင်သည် ခြွင်းချက်အနေဖြင့် မထားသင့်ပါ။

    ဒီဆိုက်ကို ခြွင်းချက်ထားချင်သေးပါက သင်၏ အဆင့်မြင့်စာဝှက်ခြင်းအပြင်အဆင်များထဲတွင် ဆောင်ရွက်နိုင်ပါသည်။

    "> + + +လုံခြုံရေးမူဝါဒအရဤစာမျက်နှာအား ယခုကဲ့သို့သောနည်းလမ်းဖြင့်ဖွင့်လှစ်ခြင်းအားတားမြစ်ထားသည်

    "> + + +အချက်အလက်ကူးယူပြောင်းခြင်းပြသာနာကြောင့်၀တ်ဆိုက်အားမပြသနိုင်ပါ။

    • ၀တ်ဆိုက်ပိုင်ရှင်များဤပြသာနာအားအသိပေးရန်ကျေးဇူးပြုပြီးဆက်သွယ်ပေးပါ။
    "> + + +
    • ၀တ်ဆိုက်ပိုင်ရှင်အားဤပြသာနားအားတင်ပြရန်ဆက်သွယ်ပါ

    "> + + + +သည် အိုဟောင်းပြီး တိုက်ခိုက်ရန်လွယ်ကူသည့် လုံခြုံရေးနည်းပညာကို အသုံးပြုထားသည်။ တိုက်ခိုက်သူသည် သင်လုံခြုံသည်ဟုထင်သည့် အချက်အလက်များကို လွယ်ကူစွာ ဖော်ထုတ်နိုင်ပါလိမ့်မည်။ သင်လာရောက်မလည်ပတ်မီ ဝဘ်ဆိုဒ်စီမံခန့်ခွဲသူသည် ဆာဗာကို အရင်ဆုံး ပြုပြင်ဖြေရှင်းရန် လိုအပ်သည်။

    Error code: NS_ERROR_NET_INADEQUATE_SECURITY

    "> diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/nsWebBrowserPersist.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/nsWebBrowserPersist.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/nsWebBrowserPersist.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/nsWebBrowserPersist.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,17 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +readError=%S could not be saved, because the source file could not be read.\n\nTry again later, or contact the server administrator. +writeError=အမည်မသိ အမှား​တခုကြောင့် %S ကို သိမ်းဆည်းလို့ မရဘူး။ \n\nအခြားနေရာတခုမျာ သိမ်းဆည်းဖို့ ကြိုးစားကြည့်ပါ။ +launchError=အမည်မသိ အမှား​တခု ဖြစ်ပေါ်နေတာကြောင့် %S ကို ဖွင့်လို့ မရဘူး။ \n\nဓါတ်ပြားထဲမှာ အရင် သိမ်းဆည်းထားပြီးနောက် ဖိုင်ကို ဖွင့်ပါ။ +diskFull=There is not enough room on the disk to save %S.\n\nRemove unnecessary files from the disk and try again, or try saving in a different location. +readOnly=%S သည် ဖိုင်သို့မဟုတ်ဖိုဒါအား ရေးသားခြင်းမှကာကွယ်ထားသောကြောင့်မသိမ်းဆည်းနိုင်ပါ။\n\n ဖိုဒါသို့ ဒစ်အား ရေးသားခွင့်+သိမ်းဆည်းခွင့်ပေးပြီးမှထပ်လုပ်ကြည့်ပါ သို့အခြားတစ်နေရာမှာသိမ်းပေးပါ။ +accessError=%S could not be saved, because you cannot change the contents of that folder.\n\nChange the folder properties and try again, or try saving in a different location. +SDAccessErrorCardReadOnly=ဖိုင်အား ဒေါင်းလုဒ်မချနိုင်ပါ။ အဘယ်ကြောင့်ဆိုသော SD ကဒ်အားသုံးနေသှ့် အရာရှိသှ် +SDAccessErrorCardMissing=ဖိုင်အား SD ကဒ်ပျောက်နေသဖြင့်ဒေါင်းလုဒ် မချနိုင်ပါ +helperAppNotFound=သက်ဆိုင်ရာ အကူအညီ လုပ်ငန်းသုံး ကိရိယာ မရှိတဲ့အတွက်၊ %S ကို ဖွင့်လို့ မရဘူး။ သင်ရဲ့ ဦးစားပေးချက်များထဲမှာ သက်ဆိုင်ရာကို ပြင်ဆင်ပါ။ +noMemory=သင်တောင်းဆိုတဲ့ လုပ်ဆောင်မှုကို ပြီးစီးဖို့ မှတ်ဉာဏ် မလုံလောက်ဘူး။\n\nအချို့ လုပ်ငန်းသုံး ကိရိယာများကို ပိတ်ပြီး ထပ် ကြိုးစားပါ။ +title=%S ဆွဲချနေတယ် +fileAlreadyExistsError='_files' ဖိုင်တွဲလို ဆင်တူတဲ့ အမည်နဲ့ ဖိုင်တခု ရှိနေပြီ ဖြစ်တဲ့အတွက် %S ကို သိမ်းဆည်းလို့ မရဘူး။\n\nတခြားနေရာ တခုမှာ သိမ်းဆည်းဖို့ ကြိုးစားပါ။ +fileNameTooLongError=ဖိုင်အမည် ရှည်လွန်းတဲ့အတွက် %S ကို သိမ်းဆည်းလို့ မရဘူး။\n\nဒီထက်တိုတဲ့ ဖိုင်အမည်တခုနဲ့ ကြိုးစား သိမ်းဆည်းပါ။ diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/plugins.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/plugins.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/plugins.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/plugins.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,36 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (plugins.properties): +# Those strings are inserted into an HTML page, so all HTML characters +# have to be escaped in a way that they show up correctly in HTML! + +title_label=ပလတ်ဂင်များ အကြောင်း +installedplugins_label=အသုံးပြုဆော့ဝဲများ +nopluginsareinstalled_label=တပ်ဆင်ထားသောဆော့ဝဲများမတွေ့ရ +findpluginupdates_label=ပလပ်အင်များ၏အဆင့်မြှင့်တင်ခြင်းအားရှာဖွေရန်မှာ +file_label=ဖိုင် - +path_label=လမ်းကြောင်း +version_label=ဗားရှင်း - +state_label=အခြေအနေ: +state_enabled=ဖွင့်ထားတယ် +state_disabled=ပိတ်ထားတယ် +mimetype_label=MIME အမျိုးအစား +description_label=ဖေါ်ပြချက် +suffixes_label=နောက်ဆက်စကားစုများ +learn_more_label=ဆက်လက်ဖတ်ရှူရန် + +deprecation_description=တစ်ခုခုပျောက်နေသလား? အချို့သော ပလပ်အင်တွေကို ထောက်ပံ့မပေးတော့ပါ +deprecation_learn_more=ဆက်လက်လေ့လာပါ + +# GMP Plugins +gmp_license_info=လိုင်စင်အချက်အလက် +gmp_privacy_info=လုံခြုံရေးအချက်အလက် + +openH264_name=Cisco Systems, Inc. မှ စီစဉ်ပေးသော OpenH264 Video Codec +openH264_description2=WebRTC သတ်မှတ်ချက်များနှင့် ကိုက်ညီစေရန် ဒီပလဂ်အင်ကို မော်ဇီလာမှ အလိုအလျောက် တပ်ဆင်ပါမည်။ ထို့ပြင် WebRTC ခေါ်ဆိုမှုများကို H.264 ဗွီဒီယို ကိုဒက်လိုအပ်သော ကိရိယာများတွင် အသုံးပြုနိုင်စေမည်။ ကိုဒက် ရင်းမြစ်ကုဒ်ကို ကြည့်ရန်နှင့် အကောင်အထည်ဖော်ခြင်းနှင့် ပတ်သက်သည်များကို ပိုမိုလေ့လာရန် http://www.openh264.org/ ကို လည်ပတ်ကြည့်ရှုပါ။ + +cdm_description= ကာကွယ်ထားသော ရုပ်သုံးအား ပြန်ဖွင့်ပါ + +widevine_description=Google Inc မှ Widevine Content Decryption ထပ်ပေါင်းဆော့ဝဲ diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/security/caps.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/security/caps.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/security/caps.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/security/caps.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,112 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. +CheckLoadURIError = Security Error: Content at %S may not load or link to %S. +CheckSameOriginError = လုံခြုံရေး အမှား - %S ထဲက အကြောင်းအရာက %S မှ အချိတ်အဆက်ကြမ်းကို ဖွင့်မှာ မဟုတ်ဘူး။ +ExternalDataError = လုံခြုံရေးပြသာနာ - %S ရှိ စာကိုယ်သည် %S အားရယူရန်ကြိုးစားခဲ့သော်လည်း ပြင်ပအချက်အလက်အနေဖြင့် ပုံပြရာတွင် ဖော်ပြမည်မဟုတ်ပါ + +# LOCALIZATION NOTE (GetPropertyDeniedOrigins): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the property of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +GetPropertyDeniedOrigins = Permission denied for <%1$S> to get property %2$S.%3$S from <%4$S>. +# LOCALIZATION NOTE (GetPropertyDeniedOriginsSubjectDomain): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the property of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +# %5$S is the value of document.domain for the script which was denied access; +# don't translate "document.domain". +GetPropertyDeniedOriginsSubjectDomain = Permission denied for <%1$S> (document.domain=<%5$S>) to get property %2$S.%3$S from <%4$S> (document.domain has not been set). +# LOCALIZATION NOTE (GetPropertyDeniedOriginsObjectDomain): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the property of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +# %5$S is the value of document.domain for the object being accessed; +# don't translate "document.domain". +GetPropertyDeniedOriginsObjectDomain = Permission denied for <%1$S> (document.domain has not been set) to get property %2$S.%3$S from <%4$S> (document.domain=<%5$S>). +# LOCALIZATION NOTE (GetPropertyDeniedOriginsSubjectDomainObjectDomain): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the property of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +# %5$S is the value of document.domain for the script which was denied access; +# don't translate "document.domain" +# %6$S is the value of document.domain for the object being accessed; +# don't translate "document.domain". +GetPropertyDeniedOriginsSubjectDomainObjectDomain = Permission denied for <%1$S> (document.domain=<%5$S>) to get property %2$S.%3$S from <%4$S> (document.domain=<%6$S>). + +# LOCALIZATION NOTE (SetPropertyDeniedOrigins): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the property of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +SetPropertyDeniedOrigins = Permission denied for <%1$S> to set property %2$S.%3$S on <%4$S>. +# LOCALIZATION NOTE (SetPropertyDeniedOriginsSubjectDomain): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the property of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +# %5$S is the value of document.domain for the script which was denied access; +# don't translate "document.domain". +SetPropertyDeniedOriginsSubjectDomain = Permission denied for <%1$S> (document.domain=<%5$S>) to set property %2$S.%3$S on <%4$S> (document.domain has not been set). +# LOCALIZATION NOTE (SetPropertyDeniedOriginsObjectDomain): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the property of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +# %5$S is the value of document.domain for the object being accessed; +# don't translate "document.domain". +SetPropertyDeniedOriginsObjectDomain = Permission denied for <%1$S> (document.domain has not been set) to set property %2$S.%3$S on <%4$S> (document.domain=<%5$S>). +# LOCALIZATION NOTE (SetPropertyDeniedOriginsSubjectDomainObjectDomain): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the property of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +# %5$S is the value of document.domain for the script which was denied access; +# don't translate "document.domain" +# %6$S is the value of document.domain for the object being accessed; +# don't translate "document.domain". +SetPropertyDeniedOriginsSubjectDomainObjectDomain = Permission denied for <%1$S> (document.domain=<%5$S>) to set property %2$S.%3$S on <%4$S> (document.domain=<%6$S>). + +# LOCALIZATION NOTE (CallMethodDeniedOrigins): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the method of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +CallMethodDeniedOrigins = Permission denied for <%1$S> to call method %2$S.%3$S on <%4$S>. +# LOCALIZATION NOTE (CallMethodDeniedOriginsSubjectDomain): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the method of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +# %5$S is the value of document.domain for the script which was denied access; +# don't translate "document.domain". +CallMethodDeniedOriginsSubjectDomain = Permission denied for <%1$S> (document.domain=<%5$S>) to call method %2$S.%3$S on <%4$S> (document.domain has not been set). +# LOCALIZATION NOTE (CallMethodDeniedOriginsObjectDomain): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the method of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +# %5$S is the value of document.domain for the object being accessed; +# don't translate "document.domain". +CallMethodDeniedOriginsObjectDomain = Permission denied for <%1$S> (document.domain has not been set) to call method %2$S.%3$S on <%4$S> (document.domain=<%5$S>). +# LOCALIZATION NOTE (CallMethodDeniedOriginsSubjectDomainObjectDomain): +# %1$S is the origin of the script which was denied access. +# %2$S is the type of object it was. +# %3$S is the method of that object that access was denied for. +# %4$S is the origin of the object access was denied to. +# %5$S is the value of document.domain for the script which was denied access; +# don't translate "document.domain" +# %6$S is the value of document.domain for the object being accessed; +# don't translate "document.domain". +CallMethodDeniedOriginsSubjectDomainObjectDomain = Permission denied for <%1$S> (document.domain=<%5$S>) to call method %2$S.%3$S on <%4$S> (document.domain=<%6$S>). + +GetPropertyDeniedOriginsOnlySubject = Permission denied for <%S> to get property %S.%S +SetPropertyDeniedOriginsOnlySubject = Permission denied for <%S> to set property %S.%S +CallMethodDeniedOriginsOnlySubject = Permission denied for <%S> to call method %S.%S +CreateWrapperDenied = %S အတန်းအစား ၀တ္ထုအတွက် အထုတ်အပိုး ဖန်တီးဖို့ ခွင့်ပြုချက် ငြင်းပယ်ခံရတယ် +CreateWrapperDeniedForOrigin = %1$S အတန်းအစား ၀တ္ထုအတွက် အထုတ်အပိုး ဖန်တီးဖို့ <%2$S> ကို ခွင့်ပြုချက် ငြင်းပယ်ခံရတယ် +ProtocolFlagError = Warning: Protocol handler for '%S' doesn't advertise a security policy. While loading of such protocols is allowed for now, this is deprecated. Please see the documentation in nsIProtocolHandler.idl. diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/security/csp.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/security/csp.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/security/csp.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/security/csp.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,116 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# CSP Warnings: +# LOCALIZATION NOTE (CSPViolation): +# %1$S is the reason why the resource has not been loaded. +CSPViolation = ရင်းမြစ် %1$S ရယူနေခြင်းကို စာမျက်နှာ၏အပြင်အဆင်က တားဆီးထားပါသည် +# LOCALIZATION NOTE (CSPViolationWithURI): +# %1$S is the directive that has been violated. +# %2$S is the URI of the resource which violated the directive. +CSPViolationWithURI = The page’s settings blocked the loading of a resource at %2$S (“%1$S”). +# LOCALIZATION NOTE (CSPROViolation): +# %1$S is the reason why the resource has not been loaded. +CSPROViolation = A violation occurred for a report-only CSP policy (“%1$S”). The behavior was allowed, and a CSP report was sent. +# LOCALIZATION NOTE (CSPROViolationWithURI): +# %1$S is the directive that has been violated. +# %2$S is the URI of the resource which violated the directive. +CSPROViolationWithURI = The page’s settings observed the loading of a resource at %2$S (“%1$S”). A CSP report is being sent. +# LOCALIZATION NOTE (triedToSendReport): +# %1$S is the URI we attempted to send a report to. +triedToSendReport = ကြိုးစားပို့သည့် ပုံစံမကျသော URI: "%1$S" +# LOCALIZATION NOTE (couldNotParseReportURI): +# %1$S is the report URI that could not be parsed +couldNotParseReportURI = စိစစ်မရသော တင်ပြချက် URI: %1$S +# LOCALIZATION NOTE (couldNotProcessUnknownDirective): +# %1$S is the unknown directive +couldNotProcessUnknownDirective = ညွှန်ကြားချက်မသေချာသော လုပ်ငန်းစဉ် '%1$S' +# LOCALIZATION NOTE (ignoringUnknownOption): +# %1$S is the option that could not be understood +ignoringUnknownOption = အမည်မသိ အပြင်အဆင် %1$S ကို လျစ်လျူရှုနေသည် +# LOCALIZATION NOTE (ignoringDuplicateSrc): +# %1$S defines the duplicate src +ignoringDuplicateSrc = ရှိပြီးဖြစ်နေသော ရင်းမြစ် %1$S ကို လျစ်လျူရှုနေသည် +# LOCALIZATION NOTE (ignoringSrcFromMetaCSP): +# %1$S defines the ignored src +ignoringSrcFromMetaCSP = Ignoring source ‘%1$S’ (Not supported when delivered via meta element). +# LOCALIZATION NOTE (ignoringSrcWithinScriptStyleSrc): +# %1$S is the ignored src +# script-src and style-src are directive names and should not be localized +ignoringSrcWithinScriptStyleSrc = Ignoring “%1$S” within script-src or style-src: nonce-source or hash-source specified +# LOCALIZATION NOTE (ignoringSrcForStrictDynamic): +# %1$S is the ignored src +# script-src, as well as 'strict-dynamic' should not be localized +ignoringSrcForStrictDynamic = Ignoring “%1$S” within script-src: ‘strict-dynamic’ specified +# LOCALIZATION NOTE (ignoringStrictDynamic): +# %1$S is the ignored src +ignoringStrictDynamic = Ignoring source “%1$S” (Only supported within script-src). +# LOCALIZATION NOTE (strictDynamicButNoHashOrNonce): +# %1$S is the csp directive that contains 'strict-dynamic' +# 'strict-dynamic' should not be localized +strictDynamicButNoHashOrNonce = Keyword ‘strict-dynamic’ within “%1$S” with no valid nonce or hash might block all scripts from loading +# LOCALIZATION NOTE (reportURInotHttpsOrHttp2): +# %1$S is the ETLD of the report URI that is not HTTP or HTTPS +reportURInotHttpsOrHttp2 = The report URI (%1$S) should be an HTTP or HTTPS URI. +# LOCALIZATION NOTE (reportURInotInReportOnlyHeader): +# %1$S is the ETLD of the page with the policy +reportURInotInReportOnlyHeader = This site (%1$S) has a Report-Only policy without a report URI. CSP will not block and cannot report violations of this policy. +# LOCALIZATION NOTE (failedToParseUnrecognizedSource): +# %1$S is the CSP Source that could not be parsed +failedToParseUnrecognizedSource = အမျိုးအစားမသိသော %1$S အားဖွင့်မရပါ +# LOCALIZATION NOTE (inlineScriptBlocked): +# inline script refers to JavaScript code that is embedded into the HTML document. +inlineScriptBlocked = An attempt to execute inline scripts has been blocked +# LOCALIZATION NOTE (inlineStyleBlocked): +# inline style refers to CSS code that is embedded into the HTML document. +inlineStyleBlocked = An attempt to apply inline style sheets has been blocked +# LOCALIZATION NOTE (scriptFromStringBlocked): +# eval is a name and should not be localized. +scriptFromStringBlocked = An attempt to call JavaScript from a string (by calling a function like eval) has been blocked +# LOCALIZATION NOTE (upgradeInsecureRequest): +# %1$S is the URL of the upgraded request; %2$S is the upgraded scheme. +upgradeInsecureRequest = Upgrading insecure request ‘%1$S’ to use ‘%2$S’ +# LOCALIZATION NOTE (ignoreSrcForDirective): +ignoreSrcForDirective = srcs များကို directive ‘%1$S’ အတွက် ဖယ်ထားမည် +# LOCALIZATION NOTE (hostNameMightBeKeyword): +# %1$S is the hostname in question and %2$S is the keyword +hostNameMightBeKeyword = %1$S အားလက်ခံ အမည်တစ်ခုအနေဖြင့် ဖတ်နေပြီး အကယ်လို့ ကီးစကားလုံးတစ်ခုအဖြစ်သုံးလိုပါက ‘%2$S’ အားသုံးပါ (single quote ထဲတွင် ထည်းထားသှ်) +# LOCALIZATION NOTE (notSupportingDirective): +# directive is not supported (e.g. 'reflected-xss') +notSupportingDirective = Directive ‘%1$S’ အားထောက်ပံ့မပေးထားပါ။ Directive နှင့် တန်ဖိုးများအား လျစ်လျူရှုထားမည်။ +# LOCALIZATION NOTE (blockAllMixedContent): +# %1$S is the URL of the blocked resource load. +blockAllMixedContent = လုံခြုံမှုမရှိသော တောင်းဆိုမှု ‘%1$S’ အား ပိတ်ထားသှ်။ +# LOCALIZATION NOTE (ignoringDirectiveWithNoValues): +# %1$S is the name of a CSP directive that requires additional values (e.g., 'require-sri-for') +ignoringDirectiveWithNoValues = ‘%1$S’ အား​ မည်သည့် parameters မှမပါသဖြင့်လျစ်လျူရှုထားသည် +# LOCALIZATION NOTE (ignoringReportOnlyDirective): +# %1$S is the directive that is ignored in report-only mode. +ignoringReportOnlyDirective = စမ်းသပ် directive အား အစီရင်ခံစာပေးပို့ ပေါ်လစီ‘%1$S’ လျစ်လျူရှုထားမည်ဖြစ်သည် +# LOCALIZATION NOTE (deprecatedReferrerDirective): +# %1$S is the value of the deprecated Referrer Directive. +deprecatedReferrerDirective = Referrer Directive ‘%1$S’ has been deprecated. Please use the Referrer-Policy header instead. + +# CSP Errors: +# LOCALIZATION NOTE (couldntParseInvalidSource): +# %1$S is the source that could not be parsed +couldntParseInvalidSource = Couldn't parse invalid source %1$S +# LOCALIZATION NOTE (couldntParseInvalidHost): +# %1$S is the host that's invalid +couldntParseInvalidHost = Couldn't parse invalid host %1$S +# LOCALIZATION NOTE (couldntParseScheme): +# %1$S is the string source +couldntParseScheme = %1$S တွင် စီစစ်မရေသောပုံစံများပါဝင်နေသှ် +# LOCALIZATION NOTE (couldntParsePort): +# %1$S is the string source +couldntParsePort = %1$S ရှိ စီစစ်တင်ပြမရသော Port +# LOCALIZATION NOTE (duplicateDirective): +# %1$S is the name of the duplicate directive +duplicateDirective = Duplicate %1$S directives detected. All but the first instance will be ignored. +# LOCALIZATION NOTE (deprecatedDirective): +# %1$S is the name of the deprecated directive, %2$S is the name of the replacement. +deprecatedDirective = Directive ‘%1$S’ အားဆက်လက် ထောက်ပံ့မပေးထားတော့ပါ။ ကျေးဇူးပြုပြီး directive ‘%2$S’ ကို အစားထိုးသုံးဆွဲပါ။ +# LOCALIZATION NOTE (couldntParseInvalidSandboxFlag): +# %1$S is the option that could not be understood +couldntParseInvalidSandboxFlag = မှန်သော sandbox flag ‘%1$S’ အားမဖတ်နိုင်ပါ diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/security/security.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/security/security.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/security/security.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/security/security.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,83 @@ +# Mixed Content Blocker +# LOCALIZATION NOTE: "%1$S" is the URI of the blocked mixed content resource +BlockMixedDisplayContent = ရောနှောထားသော ပါဝင်ပစ္စည်းများအားပိတ်"%1$S" +BlockMixedActiveContent = ရောနှောထားသောတက်ကြွ ပါဝင်ပစ္စည်းများအားပိတ်"%1$S" + +# CORS +# LOCALIZATION NOTE: Do not translate "Access-Control-Allow-Origin", Access-Control-Allow-Credentials, Access-Control-Allow-Methods, Access-Control-Allow-Headers +CORSDisabled=Cross-Origin Request Blocked: The Same Origin Policy disallows reading the remote resource at %1$S. (Reason: CORS disabled). +CORSRequestNotHttp=Cross-Origin Request Blocked: The Same Origin Policy disallows reading the remote resource at %1$S. (Reason: CORS request not http). +CORSMissingAllowOrigin=Cross-Origin Request Blocked: The Same Origin Policy disallows reading the remote resource at %1$S. (Reason: CORS header ‘Access-Control-Allow-Origin’ missing). +CORSAllowOriginNotMatchingOrigin=Cross-Origin Request Blocked: The Same Origin Policy disallows reading the remote resource at %1$S. (Reason: CORS header ‘Access-Control-Allow-Origin’ does not match ‘%2$S’). +CORSNotSupportingCredentials=Cross-Origin တောင်းဆိုချက်အား ပိတ်ထားသှ်။ ၎င်းပေါ်လစီ မှပင် အခြား ‘%1$S’ နေရာမှ အရာများရယူခွင့်ပိတ်ထားသှ်။ ( အကြောင်းပြချက် - CORS ခေါင်းစီး ‘Access-Control-Allow-Origin’ is ‘*’ မှာ Credential များသုံးခွင့်မပေးထားပါ။ +CORSMethodNotFound=Cross-Origin Request Blocked: The Same Origin Policy disallows reading the remote resource at %1$S. (Reason: Did not find method in CORS header ‘Access-Control-Allow-Methods’). +CORSMissingAllowCredentials=Cross-Origin Request Blocked: The Same Origin Policy disallows reading the remote resource at %1$S. (Reason: expected ‘true’ in CORS header ‘Access-Control-Allow-Credentials’). +CORSPreflightDidNotSucceed=Cross-Origin Request Blocked: The Same Origin Policy disallows reading the remote resource at %1$S. (Reason: CORS preflight channel did not succeed). +CORSInvalidAllowMethod=Cross-Origin Request Blocked: The Same Origin Policy disallows reading the remote resource at %1$S. (Reason: invalid token ‘%2$S’ in CORS header ‘Access-Control-Allow-Methods’). +CORSInvalidAllowHeader=Cross-Origin Request Blocked: The Same Origin Policy disallows reading the remote resource at %1$S. (Reason: invalid token ‘%2$S’ in CORS header ‘Access-Control-Allow-Headers’). +CORSMissingAllowHeaderFromPreflight=Cross-Origin Request Blocked: The Same Origin Policy disallows reading the remote resource at %1$S. (Reason: missing token ‘%2$S’ in CORS header ‘Access-Control-Allow-Headers’ from CORS preflight channel). + +# LOCALIZATION NOTE: Do not translate "Strict-Transport-Security", "HSTS", "max-age" or "includeSubDomains" +STSUnknownError=Strict-Transport-Security: An unknown error occurred processing the header specified by the site. +STSUntrustworthyConnection=Strict-Transport-Security: The connection to the site is untrustworthy, so the specified header was ignored. +STSCouldNotParseHeader=Strict-Transport-Security: The site specified a header that could not be parsed successfully. +STSNoMaxAge=Strict-Transport-Security: The site specified a header that did not include a ‘max-age’ directive. +STSMultipleMaxAges=Strict-Transport-Security: The site specified a header that included multiple ‘max-age’ directives. +STSInvalidMaxAge=Strict-Transport-Security: The site specified a header that included an invalid ‘max-age’ directive. +STSMultipleIncludeSubdomains=Strict-Transport-Security: The site specified a header that included multiple ‘includeSubDomains’ directives. +STSInvalidIncludeSubdomains=Strict-Transport-Security: The site specified a header that included an invalid ‘includeSubDomains’ directive. +STSCouldNotSaveState=Strict-Transport-Security: An error occurred noting the site as a Strict-Transport-Security host. + +# LOCALIZATION NOTE: Do not translate "Public-Key-Pins", "HPKP", "max-age", "report-uri" or "includeSubDomains" +PKPUnknownError=Public-Key-Pins: An unknown error occurred processing the header specified by the site. +PKPUntrustworthyConnection=Public-Key-Pins: The connection to the site is untrustworthy, so the specified header was ignored. +PKPCouldNotParseHeader=Public-Key-Pins: The site specified a header that could not be parsed successfully. +PKPNoMaxAge=Public-Key-Pins: The site specified a header that did not include a ‘max-age’ directive. +PKPMultipleMaxAges=Public-Key-Pins: The site specified a header that included multiple ‘max-age’ directives. +PKPInvalidMaxAge=Public-Key-Pins: The site specified a header that included an invalid ‘max-age’ directive. +PKPMultipleIncludeSubdomains=Public-Key-Pins: The site specified a header that included multiple ‘includeSubDomains’ directives. +PKPInvalidIncludeSubdomains=Public-Key-Pins: The site specified a header that included an invalid ‘includeSubDomains’ directive. +PKPInvalidPin=Public-Key-Pins: The site specified a header that included an invalid pin. +PKPMultipleReportURIs=Public-Key-Pins: The site specified a header that included multiple ‘report-uri’ directives. +PKPPinsetDoesNotMatch=Public-Key-Pins: The site specified a header that did not include a matching pin. +PKPNoBackupPin=Public-Key-Pins: The site specified a header that did not include a backup pin. +PKPCouldNotSaveState=Public-Key-Pins: An error occurred noting the site as a Public-Key-Pins host. +PKPRootNotBuiltIn=Public-Key-Pins: The certificate used by the site was not issued by a certificate in the default root certificate store. To prevent accidental breakage, the specified header was ignored. + +# LOCALIZATION NOTE: Do not translate "SHA-1" +SHA1Sig=This site makes use of a SHA-1 Certificate; it’s recommended you use certificates with signature algorithms that use hash functions stronger than SHA-1. +InsecurePasswordsPresentOnPage=မလုံခြုံသော (http://) စာမျက်နှာတွင် ပတ်စ်ဝတ်ရိုက်သွင်းရမည်ဖြစ်သှ်။ သုံးဆွဲသူ၏ ဝင်ရောက်မှုအချက်အလက်များအား ရယူနိုင်သော လုံခြုံရေး အရဲစွန့်ခြင်းဖြစ်သှ်။ +InsecureFormActionPasswordsPresent=မလုံခြုံသော (http://) စာမျက်နှာတွင် မလုံခြုံသော ပတ်စ်ဝတ်ရိုက်သွင်း ဖောင်တစ်ခုပါနေသှ်။ သုံးဆွဲသူ၏ ဝင်ရောက်မှုအချက်အလက်များအား ရယူနိုင်သော လုံခြုံရေး အရဲစွန့်ခြင်းဖြစ်သှ်။ +InsecurePasswordsPresentOnIframe=မလုံခြုံသော (http://) ပတ်စ်ဝတ်ရိုက်သွင်းရမည့် iframe တစ်ခုပါနေသှ်။ သုံးဆွဲသူ၏ ဝင်ရောက်မှုအချက်အလက်များအား ရယူနိုင်သော လုံခြုံရေး အရဲစွန့်ခြင်းဖြစ်သှ်။ +# LOCALIZATION NOTE: "%1$S" is the URI of the insecure mixed content resource +LoadingMixedActiveContent2=လုံခြုံသော စာမျက်နှာတစ်ခုတွင် ရောထားသော “%1$S” (မလုံခြုံသော) စာကိုယ်တစ်ခုကို ရယူနေသှ် +LoadingMixedDisplayContent2=လုံခြုံသော စာမျက်နှာတစ်ခုတွင် မလုံခြုံသော ပြသစာကိုယ် “%1$S” အား ရယူနေသှ် +# LOCALIZATION NOTE: Do not translate "allow-scripts", "allow-same-origin", "sandbox" or "iframe" +BothAllowScriptsAndSameOriginPresent=An iframe which has both allow-scripts and allow-same-origin for its sandbox attribute can remove its sandboxing. + +# Sub-Resource Integrity +# LOCALIZATION NOTE: Do not translate "script" or "integrity". "%1$S" is the invalid token found in the attribute. +MalformedIntegrityHash=The script element has a malformed hash in its integrity attribute: “%1$S”. The correct format is “-”. +# LOCALIZATION NOTE: Do not translate "integrity" +InvalidIntegrityLength=The hash contained in the integrity attribute has the wrong length. +# LOCALIZATION NOTE: Do not translate "integrity" +InvalidIntegrityBase64=The hash contained in the integrity attribute could not be decoded. +# LOCALIZATION NOTE: Do not translate "integrity". "%1$S" is the type of hash algorigthm in use (e.g. "sha256"). +IntegrityMismatch=None of the “%1$S” hashes in the integrity attribute match the content of the subresource. +# LOCALIZATION NOTE: "%1$S" is the URI of the sub-resource that cannot be protected using SRI. +IneligibleResource=“%1$S” is not eligible for integrity checks since it’s neither CORS-enabled nor same-origin. +# LOCALIZATION NOTE: Do not translate "integrity". "%1$S" is the invalid hash algorithm found in the attribute. +UnsupportedHashAlg=ထောက်ပံ့မပေးထားသော hash algorithm အား integrity attribute: “%1$S” တွင်တွေ့ရသှ် +# LOCALIZATION NOTE: Do not translate "integrity" +NoValidMetadata=Integrity attribute တွင် လုံလောက်သော metadata မပါလာပါ + +# LOCALIZATION NOTE: Do not translate "RC4". +WeakCipherSuiteWarning=ယခု ဆိုက်ဒ်သှ် encryption အတွက် မထောက်ပံ့တော့သော RC4 ကိုသုံးသှ် + +#XCTO: nosniff +# LOCALIZATION NOTE: Do not translate "X-Content-Type-Options: nosniff". +MimeTypeMismatch=The resource from “%1$S” was blocked due to MIME type mismatch (X-Content-Type-Options: nosniff). +# LOCALIZATION NOTE: Do not translate "X-Content-Type-Options" and also do not trasnlate "nosniff". +XCTOHeaderValueMissing=X-Content-Type-Options header warning: value was “%1$S”; did you mean to send “nosniff”? + +BlockScriptWithWrongMimeType=“%1$S” မှ ပရိုဂရမ်အား MIME အမျိုးအစား မကိုက်ညီသဖြင့် ခွင့်မပြုထားပါ diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/svg/svg.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/svg/svg.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/svg/svg.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/svg/svg.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,5 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +AttributeParseWarning=မျှော်လင့်မထားတဲ့ %2$S တန်ဖိုးက %1$S အရည်အသွေးကို ခွဲခြား ဖော်ပြနေတယ်။ diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/xml/prettyprint.dtd firefox-54.0~b2+build1/l10n/my/dom/chrome/xml/prettyprint.dtd --- firefox-54.0~b1+build1/l10n/my/dom/chrome/xml/prettyprint.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/xml/prettyprint.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,5 @@ + + + diff -Nru firefox-54.0~b1+build1/l10n/my/dom/chrome/xslt/xslt.properties firefox-54.0~b2+build1/l10n/my/dom/chrome/xslt/xslt.properties --- firefox-54.0~b1+build1/l10n/my/dom/chrome/xslt/xslt.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/dom/chrome/xslt/xslt.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,39 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +1 = XSLT အပြင်အဆင်တစ်ချို့ပျက်သွားသည်။ +2 = XPath ထုတ်ဖေါ်မှု ခွဲခြား ဖေါ်ပြမှုတခု ပျက်သွားတယ်။ +3 = +4 = XSLT ပြောင်းလဲမှု ပျက်သွားတယ်။ +5 = မမှန်ကန်တဲ့ XSLT/XPath လုပ်ဆောင်ချက်။ +6 = XSLT Stylesheet (ဖြစ်နိုင်ချေ) မှာ ထပ်ဆင့်ဖြစ်ပေါ်မှုတခု ပါရှိတယ်။ +7 = တွက်ချက်မှု တန်ဖိုးဟာ XSLT 1.0 မှာ တရားမ၀င်ဘူး။ +8 = XPath ထုတ်ဖေါ်မှုဟာ NodeSet တခုဆီ ပြန်လှည့်ဖို့ မျှောလင့်ထားတယ်။ +9 = XSLT ပြောင်းလဲမှု ကို က အဆုံးသတ်လိုက်တယ်။ +10 = ကွန်ရက် ချိတ်ဆက်မှုတခုဟာ XSLT stylesheet တခုကို ဖွင့်နေတုန်း အမှား ဖြစ်ပေါ်ခဲ့တယ်။ +11 = XSLT stylesheet တခုမှာ XML mimetype မပါရှိဘူး။ +12 = An XSLT stylesheet directly or indirectly imports or includes itself: +13 = XPath လုပ်ဆောင်ချက်တခုဟာ ​မှားယွင်းတဲ့ ဆွေးနွေးချက်များနဲ့ ခေါ်ယူထားတယ်။ +14 = အမည်မသိ XPath တိုးချဲ့ချက် လုပ်ဆောင်ချက်ကို ခေါ်ယူထားတယ်။ +15 = XPath ​ခွဲခြားဖေါ်ပြမှု ပျက်ပယ်ခြင်း - ')' မျှော်လင့်ထားတယ်။ +16 = XPath ​ခွဲခြားဖေါ်ပြမှု ပျက်ပယ်ခြင်း - မမှန်ကန်တဲ့ axis - +17 = XPath ​ခွဲခြားဖေါ်ပြမှု ပျက်ပယ်ခြင်း - အမည်နဲ့ Nodetype စမ်းသပ်မှု မျှော်လင့်ထားတယ် - +18 = XPath ​ခွဲခြားဖေါ်ပြမှု ပျက်ပယ်ခြင်း - ']' ကို မျှော်လင့်ထားတယ် - +19 = XPath ​ခွဲခြားဖေါ်ပြမှု ပျက်ပယ်ခြင်း - မမှန်ကန်တဲ့ ကိန်းရှင် အမည် - +20 = XPath ​ခွဲခြားဖေါ်ပြမှု ပျက်ပယ်ခြင်း - မမျှော်လင့်တဲ့ ထုတ်ဖေါ်မှု အဆုံး - +21 = XPath ​ခွဲခြားဖေါ်ပြမှု ပျက်ပယ်ခြင်း - စီမံခန့်ခွဲသူကို မျှော်လင့်ထားတယ် - +22 = XPath ​ခွဲခြားဖေါ်ပြမှု ပျက်ပယ်ခြင်း - မပိတ်ထားတဲ့ ရှိရင်း - +23 = XPath parse failure: ':' unexpected: +24 = XPath parse failure: '!' unexpected, negation is not(): +25 = XPath ​ခွဲခြားဖေါ်ပြမှု ပျက်ပယ်ခြင်း - မမှန်ကန်တဲ့ အက္ခရာ တွေ့ရှိရတယ် - +26 = XPath ​ခွဲခြားဖေါ်ပြမှု ပျက်ပယ်ခြင်း - ဒွိစုံကိန်း စီမံခန့်ခွဲသူကို မျှော်လင့်ထားတယ် - +27 = XSLT stylesheet တခုကို လုံခြုံရေး ကိစ္စများကြောင့် ပိတ်ဆို့ထားတယ်။ +28 = မမှန်ကန်တဲ့ ထုတ်ဖေါ်မှုတခုကို ဆန်းစစ်နေတယ်။ +29 = မညီ ကောက်နေတဲ့ အထိန်း။ +30 = မမှန်ကန်တဲ့ QName တခုနဲ့ အစိတ်အပိုင်းတခုကို ဖန်တီးနေတယ်။ +31 = ကွဲပြားတဲ့ ချည်နှောင်ခြင်းက တူညီတဲ့ ပုံစံခွက်ထဲက ကွဲပြားတဲ့ ချည်နှောင်ခြင်းကို အရိပ်ပြသလား။ +32 = ကီး လုပ်ဆောင်ချက်များအား ခွင့်မပြုထားပါ + +LoadingError = stylesheet ဖွင့်နေတဲ့ အမှား - %S +TransformError = XSLT ​ပြောင်းလဲနေစဉ် အမှား - %S diff -Nru firefox-54.0~b1+build1/l10n/my/netwerk/necko.properties firefox-54.0~b2+build1/l10n/my/netwerk/necko.properties --- firefox-54.0~b1+build1/l10n/my/netwerk/necko.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/netwerk/necko.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,52 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#ResolvingHost=Looking up +#ConnectedTo=Connected to +#ConnectingTo=Connecting to +#SendingRequestTo=Sending request to +#TransferringDataFrom=Transferring data from + +3=%1$S တွင် ရှာနေသည်… +4=%1$S ကို ချိတ်ဆက်ထားသည်… +5=%1$S သို့ တောင်းဆိုမှု ပေးပို့နေသည်… +6=%1$S ထံမှ အချက်အလက်များ ရယူလွှဲပြောင်းနေသည်… +7=%1$S သို့ ချိတ်ဆက်နေသည်… +8=%1$S ကို ဖတ်ပါ +9=%1$S ကို ရေးမှတ်ခဲ့သည် +10=%1$S ကို စောင့်ဆိုင်းနေသည်… +11=%1$S တွင် ရှာခဲ့သည်… +12=Performing a TLS handshake to %1$S… +13=The TLS handshake finished for %1$S… + +27=FTP ဆောင်ရွက်မှု စတင်နေသည်… +28=FTP ​ဆောင်ရွက်မှု ပြီးဆုံးသွားပြီ + +UnsupportedFTPServer=လတ်တလောတွင် FTP ဆာဗာ %1$S ကို အသုံးမပြုနိုင်ပါ။ +RepostFormData=ဒီကွန်ရက် စာမျက်နှာကို နေရာသစ်ဆီ လမ်းလွှဲနေတယ်။ နေရာသစ်မှာ သင်ရေးထည့်တဲ့ ပုံစံဖြည့် အချက်အလက်ကို သင် ပြန်ပို့လိုသလား။ + +# Directory listing strings +DirTitle=%1$S ၏ အညွှန်း +DirGoUp=ဖိုင်တွဲ အပေါ်တစ်ဆင့်တက်ရန် +ShowHidden=ကွယ်ဝှက်ထားသော အရာများကို ပြသပါ +DirColName=အမည် +DirColSize=အရွယ်အ​စား +DirColMTime=နောက်ဆုံး မွမ်းမံခဲ့သောချိန် +DirFileLabel=ဖိုင် - + +PhishingAuth=သင်ဟာ "%1$S" ကို လေ့လာတော့မယ်။ ဒီကွန်ရက်က အ​ခြား ကွန်ရက်တခုဆီ လည်ပတ်တဲ့ ပုံစံနဲ့ သင့်ကို လှည့်ဖြားနိုင်တယ်။ အလွန် သတိချပ်ထားပါ။ +PhishingAuthAccept=ကျွန်ပ် သဘောပေါက်ပါသည်။ ထို့ပြင် ဂရုတစိုက်အသုံးပြုပါမည်။ +SuperfluousAuth=သင်ဟာ "%1$S" ကွန်ရက်ဆီကို "%2$S" သုံးစွဲသူ အမည်နဲ့ ၀င်ရောက်တော့မယ်၊ ဒါပေမဲ့ ကွန်ရက်က အထောက်အထား ပြဖို့ မလိုအပ်ဘူး။ ဒါဟာ သင့်ကို လှည့်ဖြားတဲ့ အားထုတ်မှု တခု ဖြစ်နိုင်တယ်။\n\n"%1$S" ဟာ သင်လည်ပတ်လိုတဲ့ ကွန်ရက် ဟုတ်ပါသလား။ +AutomaticAuth=သင်ဟာ "%1$S" ကွန်ရက်ဆီကို "%2$S" သုံးစွဲသူ အမည်နဲ့ ၀င်ရောက်တော့မယ်။ + +TrackingUriBlocked=သင့်တွင် ခြေရာခံ ကာကွယ်မှုကို ဖွင့်ထားသောကြောင့် "%1$S"ရှိ အရင်းအမြစ်ကို တားဆီးထားသည်။ +UnsafeUriBlocked=The resource at “%1$S” was blocked by Safe Browsing. + +# LOCALIZATION NOTE (APIDeprecationWarning): +# %1$S is the deprecated API; %2$S is the API function that should be used. +APIDeprecationWarning=သတိပေးချက်။ ။ ‘%1$S’ သည် မပါဝင်တော့ပါ၊ ကျေးဇူးပြု၍ ‘%2$S’ကို အသုံးပြုပါ + +# LOCALIZATION NOTE (nsICookieManagerDeprecated): don't localize originAttributes. +# %1$S is the deprecated API; %2$S is the interface suffix that the given deprecated API belongs to. +nsICookieManagerAPIDeprecated=“%1$S”ကို ပြောင်းလဲထားပါသည်။ သင့်ကုဒ်များကို အက်ပ်ဒိတ်ဖြစ်စေပြီး မှန်ကန်သည့် originAttributes ကို အသုံးပြုပါ။ MDN တွင် ပိုမိုဖတ်ရှုနိုင်ပါသည်။ https://developer.mozilla.org/docs/Mozilla/Tech/XPCOM/Reference/Interface/nsICookieManager%2$S diff -Nru firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pipnss/nsserrors.properties firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pipnss/nsserrors.properties --- firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pipnss/nsserrors.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pipnss/nsserrors.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,329 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +SSL_ERROR_EXPORT_ONLY_SERVER=လုံခြုံစွာ မဆက်သွယ်နိုင်ပါ။ ချိတ်ဆက်ကိရိယာသည် အဆင့်မြင့် စာဝှက်စနစ်ကို မထောက်ပံ့ပါ။ +SSL_ERROR_US_ONLY_SERVER=လုံခြုံစွာ မဆက်သွယ်နိုင်ပါ။ ချိတ်ဆက်ကိရိယာသည် အဆင့်မြင့်စာဝှက်စနစ်ကို လိုအပ်သည်။ သို့သော် မထောက်ပံ့နိုင်ပါ။ +SSL_ERROR_NO_CYPHER_OVERLAP=မျိုးတူနဲ့ လုံလုံခြုံခြုံ မဆက်သွယ်နိုင်ဘူး - ပုံမှန် စာဝှက် လုပ်ငန်းစနစ်(များ) မဟုတ်ဘူး။ +SSL_ERROR_NO_CERTIFICATE=လက်မှတ်ကို မတွေ့နိုင်ဘူး သို့မဟုတ် စစ်မှန်ကြောင်း ပြသဖို့ သော့ချက် လိုအပ်တယ်။ +SSL_ERROR_BAD_CERTIFICATE=မျိုးတူနဲ့ လုံလုံခြုံခြုံ မ​ဆက်သွယ်​နိုင်ဘူး - မျိုးတူ လက်မှတ်ကို ပယ်ချခံရတယ်။ +SSL_ERROR_BAD_CLIENT=ဆာဗာဟာ သုံးစွဲသူထံမှ မကောင်းတဲ့ အချက်အလက်ကြမ်းကို ရင်ဆိုင်နေရတယ်။ +SSL_ERROR_BAD_SERVER=သုံးစွဲသူဟာ ဆာဗာထံမှ မကောင်းတဲ့ အချက်အလက်ကြမ်းကို ရင်ဆိုင်နေရတယ်။ +SSL_ERROR_UNSUPPORTED_CERTIFICATE_TYPE=လက်ခံမထားတဲ့ လက်မှတ် အမျိုးအစား။ +SSL_ERROR_UNSUPPORTED_VERSION=မျိုးတူက လုံခြုံရေး နည်းစဉ်ရဲ့ လက်ခံမထားတဲ့ မူအဆင့်ကို သုံးစွဲနေတယ်။ +SSL_ERROR_WRONG_CERTIFICATE=သုံးစွဲသူ စစ်မှတ်ကြောင်း ပြသမှု မအောင်မြင်ဘူး - အဓိက အချက်အလက် သိုလှောင်ခန်းထဲမှ သီးသန့် သော့ချက်ဟာ လက်မှတ် အချက်အလက် သိုလှောင်ခန်းထဲမှ လူထု သော့ချက်နဲ့ မကိုက်ညီဘူး။ +SSL_ERROR_BAD_CERT_DOMAIN=မျိုးတူနဲ့ လုံလုံခြုံခြုံ မဆက်သွယ်နိုင်ဘူး - တောင်းဆိုထားတဲ့ ဒိုမန်း အမည်ဟာ ဆာဗာရဲ့ လက်မှတ်နဲ့ မကိုက်ညီဘူ။ +SSL_ERROR_POST_WARNING=မသိနိုင်သော SSL အမှားကုဒ်။ +SSL_ERROR_SSL2_DISABLED=Peer only supports SSL version 2, which is locally disabled. +SSL_ERROR_BAD_MAC_READ=SSL က မမှန်ကန်တဲ့ သတင်း မှန်ကန်မှု ကုဒ်တခု မှတ်တမ်းတင်ချက် တခု ရရှိထားတယ်။ +SSL_ERROR_BAD_MAC_ALERT=SSL မျိုးတူက မမှန်ကန်တဲ့ သတင်း မှန်ကန်မှု ကုဒ်ကို အစီရင်ခံထားတယ်။ +SSL_ERROR_BAD_CERT_ALERT=SSL မျိုးတူက သင့်ရဲ့ လက်မှတ်ကို အတည်မပြုနိုင်ဘူး။ +SSL_ERROR_REVOKED_CERT_ALERT=SSL မျိုးတူက သင့်ရဲ့ လက်မှတ်ကို သိမ်းဆည်းခံအဖြစ် ပယ်ချထားတယ်။ +SSL_ERROR_EXPIRED_CERT_ALERT=SSL မျိုးတူက သင့်ရဲ့ လက်မှတ်ကို သက်တမ်းကုန်တဲ့အဖြစ် ပယ်ချထားတယ်။ +SSL_ERROR_SSL_DISABLED=မချိတ်ဆက်နိုင်ဘူး - SSL ကို ပိတ်ထားတယ်။ +SSL_ERROR_FORTEZZA_PQG=မချိတ်ဆက်နိုင်ဘူး - SSL မျိုးတူဟာ တခြား FORTEZZA ဒိုမိန်းထဲမှာ ရှိနေတယ်။ +SSL_ERROR_UNKNOWN_CIPHER_SUITE=အမည်မသိ SSL စာဝှက် ဖေါ်နည်း အစုံတခုကို တောင်းဆိုထားတယ်။ +SSL_ERROR_NO_CIPHERS_SUPPORTED=ဒီပရိုဂရမ်ထဲမှာ ဘယ် စာဝှက်ဖေါ်နည်း အစုံတွေ မရှိ၊ မဖွင့်ထားဘူ။ +SSL_ERROR_BAD_BLOCK_PADDING=SSL က ​မကောင်းတဲ့ အကွက်ခံနေတဲ့ မှတ်တမ်းတခုကို ရရှိထားတယ်။ +SSL_ERROR_RX_RECORD_TOO_LONG=SSL က ​အများဆုံး လက်ခံနိုင်တဲ့ အတိုင်းအတာ ကျော်လွန်းတဲ့ မှတ်တမ်းတခုကို ရရှိထားတယ်။ +SSL_ERROR_TX_RECORD_TOO_LONG=SSL က ​အများဆုံး လက်ခံနိုင်တဲ့ အတိုင်းအတာ ကျော်လွန်းတဲ့ မှတ်တမ်းတခုကို ပေးပို့ဖို့ ကြိုးစားနေတယ်။ +SSL_ERROR_RX_MALFORMED_HELLO_REQUEST=SSL က ပုံမမှန်တဲ့ နှုတ်ဆက်​ တောင်းဆိုမှု လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_CLIENT_HELLO=SSL က ပုံမမှန်တဲ့ သုံးစွဲသူ နှုတ်ဆက်​ လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_SERVER_HELLO=SSL က ပုံပျက်တဲ့ ဆာဗာ နှုတ်ဆက်​ လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_CERTIFICATE=SSL က ပုံပျက်တဲ့ လက်မှတ် နှုတ်ဆက်​ လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_SERVER_KEY_EXCH=SSL က ပုံပျက်တဲ့ ဆာဗာ သော့ချက် ဖလှယ်မှု လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_CERT_REQUEST=SSL က ပုံပျက်တဲ့ လက်မှတ် တောင်းဆိုတဲ့ လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_HELLO_DONE=SSL က ပုံပျက်တဲ့ ဆာဗာ နှုတ်ဆက် ပြီးစီးမှု လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_CERT_VERIFY=SSL က ပုံပျက်တဲ့ လက်မှတ် အတည်ပြုချက် လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_CLIENT_KEY_EXCH=SSL က ပုံပျက်တဲ့ သုံးစွဲသူ အဓိက ဖလှယ်မှု လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_FINISHED=SSL က ပုံပျက်တဲ့ ပြီးစီးမှု လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_CHANGE_CIPHER=SSL က ပုံပျက်တဲ့ စာဝှက်ဖေါ်နည်း စောင့်ကြည့်မှု မှတ်တမ်းတခု ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_ALERT=SSL က ပုံပျက်တဲ့ သတိပေး မှတ်တမ်းတခု ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_HANDSHAKE=SSL က ပုံပျက်တဲ့ လုပ်ငန်းသုံးကိရိယာ လက်ဆွဲမှု မှတ်တမ်းတခု ရရှိထားတယ်။ +SSL_ERROR_RX_MALFORMED_APPLICATION_DATA=SSL က ပုံပျက်တဲ့ လုပ်ငန်းသုံးကိရိယာ အချက်အလက်ကြမ်း မှတ်တမ်းတခု ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_HELLO_REQUEST=SSL က မမျှော်လင့်တဲ့ နှုတ်ဆက် တောင်းဆိုတဲ့ လက်ဆွဲ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_CLIENT_HELLO=SSL က မမျှော်လင့်တဲ့ သုံးစွဲသူ နှုတ်ဆက် လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_SERVER_HELLO=SSL က မမျှော်လင့်တဲ့ ဆာဗာ နှုတ်ဆက် လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_CERTIFICATE=SSL က မမျှော်လင့်တဲ့ လက်မှတ် နှုတ်ဆက် လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_SERVER_KEY_EXCH=SSL က မမျှော်လင့်တဲ့ ဆာဗာ သော့ချက် ဖလှယ်တဲ့ လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_CERT_REQUEST=SSL က မမျှော်လင့်တဲ့ လက်မှတ် တောင်းဆိုမှု လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_HELLO_DONE=SSL က မမျှော်လင့်တဲ့ ဆာဗာ နှုတ်ဆက်ပြီးစီမှု လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_CERT_VERIFY=SSL က မမျှော်လင့်တဲ့ လက်မှတ် အတည်ပြုမှု လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_CLIENT_KEY_EXCH=SSL က မမျှော်လင့်တဲ့ သုံးစွဲသူ သော့ချက် လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_FINISHED=SSL က မမျှော်လင့်တဲ့ ပြီးစီးမှု လက်ဆွဲတဲ့ သတင်းစကား တပုဒ်ကို ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_CHANGE_CIPHER=SSL က မမျှော်လင့်တဲ့ ပြင်ဆင်တဲ့ စာဝှက်ဖေါ် ​စောင့်ကြည့် မှတ်တမ်း တခု ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_ALERT=SSL က မမျှော်လင့်တဲ့ သတိပေး မှတ်တမ်းတခု ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_HANDSHAKE=SSL က မမျှော်လင့်တဲ့ လက်ဆွဲမှု မှတ်တမ်း တခု ရရှိထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_APPLICATION_DATA=SSL က မမျှော်လင့်တဲ့ လုပ်ငန်းသုံး ကိရိယာ အချက်အလက်ကြမ်း မှတ်တမ်း တခု ရရှိထားတယ်။ +SSL_ERROR_RX_UNKNOWN_RECORD_TYPE=SSL က အမည်မသိ အကြောင်းအရာ အမျိုးအစားမှတ်တမ်း တခု ရရှိထားတယ်။ +SSL_ERROR_RX_UNKNOWN_HANDSHAKE=SSL က အမည်မသိ သတင်းစကား အမျိုးအစားပါတခု ပါရှိတဲ့ နှုတ်ဆက် သတင်းစကား တခု ရရှိထားတယ်။ +SSL_ERROR_RX_UNKNOWN_ALERT=SSL က အမည်မသိ သတိပေး ဖေါ်ပြချက်တခု ပါရှိတဲ့ သတိပေး မှတ်တမ်း တခု ရရှိထားတယ်။ +SSL_ERROR_CLOSE_NOTIFY_ALERT=SSL က ဒီချိတ်ဆက်မှုကို ပိတ်လိုက်တယ်။ +SSL_ERROR_HANDSHAKE_UNEXPECTED_ALERT=SSL က ၄င်းရရှိတဲ့ လက်ဆွဲ သတင်းစကား တခုကို မျှော်လင့်မထားဘူး။ +SSL_ERROR_DECOMPRESSION_FAILURE_ALERT=SSL မျိုးတူဟာ ၄င်းရရှိတဲ့ SSL မှတ်တမ်းတခုကို အောင်အောင်မြင်မြင် လျှော့ချလို့ မရနိုင်ဘူး။ +SSL_ERROR_HANDSHAKE_FAILURE_ALERT=SSL မျိုးတူဟာ လုံခြုံရေး အကန့်အသတ်များရဲ့ လက်ခံနိုင်တဲ့ အစုတခုကို ညှိလို့ မရနိုင်ဘူး။ +SSL_ERROR_ILLEGAL_PARAMETER_ALERT=SSL မျိုးတုက လက်မခံနိုင်တဲ့ အကြောင်းအရာအတွက် လက်ဆွဲ သတင်းစကား တခုကို ပယ်ချလိုက်တယ်။ +SSL_ERROR_UNSUPPORTED_CERT_ALERT=SSL မျိုးတူက ၄င်းရရှိတဲ့ လက်မှတ် အမျိုးအစားများကို လက်မခံဘူး။ +SSL_ERROR_CERTIFICATE_UNKNOWN_ALERT=SSL မျိုးတူမှာ ၄င်းရရှိတဲ့ လက်မှတ်နဲ့ဆိုင်ပြီး သတ်မှတ်မထားတဲ့ ပြဿနာတချို့ ရှိတယ်။ +SSL_ERROR_GENERATE_RANDOM_FAILURE=SSL က ၄င်းရဲ့ ကျပမ်း ဂဏန်း ထုတ်လုပ် ကိရိယာ ချို့ယွင်းမှု တခု တွေ့ကြုံ့ရတယ်။ +SSL_ERROR_SIGN_HASHES_FAILURE=သင့်ရဲ့ လက်မှတ်ကို အတည်ပြုဖို့ လိုအပ်တဲ့ အချက်အလက်ကြမ်းကို ဒစ်ဂျစ်တယ်နည်းဖြင့် လက်မှတ် မထိုးနိုင်ဘူး။ +SSL_ERROR_EXTRACT_PUBLIC_KEY_FAILURE=SSL က မျိုးတူ လက်မှတ်ဆီမှ လူထု သော့ချက်ကို ဆွဲထုတ်လို့ မရနိုင်ဘူး။ +SSL_ERROR_SERVER_KEY_EXCHANGE_FAILURE=SSL ဆာဗာ သော့ချက် ဖလှယ်ရေး လက်ဆွဲချက်ကို လုပ်ဆောင်နေစဉ် ခွဲခြားမရတဲ့ ချို့ယွင်းချက် ဖြစ်ပေါ်နေတယ်။ +SSL_ERROR_CLIENT_KEY_EXCHANGE_FAILURE=SSL သုံးစွဲသူ သော့ချက် ဖလှယ်ရေး လက်ဆွဲချက်ကို လုပ်ဆောင်နေစဉ် ခွဲခြားမရတဲ့ ချို့ယွင်းချက် ဖြစ်ပေါ်နေတယ်။ +SSL_ERROR_ENCRYPTION_FAILURE=ထုထည်ကြီး အချက်အလက်ကြမ်း စာဝှက် လုပ်ငန်းစနှစ်ဟာ ရွေးချယ်ထားတဲ့ စာဝှက် ဖေါ် အစုထဲမှာ ချို့ယွင်းနေတယ်။ +SSL_ERROR_DECRYPTION_FAILURE=ထုထည်ကြီး အချက်အလက်ကြမ်း စာဝှက် လုပ်ငန်းစနှစ်ဟာ ရွေးချယ်ထားတဲ့ စာဝှက် ဖေါ် အစုထဲမှာ ချို့ယွင်းနေတယ်။ +SSL_ERROR_SOCKET_WRITE_FAILURE=ချို့ယွင်းတဲ့ အပေါက်ကို ဖုံးဖို့ စာဝှက်ထားတဲ့ အချက်အလက်ကြမ်းကို ရေးဖို့ ကြိုးစားချက် +SSL_ERROR_MD5_DIGEST_FAILURE=MD5 အကျဉ်းချုပ် လုပ်ဆောင်ချက် ချို့ယွင်းနေတယ်။ +SSL_ERROR_SHA_DIGEST_FAILURE=SHA-1 အကျဉ်းချုပ် လုပ်ဆောင်ချက် ချို့ယွင်းနေတယ်။ +SSL_ERROR_MAC_COMPUTATION_FAILURE=MAC တွက်ချက်မှု ချို့ယွင်းသွားတယ်။ +SSL_ERROR_SYM_KEY_CONTEXT_FAILURE=အချိုးကျတဲ့ သော့ချက် ​အကြောင်းအရာကို ဖန်တီးဖို့ ချို့ယွင်းချက် +SSL_ERROR_SYM_KEY_UNWRAP_FAILURE=သုံးစွဲသူ သော့ချက် ဖလှယ်ရေး သတင်းစကားထဲမှ အချိုးကျတဲ့ သော့ချက် ဖြည်ထုတ်ဖို့ ချို့ယွင်းချက်။ +SSL_ERROR_PUB_KEY_SIZE_LIMIT_EXCEEDED=SSL ဆာဗာဟာ ဒေသတွင်း အဆင့် လူထု သော့​ချက်ကို စာဝှက်ဖေါ်စနစ် အစုနဲ့ သုံးစွဲဖို့ ကြိုးစားနေတယ်။ +SSL_ERROR_IV_PARAM_FAILURE=PKCS11 ကုဒ်က IV တခုကို param တခုအဖြင့် ဘာသာပြန်ဆိုဖို့ မအောင်မြင်ဘူး။ +SSL_ERROR_INIT_CIPHER_SUITE_FAILURE=ရွေးချယ်ထားတဲ့ စာဝှက်ဖေါ်စနစ် အစုကို စတင်ဖို့ ချို့ယွင်းသွားတယ်။ +SSL_ERROR_SESSION_KEY_GEN_FAILURE=သုံးစွဲသူက SSL အခန်းအတွက် အခန်း သော့ချက်များကို ထုတ်လုပ်ဖို့ မအောင်မြင်ဘူး။ +SSL_ERROR_NO_SERVER_KEY_FOR_ALG=ဆာ​ဗာမှာ သော့ချက် လုပ်ငန်းစနစ် ​ဖလှယ်ရေး ကြိုးစားမှု သော့ချက်အတွက် သော့ချက်မရှိဘူး။ +SSL_ERROR_TOKEN_INSERTION_REMOVAL=PKCS#11 အမှတ်အသားကို လုပ်ငန်း လည်ပတ်နေစဉ် ထည့်သွင်း သို့ ဖယ်ရှားခံရတယ်။ +SSL_ERROR_TOKEN_SLOT_NOT_FOUND=လိုအပ်တဲ့ လုပ်ငန်းတခု ဆောင်ရွတ်ဖို့ PKCS#11 အမှတ်အသားကို မတွေ့ရဘူး။ +SSL_ERROR_NO_COMPRESSION_OVERLAP=မျိုးတူနဲ့ လုံလုံခြုံခြုံ ဆက်သွယ်လို့ ​မရနိုင်ဘူး - ဖြစ်နေကျ ဖိသိပ်မှု လုပ်ငန်းစနစ်(များ) မရှိဘူး။ +SSL_ERROR_HANDSHAKE_NOT_COMPLETED=လက်ရှိ လက်ဆွဲမှု မပြီးဆုံးတဲ့အထိ တခြား SSL လက်ဆွဲမှုကို စတင်လို့ မရနိုင်ဘူး။ +SSL_ERROR_BAD_HANDSHAKE_HASH_VALUE=မျိုးတူဆီက မမှန်ကန်တဲ့ လက်ဆွဲ ပြင်ဆင်မှု တန်ဖိုးများကို ရရှိထားတယ်။ +SSL_ERROR_CERT_KEA_MISMATCH=ပံ့ပိုးထားတဲ့ လက်မှတ်ဟာ ရွေးချယ်ထားတဲ့ သော့ချက် ​ဖလှယ်ရေး လုပ်ငန်းစနစ်နဲ့ သုံးစွဲလို့ မရနိုင်ဘူး။ +SSL_ERROR_NO_TRUSTED_SSL_CLIENT_CA=SSL သုံးစွဲသူ စစ်မှန်မှုအတွက် ဘယ် လက်မှတ် အာဏာပိုင်ကိုမှ မယုံကြည်ရဘူး။ +SSL_ERROR_SESSION_NOT_FOUND=ဆာဗာ အပိုင်း ယာယီ သိမ်းဆည်းခန်းထဲမှာ သုံးစွဲသူရဲ့ SSL အပိုင်း ID ကို မတွေ့ရဘူး။ +SSL_ERROR_DECRYPTION_FAILED_ALERT=မျိုးတူက ၄င်းရရှိထားတဲ့ SSL မှတ်တမ်းတခုကို စာဝှက် မဖေါ်နိုင်ဘူး။ +SSL_ERROR_RECORD_OVERFLOW_ALERT=မျိုးတူက ခွင့်ပြုထားချက်ထက် ပိုတဲ့ SSL မှတ်တမ်းတခုကို ရရှိထားတယ်။ +SSL_ERROR_UNKNOWN_CA_ALERT=မျိုးတူက သင့်လက်မှတ်ကို ထုတ်ပေးတဲ့ CA ကို နားမလည်ရုံမက မယုံကြည်ဘူး။ +SSL_ERROR_ACCESS_DENIED_ALERT=မျိုးတူက မှန်ကန်တဲ့ လက်မှတ်တခုကို ရရှိထားတယ်၊ ဒါပေမဲ့ ၀င်ရောက်မှု ငြင်းပယ် ခံရတယ်။ +SSL_ERROR_DECODE_ERROR_ALERT=မျိုးတူက SSL လက်ဆွဲ သတင်းစကားတခုကို စာဝှက်မဖေါ်နိုင်ဘူး။ +SSL_ERROR_DECRYPT_ERROR_ALERT=မျိုးတူက လက်မှတ် အတည်ပြုခြင်း (သို့) သော့ချက် ​​ဖလှယ်ခြင်း ချို့ယွင်းချက်များကို အစီရင်ခံတယ်။ +SSL_ERROR_EXPORT_RESTRICTION_ALERT=မျိုးတူက တင်ပို့ချက် စည်းမျဉ်းများနဲ့ မကိုက်ညီတဲ့ ညှိနှိုင်းမှုကို အ​စီရင်ခံတယ်။ +SSL_ERROR_PROTOCOL_VERSION_ALERT=မျိုးတူက လိုက်ဖက်မှုမရှိ (သို့) လက်ခံမထားတဲ့ နည်းစဉ် မူအဆင့်ကို အ​စီရင်ခံတယ်။ +SSL_ERROR_INSUFFICIENT_SECURITY_ALERT=ဆာဗာက သုံးစွဲသူများ လက်ခံထားချက်တွေထက် ပိုလုံခြုံတဲ့ စာဝှက်ဖေါ်နည်းများကို ပိုလိုအပ်တယ်။ +SSL_ERROR_INTERNAL_ERROR_ALERT=မျိုးတူက ၄င်းတွေ့ကြုံနေတဲ့ အတွင်းပိုင်း အမှားတခုကို အစီရင်ခံတယ်။ +SSL_ERROR_USER_CANCELED_ALERT=မျိုးတူ သုံးစွဲသူက လက်စွဲချက်ကို ပယ်ဖျက်လိုက်ပါတယ်။ +SSL_ERROR_NO_RENEGOTIATION_ALERT=မျိုးတူက SSL လုံခြုရေး အကန့်အသတ်များရဲ့ ခွင့်ပြုမှု ပြန်လည် ညှိနှိုင်းမှုကို ခွင့်မပြုဘူး။ +SSL_ERROR_SERVER_CACHE_NOT_CONFIGURED=SSL ဆာဗာ ယာယီ သိမ်းဆည်းခန်းကို ပြုပြင်မထားရုံမက ဒီအပေါက်အတွက် ပိတ်ပင်မထားဘူ။ +SSL_ERROR_UNSUPPORTED_EXTENSION_ALERT=SSL မျိုးတူက တောင်းဆိုထားတဲ့ TLS နှုတ်ဆက်တဲ့ တိုးချဲ့ချက်များကို လက်ခံမထားဘူး။ +SSL_ERROR_CERTIFICATE_UNOBTAINABLE_ALERT=SSL မျိုးတူက ပံ့ပိုးထားတဲ့ URL ဆီမှ သင့်ရဲ့ လက်မှတ်ကို မရရှိနိုင်ဘူး။ +SSL_ERROR_UNRECOGNIZED_NAME_ALERT=SSL မျိုးတူက တောင်းဆိုထားတဲ့ DNS အမည်အတွက် လက်မှတ် မရှိဘူး။ +SSL_ERROR_BAD_CERT_STATUS_RESPONSE_ALERT=SSL မျိုးတူဟာ ၄င်းရဲ့ လက်မှတ်အတွက် OCSP တုံ့ပြန်မှုတခုကို မရယူနိုင်ဘူး။ +SSL_ERROR_BAD_CERT_HASH_VALUE_ALERT=SSL မျိုးတူက မကောင်းတဲ့ လက်မှတ် ပြင်ဆင်မှု တန်ဖိုးကို အစီရင်ခံထားတယ်။ +SSL_ERROR_RX_UNEXPECTED_NEW_SESSION_TICKET=SSL မှမမျှော်လင့်သော ချိတ်ဆက်မှူအသစ် စာတိုရရှိခဲ့သည်။ +SSL_ERROR_RX_MALFORMED_NEW_SESSION_TICKET=SSL မှမမျှော်လင့်သော ချိတ်ဆက်မှူအသစ် စာတိုရရှိခဲ့သည်။ +SSL_ERROR_DECOMPRESSION_FAILURE=SSL မှ ဖိသိပ်ထားသော မှတ်တမ်းရရှိသော်လည် ပြန်ဖြည်ထုတ်မရပါ +SSL_ERROR_RENEGOTIATION_NOT_ALLOWED=SSL socket ပေါ်တွင်အပြန်အလှန် ချိတ်ဆက်ခြင်း ခွင့်မပြုပါ။ +SSL_ERROR_UNSAFE_NEGOTIATION=Peer attempted old style (potentially vulnerable) handshake. +SSL_ERROR_RX_UNEXPECTED_UNCOMPRESSED_RECORD=SSL က မမျှော်လင့်တဲ့ အိတ်ဖွင့်သတိပေးမှတ်တမ်းတခု ရရှိထားတယ်။ +SSL_ERROR_WEAK_SERVER_EPHEMERAL_DH_KEY=SSL received a weak ephemeral Diffie-Hellman key in Server Key Exchange handshake message. +SSL_ERROR_NEXT_PROTOCOL_DATA_INVALID=SSL သည် ပုံမှန်မဟုတ်သော NPN အချက်အလက်များလက်ခံရရှိ +SSL_ERROR_FEATURE_NOT_SUPPORTED_FOR_SSL2=SSL လုပ်ဆောင်ချက်ကို SSL 2.0 ချိတ်ဆက်မှုတွေအတွက် မထောက်ပံ့ပါ။ +SSL_ERROR_FEATURE_NOT_SUPPORTED_FOR_SERVERS=SSL လုပ်ဆောင်ချက်ကို ဆာဗာတွေအတွက် မထောက်ပံ့ပါ။ +SSL_ERROR_FEATURE_NOT_SUPPORTED_FOR_CLIENTS=SSL လုပ်ဆောင်ချက်ကို ကလိုင်းယင့်တွေအတွက် မထောက်ပံ့ပါ။ +SSL_ERROR_INVALID_VERSION_RANGE=SSL ဗားရှင်းနံပါတ်အပိုင်းအခြား မှားနေသည်။ +SSL_ERROR_CIPHER_DISALLOWED_FOR_VERSION=SSL ချိတ်ဆက်သူသည် ရွေးချယ်ထားသည့် ပရိုတိုကောလ်ဗာရှင်းအတွက် ခွင့်ပြုမထားသည့် ဆိုက်ဖာတစ်စုံကို အသုံးပြုထားသည်။ +SSL_ERROR_RX_MALFORMED_HELLO_VERIFY_REQUEST=ပုံစံပျက်နေသည့် ဟဲလိုတောင်းဆိုမှုအတည်ပြုခြင်း နှုတ်ဆက်စာကို SSL က ရရှိထားသည်။ +SSL_ERROR_RX_UNEXPECTED_HELLO_VERIFY_REQUEST=မမျှော်လင့်ထားသည့် ဟဲလိုတောင်းဆိုမှုအတည်ပြုခြင်း နှုတ်ဆက်စာကို SSL က ရရှိထားသည်။ +SSL_ERROR_FEATURE_NOT_SUPPORTED_FOR_VERSION=လက်ရှိပရိုတိုကောလ်ဗားရှင်းအတွက် SSL လုပ်ဆောင်ချက်ကို အသုံးမပြုနိုင်ပါ။ +SSL_ERROR_RX_UNEXPECTED_CERT_STATUS=မမျှော်လင့်ထားသည့် အထောက်အထားအခြေအနေဆိုင်ရာ နှုတ်ဆက်စာကို SSL က ရရှိထားသည်။ +SSL_ERROR_UNSUPPORTED_HASH_ALGORITHM=TLS ချိတ်ဆက်သူသည် အသုံးမပြုနိုင်သည့် ဟက်ရှ်အလ်ဂိုရစ်သမ်ကို အသုံးပြုထားသည်။ +SSL_ERROR_DIGEST_FAILURE=ဝှက်စာချုံ့စနစ် လုပ်ဆောင်ချက် ချို့ယွင်းနေသည်။ +SSL_ERROR_INCORRECT_SIGNATURE_ALGORITHM=ဒီဂျစ်တယ်အားဖြင့် အထောက်အထားပြုထားသည့် အစိတ်အပိုင်းတွင် မှားယွင်းနေသည့် လက်မှတ်ဆိုင်ရာ အလ်ဂိုရစ်သမ်ကို အသုံးပြုထားသည်။ +SSL_ERROR_NEXT_PROTOCOL_NO_CALLBACK=The next protocol negotiation extension was enabled, but the callback was cleared prior to being needed. +SSL_ERROR_NEXT_PROTOCOL_NO_PROTOCOL=The server supports no protocols that the client advertises in the ALPN extension. +SSL_ERROR_INAPPROPRIATE_FALLBACK_ALERT=The server rejected the handshake because the client downgraded to a lower TLS version than the server supports. +SSL_ERROR_WEAK_SERVER_CERT_KEY=The server certificate included a public key that was too weak. +SSL_ERROR_RX_SHORT_DTLS_READ=Not enough room in buffer for DTLS record. +SSL_ERROR_NO_SUPPORTED_SIGNATURE_ALGORITHM=No supported TLS signature algorithm was configured. +SSL_ERROR_UNSUPPORTED_SIGNATURE_ALGORITHM=The peer used an unsupported combination of signature and hash algorithm. +SSL_ERROR_MISSING_EXTENDED_MASTER_SECRET=The peer tried to resume without a correct extended_master_secret extension. +SSL_ERROR_UNEXPECTED_EXTENDED_MASTER_SECRET=The peer tried to resume with an unexpected extended_master_secret extension. +SEC_ERROR_IO=လုံခြုံရေး အခွင့်ကာဏာ အချိန်တွင်း I/O အမှားတခု ဖြစ်ပွားတယ်။ +SEC_ERROR_LIBRARY_FAILURE=လုံခြုံရေး စာကြည့်တိုက် ချို့ယွင်းမှု။ +SEC_ERROR_BAD_DATA=လုံခြုံရေး စာကြည့်တိုက် - မကောင်းတဲ့ အချက်အလက်ကြမ်းကို ရရှိထားတယ်။ +SEC_ERROR_OUTPUT_LEN=လုံခြုံရေး စာကြည့်တိုက် - အထွက်​ ကြာချိန် အမှား +SEC_ERROR_INPUT_LEN=လုံခြုံရေး စာကြည့်တိုက်မှာ အထွက်​ ကြာချိန် အမှားတခု ကြုံတွေ့နေတယ်။ +SEC_ERROR_INVALID_ARGS=လုံခြုံရေး စာကြည့်တိုက် - မမှန်ကန်တဲ့ ဆွေးနွေးချက်များ။ +SEC_ERROR_INVALID_ALGORITHM=လုံခြုံရေး စာကြည့်တိုက် - မမှန်ကန်တဲ့ လုပ်ငန်းစနစ်။ +SEC_ERROR_INVALID_AVA=လုံခြုံရေး စာကြည့်တိုက် - မမှန်ကန်တဲ့ AVA။ +SEC_ERROR_INVALID_TIME=မသင့်လျှော်တဲ့ စီစဉ်ထားတဲ့ အချိန် စာတန်း။ +SEC_ERROR_BAD_DER=လုံခြုံရေး စာကြည့်တိုက် - မသင့်လျှော်တဲ့ စီစဉ်ထားတဲ့ DER-စာဝှက်ထားတဲ့ သတင်းစကား။ +SEC_ERROR_BAD_SIGNATURE=မျိုးတူ လက်မှတ်မှာ မမှန်ကန်တဲ့ လက်မှတ်တခု ရှိတယ်။ +SEC_ERROR_EXPIRED_CERTIFICATE=မျိုးတူ လက်မှတ်ဟာ သက်တမ်းကုန်ပြီ။ +SEC_ERROR_REVOKED_CERTIFICATE=မျိုးတူ လက်မှတ်ကို ပြန်သိမ်းလိုက်ပြီ။ +SEC_ERROR_UNKNOWN_ISSUER=မျိုးတူ လက်မှတ် ထုတ်ပြန်သူကို မမှတ်မိဘူး။ +SEC_ERROR_BAD_KEY=မျိုးတူရဲ့ လူထု သော့ချက်ဟာ မမှန်ကန်ဘူး။ +SEC_ERROR_BAD_PASSWORD=ရေးထည့်တဲ့ လုံခြုံရေး စကားဝှက်ဟာ မမှန်ကန်ဘူး။ +SEC_ERROR_RETRY_PASSWORD=New password entered incorrectly. Please try again. +SEC_ERROR_NO_NODELOCK=လုံခြုံတဲ့ စာကြည့်တိုက် - အဖုအထိန်း မရှိဘူး။ +SEC_ERROR_BAD_DATABASE=လုံခြုံတဲ့ စာကြည့်တိုက် - ​မကောင်းတဲ့ အချက်အလက် သိုလှောင်ခန်း။ +SEC_ERROR_NO_MEMORY=လုံခြုံတဲ့ စာကြည့်တိုက် - မှတ်ဉာဏ် နေရာချမှု ချို့ယွင်းချက်။ +SEC_ERROR_UNTRUSTED_ISSUER=မျိုးတူရဲ့ လက်မှတ် ထုတ်ပြန်သူကို သုံးစွဲသူက မယုံကြည်ရတဲ့ အဖြစ်နဲ့ မှတ်ထားခံရတယ်။ +SEC_ERROR_UNTRUSTED_CERT=မျိုးတူရဲ့ လက်မှတ်ကို သုံးစွဲသူက မယုံကြည်ရတဲ့ အဖြစ်နဲ့ မှတ်ထားခံရတယ်။ +SEC_ERROR_DUPLICATE_CERT=လက်မှတ်က သင့်ရဲ့ အချက်အလက် သိုလှောင်ခန်းထဲမှာ ရှိနေပြီ။ +SEC_ERROR_DUPLICATE_CERT_NAME=ဆွဲချထားတဲ့ လက်မှတ် အမည်က သင့်အချက်အလက် သိုလှောင်ခန်းထဲမှာ ရှိပြီးသား တခုနဲ့ ထပ်နေတယ်။ +SEC_ERROR_ADDING_CERT=အချက်အလက် သိုလှောင်ခန်းထဲ လက်မှတ် ထည့်သွင်းမှု အမှား +SEC_ERROR_FILING_KEY=ဒီလက်မှတ်အတွက် သော့ချက် ဖြည့်စွတ်မှု အမှား +SEC_ERROR_NO_KEY=ဒီလက်မှတ်ရဲ့ သီးသန့် သော့ချက်ကို သော့ချက် အချက်အလက် သိုလှောင်ခန်းထဲမျာ မတွေ့ရဘူး။ +SEC_ERROR_CERT_VALID=ဒီလက်မှတ်ဟာ မှန်ကန်တယ်။ +SEC_ERROR_CERT_NOT_VALID=ဒီလက်မှတ်ဟာ မမှန်ကန်ဘူး။ +SEC_ERROR_CERT_NO_RESPONSE=လက်မှတ် စာကြည့်တိုက် - တုံ့ပြန်ချက် မရှိဘူး +SEC_ERROR_EXPIRED_ISSUER_CERTIFICATE=လက်မှတ် ထုတ်ပြန်သူရဲ့ လက်မှတ်ဟာ သက်တမ်းကုန်သွားပြီ။ သင့်စက် နေ့စွဲနဲ့ အချိန်ကို စစ်ဆေးပါ။ +SEC_ERROR_CRL_EXPIRED=လက်မှတ် ထုတ်ပြန်သူရဲ့ CRL ဟာ သက်တမ်း ကုန်သွားပြီ။ ၄င်းကို မွမ်းမံပါ (သို့) သင့်စက်ရဲ့ နေ့စွဲနဲ့ အချိန်ကို စစ်ဆေးပါ။ +SEC_ERROR_CRL_BAD_SIGNATURE=လက်မှတ် ထုတ်ပြန်သူရဲ့ CRL မှာ မမှန်ကန်တဲ့ လက်မှတ်တခု ရှိနေတယ်။ +SEC_ERROR_CRL_INVALID=CRL အသစ်မှာ မမှန်ကန်တဲ့ ပုံစံတခု ရှိတယ်။ +SEC_ERROR_EXTENSION_VALUE_INVALID=လက်မှတ် တိုးချဲ့ချက် တန်ဖိုးဟာ မမှန်ကန်ဘူး။ +SEC_ERROR_EXTENSION_NOT_FOUND=လက်မှတ် တိုးချဲ့ချက်ကို မတွေ့ရဘူး။ +SEC_ERROR_CA_CERT_INVALID=ထုတ်ပြန်သူ လက်မှတ်ဟာ မမှန်ကန်ဘူး။ +SEC_ERROR_PATH_LEN_CONSTRAINT_INVALID=လက်မှတ် လမ်းကြောင်း အရှည် အကန့်အသတ် မမှန်ကန်ဘူး။ +SEC_ERROR_CERT_USAGES_INVALID=လက်မှတ် သုံးစွဲမှု နေရာဟာ မမှန်ကန်ဘူး။ +SEC_INTERNAL_ONLY=**Internal ONLY module** +SEC_ERROR_INVALID_KEY=သော့ချက်က တောင်းဆိုထားတဲ့ လုပ်ငန်းကို ပံ့ပိုးမထားဘူး။ +SEC_ERROR_UNKNOWN_CRITICAL_EXTENSION=လက်မှတ်မှာ အမည်မသိတဲ့ အရေးပါတဲ့ တိုးချဲ့ချက်များ ပါရှိပါတယ်။ +SEC_ERROR_OLD_CRL=CRL အသစ်ဟာ လက်ရှိအရာထက် ပိုနောက်မကျဘူး။ +SEC_ERROR_NO_EMAIL_CERT=စာဝှက် (သို့) လက်မှတ်ထိုး မထားဘူး - သင့်မှာ အီးမေးလ် လိပ်စာတခု မရှိသေးဘူး။ +SEC_ERROR_NO_RECIPIENT_CERTS_QUERY=စာဝှက်မထားဘူး - သင့်ဆီမှာ လက်ခံရရှိသူများ တဦးချင်းအတွက် လက်မှတ်များ မရှိဘူး။ +SEC_ERROR_NOT_A_RECIPIENT=စာဝှက် ဖေါ်လို့ မရနိုင်ဘူး - သင်ဟာ လက်ခံရရှိသူ မဟုတ်ဘူး၊ (သို့) ကိုက်ညီတဲ့ လက်မှတ်နဲ့ သီးသန့် သော့ချက် မတွေ့ရဘူး။ +SEC_ERROR_PKCS7_KEYALG_MISMATCH=စာဝှက် ဖေါ်လို့ မရနိုင်ဘူး - သော့ချက် စာဝှက် လုပ်ငန်းစနစ်ဟာ သင့်ရဲ့ လက်မှတ်နဲ့ မကိုက်ညီဘူး။ +SEC_ERROR_PKCS7_BAD_SIGNATURE=လက်မှတ် အတည်ပြုခြင်း မအောင်မြင်ဘူး - လက်မှတ်ထိုးသူ မတွေ့ရဘူး၊ အလွန်များတဲ့ လက်မှတ်ထိုးသူတွေ တွေ့ရတယ်၊ (သို့) မသင့်လျော် (သို့) ပျက်စီးတဲ့ အချက်အလက်ကြမ်း။ +SEC_ERROR_UNSUPPORTED_KEYALG=လက်ခံမထား (သို့) အမည်မသိတဲ့ လုပ်ငန်း။ +SEC_ERROR_DECRYPTION_DISALLOWED=စာဝှက် ဖေါ်လို့ မရနိုင်ဘူး - +XP_SEC_FORTEZZA_BAD_CARD=Fortezza card has not been properly initialized. Please remove it and return it to your issuer. +XP_SEC_FORTEZZA_NO_CARD=Fortezza များ မတွေ့ရဘူး။ +XP_SEC_FORTEZZA_NONE_SELECTED=Fortezza များ မရွေးချယ်ထားဘူး။ +XP_SEC_FORTEZZA_MORE_INFO=အချက်အလက် ပိုမို ရရှိဖို့ အရည်အသွေးတခုကို ရွေးချယ်ရမဲ့အရာ +XP_SEC_FORTEZZA_PERSON_NOT_FOUND=အရည်အသွေး မတွေ့ရဘူး။ +XP_SEC_FORTEZZA_NO_MORE_INFO=အဲဒီ အရည်အသွေးအတွက် အချက်အလက် ထပ်မလိုဘူး +XP_SEC_FORTEZZA_BAD_PIN=မမှန်ကန်တဲ့ ဂဏန်းအမှတ် +XP_SEC_FORTEZZA_PERSON_ERROR=Fortezza ရဲ့ အ​ရည်အသွေးများကို စတင်လို့ မရနိုင်ဘူး။ +SEC_ERROR_NO_KRL=ဒီကွန်ရက်ရဲ့ လက်မှတ်အတွက် KRL ကို ​မတွေ့ရဘူး။ +SEC_ERROR_KRL_EXPIRED=ဒီကွန်ရက်ရဲ့ လက်မှတ်အတွက် KRL ဟာ သက်တမ်း ကုန်သွားပြီ။ +SEC_ERROR_KRL_BAD_SIGNATURE=ဒီကွန်ရက်ရဲ့ လက်မှတ်အတွက် KRL မှာ မမှန်ကန်တဲ့ လက်မှတ် တခု ရှိတယ်။ +SEC_ERROR_REVOKED_KEY=ဒီကွန်ရက်ရဲ့ လက်မှတ်အတွက် သော့ချက်ကို သိမ်းဆည်းလိုက်ပြီ။ +SEC_ERROR_KRL_INVALID=KRL မှာ မမှန်ကန်တဲ့ ပုံစံတခု ရှိတယ်။ +SEC_ERROR_NEED_RANDOM=လုံခြုံတဲ့ စာကြည့်တိုက် - ကျပမ်း အချက်အလက်ကြမ်း လိုအပ်တယ်။ +SEC_ERROR_NO_MODULE=လုံခြုံတဲ့ စာကြည့်တိုက် - ဘယ် လုံခြုံရေး အစိတ်အပိုင်းကမှ တောင်းဆိုထားတဲ့ လုပ်ငန်းကို ဆောင်ရွတ်​နိုင်မှာ မဟုတ်ဘူး။ +SEC_ERROR_NO_TOKEN=လုံခြုံရေး ကဒ် (သို့) အမှတ်အသား မရှိဘူး၊ စတင်ဖို့ လိုအပ်တယ်၊ (သို့) ဖယ်ရှားခံလိုက်ရတယ်။ +SEC_ERROR_READ_ONLY=လုံခြုံရေး စာကြည့်တိုက် - အချက်အလက် သိုလှောင်ခန်း ဖတ်ရန် အတွက်သာ။ +SEC_ERROR_NO_SLOT_SELECTED=ဘယ် အကွက် (သို့) အမှတ်အသားကိုမှ မရွေးထားဘူး။ +SEC_ERROR_CERT_NICKNAME_COLLISION=တူညီတဲ့ အမည်ရှိတဲ့ လက်မှတ်တခု ရှိနေပြီး။ +SEC_ERROR_KEY_NICKNAME_COLLISION=တူညီတဲ့ အမည်ရှိတဲ့ သော့ချက်တခု ရှိနေပြီး။ +SEC_ERROR_SAFE_NOT_CREATED=အန္တရယ်ကင်း သတ္တုကို ဖန်တီးနေတုန်း အမှား +SEC_ERROR_BAGGAGE_NOT_CREATED=အထုပ်အပိုး ၀တ္တု ဖန်တီး​နေတုန်း အမှား +XP_JAVA_REMOVE_PRINCIPAL_ERROR=အဓိကအချက်ကို ဖယ်ရှားလို့ မရဘူး +XP_JAVA_DELETE_PRIVILEGE_ERROR=အခွင့်အလမ်းကို မပယ်ဖျက်နိုင်ဘူး +XP_JAVA_CERT_NOT_EXISTS_ERROR=အဓိကအချက်မှာ လက်မှတ်တခု မရှိဘူး။ +SEC_ERROR_BAD_EXPORT_ALGORITHM=လုပ်ငန်းစနစ် လိုအပ်ချက်ကို ခွင့်ပြုမထားဘူး။ +SEC_ERROR_EXPORTING_CERTIFICATES=လက်မှတ်များကို တင်ပို့ဖို့ ကြိုးစားနေတဲ့ အမှား +SEC_ERROR_IMPORTING_CERTIFICATES=လက်မှတ်များကို တင်သွင်းဖို့ ကြိုးစားနေတဲ့ အမှား +SEC_ERROR_PKCS12_DECODING_PFX=Unable to import. Decoding error. File not valid. +SEC_ERROR_PKCS12_INVALID_MAC=Unable to import. Invalid MAC. Incorrect password or corrupt file. +SEC_ERROR_PKCS12_UNSUPPORTED_MAC_ALGORITHM=Unable to import. MAC algorithm not supported. +SEC_ERROR_PKCS12_UNSUPPORTED_TRANSPORT_MODE=Unable to import. Only password integrity and privacy modes supported. +SEC_ERROR_PKCS12_CORRUPT_PFX_STRUCTURE=Unable to import. File structure is corrupt. +SEC_ERROR_PKCS12_UNSUPPORTED_PBE_ALGORITHM=Unable to import. Encryption algorithm not supported. +SEC_ERROR_PKCS12_UNSUPPORTED_VERSION=Unable to import. File version not supported. +SEC_ERROR_PKCS12_PRIVACY_PASSWORD_INCORRECT=Unable to import. Incorrect privacy password. +SEC_ERROR_PKCS12_CERT_COLLISION=Unable to import. Same nickname already exists in database. +SEC_ERROR_USER_CANCELLED=သုံးစွဲသူက ပယ်ဖျက်ပါကို နှိုပ်လိုက်တယ်။ +SEC_ERROR_PKCS12_DUPLICATE_DATA=တင်သွင်းမထားဘူး၊ အချက်အလက် သိုလှောင်ခန်းထဲမှာ ရှိနေပြီ။ +SEC_ERROR_MESSAGE_SEND_ABORTED=သတင်းစကား မပို့လိုက်ဘူး။ +SEC_ERROR_INADEQUATE_KEY_USAGE=လက်မှတ် သော့ချက် သုံးစွဲမှုဟာ လုပ်ငန်း ကြိုးစားမှု အတွက် မလုံလောက်ဘူး။ +SEC_ERROR_INADEQUATE_CERT_TYPE=လုပ်ငန်းသုံး ကိရိယာအတွက် လက်ခံမထားတဲ့ လက်မှတ် အမျိုးအစား +SEC_ERROR_CERT_ADDR_MISMATCH=လက်မှတ် ရေးထိုးချက်ထဲက လိပ်စာဟာ ခေါင်းစည်းများပေါ်က သတင်းစကား လိပ်စာနဲ့ ကိုက်ညီမှု မရှိဘူး။ +SEC_ERROR_PKCS12_UNABLE_TO_IMPORT_KEY=Unable to import. Error attempting to import private key. +SEC_ERROR_PKCS12_IMPORTING_CERT_CHAIN=Unable to import. Error attempting to import certificate chain. +SEC_ERROR_PKCS12_UNABLE_TO_LOCATE_OBJECT_BY_NAME=Unable to export. Unable to locate certificate or key by nickname. +SEC_ERROR_PKCS12_UNABLE_TO_EXPORT_KEY=Unable to export. Private Key could not be located and exported. +SEC_ERROR_PKCS12_UNABLE_TO_WRITE=Unable to export. Unable to write the export file. +SEC_ERROR_PKCS12_UNABLE_TO_READ=Unable to import. Unable to read the import file. +SEC_ERROR_PKCS12_KEY_DATABASE_NOT_INITIALIZED=Unable to export. Key database corrupt or deleted. +SEC_ERROR_KEYGEN_FAIL=လူထု/သီးသန့် သော့ချက် အတွဲကို မဖန်တီးနိုင်ဘူး။ +SEC_ERROR_INVALID_PASSWORD=ပတ်စ်ဝတ်အားမသုံးနိုင်ပါ။ ကျေးဇူးပြုပြီး အခြားတစ်ခုရွေးပါ။ +SEC_ERROR_RETRY_OLD_PASSWORD=ပတ်စ်ဝတ်အဟောင်းအား မှားထည့်မိသည်။ ကျေးဇူးပြုပြီး ထပ်ကြိုးစားပါ +SEC_ERROR_BAD_NICKNAME=သုံးစွဲပြီးသား လက်မှတ် အမည် +SEC_ERROR_NOT_FORTEZZA_ISSUER=မျိုးတူ FORTEZZA ကွင်းဆက်မှာ FORTEZZA မဟုတ်တဲ့ လက်မှတ် တခုရှိတယ်။ +SEC_ERROR_CANNOT_MOVE_SENSITIVE_KEY=အရေးပါတဲ့ သော့ချက်ကို ၄င်းကို လိုအပ်တဲ့ အကွက်ဆီ ရွေ့လို့မရနိုင်ဘူး။ +SEC_ERROR_JS_INVALID_MODULE_NAME=မမှန်ကန်တဲ့ အစိတ်အပိုင်း အမည်။ +SEC_ERROR_JS_INVALID_DLL=မမှန်ကန်တဲ့ အစိတ်အပိုင်း လမ်းကြောင်း/ဖိုင်အမည် +SEC_ERROR_JS_ADD_MOD_FAILURE=အစိတ်အပိုင်းကို မထည့်သွင်းနိုင်ဘူး +SEC_ERROR_JS_DEL_MOD_FAILURE=အစိတ်အပိုင်းကို မပယ်ဖျက်နိုင်ဘူး +SEC_ERROR_OLD_KRL=KRL အသစ်ဟာ လက်ရှိအရာထက် ပိုနောက်မကျဘူး။ +SEC_ERROR_CKL_CONFLICT=New CKL has different issuer than current CKL. Delete current CKL. +SEC_ERROR_CERT_NOT_IN_NAME_SPACE=ဒီလက်မှတ်အတွက် ထောက်ခံပေးတဲ့ အခွင့်အာဏာကို ဒီအမည်နဲ့ လက်မှတ် တခု ထုတ်ပြန်ဖို့ ခွင့်မပြုဘူး။ +SEC_ERROR_KRL_NOT_YET_VALID=ဒီလက်မှတ်အတွက် သော့ချက် ပြန်လည်ရုတ်သိမ်းမှု စာရင်းဟာ မမှန်ကန်သေးဘူး။ +SEC_ERROR_CRL_NOT_YET_VALID=ဒီလက်မှတ်အတွက် လက်မှတ် ပြန်လည်ရုတ်သိမ်းမှု စာရင်းဟာ မမှန်ကန်သေးဘူး။ +SEC_ERROR_UNKNOWN_CERT=တောင်းဆိုထားတဲ့ လက်မှတ်ကို မတွေ့နိုင်သေးဘူး။ +SEC_ERROR_UNKNOWN_SIGNER=လက်မှတ် ရေးထိုးသူရဲ့ လက်မှတ်ကို မတွေ့နိုင်ဘူး။ +SEC_ERROR_CERT_BAD_ACCESS_LOCATION=လက်မှတ်ရ အနေအထား ဆာဗာမှာ မမှန်ကန်တဲ့ ပုံစံရှိတယ်။ +SEC_ERROR_OCSP_UNKNOWN_RESPONSE_TYPE=OCSP တုံ့ပြန်ချက်ကို ပြည့်ပြည့်၀၀ စာဝှက် ဖွင့်လို့ မရနိုင်ဘူး၊ ၄င်းဟာ အမည်မသိ အမျိုးအစား တခု ဖြစ်တယ်။ +SEC_ERROR_OCSP_BAD_HTTP_RESPONSE=OCSP ​ဆာဗာက မျှော်လင့် မထား/မမှန်ကန်တဲ့ HTTP အချက်အလက်ကြမ်းကို ပေးပို့တယ်။ +SEC_ERROR_OCSP_MALFORMED_REQUEST=OCSP ​ဆာဗာက တောင်းဆိုထားချက်ဟာ ပျက်စီး (သို့) မသင့်လျှော်တဲ့ ပုံစံနဲ့ တွေ့ရှိသွားတယ်။ +SEC_ERROR_OCSP_SERVER_ERROR=OCSP ​ဆာဗာက အတွင်းပိုင်း အမှားတခုကို တွေ့ကြုံနေတယ်။ +SEC_ERROR_OCSP_TRY_SERVER_LATER=OCSP ​ဆာဗာက ထပ်ကြိုးစားဖို့ ​အကြံပြုတယ်။ +SEC_ERROR_OCSP_REQUEST_NEEDS_SIG=OCSP ​ဆာဗာက ဒီတောင်းဆိုချက်အပေါ် လက်မှတ်တခုကို တောင်းဆိုတယ်။ +SEC_ERROR_OCSP_UNAUTHORIZED_REQUEST=OCSP ​ဆာဗာက ဒီတောင်းဆိုမှုကို မသက်ဆိုင်သူအဖြစ် ငြင်းပယ်ခံရတယ်။ +SEC_ERROR_OCSP_UNKNOWN_RESPONSE_STATUS=OCSP ​ဆာဗာက အသိအမှတ် မပြုနိုင်တဲ့ အနေအ​ထားတခုကို ​ပေးပို့တယ်။ +SEC_ERROR_OCSP_UNKNOWN_CERT=OCSP ​ဆာဗာမှာ လက်မှတ်အတွက် အနေအထားမရှိဘူး။ +SEC_ERROR_OCSP_NOT_ENABLED=ဒီလုပ်ငန်းကို မဆောင်ရွတ်မီ OCSP ကို သင် ဖွင့်ထားရမယ်။ +SEC_ERROR_OCSP_NO_DEFAULT_RESPONDER=ဒီလုပ်ငန်းကို မဆောင်ရွတ်မီ OCSP စံထားချက် တုံ့ပြန်သူကို သင် ချမှတ်ရမယ်။ +SEC_ERROR_OCSP_MALFORMED_RESPONSE=OCSP ဆာဗာဆီက တုံ့ပြန်ချက်ဟာ ပျက်စီးနေ သို့ ပုံပျက်နေတယ်။ +SEC_ERROR_OCSP_UNAUTHORIZED_RESPONSE=OCSP တုံ့ပြန်မှု လက်မှတ် ရေးထိုးသူဟာ ဒီလက်မှတ်ရဲ့ ​အ​နေအထားကို ပေးဖို့ အခွင့် မရှိဘူး။ +SEC_ERROR_OCSP_FUTURE_RESPONSE=OCSP တုံ့ပြန်မှု ဟာ မမှန်ကန်ဘူး (အ​နာဂတ်မှာ နေ့စွဲတခု ပါ၀င်တယ်)။ +SEC_ERROR_OCSP_OLD_RESPONSE=OCSP တုံ့ပြန်မှုမျာ နေ့စွဲလွန်တဲ့ အချက်အလက် ပါရှိတယ်။ +SEC_ERROR_DIGEST_NOT_FOUND=The CMS or PKCS #7 Digest was not found in signed message. +SEC_ERROR_UNSUPPORTED_MESSAGE_TYPE=The CMS or PKCS #7 Message type is unsupported. +SEC_ERROR_MODULE_STUCK=PKCS #11 အစိတ်အပိုင်းကို သုံးစွဲနေသေးတဲ့ အတွက် ဖယ်ရှားလို့ မရနိုင်ဘူး။ +SEC_ERROR_BAD_TEMPLATE=ASN.1 အချက်အလက်ကြမ်းကို စာဝှက် မဖွင့်နိုင်ဘူး။ သတ်မှတ်ထားတဲ့ ပုံစံခွက်ဟာ မမှန်ကန်ဘူး။ +SEC_ERROR_CRL_NOT_FOUND=ကိုက်ညီတဲ့ CRL ကို မတွေ့ရဘူး။ +SEC_ERROR_REUSED_ISSUER_AND_SERIAL=သင်ဟာ တူညီတဲ့ ထုတ်ပြန်သူပါတဲ့ လက်မှတ်တခု/တည်ရှိနေတဲ့ လက်မှတ်တခု အစဉ်လိုက်ကို တင်သွင်းဖို့ ကြိုးစားနေတယ်၊ ဒါပေမဲ့ ဒီဟာ တူညီတဲ့ လက်မှတ်မဟုတ်ဘူး။ +SEC_ERROR_BUSY=NSS ကို အပြီးမပိတ်နိုင်ဘူး။ ၀တ္တုများကို သုံးစွဲနေတုန်း။ +SEC_ERROR_EXTRA_INPUT=DER-စာဝှက်တဲ့ သတင်းစကားမျာ အသုံးမပြုတဲ့ အချက်အလက်ကြမ်း အပို ပါရှိတယ်။ +SEC_ERROR_UNSUPPORTED_ELLIPTIC_CURVE=လက်ခံမထားတဲ့ အချက်ပြ ပြင်ခုံး။ +SEC_ERROR_UNSUPPORTED_EC_POINT_FORM=လက်ခံမထားတဲ့ အချက်ပြ ပြင်ခုံး နေရာ ဖြည့်စွတ်ပုံစံ။ +SEC_ERROR_UNRECOGNIZED_OID=အသိအမှတ်မပြုတဲ့ ၀တ္တု ဖေါ်ထုတ်သူ။ +SEC_ERROR_OCSP_INVALID_SIGNING_CERT=OCSP တုံ့ပြန်မှုထဲမှ မမှန်ကန်တဲ့ OCSP လက်မှတ် ရေးထိုးမှု လက်မှတ်။ +SEC_ERROR_REVOKED_CERTIFICATE_CRL=လက်မှတ်ဟာ ထုတ်ပြန်သူရဲ့ လက်မှတ် ပြန်လည်ရုတ်သိမ်းမှု စရင်းမှာ ရုတ်သိမ်းထားတယ်။ +SEC_ERROR_REVOKED_CERTIFICATE_OCSP=ထုတ်ပြန်သူရဲ့ OCSP တုံ့ပြန်သူက လက်မှတ်ကို ရုတ်သိမ်းမှုအဖြစ် အစီရင်ခံတယ်။ +SEC_ERROR_CRL_INVALID_VERSION=ထုတ်ပြန်သူရဲ့ လက်မှတ် ပြန်လည် ရုတ်သိမ်းမှု စာရင်းမှာ အမည်မသိတဲ့ မူအဆင့် ဂဏန်းတခု ပါရှိတယ်။ +SEC_ERROR_CRL_V1_CRITICAL_EXTENSION=ထုတ်ပြန်သူရဲ့ V1 လက်မှတ် ပြန်လည် ရုတ်သိမ်းမှု စာရင်းမှာ အရေးပါတဲ့ တိုးချဲ့ချက်တခု ပါရှိတယ်။ +SEC_ERROR_CRL_UNKNOWN_CRITICAL_EXTENSION=ထုတ်ပြန်သူရဲ့ V2 လက်မှတ် ပြန်လည် ရုတ်သိမ်းမှု စာရင်းမှာ အရေးပါတဲ့ တိုးချဲ့ချက်တခု ပါရှိတယ်။ +SEC_ERROR_UNKNOWN_OBJECT_TYPE=အမည်မသိတဲ့ ၀တ္တု အမျိုးအစား သတ်မှတ်ထားတယ်။ +SEC_ERROR_INCOMPATIBLE_PKCS11=PKCS #11 ဆော့ဗ်ဝဲက မလိုက်ဖက်တဲ့ နည်းနဲ့ လက်မှတ်ကို ထိပါး နှောင့်ယှက်တယ်။ +SEC_ERROR_NO_EVENT=ဒီချိန်မှာ သစ်လွင်တဲ့ အကွက် ဖြစ်ရပ် မရှိဘူး။ +SEC_ERROR_CRL_ALREADY_EXISTS=CRL ရှိပြီးပြီ။ +SEC_ERROR_NOT_INITIALIZED=NSS ကို မစတင်သေးဘူး။ +SEC_ERROR_TOKEN_NOT_LOGGED_IN=PKCS#11 အမှတ်အသားဟာ မ၀င်ရောက်တဲ့အတွက် လုပ်ငန်း မအောင်မြင်ဘူး။ +SEC_ERROR_OCSP_RESPONDER_CERT_INVALID=ပြုပြင်ထားတဲ့ OCSP တုံ့ပြန်သူရဲ့ လက်မှတ်ဟာ မမှန်ကန်ဘူး။ +SEC_ERROR_OCSP_BAD_SIGNATURE=OCSP တုံ့ပြန်ချက်မှာ မှန်ကန်တဲ့ လက်မှတ်တခု မရှိဘူး။ +SEC_ERROR_OUT_OF_SEARCH_LIMITS=အသိအမှတ်ပြုလက်မှတ် စစ်ဆေးခြင်း ရှာဖွေခြင်းသှ် သတ်မှတ်ချက်ထက်ကျော်လွန်နေပါသှ် +SEC_ERROR_INVALID_POLICY_MAPPING=ပေါ်လစီစုစည်းမှူတွင် အလုံးစုံသော ပေါ်လစီများအားထည့်သွင်းထားသှ် +SEC_ERROR_POLICY_VALIDATION_FAILED=အသိအမှတ်ပြုလက်မှတ် သည် ပေါ်လစီစစ်ဆေးခြင်း မအောင်မြင်ပါ +SEC_ERROR_UNKNOWN_AIA_LOCATION_TYPE=Unknown location type in cert AIA extension +SEC_ERROR_BAD_HTTP_RESPONSE=ဆာဗာမှ bad HTTP တုန့်ပြန်ပေးလိုက်သှ် +SEC_ERROR_BAD_LDAP_RESPONSE=ဆာဗာမှ bad LDAP တုန့်ပြန်ပေးလိုက်သှ် +SEC_ERROR_FAILED_TO_ENCODE_DATA=အချက်အလက်အား ASN1 Encoder ဖြင့် encode လုပ်ရန် မအောင်မြင် +SEC_ERROR_BAD_INFO_ACCESS_LOCATION=အသိအမှတ်ပြုလက်မှတ်တွင် မှားသော အချက်အလက် ရယူခြင်း တည်နေရာ\u0020 +SEC_ERROR_LIBPKIX_INTERNAL=Libpkix internal error occured during cert validation. +SEC_ERROR_PKCS11_GENERAL_ERROR=A PKCS #11 module returned CKR_GENERAL_ERROR, indicating that an unrecoverable error has occurred. +SEC_ERROR_PKCS11_FUNCTION_FAILED=A PKCS #11 module returned CKR_FUNCTION_FAILED, indicating that the requested function could not be performed. Trying the same operation again might succeed. +SEC_ERROR_PKCS11_DEVICE_ERROR=A PKCS #11 module returned CKR_DEVICE_ERROR, indicating that a problem has occurred with the token or slot. +SEC_ERROR_BAD_INFO_ACCESS_METHOD=Unknown information access method in certificate extension. +SEC_ERROR_CRL_IMPORT_FAILED=Error attempting to import a CRL. +SEC_ERROR_EXPIRED_PASSWORD=စကားဝှက် သက်တမ်းကုန်သွားပါပြီ။ +SEC_ERROR_LOCKED_PASSWORD=စကားဝှက်အားပိတ်ထားသှ် +SEC_ERROR_UNKNOWN_PKCS11_ERROR=အမျိုးအမည်မသိသော PKCS #11 အမှား +SEC_ERROR_BAD_CRL_DP_URL=Invalid or unsupported URL in CRL distribution point name. +SEC_ERROR_CERT_SIGNATURE_ALGORITHM_DISABLED=The certificate was signed using an signature algorithm that is disabled because it is not secure. +MOZILLA_PKIX_ERROR_KEY_PINNING_FAILURE=The server uses key pinning (HPKP) but no trusted certificate chain could be constructed that matches the pinset. Key pinning violations cannot be overridden. +MOZILLA_PKIX_ERROR_CA_CERT_USED_AS_END_ENTITY=The server uses a certificate with a basic constraints extension identifying it as a certificate authority. For a properly-issued certificate, this should not be the case. +MOZILLA_PKIX_ERROR_INADEQUATE_KEY_SIZE=The server presented a certificate with a key size that is too small to establish a secure connection. +MOZILLA_PKIX_ERROR_V1_CERT_USED_AS_CA=An X.509 version 1 certificate that is not a trust anchor was used to issue the server’s certificate. X.509 version 1 certificates are deprecated and should not be used to sign other certificates. +MOZILLA_PKIX_ERROR_NOT_YET_VALID_CERTIFICATE=The server presented a certificate that is not yet valid. +MOZILLA_PKIX_ERROR_NOT_YET_VALID_ISSUER_CERTIFICATE=A certificate that is not yet valid was used to issue the server’s certificate. +MOZILLA_PKIX_ERROR_SIGNATURE_ALGORITHM_MISMATCH=The signature algorithm in the signature field of the certificate does not match the algorithm in its signatureAlgorithm field. +MOZILLA_PKIX_ERROR_OCSP_RESPONSE_FOR_CERT_MISSING=The OCSP response does not include a status for the certificate being verified. +MOZILLA_PKIX_ERROR_VALIDITY_TOO_LONG=The server presented a certificate that is valid for too long. +MOZILLA_PKIX_ERROR_REQUIRED_TLS_FEATURE_MISSING=A required TLS feature is missing. +MOZILLA_PKIX_ERROR_INVALID_INTEGER_ENCODING=The server presented a certificate that contains an invalid encoding of an integer. Common causes include negative serial numbers, negative RSA moduli, and encodings that are longer than necessary. +MOZILLA_PKIX_ERROR_EMPTY_ISSUER_NAME=ထုတ်ပေးသူအမည်မပါသည့် အထောက်အထားတစ်စောင်ကို ဆာဗာက ဖော်ပြထားသည်။ diff -Nru firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pipnss/pipnss.properties firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pipnss/pipnss.properties --- firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pipnss/pipnss.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pipnss/pipnss.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,296 @@ +# +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +CertPassPrompt=%S အတွက် ပင်မ စကားဝှက်ကို ရေးထည့်ပါ။ +# the following strings have special requirements: +# they must fit in a 32 or 64 byte buffer after being translated +# to UTF8. Note to translator. It's not easy for you to figure +# whether the escaped unicode string you produce will fit in +# the space allocated. +# +# 64 bytes long after conversion to UTF8 +RootCertModuleName=ထည့်သွင်းထားတဲ့ ပင်မ အစိတ်အပိုင်း +# +# 32 bytes long after conversion to UTF8 +ManufacturerID=Mozilla.org +# +# 32 bytes long after conversion to UTF8 +LibraryDescription=PSM အတွင်းပိုင်း ဝှက်စာ ​ဖေါ်နည်း ၀န်ဆောင်မှုများ +# +# 32 bytes long after conversion to UTF8 +TokenDescription=ယေဘုယျ ဝှက်စာ ​ဖေါ်နည်း ​၀န်ဆောင်မှုများ +# +# 32 bytes long after conversion to UTF8 +PrivateTokenDescription=ဆော့ဗ်ဝဲ လုံခြုံရေး ကိရိယာ +# +# 64 bytes long after conversion to UTF8 +SlotDescription=PSM အတွင်းပိုင်း ဝှက်စာ ဖေါ်ခြင်းဆိုင်ရာ ၀န်ဆောင်မှုများ +# +# 64 bytes long after conversion to UTF8 +PrivateSlotDescription=PSM သီးသန့် သော့ချက်များ +# +# 32 +Fips140TokenDescription=ဆော့ဗ်ဝဲ လုံခြုံရေး ကိရိယာ (FIPS) +# 64 +Fips140SlotDescription=FIPS 140 Cryptographic, Key and Certificate Services +# 32 +InternalToken=ဆော့ဗ်ဝဲ လုံခြုံရေး ကိရိယာ +# End of size restriction. +VerifySSLClient=SSL သုံးစွဲသူ လက်မှတ် +VerifySSLServer=SSL ဆာဗာ လက်မှတ် +VerifySSLCA=SSL လက်မှတ် အခွင့်အာဏာ +VerifyEmailSigner=အီးမေးလ် ​စာရင်းသွင်းသူ လက်မှတ် +VerifyEmailRecip=အီးမေးလ် ​လက်ခံသူ လက်မှတ် +VerifyObjSign=Object Signer +HighGrade=အဆင့်မြင့် +MediumGrade=အလယ်လတ်အဆင့် +# LOCALIZATION NOTE (nick_template): $1s is the common name from a cert (e.g. "Mozilla"), $2s is the CA name (e.g. VeriSign) +nick_template=%1$s's %2$s ID +#These are the strings set for the ASN1 objects in a certificate. +CertDumpCertificate=လက်မှတ် +CertDumpVersion=မူအဆင့် +# LOCALIZATION NOTE (CertDumpVersionValue): %S is a version number (e.g. "3" in "Version 3") +CertDumpVersionValue=ထုတ်လုပ်မှု %S +CertDumpSerialNo=အစဉ်လိုက် အမှတ်စဉ် +CertDumpMD2WithRSA=RSA စာဝှက်စနစ်နဲ့ PKCS #1 MD2 +CertDumpMD5WithRSA=RSA စာဝှက်စနစ်နဲ့ PKCS #1 MD5 +CertDumpSHA1WithRSA=RSA စာဝှက်စနစ်နဲ့ PKCS #1 SHA-1 +CertDumpSHA256WithRSA=RSA စာဝှက်စနစ်နဲ့ PKCS #1 SHA-256 +CertDumpSHA384WithRSA=RSA စာဝှက်စနစ်နဲ့ PKCS #1 SHA-384 +CertDumpSHA512WithRSA=RSA စာဝှက်စနစ်နဲ့ PKCS #1 SHA-512 +CertDumpDefOID=၀တ္တု ဖေါ်ထုတ်သူ (%S) +CertDumpIssuer=ထုတ်ပြန်သူ +CertDumpSubject=အကြောင်းအရာ +CertDumpAVACountry=C +CertDumpAVAState=ST +CertDumpAVALocality=L +CertDumpAVAOrg=O +CertDumpAVAOU=OU +CertDumpAVACN=CN +CertDumpUserID=UID +CertDumpPK9Email=E +CertDumpAVADN=DN +CertDumpAVADC=DC +CertDumpSurname=ဆာနိမ်း +CertDumpGivenName=အမည် +CertDumpValidity=ခိုင်လုံမှု +CertDumpNotBefore=မတိုင်မီ မဟုတ်သော +CertDumpNotAfter=ပြီးနောက် မဟုတ်သော +CertDumpSPKI=အကြောင်းအရာ လူထု သော့ချက် အချက်အလက် +CertDumpSPKIAlg=အကြောင်းအရာ လူထု သော့ချက် လုပ်ငန်းစနစ် +CertDumpAlgID=လုပ်ငန်းစနစ် ဖေါ်ထုတ်သူ +CertDumpParams=လုပ်ငန်းစနစ် အကန့်အသတ်များ +CertDumpRSAEncr=PKCS #1 RSA စာဝှက်စနစ် +CertDumpRSAPSSSignature=PKCS #1 RSASSA-PSS Signature +CertDumpRSATemplate=မော်ဂျုး (%S bits) - \n%S\nထပ်ညွှန်း (%S bits) - \n%S +CertDumpECTemplate=သော့ချက် အရွယ်အတစား - %S bits\nအောက်ခြေအ​ဆင့် အစဉ်လိုက် အရှည် - %S bits\nလူထု တန်ဖိုး - \n%S +CertDumpIssuerUniqueID=ထုတ်ပြန်သူ ကိုယ်ပိုင် ID +CertDumpSubjPubKey=အကြောင်းအရာရဲ့ လူတု သော့ချက် +CertDumpSubjectUniqueID=အကြောင်းအရာ ကိုယ်ပိုင် ID +CertDumpExtensions=တိုးချဲ့ချက်များ +CertDumpSubjectDirectoryAttr=လက်မှတ် အကြောင်းအရာ ဖိုင်တွဲ အရည်အသွေးများ +CertDumpSubjectKeyID=လက်မှတ် အကြောင်းအရာ သော့ချက် ID +CertDumpKeyUsage=လက်မှတ် အဓိက သုံးစွဲမှု +CertDumpSubjectAltName=လက်မှတ် အကြောင်းအရာ တခြား အမည် +CertDumpIssuerAltName=လက်မှတ် ထုတ်ပြန်သူ တခြား အမည် +CertDumpBasicConstraints=လက်မှတ် အခြေခံ အကန့်အသတ်များ +CertDumpNameConstraints=လက်မှတ် အမည် အကန့်အသတ်များ +CertDumpCrlDistPoints=CRL ဖြန့်ဖြူးရေး အဆင့်များ +CertDumpCertPolicies=လက်မှတ် မူဝါဒများ +CertDumpPolicyMappings=လက်မှတ် မူဝါဒ စီစဉ်ချက်များ +CertDumpPolicyConstraints=လက်မှတ် မူဝါဒ အကန့်အသတ်များ +CertDumpAuthKeyID=လက်မှတ် အခွင့်အာဏာ ​သော့ချက် ထုတ်ဖေါ်သူ +CertDumpExtKeyUsage=တိုးချဲ့တဲ့ ​သော့ချက် သုံးစွဲမှု +CertDumpAuthInfoAccess=အခွင့်အာဏာ အချက်အလက် ၀င်ရောက်မှု +CertDumpAnsiX9DsaSignature=ANSI X9.57 DSA လက်မှတ် +CertDumpAnsiX9DsaSignatureWithSha1=SHA1 အကျဉ်းချုပ်နဲ့ ANSI X9.57 DSAလက်မှတ် +CertDumpAnsiX962ECDsaSignatureWithSha1=SHA1 နဲ့ ANSI X9.62 ECDSA လက်မှတ် +CertDumpAnsiX962ECDsaSignatureWithSha224=SHA224 ကို အသုံးပြုထားသော ANSI X9.62 ECDSA လက်မှတ် +CertDumpAnsiX962ECDsaSignatureWithSha256=SHA256 ကို အသုံးပြုထားသော ANSI X9.62 ECDSA လက်မှတ် +CertDumpAnsiX962ECDsaSignatureWithSha384=SHA384 ကို အသုံပြုထားသော ANSI X9.62 ECDSA လက်မှတ် +CertDumpAnsiX962ECDsaSignatureWithSha512=SHA512 ကို အသုံးပြုထားသော ANSI X9.62 ECDSA လက်မှတ် +CertDumpKUSign=၀င်ရောက်ခြင်း +CertDumpKUNonRep=ငြင်းပယ်ခြင်း မရှိ +CertDumpKUEnc=သော့ချက် စာဝှက် ဖေါ်နည်း +CertDumpKUDEnc=အချက်အလက်ကြမ်း စာဝှက် ဖေါ်နည်း +CertDumpKUKA=သော့ချက် သဘောတူညီမှု +CertDumpKUCertSign=လက်မှတ် စာရင်းသွင်းသူ +CertDumpKUCRLSigner=CRL စာရင်းသွင်းသူ +CertDumpCritical=အရေးပါသော +CertDumpNonCritical=အရေးမပါသော +CertDumpSigAlg=လက်မှတ် ရေးထိုးခြင်း လုပ်ငန်းစနစ် +CertDumpCertSig=လက်မှတ် ရေးထိုးခြင်း တန်ဖိုး +CertDumpExtensionFailure=အမှား - တိုးချဲ့ချက်များ မလုပ်ဆောင်နိုင်ဘူး။ +CertDumpIsCA=လက်မှတ် အခွင့်အာဏာတခု ဖြစ်တယ် +CertDumpIsNotCA=လက်မှတ် အခွင့်အာဏာတခု မဟုတ်ဘူး။ +CertDumpPathLen=CAs စပ်ကြားရဲ့ အများဆုံး ကြိမ်နှုန်း - %S +CertDumpPathLenUnlimited=အကန့်အသတ် မရှိ +CertDumpEKU_1_3_6_1_5_5_7_3_1=TLS ကွန်ရက် ဆာဗာ စစ်မှန်မှု +CertDumpEKU_1_3_6_1_5_5_7_3_2=TLS ကွန်ရက် သုံးစွဲသူ စစ်မှန်မှု +CertDumpEKU_1_3_6_1_5_5_7_3_3=ကုဒ် သတ်မှတ်ခြင်း +CertDumpEKU_1_3_6_1_5_5_7_3_4=အီးမေးလ် အကာအကွယ် +CertDumpEKU_1_3_6_1_5_5_7_3_8=အချိန် သတ်မှတ်ခြင်း +CertDumpEKU_1_3_6_1_5_5_7_3_9=OCSP သတ်မှတ်ခြင်း +CertDumpEKU_1_3_6_1_4_1_311_2_1_21=မိုက်ခရိုဆော့ဗ် တဦးချင်း ကုဒ် သတ်မှတ်ခြင်း +CertDumpEKU_1_3_6_1_4_1_311_2_1_22=မိုက်ခရိုဆော့ဗ် ကူးသန်းရောင်း၀ယ်မှု ကုဒ် သတ်မှတ်ခြင်း +CertDumpEKU_1_3_6_1_4_1_311_10_3_1=မိုက်ခရိုဆော့ဗ် စောင့်ရှောက်မှု စာရင်း သတ်မှတ်ခြင်း +CertDumpEKU_1_3_6_1_4_1_311_10_3_2=မိုက်ခရိုဆော့ဗ် အချိန် သတ်မှတ်ခြင်း +CertDumpEKU_1_3_6_1_4_1_311_10_3_3=မိုက်ခရိုဆော့ဗ် ဆာဗာ ဂိတ် စာဝှက်ဖေါ်စနစ် +CertDumpEKU_1_3_6_1_4_1_311_10_3_4=မိုက်ခရိုဆော့ဗ် စာဝှက်ခြင်း ဖိုင် နည်းစနစ် +CertDumpEKU_1_3_6_1_4_1_311_10_3_4_1=မိုက်ခရိုဆော့ဗ် ဖိုင် ပြန်ဖေါ်ခြင်း +CertDumpEKU_1_3_6_1_4_1_311_10_3_5=မိုက်ခရိုဆော့ဗ် ၀င်းဒိုး စက်ကိရိယာ ​ဆော့ဗ်ဝဲ အတည်ပြုခြင်း +CertDumpEKU_1_3_6_1_4_1_311_10_3_10=မိုက်ခရိုဆော့ဗ် အဆင့်မှီ​သော လိုက်နာမှု +CertDumpEKU_1_3_6_1_4_1_311_10_3_11=မိုက်ခရိုဆော့ဗ် သော့ချက် ပြန်ဖေါ်ခြင်း +CertDumpEKU_1_3_6_1_4_1_311_10_3_12=မိုက်ခရိုဆော့ဗ် စာတမ်း သတ်မှတ်မှု +CertDumpEKU_1_3_6_1_4_1_311_10_3_13=မိုက်ခရိုဆော့ဗ် ရာသက်ပန် သတ်မှတ်ခြင်း +CertDumpEKU_1_3_6_1_4_1_311_20_2_2=မိုက်ခရိုဆော့ဗ် စမတ်ကတ်ပြား ဝင်ရောက်ခြင်း +CertDumpEKU_1_3_6_1_4_1_311_21_6=မိုက်ခရိုဆော့ဗ် သော့ချက် ပြန်ဖေါ်မှု ဖန်တီးသူ +CertDumpMSCerttype=မိုက်ခရိုဆော့ဗ် လက်မှတ် ပုံစံခွက် အမည် +CertDumpMSNTPrincipal=မိုက်ခရိုဆော့ဗ် အဓိက အမည် +CertDumpMSCAVersion=မိုက်ခရိုဆော့ဗ် CA မူအဆင့် +CertDumpMSDomainGUID=မိုက်ခရိုဆော့ဗ် ဒိုမန်း GUID +CertDumpEKU_2_16_840_1_113730_4_1=နက်စကက် ဆာဗာ ဂိတ် စာဝှက်ဖေါ်စနစ် +CertDumpRFC822Name=အီးမေးလ် လိပ်စာ +CertDumpDNSName=DNS အမည် +CertDumpX400Address=X.400 လိပ်စာ +CertDumpDirectoryName=X.500 အမည် +CertDumpEDIPartyName=EDI ပါတီ အမည် +CertDumpURI=URI +CertDumpIPAddress=IP လိပ်စာ +CertDumpRegisterID=မှတ်ပုံတင်ထားတဲ့ OID +CertDumpKeyID=သော့ချက် ID +CertDumpVerisignNotices=အတည်ပြုလက်မှတ် သုံးစွဲသူ မှတ်ချက်များ +CertDumpUnused=မသုံးစွဲသော +CertDumpKeyCompromise=သော့ချက် အန္တရယ် +CertDumpCACompromise=CA အန္တရယ် +CertDumpAffiliationChanged=ပေါင်းစည်မှု အပြောင်းအလဲ +CertDumpSuperseded=အစားထိုးထားတယ် +CertDumpCessation=လည်ပတ်မှု ရပ်ဆိုင်းခြင်း +CertDumpHold=လက်မှတ် လက်ကိုင်ထားမှု +CertDumpOCSPResponder=OCSP +CertDumpCAIssuers=CA ​ထုတ်ပြန်သူများ +CertDumpCPSPointer=လက်မှတ် အစဉ်အလာ ထုတ်ပြန်ချက် ညွှန်ပြကိရိယာ +CertDumpUserNotice=သုံးစွဲသူ မှတ်ချက် +CertDumpLogotype=အမှတ်တဆိပ်အမျိုးအစား +CertDumpECPublicKey=အ​ချက်ပြ ပြင်ခုံး လူထု သော့ချက် +CertDumpECDSAWithSHA1=SHA1 ပါတဲ့ X9.62 ECDSA လက်မှတ် +CertDumpECprime192v1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး prime192v1 (ခေါ် secp192r1, NIST P-192) +CertDumpECprime192v2=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး prime192v2 +CertDumpECprime192v3=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး prime192v3 +CertDumpECprime239v1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး prime239v1 +CertDumpECprime239v2=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး prime239v2 +CertDumpECprime239v3=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး prime239v3 +CertDumpECprime256v1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး prime256v1 (ခေါ် secp256r1, NIST P-256) +CertDumpECsecp112r1=SECG အ​ချက်ပြ ပြင်ခုံး secp112r1 +CertDumpECsecp112r2=SECG အ​ချက်ပြ ပြင်ခုံး secp112r2 +CertDumpECsecp128r1=SECG အ​ချက်ပြ ပြင်ခုံး secp128r1 +CertDumpECsecp128r2=SECG အ​ချက်ပြ ပြင်ခုံး secp128r2 +CertDumpECsecp160k1=SECG အ​ချက်ပြ ပြင်ခုံး secp160k1 +CertDumpECsecp160r1=SECG အ​ချက်ပြ ပြင်ခုံး secp160r1 +CertDumpECsecp160r2=SECG အ​ချက်ပြ ပြင်ခုံး secp160r2 +CertDumpECsecp192k1=SECG အ​ချက်ပြ ပြင်ခုံး secp192k1 +CertDumpECsecp224k1=SECG အ​ချက်ပြ ပြင်ခုံး secp224k1 +CertDumpECsecp224r1=SECG elliptic curve secp224r1 (aka NIST P-224) +CertDumpECsecp256k1=SECG အ​ချက်ပြ ပြင်ခုံး secp256k1 +CertDumpECsecp384r1=SECG အ​ချက်ပြ ပြင်ခုံး secp384r1 (ခေါ် NIST P-384) +CertDumpECsecp521r1=SECG အ​ချက်ပြ ပြင်ခုံး secp521r1 (ခေါ် NIST P-521) +CertDumpECc2pnb163v1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2pnb163v1 +CertDumpECc2pnb163v2=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2pnb163v2 +CertDumpECc2pnb163v3=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2pnb163v3 +CertDumpECc2pnb176v1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2pnb176v1 +CertDumpECc2tnb191v1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2tnb191v1 +CertDumpECc2tnb191v2=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2tnb191v2 +CertDumpECc2tnb191v3=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2tnb191v3 +CertDumpECc2onb191v4=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2onb191v4 +CertDumpECc2onb191v5=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2onb191v5 +CertDumpECc2pnb208w1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2pnb208w1 +CertDumpECc2tnb239v1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2tnb239v1 +CertDumpECc2tnb239v2=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2tnb239v2 +CertDumpECc2tnb239v3=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2tnb239v3 +CertDumpECc2onb239v4=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2onb239v4 +CertDumpECc2onb239v5=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2onb239v5 +CertDumpECc2pnb272w1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2pnb272w1 +CertDumpECc2pnb304w1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2pnb304w1 +CertDumpECc2tnb359v1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2tnb359v1 +CertDumpECc2pnb368w1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2pnb368w1 +CertDumpECc2tnb431r1=ANSI X9.62 အ​ချက်ပြ ပြင်ခုံး c2tnb431r1 +CertDumpECsect113r1=SECG အ​ချက်ပြ ပြင်ခုံး sect113r1 +CertDumpECsect113r2=SECG အ​ချက်ပြ ပြင်ခုံး sect113r2 +CertDumpECsect131r1=SECG အ​ချက်ပြ ပြင်ခုံး sect131r1 +CertDumpECsect131r2=SECG အ​ချက်ပြ ပြင်ခုံး sect131r2 +CertDumpECsect163k1=SECG အ​ချက်ပြ ပြင်ခုံး sect163k1 (ခေါ် NIST K-163) +CertDumpECsect163r1=SECG အ​ချက်ပြ ပြင်ခုံး sect163r1 +CertDumpECsect163r2=SECG အ​ချက်ပြ ပြင်ခုံး sect163r2 (ခေါ် NIST B-163) +CertDumpECsect193r1=SECG အ​ချက်ပြ ပြင်ခုံး sect193r1 +CertDumpECsect193r2=SECG အ​ချက်ပြ ပြင်ခုံး sect193r2 +CertDumpECsect233k1=SECG အ​ချက်ပြ ပြင်ခုံး sect233k1 (ခေါ် NIST K-233) +CertDumpECsect233r1=SECG အ​ချက်ပြ ပြင်ခုံး sect233r1 (ခေါ် NIST B-233)​ေ +CertDumpECsect239k1=SECG အ​ချက်ပြ ပြင်ခုံး sect239k1 +CertDumpECsect283k1=SECG အ​ချက်ပြ ပြင်ခုံး sect283k1 (ခေါ် NIST K-283) +CertDumpECsect283r1=SECG အ​ချက်ပြ ပြင်ခုံး sect283r1 (ခေါ် NIST B-283) +CertDumpECsect409k1=SECG အ​ချက်ပြ ပြင်ခုံး sect409k1 (ခေါ် NIST K-409) +CertDumpECsect409r1=SECG အ​ချက်ပြ ပြင်ခုံး sect409r1 (ခေါ် NIST B-409) +CertDumpECsect571k1=SECG အ​ချက်ပြ ပြင်ခုံး sect571k1 (ခေါ် NIST K-571) +CertDumpECsect571r1=SECG အ​ချက်ပြ ပြင်ခုံး sect571r1 (ခေါ် NIST B-571) +CertDumpRawBytesHeader=အရွယ်အစား - %S Bytes / %S Bits +PK11BadPassword=ရေးထည့်လိုက်တဲ့ စကားဝှက် မမှန်ကန်ဘူး။ +SuccessfulP12Backup=သင့်ရဲ့ လုံခြုံရေး လက်မှတ်(များ) နဲ့ သီးသန့် သော့ချက်(များ) ကို အောင်မြင်စွာ သိမ်းဆည်းထားပြီ။ +SuccessfulP12Restore=သင့်ရဲ့ လုံခြုံရေး လက်မှတ်(များ) နဲ့ သီးသန့် သော့ချက်(များ) ကို အောင်မြင်စွာ ပြန်ထားလိုက်ပြီ။ +PKCS12DecodeErr=Failed to decode the file. Either it is not in PKCS #12 format, has been corrupted, or the password you entered was incorrect. +PKCS12UnknownErrRestore=အမည်မသိ အကြောင်း ကိစ္စများကြောင့် PKCS #12 ဖိုင် ပြန်ထားဖို့ မအောင်မြင်ဘူး။ +PKCS12UnknownErrBackup=အမည်မသိတဲ့ အကြောင်းကိစ္စကြောင့် PKCS #12 သိမ်းဆည်းဖိုင်ကို ဖန်တီးဖို့ မအောင်မြင်ဘူး။ +PKCS12UnknownErr=အမည်မသိ အကြောင်းကိစ္စကြောင့် PKCS #12 လည်ပတ်မှု မအောင်မြင်ဘူး။ +PKCS12InfoNoSmartcardBackup=စမတ် ကတ်ပြား တခုလို စက်ပစ္စည်း လုံခြုံရေး ကိရိယာ မှ လက်မှတ်များကို သိမ်းဆည်းဖို့ မဖြစ်နိုင်ဘူး။ +PKCS12DupData=လုံခြုံရေး ကိရိယာမှာ လက်မှတ်နဲ့ သီးသန့် သော့ချက် ရှိနေပြီ။ +AddModuleFailure=အစိတ်အပိုင်းကို မထည့်သွင်းနိုင်ဘူး +AddModuleDup=လုံခြုံရေး အစိတ်အပိုင်း ရှိနေပြီ +DelModuleWarning=ဒီလုံခြုံရေး အစိတ်အပိုင်းကို ပယ်ဖျက်ဖို့ သင် သေချာသလား။ +DelModuleError=အစိတ်အပိုင်းကို မပယ်ဖျက်နိုင်ဘူး +AVATemplate=%S = %S + +PSMERR_SSL_Disabled=SSL နည်းစဉ်ကို ပိတ်ထားတဲ့အတွက် လုံခြုံ​စွာ မချိတ်ဆက်နိုင်ဘူး။ +PSMERR_SSL2_Disabled=ကွန်ရက် အ​ဟောင်းတခု၊ မလုံခြုံတဲ့ SSL နည်းစဉ် မူအဆင့်ကို သုံးစွဲတဲ့အတွက် လုံခြုံ​စွာ မချိတ်ဆက်နိုင်ဘူး၊ +PSMERR_HostReusedIssuerSerial=You have received an invalid certificate. Please contact the server administrator or email correspondent and give them the following information:\n\nYour certificate contains the same serial number as another certificate issued by the certificate authority. Please get a new certificate containing a unique serial number. + +SSLConnectionErrorPrefix=%S ဆီ ချိတ်ဆက်မှု တခု လုပ်နေစဉ် အမှားတခု ဖြစ်ပွာ​နေတယ်။ + +certErrorIntro=%S က မမှန်ကန်တဲ့ လုံခြုံရေး လက်မှတ်တခုကို သုံးစွဲနေတယ်။ + +certErrorTrust_SelfSigned=လက်မှတ်ကို ကိုယ်တိုင် ရေးထိုးထားတဲ့ အတွက် စိတ်မချရဘူး။ +certErrorTrust_UnknownIssuer=လက်မှတ်ကို ထုတ်ပြန်သူ လက်မှတ်ကို မသိရတဲ့အတွက် စိတ်မချရဘူး။ +certErrorTrust_UnknownIssuer2=ဆာဗာမှ ရုတ်တရက် အသိအမှတ်ပြု လက်မှတ် များထုတ်မပေးခြင်း ဖြစ်နိုင်သှ် +certErrorTrust_UnknownIssuer3=ဖြည့်စွက်ရင်းမြစ်အထောက်အထားလက်မှတ်ကို တင်သွင်းရန် လိုအပ်နိုင်သည်။ +certErrorTrust_CaInvalid=လက်မှတ်ကို မမှန်ကန်တဲ့ CA လက်မှတ် တခုက ထုတ်ပြန်ထားတဲ့ အတွက် စိတ်မချရဘူး။ +certErrorTrust_Issuer=လက်မှတ်ကို လက်မှတ် ထုတ်ပြန်သူကို စိတ်မချတဲ့ အတွက် စိတ်မချရဘူး။ +certErrorTrust_SignatureAlgorithmDisabled=The certificate is not trusted because it was signed using a signature algorithm that was disabled because that algorithm is not secure. +certErrorTrust_ExpiredIssuer=လက်မှတ်ကို လက်မှတ် ထုတ်ပြန်သူကို စိတ်မချတဲ့ အတွက် စိတ်မချရဘူး။ +certErrorTrust_Untrusted=လက်မှတ်ဟာ စိတ်ချရတဲ့ အရင်းအမြစ်တခုမှ လာတာ မဟုတ်ဘူး။ + +certErrorMismatch=လက်မှတ်ဟာ %S အမည်အတွက် တရားမ၀င်ဘူး။ +# LOCALIZATION NOTE (certErrorMismatchSingle2): Do not translate %1$S +certErrorMismatchSingle2=လက်မှတ်ဟာ %1$S အတွက်သာ တရား၀င်တယ်။ +certErrorMismatchSinglePlain=ဤလက်မှတ်သည် %S အတွက်သာအကျုံးဝင်သည် +certErrorMismatchMultiple=အောက်ပါ အမည်များအတွက်သာ လက်မှတ်ဟာ တရားမ၀င်ဘူး - + +# LOCALIZATION NOTE (certErrorExpiredNow): Do not translate %1$S (date+time of expired certificate) or %2$S (current date+time) +certErrorExpiredNow=The certificate expired on %1$S. The current time is %2$S. +# LOCALIZATION NOTE (certErrorNotYetValidNow): Do not translate %1$S (date+time certificate will become valid) or %2$S (current date+time) +certErrorNotYetValidNow=ဤလက်မှတ်သည် %1$S မတိုင်ခင်အထိအကျုံးဝင်ပါသည်။ လက်ရှိအချိန်သည် %2$S ဖြစ်သည်။ + +# LOCALIZATION NOTE (certErrorCodePrefix2): Do not translate %1$S +certErrorCodePrefix2=အမှားကုဒ်။: %1$S + +P12DefaultNickname=တင်သွင်းထားတဲ့ လက်မှတ် +CertUnknown=မသိသော +CertNoEmailAddress=(အီးမေးလ် လိပ်စာ မပါဘူး) +CaCertExists=ဒီလက်မှတ်ဟာ လက်မှတ် အခွင့်အာဏာ တခု အနေနဲ့ တပ်ဆင်ထားပြီး။ +NotACACert=ဒီလက်မှတ်ဟာ လက်မှတ် အခွင့်အာဏာ လက်မှတ်တခု မဟုတ်ဘူး၊ ဒါကြောင့် ၄င်းကကို လက်မှတ် အခွင့်အာဏာ စာရင်းထဲမှာ တင်သွင်းလို့ မရနိုင်ဘူး။ +NotImportingUnverifiedCert=ဒီလက်မှတ်ကို အတည်မပြုနိုင်တဲ့အ​တွက် တင်သွင်းလို့ မရဘူး။ လက်မှတ် ထုတ်ပြန်သူကို အမည်မသိ (သို့) စိတ်မချရသူ ဖြစ်နိုင်ပြီး၊ လက်မှတ်ဟာ သက်တမ်းကုန် (သို့) ပြန်ရုပ်သိမ်းပြီး ဖြစ်နိုင်တယ်၊ (သို့) လက်မှတ်ကို အတည်မပြုထားလို့ ဖြစ်နိုင်တယ်။ +UserCertIgnoredNoPrivateKey=လက်မှတ်ကို တောင်းဆိုတဲ့အခါ ဖန်တီးထားတဲ့ သက်ဆိုင်ရာ သီးသန့် သော့ချက်ကို သင် ပိုင်ဆိုင် မထားတဲ့အတွက် တကိုယ်ရေး လက်မှတ်ကို တပ်ဆင်လို့ မရဘူး။ +UserCertImported=သင့်ရဲ့ တကိုယ်ရေ လက်မှတ်ကို တပ်ဆင်ထားပြီ။ ဒီလက်မှတ်အတွက် သိမ်းဆည်းထားတဲ့ မိတ္တူတခုကို သင် သိမ်းထားရမယ်။ +CertOrgUnknown=(အမည်မသိ) +CertNotStored=(သိုလှောင်မထားဘူး) +CertExceptionPermanent=အမြဲတမ်း +CertExceptionTemporary=ခေတ္တ ခဏ diff -Nru firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pippki/certManager.dtd firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pippki/certManager.dtd --- firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pippki/certManager.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pippki/certManager.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,93 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pippki/deviceManager.dtd firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pippki/deviceManager.dtd --- firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pippki/deviceManager.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pippki/deviceManager.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,36 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pippki/pippki.dtd firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pippki/pippki.dtd --- firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pippki/pippki.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pippki/pippki.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,51 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pippki/pippki.properties firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pippki/pippki.properties --- firefox-54.0~b1+build1/l10n/my/security/manager/chrome/pippki/pippki.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/security/manager/chrome/pippki/pippki.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,189 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +CertPassPrompt=PSM သီးသန့် သော့ချက်များ လုံခြုံရေး ကိရိယာအတွက် တကိုယ်ရေ လုံ​ခြုံရေး စကားဝှက်ကို ရေးထည့်ပါ။ + +# LOCALIZATION NOTE(certWithSerial): Used for semi-uniquely representing a cert. +# %1$S is the serial number of the cert in AA:BB:CC hex format. +certWithSerial=အမှတ်စဉ်ဖြင့် လက်မှတ် - %1$S + +# Download Cert dialog +# LOCALIZATION NOTE(newCAMessage1): +# %S is a string representative of the certificate being downloaded/imported. +newCAMessage1=အောက်ပါ ရည်ရွယ်ချက်အတွက် "%S" ကို သင် စိတ်ချလိုသလား။ +unnamedCA=လက်မှတ် အခွင့်အာဏာ (အမည်​မပေးထားသော) + +# For editing cert trust +editTrustCA=လက်မှတ် "%S" က လက်မှတ် အခွင့်အာဏာ တခုကို ကိုယ်စားပြုတယ်။ + +# For Deleting Certificates +deleteSslCertConfirm3=ဒီဆာဗာ ချွင်းချက်များကို သင်တကယ် ပယ်ဖျက်လိုသလား။ +deleteSslCertImpact3=ဆာဗာ ချွင်းချက်တခုကို သင်ပယ်ဖျက်လိုက်ရင်၊ အဲဒီ ​ဆာဗာအတွက် ပုံမှန် လုံခြုံရေး စစ်ဆေးမှုများကို ပြန်ထားပြီး ၄င်းက မှန်ကန်တဲ့ လက်မှတ်တခုကို သုံးစွဲဖို့ လိုအပ်တယ်။ +deleteSslCertTitle3=ဆာဗာ လက်မှတ် တိုးချဲ့ချက်များကို ပယ်ဖျက်ပါ + +deleteUserCertConfirm=ဒီလက်မှတ်များကို သင်တကယ် ပယ်ဖျက်လို သလား။ +deleteUserCertImpact=သင့်ကိုယ်တိုင် လက်မှတ်များထဲက တခုကို သင်ပယ်ဖျက်တာနဲ့၊ သင့်ကိုသင် ​ဖေါ်ထုတ်ဖို့ ၄င်းကို သင်သုံးစွဲတော့မှာ မဟုတ်ဘူး။ +deleteUserCertTitle=သင့်လက်မှတ်များကို ပယ်ဖျက်ပါ + +deleteCaCertConfirm2=CAအသိအမှတ်ပြုလက်မှတ်အားဖျက်ပစ်ရန်သင်တောင်းဆိုခဲ့ပါသည်။မူရင်းအသိအမှတ်ပြုလက်မှတ်များထဲမှ သက်ရောက်မှူ တူညီသောယုံကြည်မှူအားလုံးကိုဖျက်ပစ်မည်ဖြစ်သည်။သင်ဖျက်မည်မှာသေချာပြီလား? +deleteCaCertImpactX2=(CA) အသိအမှတ်ပြုလက်မှတ်တစ်ခုအားဖျက်ပစ်လိုက်ပါက ယခု အက်ပလီကေးရှင်းသည်မည်သည် (CA) မှထုတ်လုပ်သည်အသိအမှတ်ပြုလက်မှတ်ကိုမှယုံကြည်တော့မည်မဟုတ်ပါ။ +deleteCaCertTitle2=CA အသိအမှတ်ပြုလက်မှတ်အား ဖျက်ပါ(သို့)ပုံဖျက်ပါ + +deleteEmailCertConfirm=ဒီလူများရဲ့ အီးမေးလ် လက်မှတ်များကို သင်တယ် ပယ်ဖျက်လိုသလား။ +deleteEmailCertImpactDesc=လူတဦးရဲ့ အီးမေးလ် လက်မှတ် တခုကို သင် ပယ်ဖျက်လိုက်ရင်၊ အဲဒီ ပုဂ္ဂိုလ်ထံ စာဝှက်ထားတဲ့ အီးမေးလ်ကို သင်ပို့နိုင်တော့မှာ မဟုတ်ဘူး။ +deleteEmailCertTitle=အီးမေးလ် လက်မှတ်များကို ပယ်ဖျက်ပါ + +deleteOrphanCertConfirm=ဒီလက်မှတ်များကို သင်တကယ် ပယ်ဖျက်လို သလား။ +deleteOrphanCertTitle=လက်မှတ်များကို ပယ်ဖျက်ပါ + +# PKCS#12 file dialogs +chooseP12RestoreFileDialog2=ထည့်သွင်းရန် လက်မှတ်ဖိုင် +chooseP12BackupFileDialog=သိမ်းဆည်းမဲ့ ဖိုင်အမည် +file_browse_PKCS12_spec=PKCS12 ဖိုင်များ +getPKCS12FilePasswordMessage=စာဝှက်စဉ် အသုံးပြုခဲ့သော ဒီအရန်အထောက်အထားလက်မှတ်၏ စကားဝှက်ကို ရိုက်ပါ။: + +# Cert verification +certVerified=​အောက်ပါ သုံးစွဲမှုများအတွက် ဒီလက်မှတ်ကို အတည်ပြုထားတယ်: +certNotVerified_CertRevoked=ဒီလက်မှတ်ကို ပြန်ရုပ်သိမ်းထားတဲ့ အတွက် အတည်မပြုနိုင်ဘူး။ +certNotVerified_CertExpired=ဒီလက်မှတ်ကို သက်တမ်း ကုန်သွားတဲ့အတွက် အတည်မပြုနိုင်ဘူး။ +certNotVerified_CertNotTrusted=ဒီလက်မှတ်ကို စိတ်မချတဲ့အတွက် အတည်မပြုနိုင်ဘူး။ +certNotVerified_IssuerNotTrusted=ဒီလက်မှတ်ဟာ ထုတ်ပြန်သူကို စိတ်မချတဲ့အတွက် အတည်မပြုနိုင်ဘူး။ +certNotVerified_IssuerUnknown=ဒီလက်မှတ်ဟာ သက်တမ်း ကုန်သွားတဲ့အတွက် အတည်မပြုနိုင်ဘူး။ +certNotVerified_CAInvalid=ဒီလက်မှတ်ကို CA လက်မှတ် မမှန်ကန်တဲ့အတွက် အတည်မပြုနိုင်ဘူး။ +certNotVerified_AlgorithmDisabled=Could not verify this certificate because it was signed using a signature algorithm that was disabled because that algorithm is not secure. +certNotVerified_Unknown=ဒီလက်မှတ်ကို မသိရတဲ့ အကြောင်းများကြောင့် အတည်မပြုနိုင်ဘူး။ + +# Client auth +clientAuthRemember=ယခု ဆုံးဖြတ်ချက်အား မှတ်ထားပါ +# LOCALIZATION NOTE(clientAuthNickAndSerial): Represents a single cert when the +# user is choosing from a list of certificates. +# %1$S is the nickname of the cert. +# %2$S is the serial number of the cert in AA:BB:CC hex format. +clientAuthNickAndSerial=%1$S [%2$S] +# LOCALIZATION NOTE(clientAuthHostnameAndPort): +# %1$S is the hostname of the server. +# %2$S is the port of the server. +clientAuthHostnameAndPort=%1$S:%2$S +# LOCALIZATION NOTE(clientAuthMessage1): %S is the Organization of the server +# cert. +clientAuthMessage1=အဖွဲ့အစည်း - "%S" +# LOCALIZATION NOTE(clientAuthMessage2): %S is the Organization of the issuer +# cert of the server cert. +clientAuthMessage2=ထုတ်ပြန်ရမယ့် နေရာ - "%S" +# LOCALIZATION NOTE(clientAuthIssuedTo): %1$S is the Distinguished Name of the +# currently selected client cert, such as "CN=John Doe,OU=Example" (without +# quotes). +clientAuthIssuedTo=ထုတ်ပေးခံထားရသူ- %1$S +# LOCALIZATION NOTE(clientAuthSerial): %1$S is the serial number of the selected +# cert in AA:BB:CC hex format. +clientAuthSerial=စီရီရယ်အမှတ်- %1$S +# LOCALIZATION NOTE(clientAuthValidityPeriod): +# %1$S is the already localized notBefore date of the selected cert. +# %2$S is the already localized notAfter date of the selected cert. +clientAuthValidityPeriod=%1$S မှ %2$S ထိ အကျုံးဝင်သှ် +# LOCALIZATION NOTE(clientAuthKeyUsages): %1$S is a comma separated list of +# already localized key usages the selected cert is valid for. +clientAuthKeyUsages=အဓိကသုံးဆွဲမှုများ- %1$S +# LOCALIZATION NOTE(clientAuthEmailAddresses): %1$S is a comma separated list of +# e-mail addresses the selected cert is valid for. +clientAuthEmailAddresses=အီးမေလ်းလိပ်စာများ- %1$S +# LOCALIZATION NOTE(clientAuthIssuedBy): %1$S is the Distinguished Name of the +# cert which issued the selected cert. +clientAuthIssuedBy=ထုတ်ပေးထားသူ- %1$S +# LOCALIZATION NOTE(clientAuthStoredOn): %1$S is the name of the PKCS #11 token +# the selected cert is stored on. +clientAuthStoredOn=သိမ်းထားသောနေရာ- %1$S + +# Page Info +pageInfo_NoEncryption=စာဝှက်မထားတဲ့ ချိတ်ဆက်မှု +pageInfo_Privacy_None1=The website %S does not support encryption for the page you are viewing. +pageInfo_Privacy_None2=စာဝှက်စနစ် မပါပဲ ပို့လိုက်တဲ့ အချက်အလက်ကို ၄င်းကူးပြောင်းနေချိန်မှာ အခြား လူများက မြင်တွေ့နိုင်တယ်။ +pageInfo_Privacy_None4=သင်ကြည့်နေသော စာမျက်နှာသည် အင်တာနက်ပေါ်သို့ တက်မလာခင် encrypt မပြုလုပ်လာခဲ့ပါ +# LOCALIZATION NOTE (pageInfo_EncryptionWithBitsAndProtocol and pageInfo_BrokenEncryption): +# %1$S is the name of the encryption standard, +# %2$S is the key size of the cipher. +# %3$S is protocol version like "SSL 3" or "TLS 1.2" +pageInfo_EncryptionWithBitsAndProtocol=ချိတ်ဆက်မှုကို စာဝှက်စနစ် အသုံးပြုထားသည် (%1$S, %2$S bit keys, %3$S) +pageInfo_BrokenEncryption=ကျိုးပေါက်နေသည့် စာဝှက်စနစ် (%1$S, %2$S bit keys, %3$S) +pageInfo_Privacy_Encrypted1=သင်ရှုမြင်နေတဲ့ စာမျက်နှာဟာ အင်တာနက်ပေါ် မကူးပြောင်းခင် စာဝှက်ထားတယ်။ +pageInfo_Privacy_Encrypted2=Encryption ကွန်ပျူတာများကြားတွင် သတင်းအချက်အလက်ကူး ယူနေသည်ကို ကြားဖြတ်ရယူခြင်းအား ခက်ခဲစေပါသည်။ထို့ကြောင့် ယခု စာမျက်နှာအား တစ်ခြားတစ်စုံတရာမှ ကြည့်ရှုခြင်း မရှိစေ ရန်သုံးခြင်းဖြစ်ပါသှ်။ +pageInfo_MixedContent=ချိတ်ဆက်မှု တပိုင်းတစ စာဝှက်ထားတယ် +pageInfo_MixedContent2=သင်ရှုမြင်နေတဲ့ စာမျက်နှာ အပိုင်းများဟာ အင်တာနက်ပေါ် မထုတ်လွှင့်ခင် စာဝှက် မထားဘူး။ +pageInfo_WeakCipher=ယခုဝက်ဆိုဒ်သို့ သင့်ဝက်ဆိုဒ်ချိတ်ဆက်မှု သည် encrypt မလုပ်ထားသဖြင့် သီးသန့်မဟုတ်ပါ။ အခြားလူများ သင့် အချက်အလက်များကို ရယူကြည့်နေနိုင်သေးသှ်။ +pageInfo_CertificateTransparency_Compliant=ယခုဝဘ်ဆိုက်ကို အထောက်အထားပွင့်လင်းမြင်သာမှုမူဝါဒဖြင့် စီစဉ်တည်ဆောက်ထားသည်။ + +# Cert Viewer +# LOCALIZATION NOTE(certViewerTitle): Title used for the Certificate Viewer. +# %1$S is a string representative of the certificate being viewed. +certViewerTitle=လက်မှတ်ကြည့်သူ - “%1$S” +notPresent=<လက်မှတ်ရဲ့ အစိတ်အပိုင်း မဟုတ်ဘူး> + +# Token Manager +password_not_set=(ချမှတ်မထားဘူး) +failed_pw_change=ပင်မ စကားဝှက်ကို ​မပြောင်းလဲနိုင်ဘူး။ +incorrect_pw=မှန်ကန်တဲ့ လက်ရှိ ပင်မ စာဝှက်စနစ်ကို သင် ရေးထည့်မထားဘူး။ ထပ်ကြိုးစားပါ။ +pw_change_ok=ပင်မ စကားဝှက်ကို အောင်မြင်စွာ ပြောင်းလဲထားပြီ။ +pw_erased_ok=သတိပေးချက်။ သင့်ရဲ့ ပင်မ စကားဝှက်ကို သင် ပယ်ဖျက်လိုက်ပြီ။ +pw_not_wanted=သတိပေးချက်။ ပင်မ စကားဝှက်ကို မသုံးစွဲဖို့ သင် ဆုံးဖြတ်လိုက်ပြီ။ +pw_empty_warning=သင်သိုထားတဲ့ ကွန်ရက်နဲ့ အီးမေးလ် စကားဝှက်များ၊ ဖြည့်စွက်ပုံစံ အချက်အလက်ကြမ်းနဲ့၊ သီးသန့် သော့ချက်များကို ကာကွယ်မှာ မဟုတ်ဘူး။ +pw_change2empty_in_fips_mode=လတ်တလော FIPS အသွင်အတွင်း ရှိသည်။ FIPSသည် ‌ဗလာမဖြစ်သော ပင်မစကားဝှက်တစ်ခု လိုအပ်နေသည်။ +login_failed=၀င်ရောက်ဖို့ မအောင်မြင်ဘူး +loadPK11TokenDialog=ဖွင့်ဖို့ PKCS#11 ကိရိယာတခုကို ရွေးချယ်ပါ +devinfo_modname=အစိတ်အပိုင်း +devinfo_modpath=လမ်းကြောင်း +devinfo_label=အမှတ်တဆိပ် +devinfo_manID=ထုတ်လုပ်သူ +devinfo_serialnum=အစဉ်လိုက် အမှတ်စဉ် +devinfo_hwversion=HW မူအဆင့် +devinfo_fwversion=FW မူအဆင့် +devinfo_status=လက်ရှိအခြေအနေ +devinfo_desc=ဖေါ်ပြချက် +devinfo_stat_disabled=ပိတ်ထားတယ် +devinfo_stat_notpresent=မရှိဘူး +devinfo_stat_uninitialized=မစတင်ထားဘူး +devinfo_stat_notloggedin=မ၀င်ရောက်သေးဘူး +devinfo_stat_loggedin=၀င်ရောက်ပြီ +devinfo_stat_ready=အသင့်ရှိပြီ +enable_fips=FIPS ကို ဖွင့်ထားပါ +disable_fips=FIPS ကို ပိတ်ထားပါ +fips_nonempty_password_required=FIPS စနစ်က လုံခြုံရေး ကိရိယာတိုင်းအတွက် ပင်မ စကားဝှက် အစုတခု သင်ထားရှိဖို့ တောင်းဆိုတယ်။ FIPS စနစ်ကို ဖွင့်ဖို့ မကြိုးစားခင် စကားဝှက်ကို ထားရှိပါ။ +unable_to_toggle_fips=လုံခြုံရေးပစ္စည်းအတွက် FIPS အပြင်အဆင်သို့မပြောင်းလဲနိုင်ပါ။အက်ပလီကေးရှင်းအား ထွက်(သို့)ပြန်စလိုက်တာအကောင်းဆုံးဖြစ်သည်။ + +resetPasswordConfirmationTitle=ပင်မ စကားဝှက်ကို ပြန်ချိန်ပါ +resetPasswordConfirmationMessage=သင့်ရဲ့ စကားဝှက်ကို ပြန်ချိန်ထားပြီ။ + +# Import certificate(s) file dialog +importEmailCertPrompt=တင်သွင်းဖို့ တစုံတယောက်ရဲ့ အီးမေးလ် လက်မှတ် ပါတဲ့ ဖိုင်ကို ရွေးချယ်ပါ +importCACertsPrompt=တင်သွင်းဖို့ CA လက်မှတ် ပါတဲ့ ဖိုင်ကို ရွေးချယ်ပါ +file_browse_Certificate_spec=လက်မှတ် ဖိုင်များ + +# Cert export +SaveCertAs=လက်မှတ်ကို ဖိုင်ထဲမှာ သိမ်းဆည်းပါ +CertFormatBase64=X.509 လက်မှတ် (PEM) +CertFormatBase64Chain=X.509 အချိတ်အဆက်ပါတဲ့ လက်မှတ် (PEM) +CertFormatDER=X.509 လက်မှတ် (DER) +CertFormatPKCS7=X.509 လက်မှတ် (PKCS#7) +CertFormatPKCS7Chain=X.509 အချိတ်အဆက်ပါတဲ့ လက်မှတ် (PKCS#7) +writeFileFailure=ဖိုင် အမှား +writeFileFailed=%S ဖိုင်ကို မရေးနိုင်ဘူး -\n%S။ +writeFileAccessDenied=၀င်ရောက်မှု ငြင်းပယ်ခံရတယ် +writeFileIsLocked=ဖိုင်ကို သော့ပိတ်ထားတယ် +writeFileNoDeviceSpace=ကိရိယာထဲမှာ နေရာ မကျန်တော့ဘူး +writeFileUnknownError=အမည်မသိတဲ့ အမှား + +# Add Security Exception dialog +addExceptionBrandedWarning2=%S က ဒီကွန်ရက်ကို ဖေါ်ထုတ်တဲ့နည်းကို သင် ထပ်ဖြည့်တော့မယ်။ +addExceptionInvalidHeader=ဒီကွန်ရက်က မမှန်ကန်တဲ့ အချက်အလက်နဲ့ ၄င်းကိုယ်တိုင် ထုတ်ဖေါ်ဖို့ ကြိုးစားနေတယ်။ +addExceptionDomainMismatchShort=မှားတဲ့ ကွန်ရက် +addExceptionDomainMismatchLong2=ယခု လက်မှတ်သှ် အခြား ဆိုက်ဒ်တစ်ခုမှ ပိုင်ဆိုင်နေပြီး ၎င်းအား အယောင်ဆောင်ထားခြင်းလည်း ဖြစ်နိုင်သှ်။ +addExceptionExpiredShort=ရက်လွန်တဲ့ အချက်အလက် +addExceptionExpiredLong2=ယခု လက်မှတ်သည် အလုပ်မလုပ်ပါ။ ပျောက်ဆုံးသို့ အခိုးခံထားရခြင်းလည်း ဖြစ်နိုင်သည်။ +addExceptionUnverifiedOrBadSignatureShort=အမည်မသိ အထောက်အထား +addExceptionUnverifiedOrBadSignatureLong2=Certificate is not trusted, because it hasn't been verified by a recognized authority using a secure signature. +addExceptionValidShort=မှန်ကန်တဲ့ လက်မှတ် +addExceptionValidLong=This site provides valid, verified identification. There is no need to add an exception. +addExceptionCheckingShort=အချက်အလက်ကို စစ်ဆေးနေတယ် +addExceptionCheckingLong2=ယခုဆိုဒ်အား အတည်ပြုရန်ကြိုးစားနေသှ်… +addExceptionNoCertShort=အချက်အလက် မရနိုင်ဘူး +addExceptionNoCertLong2=ယခု ဆိုက်ဒ်အတွက် အတည်ပြုပုံစံ မရယူနိုင်ပါ diff -Nru firefox-54.0~b1+build1/l10n/my/services/sync/errors.properties firefox-54.0~b2+build1/l10n/my/services/sync/errors.properties --- firefox-54.0~b1+build1/l10n/my/services/sync/errors.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/services/sync/errors.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,27 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +error.login.reason.network = ဆာဗာသို့ချိတ်ဆက်ခြင်းမအောင်မြင်ပါ။ +error.login.reason.recoverykey = မှားသော ကယ်ဆယ်ရေးခလုတ် +error.login.reason.account = အမည် (သို့) လျှို့ဝှက်စကားလုံး မှားနေသည် +error.login.reason.no_username = အကောင့်အမည်ပျောက်ဆုံးနေသည် +error.login.reason.no_password2 = လျှို့ဝှက်စကားလုံး ပျောက်ဆုံးနေသည် +error.login.reason.no_recoverykey= ကယ်ဆယ်ရေးခလုတ်ကို မသိမ်းခဲ့ပါ။ +error.login.reason.server = ဆာဗာအားမှားယွင်းစွာ သိရှိထားသည်။ + +error.sync.failed_partial = တစ်ခုသို့တစ်ခုထက်ပိုသော ဒေတာအမျိုးအစားများအားမှတ်သားအသုံးမပြုနိုင်။ +# LOCALIZATION NOTE (error.sync.reason.serverMaintenance): We removed the extraneous period from this string +error.sync.reason.serverMaintenance = မီးမြေခွေး Sync ဆာဗာ ပြုပြင်ခြင်း လုပ်ဆောင်နေပါသည်။ syncing ဟာ မကြာမီ အလိုအလျောက်စတင်ပါတော့မည် + +invalid-captcha = စာလုံးများမှားယွင်းနေပါသည်၊ပြန်လည်ကြိုးစားကြည့်ပါ။ +weak-password = ဒီထက်ပိုလုံခြုံသောလျှို့ဝှက်စကားလုံးအားသုံးပါ။ + +# this is the fallback, if we hit an error we didn't bother to localize +error.reason.unknown = အမည်မသိတဲ့ အမှား + +change.password.pwSameAsPassword = လျှို့ဝှက်စကားဝှက်သည်လက်ရှိသုံးနေသောစကားဝှက်ဖြင့်မကိုက်ညီဖြစ်နေသည်။ +change.password.pwSameAsUsername = အသုံးပြုသည်အမည်ဖြင့် လျှို့ဝှက်စကားဝှက်မကိုက်ညီပါ။ +change.password.pwSameAsEmail = လျှို့ဝှက်စကားလုံးနှင့်အီးမေလ်းလိပ်စာမကိုက်ညီပါ +change.password.mismatch = ထည့်သွင်းသောလျှို့ဝှက်စကားလုံးမကိုက်ညီပါ +change.password.tooShort = ထည့်သွင်းသောလျှိုဝှက်စကားလုံးအလွန်တိုလွန်းသည် diff -Nru firefox-54.0~b1+build1/l10n/my/services/sync/sync.properties firefox-54.0~b2+build1/l10n/my/services/sync/sync.properties --- firefox-54.0~b1+build1/l10n/my/services/sync/sync.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/services/sync/sync.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,16 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# %1: the user name (Ed), %2: the app name (Firefox), %3: the operating system (Android) +client.name2 = %3$S ရှိ %1$S ၏ %2$S + +# %S is the date and time at which the last sync successfully completed +lastSync2.label = နောက်ဆုံး ချိတ်ဆက်ခြင်း %S + +# signInToSync.description is the tooltip for the Sync buttons when Sync is +# not configured. +signInToSync.description = တပြေးညီဖြစ်စေရန် ဝင်ရောက်ပါ + +syncnow.label = ယခုပင်တစ်ပြေးညီပြုလုပ်မည် +syncing2.label = တစ်ပြေးညီပြုလုပ်နေသည်… diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/alerts/alert.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/alerts/alert.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/alerts/alert.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/alerts/alert.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,6 @@ + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/alerts/alert.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/alerts/alert.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/alerts/alert.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/alerts/alert.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,23 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE(closeButton.title): Used as the close button text for web notifications on OS X. +# This should ideally match the string that OS X uses for the close button on alert-type +# notifications. OS X will truncate the value if it's too long. +closeButton.title = ပိတ် +# LOCALIZATION NOTE(actionButton.label): Used as the button label to provide more actions on OS X notifications. OS X will truncate this if it's too long. +actionButton.label = … +# LOCALIZATION NOTE(webActions.disableForOrigin.label): %S is replaced +# with the hostname origin of the notification. +webActions.disableForOrigin.label = %S ထံမှ အသိပေးချက်များကို ပိတ်ပါ + +# LOCALIZATION NOTE(source.label): Used to show the URL of the site that +# sent the notification (e.g., "via mozilla.org"). "%1$S" is the source host +# and port. +source.label=%1$S မှတဆင့် +webActions.settings.label = အသိပေးချက် အပြင်အဆင်များ + +# LOCALIZATION NOTE(doNotDisturb.label): %S is replaced with the +# brandShortName of the application. +doNotDisturb.label = %S ကို ပြန်လည်မစတင်မီအချိန်ထိ မနှောက်ယှက်ပါနှင့် diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/autoconfig/autoconfig.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/autoconfig/autoconfig.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/autoconfig/autoconfig.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/autoconfig/autoconfig.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,12 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +readConfigTitle = ပြုပြင်ဖန်တီးမှု အမှား +readConfigMsg = ပြုပြင်ဖန်တီးမှု ဖိုင်ကို ဖတ်ရှုဖို့ မအောင်မြင်ဘူး။ + +autoConfigTitle = အလိုအလျှောက်ပြုပြင်မှု အချက်ပေး +autoConfigMsg = Netscape.cfg/အလိုအလျှောက်ပြုပြင်မှု မအောင်မြင်ဘူး။ သင်နည်းစနစ် စီမံ ခန့်ခွဲသူကို ဆက်သွယ်ပါ။ \n အမှား၊ %S မအောင်မြင်မှု။ + +emailPromptTitle = အီးမေးလ် လိပ်စာ +emailPromptMsg = သင့်ရဲ့ အီးမေးလ် လိပ်စာကို ရေးထည့်ပါ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutAbout.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutAbout.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutAbout.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutAbout.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,6 @@ + + + + Some of them might be confusing. Some are for diagnostic purposes only.
    And some are omitted because they require query strings."> diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/about.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/about.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/about.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/about.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,30 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutNetworking.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutNetworking.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutNetworking.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutNetworking.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,43 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +HTTP ခြေရာမှတ်တမ်း အား ယခု တူးလ်ကို သုံးရန်လေ့လာပါ"> + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutProfiles.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutProfiles.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutProfiles.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutProfiles.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,10 @@ + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutProfiles.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutProfiles.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutProfiles.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutProfiles.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,42 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +name = ပရိုဖိုင်လ်: %S +isDefault = မူလပရိုဖိုင်လ် +rootDir = ရင်းမြစ်ဖိုင်လမ်းကြောင်း +# LOCALIZATION NOTE: localDir is used to show the directory corresponding to +# the main profile directory that exists for the purpose of storing data on the +# local filesystem, including cache files or other data files that may not +# represent critical user data. (e.g., this directory may not be included as +# part of a backup scheme.) +# In case localDIr and rootDir are equal, localDir is not shown. +localDir = မူလသတ်မှတ်ထားသည့် ဖိုင်လမ်းကြောင်း +currentProfile = ဒီပရိုဖိုင်လ်ကို အသုံးပြုနေဆဲ ဖြစ်သည့်အတွက် ၎င်းကို မဖျက်နိုင်ပါ။ + +rename = အမည်ပြောင်းပါ +remove = ဖယ်ရှားပါ +setAsDefault = မူလပရိုဖိုင်လ်အနေနှင့် သတ်မှတ်ရန် +launchProfile = ဘရောင်ဇာအသစ်တွင် ပရိုဖိုင်လ်ကို ဖွင့်ပါ + +yes = ဟုတ်ကဲ့ +no = မဟုတ်ပါ + +renameProfileTitle = ပရိုဖိုင်လ်ကို အမည်ပြောင်းရန် +renameProfile = ပရိုဖိုင်လ် %S ကို အမည်ပြောင်းရန် + +invalidProfileNameTitle = မှားယွင်းနေသည့် ပရိုဖိုင်လ်အမည် +invalidProfileName = ပရိုဖိုင်လ်အမည် “%S” ကို အသုံးပြုခွင့်မရှိပါ။ + +deleteProfileTitle = ပရိုဖိုင်လ်ကို ဖျက်ရန် +deleteProfileConfirm = ပရိုဖိုင်လ်ကို ဖျက်ပါက ဘရောင်ဇာတွင် ရှိနေသော ပရိုဖိုင်လ်စာရင်းထဲမှပါ ဖယ်ရှားခံရပါလိမ့်မည်။ ထို့ပြင် ၎င်းပရိုဖိုင်လ်ကို ပြန်ယူ၍ မရနိုင်ပါ။\nအပြင်အဆင်များ၊ အထောက်အထားများနှင့် အခြားဆက်စပ်အချက်အလက်များအပါအဝင် ပရိုဖိုင်လ်အချက်အလက်ဖိုင်များကို ဖျက်ရန် ရွေးချယ်နိုင်ပါသည်။ ဒီရွေးချယ်မှုသည် ဖိုင်တွဲ “%S” ကို ဖျက်မည်ဖြစ်ပြီး ၎င်းကို ပြန်ယူ၍ မရနိုင်ပါ။\nသင်သည် ပရိုဖိုင်လ်အချက်အလက်ဖိုင်များကို ဖျက်ချင်ပါသလား။ +deleteFiles = ဖိုင်များကို ဖျက်ရန် +dontDeleteFiles = ဖိုင်များကို မဖျက်ပါနှင့် + +openDir = ဖွင့်ထားသော ဖိုင်လမ်းကြောင်း +# LOCALIZATION NOTE (macOpenDir): This is the Mac-specific variant of openDir. +# This allows us to use the preferred"Finder" terminology on Mac. +macOpenDir = ရှာဖွေကိရိယာမှာ ပြပါ +# LOCALIZATION NOTE (winOpenDir2): This is the Windows-specific variant of +# openDir. +winOpenDir2 = ဖိုဒါအား ဖွင့်ပါ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutReader.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutReader.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutReader.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutReader.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,48 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#LOCALIZATION NOTE (aboutReader.loading2): +# Use the unicode ellipsis char, \u2026, +# or use "..." if \u2026 doesn't suit traditions in your locale. +aboutReader.loading2=ဆောင်ရွက်နေသည်… +aboutReader.loadError=ဆောင်းပါးကို စာမျက်နှာမှ ခေါ်တင်ရာတွင် မအောင်မြင်ပါ + +aboutReader.colorScheme.light=လင်းသော +aboutReader.colorScheme.dark=မှောင်သော +aboutReader.colorScheme.sepia=နီညိုရောင် +aboutReader.colorScheme.auto=အလိုအလျောက် + +# LOCALIZATION NOTE (aboutReader.estimatedReadTimeValue1): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the number of minutes it is estimated to take to read the article +# example: `3 minutes` +aboutReader.estimatedReadTimeValue1=#1 မိနစ်;#1 မိနစ်များ + +#LOCALIZATION NOTE (aboutReader.estimatedReadingTimeRange1): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# When there is some uncertainty in how long the article will take to read show a range of +# minutes it is expected to take. +# #1 is the number of minutes it is estimated to take to read the article for a fast reader +# #2 is the number of minutes it is estimated to take to read the article for a slow reader +# #2 is the variable used to determine the plural form to use. +# example: `5-8 minutes` +aboutReader.estimatedReadTimeRange1=#1-#2 မိနစ်;#1-#2 မိနစ်များ + +# LOCALIZATION NOTE (aboutReader.fontType.serif, aboutReader.fontType.sans-serif): +# These are the styles of typeface that are options in the reader view controls. +aboutReader.fontType.serif=အစွန်းပါ စာလုံး +aboutReader.fontType.sans-serif=Sans-serif + +# LOCALIZATION NOTE (aboutReader.fontTypeSample): String used to sample font types. +aboutReader.fontTypeSample=Aa + +aboutReader.toolbar.close=စာဖတ်ပုံစံကို ပိတ်ရန် +aboutReader.toolbar.typeControls=စာရိုက်ခြင်း ထိန်းချုပ်ရန်များ + +# These are used for the Reader View toolbar button and the menuitem within the +# View menu. +readerView.enter=စာဖတ်ပုံစံသို့ပြောင်းပါ +readerView.enter.accesskey=R +readerView.close=စာဖတ်ပုံစံကို ပိတ်ရန် +readerView.close.accesskey=R diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutRights.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutRights.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutRights.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutRights.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,91 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutServiceWorkers.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutServiceWorkers.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutServiceWorkers.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutServiceWorkers.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,12 @@ + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutServiceWorkers.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutServiceWorkers.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutServiceWorkers.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutServiceWorkers.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,36 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +title = မူလ။ %S + +# LOCALIZATION NOTE: %1$S is brandShortName, %2$2 is the application ID, and $%$3 is true/false value. +# LOCALIZATION NOTE: the term "InBrowserElement" should not be translated +b2gtitle = %1$S Application ID %2$S - InBrowserElement %3$S + +scope = အပိုင်းအခြား။ + +scriptSpec = Script Spec: + +# LOCALIZATION NOTE: the term "Worker" should not be translated. +currentWorkerURL = လက်ရှိ Worker URL။ + +activeCacheName = အသုံးပြုဆဲ Cache အမည်။ + +waitingCacheName = Cache အမည်ကို စောင့်ဆိုင်းနေသည်။ + +true = မှန် + +false = မှားတယ် + +# LOCALIZATION NOTE this term is used as a button label (verb, not noun). +update = မွမ်းမံချက် + +unregister = စာရင်းမပေးသွင်းတော့ပါ + +waiting = စောင့်နေသည်... + +# LOCALIZATION NOTE: the term "Service Worker" should not translated. +unregisterError = ဒီ Service Worker ကို စာရင်းပေးထားခြင်းမှ ပယ်ဖျက်ရာတွင် အမှားဖြစ်ခဲ့သည်။ + +pushEndpoint = Push Endpoint: diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutSupport.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutSupport.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutSupport.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutSupport.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,131 @@ + + + + + +support website."> + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +user.js file, which includes preferences that were not created by &brandShortName;."> + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutSupport.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutSupport.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutSupport.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutSupport.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,142 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (crashesTitle): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 number of relevant days with crash reports +crashesTitle=လွန်ခဲ့သော #1 ရက်အတွက် ပျက်စီးမှု အစီရင်ခံစာများ;လွန်ခဲ့သော #1 ရက်အတွက် ပျက်စီးမှု အစီရင်ခံစာများ + +# LOCALIZATION NOTE (crashesTimeMinutes): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 number of minutes (between 1 and 59) which have passed since the crash +crashesTimeMinutes=လွန်ခဲ့သော #1 မိနစ်က;လွန်ခဲ့သော #1 မိနစ်က + +# LOCALIZATION NOTE (crashesTimeHours): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 number of hours (between 1 and 23) which have passed since the crash +crashesTimeHours=လွန်ခဲ့သော #1 နာရီခန့်က;လွန်ခဲ့သော #1 နာရီခန့်က + +# LOCALIZATION NOTE (crashesTimeDays): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 number of days (1 or more) which have passed since the crash +crashesTimeDays=လွန်ခဲ့သော #1 ရက်က;လွန်ခဲ့သော #1 ရက်က + +# LOCALIZATION NOTE (pendingReports): Semi-colon list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 number of pending crash reports +pendingReports=ပျက်စီးမှု အစီရင်ခံစာ အားလုံး (သတ်မှတ်ထားသော ကာလအတွင်းရှိ ဆိုင်းငံ့ ပျက်စီးမှု အစီရင်ခံစာ #1 ခု အပါအဝင်);ပျက်စီးမှု အစီရင်ခံစာ အားလုံး (သတ်မှတ်ထားသော ကာလအတွင်းရှိ ဆိုင်းငံ့ ပျက်စီးမှု အစီရင်ခံစာ #1 ခု အပါအဝင်) + +# LOCALIZATION NOTE (rawDataCopied) Text displayed in a mobile "Toast" to user when the +# raw data is successfully copied to the clipboard via button press. +rawDataCopied=ကလစ်ဘုတ်သို့ ကူးပြီးသောဒေတာအကြမ်း + +# LOCALIZATION NOTE (textCopied) Text displayed in a mobile "Toast" to user when the +# text is successfully copied to the clipboard via button press. +textCopied=ကလစ်ဘုတ်သို့ ကူးပြီးသောစာ + +# LOCALIZATION NOTE The verb "blocked" here refers to a graphics feature such as "Direct2D" or "OpenGL layers". +blockedDriver = သင်၏ရုပ်ထွက်ပြဆော့ဝဲဗားရှင်းကြောင့်ပိတ်ထားသည်။ + +# LOCALIZATION NOTE The %S here is a placeholder, leave unchanged, it will get replaced by the driver version string. +tryNewerDriver = သင်၏ရုပ်ထွက်ပြဆော့ဝဲဗားရှင်းအရပိတ်ထားသည်။ကျေးဇူးပြုသင့်ဆော့ဝဲကို %S အဆင့်သို့မဟုတ်ထိုထက်အသစ်သို့မြှင့်တင်ပေးပါ။ + +# LOCALIZATION NOTE The verb "blocked" here refers to a graphics feature such as "Direct2D" or "OpenGL layers". +blockedGfxCard = သင်၏ရုပ်ထွက်ပြဟတ်ဒ်ဝဲကဒ်ကြောင့်ပိတ်ထားပါသည်။ + +# LOCALIZATION NOTE The verb "blocked" here refers to a graphics feature such as "Direct2D" or "OpenGL layers". +blockedOSVersion = သင်၏အော်ပရေးတင်း စနစ်ဗားရှင်းကြောင့်ပိတ်ထားသည်။ + +# LOCALIZATION NOTE The verb "blocked" here refers to a graphics feature such as "Direct2D" or "OpenGL layers". +blockedMismatchedVersion = သင့် ရုပ်ထွက်ပြကြားခံဆော့ဖ်ဝဲသည် စာရင်းပြနှင့် DLLဖိုင် မတူညီသောကြောင့် ပိတ်ထားသည်။ + +# LOCALIZATION NOTE In the following strings, "Direct2D", "DirectWrite" and "ClearType" +# are proper nouns and should not be translated. Feel free to leave english strings if +# there are no good translations, these are only used in about:support +clearTypeParameters = ClearType Parameters + +compositing = ပေါင်းစပ်ဖွဲ့စည်းခြင်း +hardwareH264 = Hardware H264 Decoding +audioBackend = အသံနောက်ကွယ် +mainThreadNoOMTC = အဓိက thread, OMTC မပါဝင် +yes = ဟုတ်ပါသည် +no = မဟုတ်ပါ +# LOCALIZATION NOTE The following strings indicate if an API key has been found. +# In some development versions, it's expected for some API keys that they are +# not found. +found = တွေ့ပြီ +missing = ပျောက်နေသော + +gpuDescription = ဖေါ်ပြချက် +gpuVendorID = ထုတ်လုပ်ရောင်းချသူ အမှတ်အသား +gpuDeviceID = ပစ္စည်း အမှတ်အသား +gpuSubsysID = စနစ်ခွဲ အိုင်ဒီ +gpuDrivers = Drivers +gpuRAM = RAM +gpuDriverVersion = Driver ဗားရှင်း +gpuDriverDate = Driver နေ့စွဲ +gpuActive = လုပ်ဆောင်နေသည် +webgl1WSIInfo = WebGL 1 စက်သုံးဆော့ဝဲ WSI အချက်အလက် +webgl1Renderer = WebGL 1 စက်သုံးဆော့ဝဲ စက်သုံး +webgl1Version = WebGL 1 စက်သုံး ဗားရှင်း +webgl1DriverExtensions = WebGL 1 စက်သုံးချဲ့သုံးဆော့ဝဲများ +webgl1Extensions = WebGL 1 ချဲ့သုံးဆော့ဝဲများ +webgl2WSIInfo = WebGL 2 စက်သုံး WSI အချက်အလက် +webgl2Renderer = WebGL2 ပံ့ပိုးသူ +webgl2Version = WebGL 2 စက်သုံးဗားရှင်း +webgl2DriverExtensions = WebGL 2 စက်သုံးချဲ့ သုံးဆော့ဝဲများ +webgl2Extensions = WebGL 2 ချဲ့သုံးဆော့ဝဲများ +GPU1 = GPU #1 +GPU2 = GPU #2 +blocklistedBug = ဖြစ်တတ်သည့်ပြဿနာများရှိသောကြောင့် ပိတ်ပင်စာရင်းထဲ ထည့်ထားသည် +# LOCALIZATION NOTE %1$S will be replaced with a bug number string. +bugLink = အမှား %1$S +# LOCALIZATION NOTE %1$S will be replaced with an arbitrary identifier +# string that can be searched on DXR/MXR or grepped in the source tree. +unknownFailure = ပိတ်ပင်စာရင်းထဲ ထည့်ထားသည်။; အမှားကုဒ် %1$S +d3d11layersCrashGuard = D3D11 Compositor +d3d11videoCrashGuard = D3D11 Video Decoder +d3d9videoCrashGuard = D3D9 Video Decoder +glcontextCrashGuard = OpenGL +resetOnNextRestart = နောက်တစ်ကြိမ်ဖွင့်သည့်အချိန်တွင် တန်ဖိုးများကို မူလအတိုင်း ပြန်သတ်မှတ်ပါ +gpuProcessKillButton = GPU လုပ်ဆောင်မှုကို ရပ်ဆိုင်းရန် + +minLibVersions = ရှိသင့်တဲ့ အနိမ့်ဆုံး ဗားရှင်း +loadedLibVersions = အသုံးပြုသည့် ဗားရှင်း + +hasSeccompBPF = Seccomp-BPF (System Call Filtering) +hasSeccompTSync = Seccomp Thread Synchronization +hasUserNamespaces = User Namespaces +hasPrivilegedUserNamespaces = အခွင့်ရလုပ်ငန်းစဉ်များအတွက် User Namespaces +canSandboxContent = Content Process စမ်းသပ်ခြင်း +canSandboxMedia = မီဒီယာ ပလပ်အင် စမ်းသပ်ခြင်း +contentSandboxLevel = Content Process Sandbox Level +sandboxProcType.content = အကြောင်းအရာ +sandboxProcType.mediaPlugin = မီဒီယာ ပလက်ဂ်အင် + +# LOCALIZATION NOTE %1$S and %2$S will be replaced with the number of remote and the total number +# of windows, respectively, while %3$S will be replaced with one of the status strings below, +# which contains a description of the multi-process preference and status. +# Note: multiProcessStatus.3 doesn't exist because status=3 was deprecated. +multiProcessWindows = %1$S/%2$S (%3$S) +multiProcessStatus.0 = အသုံးပြုသူက ဖွင့်ထားသည် +multiProcessStatus.1 = မူလကတည်းက ဖွင့်ထားသည် +multiProcessStatus.2 = ပိတ်ထားသည် +multiProcessStatus.4 = သုံးစွဲနိုင်စွမ်းတန်ဆာပလာများက ပိတ်ထားသည် +multiProcessStatus.5 = Mac OS X ပေါ်တွင် ရုပ်ပုံများဆိုင်ရာပုံရိပ်မြှင့်စနစ် မပါဝင်သောကြောင့် ပိတ်ထားသည် +multiProcessStatus.6 = ပေးမရိုက်သည့်စာများပါဝင်နေသောကြောင့် ပိတ်ထားသည် +multiProcessStatus.7 = အတ်အွန်များက ပိတ်ထားသည် +multiProcessStatus.8 = အတင်းအကျပ် ပိတ်ထားသည် +# No longer in use (bug 1296353) but we might bring this back. +multiProcessStatus.9 = Windows XP ရှိ ရုပ်ပုံများဆိုင်ရာပုံရိပ်မြှင့်စနစ်က ပိတ်ထားသည် +multiProcessStatus.unknown = မသိနိုင်သော အခြေအနေ + +asyncPanZoom = Asynchronous Pan/Zoom +apzNone = မရွေးပါ +wheelEnabled = မောက်စ်အလယ်ဘီးမှ ဒေတာလက်ခံမှုကို ဖွင့်ထားသည် +touchEnabled = တို့ထိပြားမှ ဒေတာလက်ခံမှုကို ဖွင့်ထားသည် +dragEnabled = စခရိုးလ်ဘားတန်းဆွဲရွှေ့ခြင်း ဖွင့်ထားသည် + +# LOCALIZATION NOTE %1 will be replaced with the key of a preference. +wheelWarning = မထောက်ပံ့ထားသော အပြင်အဆင် %S ကြောင့် async wheel input ကို ပိတ်ထားသည် +touchWarning = မထောက်ပံ့ထားသော အပြင်အဆင် %S ကြောင့် async touch input ကို ပိတ်ထားသည် diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutTelemetry.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutTelemetry.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutTelemetry.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutTelemetry.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,102 @@ + + + + + + +ဖွင့်ထားသည်။"> + +ပိတ်ထားသည်။"> + +ဖွင့်ထားသည်။"> + +ပိတ်ထားသည်။"> + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutTelemetry.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutTelemetry.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutTelemetry.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutTelemetry.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,98 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# Note to translators: +# - %1$S will be replaced by brandFullName +# - %2$S will be replaced with the value of the toolkit.telemetry.server_owner preference +pageSubtitle = This page shows the information about performance, hardware, usage and customizations collected by Telemetry. This information is submitted to %1$S to help improve %2$S. + +generalDataTitle = အထွေထွေ အချက်အလက် + +generalDataHeadingName = အမည် + +generalDataHeadingValue = တန်ဖိုး + +environmentDataHeadingName = အမည် + +environmentDataHeadingValue = တန်ဖိုး + +environmentDataSubsectionToggle = ကဏ္ဍကို အပိတ်အဖွင့်လုပ်ရန် နှိပ်ပါ + +environmentDataSubsectionEmpty = (မည်သည့်အချက်အလက်မျှ မရရှိပါ) + +telemetryLogTitle = Telemetry မှတ်တမ်း + +telemetryLogHeadingId = အိုင်ဒီ + +telemetryLogHeadingTimestamp = အချိန် + +telemetryLogHeadingData = အချက်အလက်ကြမ်း + +slowSqlMain = Slow SQL Statements on Main Thread + +slowSqlOther = Slow SQL Statements on Helper Threads + +slowSqlHits = Hits + +slowSqlAverage = ပျှမ်းမျှအချိန် (ms) + +slowSqlStatement = ထုတ်ပြန်ချက် + +# Note to translators: +# - The %1$S will be replaced with the number of the hang +# - The %2$S will be replaced with the duration of the hang +chrome-hangs-title = Hang Report #%1$S (%2$S seconds) + +# Note to translators: +# - The %1$S will be replaced with the string key for this stack. +# - The %2$S will be replaced with the number of times this stack was captured. +captured-stacks-title = %1$S (မှတ်သားချက်များ- %2$S) + +# Note to translators: +# - The %1$S will be replaced with the number of the late write +late-writes-title = Late Write #%1$S + +stackTitle = Stack: + +memoryMapTitle = Memory map: + +errorFetchingSymbols = သင်္ကေတများအားရယူနေစဉ် ပြတ်တောက်သွားသှ်။ အင်တာနက်သို့ချိတ်ဆက်မှူအား စစ်ဆေးကြည့်ပါရန်။ + +histogramSamples = နမူနာများ + +histogramAverage = ပျမ်းမျှ + +histogramSum = sum + +histogramCopy = ကူးယူပါ + +keysHeader = ဂုဏ်သတ္တိများ + +namesHeader = အမည် + +valuesHeader = တန်ဖိုး + +addonTableID = အတ်အွန် အိုင်ဒီ + +addonTableDetails = အသေးစိတ်များ + +# Note to translators: +# - The %1$S will be replaced with the name of an Add-on Provider (e.g. "XPI", "Plugin") +addonProvider = %1$S Provider + +parentPayload = ရှေ့ရှိကုန်ပစ္စည်း + +# Note to translators: +# - The %1$S will be replaced with the number of the child payload (e.g. "1", "2") +childPayloadN = နောက်ရှိကုန်ပစ္စည်း %1$S + +timestampHeader = timestamp + +categoryHeader = ကဏ္ဍ + +methodHeader = နည်းလမ်း + +objectHeader = အရာ + +extraHeader = အပို diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutWebrtc.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutWebrtc.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/aboutWebrtc.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/aboutWebrtc.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,124 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (document_title, cannot_retrieve_log): +# The text "WebRTC" is a proper noun and should not be translated. +# It is the general label for the standards based technology. see http://www.webrtc.org +document_title = WebRTC အတွင်းပိုင်းများ +cannot_retrieve_log = WebRTC မှတ်တမ်းကို မဆွဲယူနိုင်ပါ + +# LOCALIZATION NOTE (save_page_msg): +# %1$S will be replaced by a full path file name: the target of the SavePage operation. +save_page_msg = စာမျက်နှာအားသိမ်း - %1$S + +# LOCALIZATION NOTE (save_page_dialog_title): "about:webrtc" is a internal browser URL and should not be +# translated. This string is used as a title for a file save dialog box. +save_page_dialog_title = about:webrtc အားသိမ်း + +# LOCALIZATION NOTE (debug_mode_off_state_msg): +# %1$S will be replaced by the full path file name of the debug log. +debug_mode_off_state_msg = နောက်ယောင်ခံလိုက် မှတ်တမ်း - %1$S + +# LOCALIZATION NOTE (debug_mode_on_state_msg): +# %1$S will be replaced by the full path file name of the debug log. +debug_mode_on_state_msg = အမှားရှာ စနစ်ကို ဖွင့်ထားသည်၊ %1$S တွင် မှတ်တမ်းများကို ကြည့်ပါ + +# LOCALIZATION NOTE (aec_logging_msg_label, aec_logging_off_state_label, +# aec_logging_on_state_label, aec_logging_on_state_msg): +# AEC is an abbreviation for Acoustic Echo Cancellation. +aec_logging_msg_label = AEC မှတ်တမ်းမှတ်ခြင်း +aec_logging_off_state_label = AEC မှတ်တမ်းကို စမှတ်ပါ +aec_logging_on_state_label = AEC မှတ်တမ်းမှတ်ခြင်းကို ရပ်ဆိုင်းပါ +aec_logging_on_state_msg = AEC မှတ်တမ်းမှတ်ခြင်းကို ဖွင့်ထားသည် (ဆောင်ရွက်သူကို မိနစ်အနည်းငယ် ဖွင့်ထားပါ၊ ပြီးလျှင် မှတ်တမ်းမှတ်သူကို ပိတ်ပါ) + +# LOCALIZATION NOTE (aec_logging_off_state_msg): +# %1$S will be replaced by the full path to the directory containing the captured log files. +# AEC is an abbreviation for Acoustic Echo Cancellation. +aec_logging_off_state_msg = မှတ်သားထားသည့် မှတ်တမ်းဖိုင်များကို %1$S ထဲတွင် တွေ့နိုင်သည် + +# LOCALIZATION NOTE (peer_connection_id_label): "PeerConnection" is a proper noun +# associated with the WebRTC module. "ID" is an abbreviation for Identifier. This string +# should not normally be translated and is used as a data label. +peer_connection_id_label = PeerConnection ID + +# LOCALIZATION NOTE (sdp_heading, local_sdp_heading, remote_sdp_heading): +# "SDP" is an abbreviation for Session Description Protocol, an IETF standard. +# See http://wikipedia.org/wiki/Session_Description_Protocol +sdp_heading = SDP +local_sdp_heading = Local SDP +remote_sdp_heading = အဝေးရောက် SDP + +# LOCALIZATION NOTE (rtp_stats_heading): "RTP" is an abbreviation for the +# Real-time Transport Protocol, an IETF specification, and should not +# normally be translated. "Stats" is an abbreviation for Statistics. +rtp_stats_heading = RTP အချက်အလက်များ + +# LOCALIZATION NOTE (ice_state, ice_stats_heading): "ICE" is an abbreviation +# for Interactive Connectivity Establishment, which is an IETF protocol, +# and should not normally be translated. "Stats" is an abbreviation for +# Statistics. +ice_state = ICE အခြေအနေ +ice_stats_heading = ICE အချက်အလက်များ +ice_restart_count_label = ICE ပြန်စတင်မှုများ +ice_rollback_count_label = ICE မူလသို့ပြန်သွားမှုများ + +# LOCALIZATION NOTE (av_sync_label): "A/V" stands for Audio/Video. +# "sync" is an abbreviation for sychronization. This is used as +# a data label. +av_sync_label = A/V တပြေးညီ ဖြစ်မှု + +# LOCALIZATION NOTE (jitter_buffer_delay_label): A jitter buffer is an +# element in the processing chain, see http://wikipedia.org/wiki/Jitter +# This is used as a data label. +jitter_buffer_delay_label = Jitter-buffer နှောင့်နှေးချိန် + +# LOCALIZATION NOTE (avg_bitrate_label, avg_framerate_label): "Avg." is an abbreviation +# for Average. These are used as data labels. +avg_bitrate_label = ပျမ်းမျှ bitrate +avg_framerate_label = ပျမ်းမျှ framerate + +# LOCALIZATION NOTE (typeLocal, typeRemote): These adjectives are used to label a +# line of statistics collected for a peer connection. The data represents +# either the local or remote end of the connection. +typeLocal = Local +typeRemote = Remote + +# LOCALIZATION NOTE (nominated): This adjective is used to label a table column. +# Cells in this column contain the localized javascript string representation of "true" +# or are left blank. +nominated = အဆိုပြုခံထားရသော + +# LOCALIZATION NOTE (selected): This adjective is used to label a table column. +# Cells in this column contain the localized javascript string representation of "true" +# or are left blank. This represents an attribute of an ICE candidate. +selected = ရွေးထားသော + +save_page_label = စာမျက်နှာ အားသိမ်း +debug_mode_msg_label = အမှားရှာ စနစ် +debug_mode_off_state_label = အမှားရှာ စနစ်ကို စတင်ပါ +debug_mode_on_state_label = အမှားရှာ စနစ်ကို ရပ်ဆိုင်းပါ +stats_heading = အသုံးပြုမှုဆိုင်ရာ ကိန်းဂဏန်းအချက်အလက်များ +stats_clear = မှတ်တမ်းရှင်းပါ +log_heading = ချိတ်ဆက်မှု မှတ်တမ်း +log_clear = မှတ်တမ်းရှင်းပါ +log_show_msg = မှတ်တမ်းကို ပြပါ +log_hide_msg = မှတ်တမ်းကို ဖျောက်ပါ +connection_closed = ပိတ် +local_candidate = Local Candidate +remote_candidate = Remote Candidate +priority = ဦးစာပေး +fold_show_msg = အသေးစိတ် ပြပါ +fold_show_hint = ဒီအပိုင်းကို အကျယ်ချဲ့ရန် ကလစ်နှိပ်ပါ +fold_hide_msg = အသေးစိတ်များကို ဖျောက်ပါ +fold_hide_hint = ဒီအပိုင်းကို ခေါက်သိမ်းရန် ကလစ်နှိပ်ပါ +dropped_frames_label = Dropped frames +discarded_packets_label = Discarded packets +decoder_label = Decoder +encoder_label = Encoder +received_label = လက်ခံရရှိသည် +packets = packet များ +lost_label = Lost +jitter_label = Jitter +sent_label = ပို့ပြီး + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/appPicker.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/appPicker.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/appPicker.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/appPicker.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/autocomplete.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/autocomplete.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/autocomplete.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/autocomplete.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,23 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (searchWithEngine): %S will be replaced with +# the search engine provider's name. This format was chosen because +# the provider can also end with "Search" (e.g.: MSN Search). +searchWithEngine = %S နှင့် ရှာဖွေရန် + +# LOCALIZATION NOTE (switchToTab2): This is the same as the older switchToTab +# string that it's replacing, except it uses title case, so "Switch" and "Tab" +# are capitalized. +switchToTab2 = တပ်ဗ်အဖြစ်သို့ ပြောင်းပါ + +# LOCALIZATION NOTE (visit): This is shown next to autocomplete entries that are +# simple URLs or sites, which will be visited when the user selects them. +visit = လည်ပတ်ရန် + +# LOCALIZATION NOTE (bookmarkKeywordSearch): This is the title of autocomplete +# entries that are bookmark keyword searches. %1$S will be replaced with the +# domain name of the bookmark, and %2$S will be replaced with the keyword +# search text that the user is typing. %2$S will not be empty. +bookmarkKeywordSearch = %1$S: %2$S diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/browser.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/browser.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/browser.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/browser.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,14 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +browsewithcaret.checkMsg=ဒီအညွှန်း သေတ္တာကို ထပ်မပြပါနဲ့။ +browsewithcaret.checkWindowTitle=Caret လှော်လှန်ခြင်း +browsewithcaret.checkLabel=F7 ကို နှိုပ်ခြင်းဖြင့် Caret လှော်လှန်ခြင်းကို အဖွင့် (သို့) အပိတ် လုပ်ပေးတယ်။ ဒီအင်္ဂါရပ်က ကွန်ရက် စာမျက်နှာများမှာ ရွေ့လျားနိင်တဲ့ cursor တခုကို ထားရှိပေးပြီး၊ ကီးဘုတ်နဲ့တကွ စာသားကို ရွေးချယ်​ဖို့ သင့်ကို ခွင့်ပြုတယ်။ ကာရက် လှော်လှန်ခြင်းကို ဖွင့်ထားမလား။ +browsewithcaret.checkButtonLabel=ကောင်းပြီ + +plainText.wordWrap=စာကြောင်းများကိုထုပ်ပေးပါ + +formPostSecureToInsecureWarning.title = လုံခြုံရေး သတိပေးချက် +formPostSecureToInsecureWarning.message = ဒီစာမျက်နှာရှိ သင်ရေးထားသည့် အချက်အလက်များကို မလုံခြုံသော ချိတ်ဆက်မှုပေါ်မှ ပေးပို့ပါမည်။ ထို့ပြင် ထိုအကြောင်းအရာများကို တတိယအဖွဲ့မှ ကြည့်ရှုနိုင်လိမ့်မည်။\n\nဒီအချက်အလက်များကို ပေးပို့ချင်သည်မှာ သေချာပါသလား။ +formPostSecureToInsecureWarning.continue = ဆက်လုပ်ပါ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/charsetMenu.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/charsetMenu.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/charsetMenu.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/charsetMenu.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,6 @@ + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/charsetMenu.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/charsetMenu.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/charsetMenu.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/charsetMenu.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,116 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE: The property keys ending with ".key" are for access keys. +# Localizations may add or delete properties where the property key ends with +# ".key" as appropriate for the localization. The code that uses this data can +# deal with the absence of an access key for an item. +# +# For gbk, gbk.bis and gbk.bis.key are used to trigger string changes in +# localizations. +# +# In the en-US version of this file, access keys are given to the following: +# * UTF-8 +# * All encodings that are the fallback encoding for some locale in Firefox +# * All encodings that are the fallback encoding for some locale in IE +# * All Japanese encodings +# +# For the items whose property key does not end in ".key" and whose value +# includes "(" U+0028 LEFT PARENTHESIS, the "(" character is significant for +# processing by CharsetMenu.jsm. If your localization does not use ASCII +# parentheses where en-US does in this file, please file a bug to make +# CharsetMenu.jsm also recognize the delimiter your localization uses. +# (When this code was developed, all localizations appeared to use +# U+0028 LEFT PARENTHESIS for this purpose.) + +# Auto-Detect (sub)menu +charsetMenuCharsets = အက္ခရာ စာဝှက်ရေးသားခြင်း +charsetMenuAutodet = အလိုအလျှောက်သိ +# 'A' is reserved for Arabic: +charsetMenuAutodet.key = D +charsetMenuAutodet.off = (ပိတ်) +charsetMenuAutodet.off.key = o +charsetMenuAutodet.ja = ဂျပန် +charsetMenuAutodet.ja.key = J +charsetMenuAutodet.ru = ရုရှန်း +charsetMenuAutodet.ru.key = R +charsetMenuAutodet.uk = ယူဂရိန်းနီးယန်း +charsetMenuAutodet.uk.key = U + +# Globally-relevant +UTF-8.key = U +UTF-8 = ယူနီကုဒ် +windows-1252.key = W +windows-1252 = အနောက်တိုင်း စာလုံး + +# Arabic +windows-1256.key = A +windows-1256 = အာရ​ဗစ် (Windows) +ISO-8859-6 = အာရဗစ်(ISO) + +# Baltic +windows-1257.key = B +windows-1257 = ဘောလ်တစ် (Windows) +ISO-8859-4 = ဘောတစ်စ် (ISO)\u0020 + +# Central European +windows-1250.key = E +windows-1250 = ဥရောပ အလယ်ပိုင်း (Windows) +ISO-8859-2.key = I +ISO-8859-2 = ဥရောပ အလယ်ပိုင်း (ISO) + +# Chinese, Simplified +gbk.bis.key = S +gbk.bis = ရိုးရှင်း တရုတ်ဘာသာ + +# Chinese, Traditional +Big5.key = T +Big5 = ရိုးရာ တရုတ်စာ + +# Cyrillic +windows-1251.key = C +windows-1251 = ဆိုင်းရီလစ် (Windows) +ISO-8859-5 = ဆီရီလစ် (ISO) +KOI8-R = ဆိုင်းရီလစ် (KOI8-R) +KOI8-U = ဆိုင်းရီလစ် (KOI8-U) +IBM866 = ဆီရီလစ် (DOS) + +# Greek +windows-1253.key = G +windows-1253 = ဂရိ (Windows) +ISO-8859-7.key = O +ISO-8859-7 = ဂရိ (ISO) + +# Hebrew +windows-1255.key = H +windows-1255 = ဟေဗြဲ +# LOCALIZATION NOTE (ISO-8859-8): The value for this item should begin with +# the same word for Hebrew as the value for windows-1255 so that this item +# sorts right after that one in the collation order for your locale. +ISO-8859-8 = ဟီဗရူး , Visual + +# Japanese +Shift_JIS.key = J +Shift_JIS = ဂျပန် (Shift_JIS) +EUC-JP.key = p +EUC-JP = ဂျပန် (EUC-JP) +ISO-2022-JP.key = n +ISO-2022-JP = ဂျပန် (ISO-2022-JP) + +# Korean +EUC-KR.key = K +EUC-KR = ကိုးရီးယား + +# Thai +windows-874.key = i +windows-874 = ထိုင်း + +# Turkish +windows-1254.key = r +windows-1254 = တာရ်ကူရှ် + +# Vietnamese +windows-1258.key = V +windows-1258 = ဗီယက်နမ်မီး + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/commonDialog.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/commonDialog.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/commonDialog.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/commonDialog.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,13 @@ + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/commonDialogs.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/commonDialogs.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/commonDialogs.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/commonDialogs.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,32 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +Alert=အချက်ပေး +Confirm=အတည်ပြုပါ +ConfirmCheck=အတည်ပြုပါ +Prompt=လှုံ့ဆော်ချက် +PromptUsernameAndPassword2=စစ်မှန်ကြေင်း ပြဖို့ လိုအပ်တယ် +PromptPassword2=စကားဝှက် လိုအပ်တယ် +Select=ရွေးချယ်ပါ +OK=ကောင်းပြီ +Cancel=ပယ်​ဖျက်ပါ +Yes=လက်ခံတယ် +No=လက်မခံဘူး +Save=သိမ်းဆည်းပါ +Revert=ပြန်ထားပါ +DontSave=မသိမ်းဆည်းနဲ့ +ScriptDlgGenericHeading=[JavaScript လုပ်ငန်းသုံး ကိရိယာ] +ScriptDlgHeading=%S နေရာမှ စာမျက်နှာ ဖေါ်ပြတာက၊ +ScriptDialogLabel=ဤစာမျက်နှာအား အခြားဘောက်စ်များမဖွင့်ရန်ကာကွယ်ပိတ်ထားမည်။ +ScriptDialogPreventTitle=ဒိုရာလောခ့်ဘောက်စ်အပြင်အဆင်အတည်ပြုမည် +# LOCALIZATION NOTE (EnterLoginForRealm3, EnterLoginForProxy3): +# %1 is an untrusted string provided by a remote server. It could try to +# take advantage of sentence structure in order to mislead the user (see +# bug 244273). %1 should be integrated into the translated sentences as +# little as possible. %2 is the url of the site being accessed. +EnterLoginForRealm3=%2$S သည်သင့် သုံးဆွဲသူအမည်နှင့် စကားဝှက်အားတောင်းခံနေသညှ်။ “%1$S” ဟုလည်းပြောသှ်။ +EnterLoginForProxy3=%2$S ပရောက်ဆီမှ သင့် သုံးဆွဲသူအမည်နှင့် စကားဝှက်အားတောင်ခံနေသည်။ “%1$S” ဟုလည်းပြောသည် +EnterUserPasswordFor2=%1$S သည် သင့် အမည်နှင့် လျှို့ဝှက်စကားလုံးအား တောင်းနေသှ် +EnterUserPasswordForCrossOrigin2=%1$S ​သှ် သင့်သုံးဆွဲသူအမည်နှင့် စကားဝှက်အား တောင်းခံနေသှ်။ WARNING သင့်စကားဝှက်အား ၎င်းဝက်ဆိုဒ်သို့ပေးပို့ပေးမည်မဟုတ်ပါ! +EnterPasswordFor=%2$S တွင် %1$S အတွက် လျှို့ဝှက်စကားလုံးရိုက်ပါ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/config.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/config.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/config.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/config.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,50 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/config.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/config.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/config.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/config.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,22 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# Lock column values +default=စံထားချက် +user=သုံးစွသူ ချမှတ်ပါ +locked=သော့ခတ်ထားတယ် + +# Type column values +string=အတန်း +int=ကိန်းပြည့် +bool=ယုတ္တိတန် ပေါင်းစပ်မှု နည်းစနှစ် + +# Preference prompts +# %S is replaced by one of the type column values above +new_title=%S ရဲ့ တန်ဖိုးသစ် +new_prompt=ဦး​စားပေး အမည်ကို ရေးထည့်ပါ +modify_title=%S ရဲ့ တန်ဖိုးကို ရေးထည့်ပါ + +nan_title=ထည့်သွင်းသော တန်ဖိုး မမှန်ကန်ပါ +nan_text=သင်ရိုက်ထည့်သော စာ သည် နံပါတ်မပါ၀င်ပါ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/console.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/console.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/console.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/console.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,37 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + Last Sort Order"> + + First Sort Order"> + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/console.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/console.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/console.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/console.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,17 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +typeError=အမှား၊ +typeWarning=သတိ​ပေးချက်၊ +typeMessage=စာ - +errFile=အရင်းအမြစ် ဖိုင်၊ %S +errLine=လိုင်း၊ %S +errLineCol=လိုင်း - %S၊ ကော်လံ - %S +errCode=အရင်းအမြစ် ကုဒ် - +errTime=အချိန် - %S + +# LOCALIZATION NOTE (evaluationContextChanged): The message displayed when the +# browser console's evaluation context (window against which input is evaluated) +# changes. +evaluationContextChanged=The console’s evaluation context changed, probably because the target window was closed or because you opened a main window from the browser console’s window. diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/contentAreaCommands.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/contentAreaCommands.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/contentAreaCommands.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/contentAreaCommands.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,23 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# context menu strings + +SaveImageTitle=ရုပ်ပုံ သိမ်းဆည်းပါ +SaveMediaTitle=မီဒီယာကို သိမ်းမည် +SaveVideoTitle=ဗွီဒီယို သိမ်းဆည်းပါ +SaveAudioTitle=အသံ သိမ်းဆည်းပါ +SaveLinkTitle=သိမ်းဆည်းမဲ့ ပုံစံ +DefaultSaveFileName=အညွှန်း +WebPageCompleteFilter=ကွန်ရက် စာမျက်နှာ၊ အပြည့်အစုံ +WebPageHTMLOnlyFilter=ကွန်ရက် စာမျက်နှာ၊ HTML သာ +WebPageXHTMLOnlyFilter=ကွန်ရက် စာမျက်နှာ၊ XHTML သာ +WebPageSVGOnlyFilter=ကွန်ရက် စာမျက်နှာ၊ SVG သာ +WebPageXMLOnlyFilter=ကွန်ရက် စာမျက်နှာ၊ XML သာ + +# LOCALIZATION NOTE (filesFolder): +# This is the name of the folder that is created parallel to a HTML file +# when it is saved "With Images". The %S section is replaced with the +# leaf name of the file being saved (minus extension). +filesFolder=%S_ ဖိုင်များ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/customizeToolbar.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/customizeToolbar.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/customizeToolbar.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/customizeToolbar.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/customizeToolbar.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/customizeToolbar.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/customizeToolbar.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/customizeToolbar.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,11 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +enterToolbarTitle=ခလုတ်တန်း အသစ် +enterToolbarName=ဒီခလုတ်တန်း အတွက် အမည်တခုကို ရေးထည့်ပါ - +enterToolbarDup=ယခု "%S" အမည်နဲ့ ခလုတ်တန်းတခု ရှိနေပြီ။ အခြား အမည်တခုကို ရေးထည့်ပါ။ +enterToolbarBlank=ခလုတ်တန်း အသစ်တခု ဖန်တီးဖို့ အမည်တခု ရေးထည့်ရမယ်။ +separatorTitle=ပုဒ်ခွဲ +springTitle=ပျော့ပြောင်းနိုင်တဲ့ နေရာလပ် +spacerTitle=နေရာလပ် diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/datetimepicker.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/datetimepicker.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/datetimepicker.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/datetimepicker.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/dialogOverlay.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/dialogOverlay.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/dialogOverlay.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/dialogOverlay.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,10 @@ + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/dialog.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/dialog.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/dialog.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/dialog.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,12 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +button-accept=OK +button-cancel=ပယ်​ဖျက်ပါ +button-help=အကူအညီ +button-disclosure=ပိုမို အချက်အလက် +accesskey-accept= +accesskey-cancel= +accesskey-help=H +accesskey-disclosure=I diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/editMenuOverlay.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/editMenuOverlay.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/editMenuOverlay.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/editMenuOverlay.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,35 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/extensions.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/extensions.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/extensions.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/extensions.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,29 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +csp.error.missing-directive = လိုအပ်သော ညွှန်ကြားချက် ‘%S’ အတွက် မူဝါဒ မရှိပါ + +#LOCALIZATION NOTE (csp.error.illegal-keyword) %1$S is the name of a CSP directive, such as "script-src". %2$S is the name of a CSP keyword, usually 'unsafe-inline'. +csp.error.illegal-keyword = ‘%1$S’ ဒါရိုက်တစ်တွင် တားမြစ်ထားသည့် အဓိကစကားလုံး %2$S ပါဝင်နေသည် + +#LOCALIZATION NOTE (csp.error.illegal-protocol) %2$S a protocol name, such as "http", which appears as "http:", as it would in a URL. +csp.error.illegal-protocol = ‘%1$S’ တွင် တားမြစ်ထားသော %2$S: ပရိုတိုကောရင်းမြစ်ပါနေသေည် + +#LOCALIZATION NOTE (csp.error.missing-host) %2$S a protocol name, such as "http", which appears as "http:", as it would in a URL. +csp.error.missing-host = %2$S: ပရိုတိုကော သည် ‘%1$S’ ပုံစံအား လက်ခံ အမည်တွင်ပါရန်လိုအပ်သှ် + +#LOCALIZATION NOTE (csp.error.missing-source) %1$S is the name of a CSP directive, such as "script-src". %2$S is the name of a CSP source, usually 'self'. +csp.error.missing-source = ‘%1$S’ အား %2$S ရင်းမြစ်ပါရမည် + +#LOCALIZATION NOTE (csp.error.illegal-host-wildcard) %2$S a protocol name, such as "http", which appears as "http:", as it would in a URL. +csp.error.illegal-host-wildcard = %2$S: wildcard sources in ‘%1$S’ directives must include at least one non-generic sub-domain (e.g., *.example.com rather than *.com) + +#LOCALIZATION NOTE (uninstall.confirmation.title) %S is the name of the extension which is about to be uninstalled. +uninstall.confirmation.title = ဖြုတ်ပါ %S + +#LOCALIZATION NOTE (uninstall.confirmation.message) %S is the name of the extension which is about to be uninstalled. +uninstall.confirmation.message = “%S”မှ ဖြုတ်ပေးရန် တောင်းဆိုနေသည်။ သင်ဘာလုပ်ချင်ပါသလဲ? + +uninstall.confirmation.button-0.label = ဖြုတ်ပါ +uninstall.confirmation.button-1.label = တပ်ဆင်ထားပါ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/fallbackMenubar.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/fallbackMenubar.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/fallbackMenubar.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/fallbackMenubar.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,8 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# OSX only. Default menu label when there is no xul menubar. + +quitMenuitem.label=ထွက်ရန် +quitMenuitem.key=q diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/filefield.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/filefield.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/filefield.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/filefield.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#### Change Action + +downloadHelperNoneSelected=တခုမှ မရွေးထားဘူး diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/filepicker.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/filepicker.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/filepicker.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/filepicker.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,21 @@ + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/filepicker.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/filepicker.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/filepicker.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/filepicker.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,55 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE: The extensions to which these descriptions refer +# now live in toolkit/content/filepicker.properties +allTitle=ဖိုင်များ အားလုံး +htmlTitle=HTML ဖိုင်များ +textTitle=စာသား ဖိုင်များ +imageTitle=ရုပ်ပုံ ဖိုင်များ +xmlTitle=XML ဖိုင်များ +xulTitle=XUL ဖိုင်များ +appsTitle=လုပ်ငန်းသုံး ကိရိယာများ +audioTitle=အသံဖိုင်များ +videoTitle=ဗီဒီယိုဖိုင်များ + +dirTextInputLabel=ဖိုင်တွဲ အမည် - +dirTextInputAccesskey=n + +confirmTitle=အတည်ပြုပါ +confirmFileReplacing=%S တည်ရှိနေပြီးသား။\n၄င်းကို အစားထိုး လိုသလား။ +openButtonLabel=ဖွင့်ပါ +saveButtonLabel=သိမ်းဆည်းပါ +selectFolderButtonLabel=ရွေးချယ်ပါ +noButtonLabel=မလုပ်ဘူး +formatLabel=ပုံစံ: + +errorOpenFileDoesntExistTitle=%S ဖွင့်လှစ်မှု အမှား +errorOpenFileDoesntExistMessage=ဖိုင် %S မရှိဘူး +errorDirDoesntExistTitle=%S ဆီ ဝင်ရောက်မှု အမှား +errorDirDoesntExistMessage=ဖိုင်တွဲ %S မရှိဘူး။ + +errorOpeningFileTitle=%S ဖွင့်လှစ်မှု အမှား +openWithoutPermissionMessage_file=ဖိုင် %S ကို ဖတ်လို့ မရဘူး။ + +errorSavingFileTitle=%S သိမ်းဆည်းမှု အမှား +saveParentIsFileMessage=%S ဟာ ဖိုင်တခု ဖြစ်တယ်၊ %S ကို သိမ်းဆည်းလို့ မရဘူး။ +saveParentDoesntExistMessage=%S လမ်းကြောင်း မရှိဘူး၊ %S ကို သိမ်းဆည်းလို့ မရဘူး။ + +saveWithoutPermissionMessage_file=%S ဖိုင်မှာ ရေးလို့ မရဘူး။ +saveWithoutPermissionMessage_dir=ဖိုင်ကို ဖန်တီးလို့ မရဘူး။ %S ဖိုင်တွဲမှာ ရေးလို့ မရဘူး။ + +errorNewDirDoesExistTitle=%S ဖန်တီးမှု အမှား +errorNewDirDoesExistMessage=%S အမည်နဲ့ ဖိုင်တခု ရှိထားပြီ၊ ဖိုင်တွဲကို ဖန်တီးလို့ မရဘူး။ + +errorCreateNewDirTitle=%S ဖန်တီးမှု အမှား +errorCreateNewDirMessage=%S ဖိုင်တွဲကို ဖန်တီးလို့ မရဘူး +errorCreateNewDirIsFileMessage=ဖိုင်တွဲကို ဖန်တီးလို့ မရဘူး၊ %S ဟာ ဖိုင်တခု ဖြစ်တယ် +errorCreateNewDirPermissionMessage=ဖိုင်တွဲကို ဖန်တီးလို့ မရဘူး၊ %S မှာ ရေးလို့ မရဘူး။ + +promptNewDirTitle=ဖိုင်တွဲသစ် ဖန်တီးပါ +promptNewDirMessage=ဖိုင်တွဲ အမည် - + +errorPathProblemTitle=အမည်မသိ အမှား +errorPathProblemMessage=မမျှော်လင့်သော ပြသာနာတွေ့ရသှ် (လမ်းကြောင်း %S) diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/findbar.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/findbar.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/findbar.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/findbar.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,19 @@ + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/findbar.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/findbar.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/findbar.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/findbar.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,22 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# strings used by the Find bar, split from browser.properties +NotFound=စကားစု မတွေ့ရဘူး +WrappedToTop=စာမျက်နှာအဆုံး ရောက်နေပြီ၊ ထိပ်ကနေ ပြန်စပါ +WrappedToBottom=စာမျက်နှာထိပ် ရောက်နေပြီ၊ အဆုံးကနေ ပြန်စပါ +NormalFind=ဒီစာမျက်နှာတွင် ရှာပါ +FastFind=အမြန် ရှာ +FastFindLinks=အမြန် ရှာ (အချိတ်အဆက်များသာ) +CaseSensitive=(စာလုံး အမှားမခံ) +EntireWord=(စာလုံးတစ်လုံးလုံးသာ) +# LOCALIZATION NOTE (FoundMatches): Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is currently selected match and #2 the total amount of matches. +FoundMatches=ကိုက်ညီမှု #1 of #2;ကိုက်ညီမှု #1 of #2 +# LOCALIZATION NOTE (FoundMatchesCountLimit): Semicolon-separated list of plural +# forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the total amount of matches allowed before counting stops. +FoundMatchesCountLimit=ကိုက်ညီမှု #1 ခုထက်ပို;ကိုက်ညီမှု #1 ခုထက်ပို diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/finddialog.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/finddialog.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/finddialog.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/finddialog.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,22 @@ + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/finddialog.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/finddialog.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/finddialog.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/finddialog.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,6 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +notFoundWarning=သင်ရှာဖွေထားသော စာလုံးများအားရှာမတွေ့ပါ။ +notFoundTitle=ရှာဖွေပါ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/globalKeys.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/globalKeys.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/globalKeys.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/globalKeys.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,6 @@ + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/headsUpDisplay.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/headsUpDisplay.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/headsUpDisplay.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/headsUpDisplay.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,15 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + + +# LOCALIZATION NOTE (stacktrace.anonymousFunction): +# This string is used to display JavaScript functions that have no given name - +# they are said to be anonymous. See stacktrace.outputMessage. +stacktrace.anonymousFunction=< အမည်မသိ > + +# LOCALIZATION NOTE (stacktrace.outputMessage): +# This string is used in the Web Console output to identify a web developer call +# to console.trace(). The stack trace of JavaScript function calls is displayed. +# In this minimal message we only show the last call. +stacktrace.outputMessage=စောင့်ကြည့်ခြင်းအား %S, function %S, Line %S မှစမည် diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/intl.css firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/intl.css --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/intl.css 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/intl.css 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,11 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +/* + * This file contains all localizable skin settings such as + * font, layout, and geometry + */ +window { + font: 3mm tahoma,arial,helvetica,sans-serif; +} diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/intl.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/intl.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/intl.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/intl.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,61 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (general.useragent.locale): +# This is the valid BCP 47 language tag representing your locale. +# +# In most cases, this will simply be your locale code. However, in rare cases +# (such as 'jp-JP-mac'), you may need to modify your locale code in order to +# make it a valid BCP 47 language tag. (If your locale code does not include a +# region subtag, do not include one in the language tag representing your +# locale.) +general.useragent.locale=my + +# LOCALIZATION NOTE (intl.accept_languages): +# This is a comma-separated list of valid BCP 47 language tags. +# +# Begin with the value of 'general.useragent.locale'. Next, include language +# tags for other languages that you expect most users of your locale to be +# able to speak, so that their browsing experience degrades gracefully if +# content is not available in their primary language. +# +# It is recommended that you include "en-US, en" at the end of the list as a +# last resort. However, if you know that users of your locale would prefer a +# different variety of English, or if they are not likely to understand +# English at all, you may opt to include a different English language tag, or +# to exclude English altogether. +# +# For example, the Breton [br] locale might consider including French and +# British English in their list, since those languages are commonly spoken in +# the same area as Breton: +# intl.accept_languages=br, fr-FR, fr, en-GB, en +intl.accept_languages=my, en-GB, en + +# LOCALIZATION NOTE (font.language.group): +# This preference controls the initial setting of the language drop-down menu +# in the Content > Fonts & Colors > Advanced preference panel. +# +# Set it to the value of one of the menuitems in the "selectLangs" menulist in +# http://mxr.mozilla.org/mozilla/source/browser/components/preferences/fonts.xul +font.language.group=x-western + +# LOCALIZATION NOTE (intl.charset.detector): +# This preference controls the initial setting for the character encoding +# detector. Valid values are ja_parallel_state_machine for Japanese, ruprob +# for Russian and ukprob for Ukrainian and the empty string to turn detection +# off. The value must be empty for locales other than Japanese, Russian and +# Ukrainian. +intl.charset.detector=UTF-8 + +# LOCALIZATION NOTE (pluralRule): Pick the appropriate plural rule for your +# language. This will determine how many plural forms of a word you will need +# to provide and in what order. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +pluralRule=1 + +# LOCALIZATION NOTE (intl.menuitems.alwaysappendaccesskeys, intl.menuitems.insertseparatorbeforeaccesskeys): +# Valid values are: true, false, +# Missing preference or empty value equals false. +intl.menuitems.alwaysappendaccesskeys= +intl.menuitems.insertseparatorbeforeaccesskeys=true diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/keys.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/keys.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/keys.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/keys.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,71 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE : FILE This file contains the application's labels for keys on the keyboard. +# If you decide to translate this file, you should translate it based on +# the prevelant kind of keyboard for your target user. +# LOCALIZATION NOTE : There are two types of keys, those w/ text on their labels +# and those w/ glyphs. +# LOCALIZATION NOTE : VK_<…> represents a key on the keyboard. +# +# For more information please see bugzilla bug 90888. + +# F1..F10 should probably not be translated unless there are keyboards that actually have other labels +# F11..F20 might be something else, but are really keyboard specific and not region/language specific +# there are actually two different F11/F12 keys, I don't know which one these labels represent. +# eg, F13..F20 on a sparc keyboard are labeled Props, Again .. Find, Cut +# sparc also has Stop, Again and F11/F12. VK_F11/VK_F12 probably map to Stop/Again +# LOCALIZATION NOTE : BLOCK Do not translate the next block +VK_F1=F1 +VK_F2=F2 +VK_F3=F3 +VK_F4=F4 +VK_F5=F5 +VK_F6=F6 +VK_F7=F7 +VK_F8=F8 +VK_F9=F9 +VK_F10=F10 + +VK_F11=F11 +VK_F12=F12 +VK_F13=F13 +VK_F14=F14 +VK_F15=F15 +VK_F16=F16 +VK_F17=F17 +VK_F18=F18 +VK_F19=F19 +VK_F20=F20 +# LOCALIZATION NOTE : BLOCK end do not translate block + +# LOCALIZATION NOTE : BLOCK GLYPHS, DO translate this block +VK_UP=Up Arrow +VK_DOWN=Down Arrow +VK_LEFT=Left Arrow +VK_RIGHT=Right Arrow +VK_PAGE_UP=Page Up +VK_PAGE_DOWN=Page Down +# LOCALIZATION NOTE : BLOCK end GLYPHS + +# Enter, backspace, and Tab might have both glyphs and text +# if the keyboards usually have a glyph, +# if there is a meaningful translation, +# or if keyboards are localized +# then translate them or insert the appropriate glyph +# otherwise you should probably just translate the glyph regions + +# LOCALIZATION NOTE : BLOCK maybe GLYPHS +VK_RETURN=Return +VK_TAB=Tab +VK_BACK=Backspace +VK_DELETE=Del +# LOCALIZATION NOTE : BLOCK end maybe GLYPHS +# LOCALIZATION NOTE : BLOCK typing state keys +VK_HOME=Home +VK_END=End + +VK_ESCAPE=Esc +VK_INSERT=Ins +# LOCALIZATION NOTE : BLOCK end diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/languageNames.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/languageNames.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/languageNames.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/languageNames.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,201 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +aa = အာဖာ +ab = အခ္ဘါဇီယန် +ae = Avestan +af = အာဖရိကန် +ak = အာကန် +am = အန်ဟာရစ် +an = အာရဂိုနစ် +ar = အာရေဗိ +as = အာဆမ်မစ် +ast = အာစတူရီယန် +av = အာဗာရစ် +ay = အေမာရာ +az = အာဇာဘိုင်ဂျာနီ +ba = ဘာရှ်ကီး +be = ဘယ်လာရူရှန် +bg = ဘူလဂေးရီးယန်း +bh = ဘီဟာရီး +bi = ဘီးစလန်မား +bm = ဘန်ဘာရာ +bn = ဘန်ဂါလီ +bo = တီဘက်တန် +br = ဘရီတွန် +bs = ဘောစနီးယန်း +ca = ကာတာလန် +ce = ချီချန် +ch = ချန်မာရို +co = ကော်ရ်စီကန် +cr = ဂရီး +cs = ချက် +csb = ကက်စဘီးယန်း +cu = ချပ်စလာဗစ် +cv = ကျုဗားရှ် +cy = ဝဲလ်ရှ် +da = ဒန်နစ်ချ် +de = ဂျာမန် +dsb = Lower Sorbian +dv = ဒီဗေးဟီ +dz = ဇောင်ခါး +ee = ဧဝီ +el = ဂရိ +en = အင်္ဂလိပ် +eo = အယ်စပါရန်တို +es = စပိန် +et = အယ်စတိုနီးယန်း +eu = ဘားစကွီ +fa = ပါရှန် +ff = ဖူးလာ +fi = ဖီးနစ်ရှ် +fj = ဖီဂျီယန် +fo = ဖာ​​ရောယီး +fr = ပြင်သစ် +fur = ဖရူးလီယန် +fy = ဖရီးရှန် +ga = အိုင်ရစ် +gd = Scottish Gaelic +gl = ဂါလီရှန် +gn = ဂူအာရန်နီ +gu = ဂူဂျာရာတီ +gv = မန်ဇ် +ha = ဟူဆ +haw = Hawaiian +he = ဟေဗြဲ +hi = ဟင်ဒီ +hil = Hiligaynon +ho = ဟီရီ မောသူး +hr = ခရိုအေးရှား +hsb = ဆော်ဗျံ အထက် +ht = ဟေတီရန် +hu = ဟန်ဂေရီယန် +hy = အာမေးနီးယန်း +hz = ဟေးရေးရို +ia = အင်တာလင်းကွာ +id = အင်ဒိုနီးရှန် +ie = အင်တာလင်းကွေး +ig = အိဘို +ii = စီချောင်းဇီ +ik = အိုင်နူးပစ် +io = အီဒို +is = အိုင်စလန်ဒစ် +it = အီတလျှံ +iu = အီနုတီတု +ja = ဂျပန် +jv = ဂျာဗားနစ် +ka = ဂျော်ဂျီယန် +kg = ဂွန်ဂို +ki = ကီကူယူ +kj = ကွာန်ရာမာ +kk = ခါရာခ် +kl = ဂရင်းလဲန်းဒစ် +km = ခမာ +kn = ကန်နာဒါ +ko = ကိုးရီးယား +kok = ကွန်ကာနီ +kr = ကန်နူရီ +ks = ခါရှ်မီးရီး +ku = ကာဒ်ဒစ် +kv = ကိုမီး +kw = ကောနီးရှ် +ky = ကီးဂျစ်ဇ် +la = လက်တင် +lb = လူဇင်ဘာဂစ် +lg = ကန်ဒါ +li = လင်ဘာဂန် +ln = လင်ကာလာ +lo = လာအို +lt = လီသူယားနီးယား +lu = လူဘာ-ကတန်ဂါ +lv = လက်​ဗီးယန်း +mg = မာလာဂါဆီ +mh = မာရှာလစ် +mi = မောင်ရီ +mk = မက်ဆီဒိုးနီးယန်း +ml = မလေးရာလမ် +mn = မွန်ဂိုလီးယန်း +mr = မာရာသီး +ms = မလေး +mt = မားသီးစ် +my = မြန်မာ +na = နိုင်ရို +nb = နော်ဝေးဂျီယန်း ဘောက်မာ +nd = နဒီဘဲလီ၊ မြောက်ပိုင်း +ne = နီ​ပါလီး +ng = နဒေါင်ဂါ +nl = ဒါးချ် +nn = နော်ဝေးဂျီးယန်း နီနောရ် +no = နော်ဝေးဂျီးယန်း +nr = နဒီဘဲလီ၊ တောင်ပိုင်း +nso = ဆိုထို၊ မြောက်ပိုင်း +nv = နဗာဂျို +ny = ချီချဲဗား +oc = အော်ချစ်တန် +oj = အိုဂျီဘွား +om = အိုရိုမို +or = အိုဒီယာ +os = အိုဆက်တီယန်း +pa = ပန်ဂျပ်ဘီ +pi = ပါဠိ +pl = ပိုလီရှ် +ps = ပါစသို +pt = ပေါ်တူဂီစ် +qu = ကွာချုဝါး +rm = ရေးသို - ရိုမန်နစ် +rn = ကီရန်ဒီ +ro = ရိုမေးနီးယန်း +ru = ရုရှန်း +rw = ကင်ညာ၀မ်ဒါ +sa = ဆန်စခရစ် +sc = ဆာရ်ဒီးနီးယန်း +sd = ဆင်ဒီ +se = မြောက်ပိုင်း ဆာမီး +sg = ဆန်ဂို +si = ဆင်ဟာလစ် +sk = စလိုဗက် +sl = စလိုဗေးနီးယန်း +sm = ဆာမွန် +sn = ရှိုးနား +so = ဆိုမာလီ +son = Songhay +sq = အယ်လဗေးနီးယန်း +sr = ဆာ​ဗီးယန်း +ss = စစ်ဝါသီ +st = ဆိုထို၊ တောင်ပိုင်း +su = ဆန်ဒေးနစ် +sv = ဆွီဒစ် +sw = ဆွာဟီလီ +ta = တမီးလ် +te = တယ်လကူ +tg = သာဂျစ် +th = ထိုင်း +ti = တီဂရီယန်း +tig = တီဂရီ +tk = တတ်ခမန် +tl = တာဂါလော့ခ် +tlh = ကလင်ဂေါင် +tn = တဆွန်နာ +to = တောင်ဂါး +tr = တာရ်ကူရှ် +ts = တဆောင်ဂါ +tt = တာတာ +tw = တွီး +ty = တဟီးတီယန်း +ug = အွီးဟူ +uk = ယူဂရိန်းနီးယန်း +ur = အူရ်ဒူး +uz = ဥဇဘက် +ve = ဗင်ဒါ +vi = ဗီယက်နမ်မီး +vo = ဘောလာပုတ် +wa = ဝေါလောင် +wen = ဆောဗီယန် +wo = ဝေါလောက် +xh = ဇော်ဆာ +yi = ရစ်ဒစ်ရှ် +yo = ယောရူဘာ +za = ဇူးရန် +zh = တရုတ် +zu = ဖူလူ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/mozilla.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/mozilla.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/mozilla.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/mozilla.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,9 @@ + + + + +twins of Mammon quarrelled. Their warring plunged the world into a new darkness, and the beast abhorred the darkness. So it began to move swiftly, and grew more powerful, and went forth and multiplied. And the beasts brought fire and light to the darkness."> + +The Book of Mozilla, 15:1"> diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/narrate.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/narrate.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/narrate.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/narrate.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,19 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# Narrate, meaning "read the page out loud". This is the name of the feature +# and it is the label for the popup button. +narrate = နောက်ခံစကားပြော ဖွင့်ပါ +back = နောက်သို့ +start = စ +stop = ရပ် +forward = ဆက်ပို့ပါ +speed = လျင်မြန်မှု +selectvoicelabel = အသံ - +# Default voice is determined by the language of the document. +defaultvoice = ပုံမှန် + +# Voice name and language. +# eg. David (English) +voiceLabel = %S (%S) \ No newline at end of file diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/notification.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/notification.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/notification.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/notification.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,12 @@ + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/nsTreeSorting.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/nsTreeSorting.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/nsTreeSorting.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/nsTreeSorting.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,5 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +SortMenuItems=%COLNAME% အလိုက် မျိုးတူစုထားချက် diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/preferences.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/preferences.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/preferences.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/preferences.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,9 @@ + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printdialog.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printdialog.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printdialog.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printdialog.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,44 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printdialog.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printdialog.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printdialog.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printdialog.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,63 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# These strings are used in the native GTK, Mac and Windows print dialogs. + +# GTK titles: +printTitleGTK=ပုံနှိုပ်ပါ +optionsTabLabelGTK=ရွေးစရာများ +printFramesTitleGTK=ဘောင်များကို ပုံနှိုပ်ပါ + +# Mac titles: +optionsTitleMac=ရွေးချယ်ခွင့်များ +appearanceTitleMac=အသွင်အပြင် +framesTitleMac=အကွက်များ: +pageHeadersTitleMac=စာမျက်နာ၏ ခေါင်းစဥ် +pageFootersTitleMac=စာမျက်နှာ အောက်ခြေစာတမ်းများ - + +# Windows titles: +optionsTitleWindows=ရွေးစရာများ +printFramesTitleWindows=ဘောင်များကို ပုံနှိုပ်ပါ + +# TRANSLATOR NOTE: For radio button labels and check button labels, an underscore _ +# before a character will turn that character into an accesskey in the GTK dialog. +# e.g. "_As laid out" will make A the accesskey. +# In the Windows labels, use an ampersand (&). +# On Mac, underscores will be stripped. + +asLaidOut=_Aဖန်သားပြင်ပေါ် ခင်းကျင်းတဲ့အတိုင်း +asLaidOutWindows=ဖန်သားပြင်ပေါ် ခင်းကျင်းတဲ့အတိုင်း +selectedFrame=ရွေးချယ်လိုက်တဲ့ ဘောင် +selectedFrameWindows=ရွေးချယ်ထားတဲ့ ဘောင် +separateFrames=သီးခြား စာမျက်နှာများမှာ ရှိတဲ့ ဘောင်တခုစီ +separateFramesWindows=ဘောင်တိုင်းကို သီးခြားစီ +shrinkToFit=_h စကေးကိုက်ခြင်းအား လျစ်လျူရှူပြီး စာမျက်နှာဖြင့် အကိုက် ညှိပါ ။ +selectionOnly=ရွေးထားတဲ့ အပိုင်းကိုသာ ပရင့်ထုတ်ရန် +printBGOptions=နောက်ခံများကို ပရင့်ထုတ်ရန် +printBGColors=နောက်ခံ အရောင်များကို ပရင့်ထုတ်ရန် +printBGImages=နောက်ခံ ရုပ်ပုံများကို ပရင့်ထုတ်ရန် +headerFooter=ခေါင်းစီးနဲ့ အောက်ခြေစာတမ်း +left=ဘယ် +center=ဗဟို +right=ညာ +headerFooterBlank=--ကွတ်လပ်-- +headerFooterTitle=ခေါင်းစဉ် +headerFooterURL=URL +headerFooterDate=နေ့စွဲ/အချိန် +headerFooterPage=စာမျက်နှာ # +headerFooterPageTotal=စာမျက်နှာ # မှ # +headerFooterCustom=စိတ်ကြိုက်... +customHeaderFooterPrompt=ကျေးဇူးပြု၍ သင်၏ ခေါင်းစဥ်၊ အောက်ခြေ စာသားကို ထည့်ပါ + +# These are for the summary view in the Mac dialog: +summaryFramesTitle=ဘောင်များကို ပုံနှိုပ်ပါ +summarySelectionOnlyTitle=ရွေးချယ်ထားသော အပိုင်းကို စာပုံနှိပ်ထုတ်ပါ +summaryShrinkToFitTitle=အံကိုက်ဖို့ စိတ်ကြိုက်ဖန်တီးပါ +summaryPrintBGColorsTitle=Print BG Colors +summaryPrintBGImagesTitle=Print BG Images +summaryHeaderTitle=စာမျက်နှာ၏ခေါင်းစဥ် +summaryFooterTitle=စာမျက်နှာ၏ အောက်ခြေ +summaryNAValue=N/A +summaryOnValue=ဖွင့်ပါ +summaryOffValue=ပိတ်ပါ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printjoboptions.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printjoboptions.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printjoboptions.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printjoboptions.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,29 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printPageSetup.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printPageSetup.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printPageSetup.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printPageSetup.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,66 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printPreview.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printPreview.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printPreview.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printPreview.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,43 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printPreviewProgress.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printPreviewProgress.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printPreviewProgress.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printPreviewProgress.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,9 @@ + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printProgress.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printProgress.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/printProgress.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/printProgress.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,21 @@ + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/regionNames.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/regionNames.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/regionNames.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/regionNames.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,276 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +ad= အန်ဒိုရာ +ae= အာရပ်စော်ဘွားများပြည်ထောင်စု +af= အာဖဂန်နစ္စတန် +ag= အန်တီဂွာနဲ့ ဘာဘူဒါ +ai= အန်ဂွီလာ +al= အယ်ဘေးနီးယား +am= အာမေးနီးယား +ao= အင်ဂိုလာ +aq= အန္တာတိတ်က +ar= အာဂျင်တီးနား +as= အမေရိကန် ဆာမိုအာ +at= သြစတြီးယား +au= သြစတြေးလျ +aw= အာရိုဘာ +az= အာဇာဘိုင်ကျန် +ba= ဘောစနီးယားနဲ့ ဟာဇီဂိုဗင်းနား +bb= ဘာရ်ဘာဒို +bd= ဘင်္ဂလားဒေ့ချ် +be= ဘယ်လဂျီယံ +bf= ဘာကင်နာ ဖာဆို +bg= ဘူဂေးရီးယား +bh= ဘာရိန် +bi= ဘူရွန်ဒီ +bj= ဘယ်နင် +bl= စိန့်ဘာသီလီမီ +bm= ဘာမျုဒါ +bn= ဘရူနိုင်း +bo= ဘူလီးဗီးယား +bq= ဘိုနိုင်ရီ၊ ဆင့် အက်စတေတီးယက်စ်၊နှင့် ဆားဘား +br= ဘရာဇီး +bs= ဘဟားမားစ် +bt= ဘူတန် +bv= ဘောင်​​ဗစ် ကျွန်း +bw= ဘော့ထ်ဆွာနာ +by= ဘယ်လာရူ +bz= ဘယ်လိုက် +ca= ကနေဒါ +cc= ကိုကိုး (ဘေး​စောင်းလျက်) ကျွန်းများ +cd= ကွန်ဂို (ကင်ရှားစား) +cf= အာဖရိက အလယ်ပိုင်း ပြည်ထောင်စု +cg= ကွန်ဂို (ဘရာဇာဗီးလ်) +ch= ဆွီဇာလန် +ci= ကို့ဒ် ဒီ အိုင်ဗွိုင်ရီ +ck= ကုက် ကျွန်းများ +cl= ချီလီ +cm= ကင်မရွန်း +cn= တရုတ် +co= ကိုလံဘီယာ +cp= ကလစ်ပါတန် ကျွန်း +cr= ကိုစတာ ရီကာ +cu= ကျုးဘား +cv= ကာဗို ဗာဒီ +cw= ကူရာကောင်း +cx= ခရစ္စမတ် ကျွန်း +cy= ဆိုင်းရပ်စ် +cz= ချက် ပြည်ထောင်စု +de= ဂျာမနီ +dg= ဒေဂို ဂါဆီးရား +dj= ဒဂျီဘောင်တီ +dk= ဒိန်းမတ် +dm= ဒိုမီနီကာ +do= ဒိုမီနီကန် ပြည်ထောင်စု +dz= ဘယ်ဂျီးရီယား +ec= အီကွေဒေါ +ee= အဲစတိုးနီးယား +eg= အီဂျစ် +eh= ဆာဟာရ အနောက်ပိုင်း +er= အဲရစ်ထရီယား +es= စပိန် +et= အီတီယိုးပီးယား +fi= ဖင်လန် +fj= ဖီဂျီ +fk= ဖောက်ကလန်ကျွန်းများ (အိုင်းလက်စ် မာလ်ဗီနာ့စ်) +fm= မိုက္ကရိုနီးရှား ပြည်ထောင်စု +fo= ဖာရိုးကျွန်းများ +fr= ပြင်သစ် +ga= ဂါဘွန် +gb= ယူနိုက်တက် ကင်းဒန်း +gd= ခရေနဒါ +ge= ဂျော်ဂျီယာ +gf= ပြင်သစ် ဂွန်နား +gg= ကွာန်ဆေး +gh= ဂါနာ +gi= ဂျီဗရောတာ +gl= ဂရင်းလဲန်း +gm= ဂမ်ဘီးယား +gn= ဂီးနီးယား +gp= ဂွာဒေလိုပီ +gq= အီကွေတာ ဒေသ ဂီးနီးယား +gr= ဂရိ +gs= ဂျော်ဂျီယာတောင်ပိုင်းနှင့် တောင်ပိုင်း ဆန်းဒဝှစ် ကျွန်းများ +gt= ဂွာတေမာလာ +gu= ဂိုအန် +gw= ဂီးနီးယား-ဘီဆော +gy= ဂူယန်နား +hk= ဟောင်ကောင် +hm= ဟာဒ် ကျွန်းနဲ့ မခ်​ဒေါနယ် ကျွန်းများ +hn= ဟွန်ဒူးရပ် +hr= ခရိုအေးရှား +ht= ဟေတီ +hu= ဟန်ဂေရီ +id= အင်ဒိုနီးရှား +ie= အိုင်ယာလန် +il= အစ္စရေး +im= မန် ကျွန်းငယ် +in= အိန္ဒိယ +io= ဗြိတိသျှ အိန္ဒိယန် သမုဒ္ဒရာ ပိုင်နက် +iq= အီရတ် +ir= အီရန် +is= အိုင်ယာလန် +it= အီတလီ +je= ဂျာဆီ +jm= ဂျမိုင်ကာ +jo= ဂျော်ဒန် +jp= ဂျပန် +ke= ကင်ညာ +kg= ကီဂျစ္စတန် +kh= ကမ္ဘော်ဒီးယား +ki= ကီရီဘတ္တီ +km= ကိုမိုရိုစ် +kn= စိန့် ကစ်နဲ့ နဲဗစ် +kp= ကိုရီးယား၊ မြောက် +kr= ကိုရီးယား၊ တောင် +kw= ကူးဝိတ် +ky= ဂေးမန် ကျွန်းများ +kz= ကာဇက်စတန် +la= လာအို +lb= လက်ဘနွန် +lc= စိန့် လူစီယား +li= လစ်တန်စတိန်း +lk= သီရိလင်္ကာ +lr= လိုင်ဘေးရီးယား +ls= လေဆိုထို +lt= လီသူယားနား +lu= လူဇင်ဘတ် +lv= လက်ဗီးယား +ly= လီဗျား +ma= မော်ရိုကို +mc= မိုနာကို +md= မောလ်ဒိုဗာ +me= မွန်တေးနက်ဂရို +mf= စိန့် မာတင် +mg= မာဒါဂျားစကား +mh= မာရှယ် ကျွန်းများ +mk= မာဆီဒိုးနီးယား +ml= မာလီ +mm= မြန်မာ +mn= မွန်ဂိုးလီးယား +mo= မက္ကာအို +mp= မြောက်ပိုင်း မာရီယာနာ ကျွန်းများ +mq= မာတင်နီဂွီ +mr= မောရီတန်နီယား +ms= မွန်ဆီရပ် +mt= မောလတာ +mu= မောရိတီယက် +mv= မော်လဒိုက် +mw= မာလာဝီ +mx= မက္ကဆီကို +my= မလေးရှား +mz= မိုဇန်ဘစ် +na= နမီးဘီးယား +nc= ကာလေဒိုနီယား သစ် +ne= နိုင်ဂါ +nf= နော်ဖေါက် ကျွန်း +ng= နိုင်ဂျီးရီးယား +ni= နိုင်ကာရာဂွာ +nl= နယ်သာလန် +no= နော်ဝေ +np= နီပေါ +nr= နိုင်ရို +nu= နိုင်ယူ +nz= နယူးဇီးလန် သစ် +om= အိုမန် +pa= ပါနားမား +pe= ပီရူး +pf= ပြင်သစ် ပိုလီနီးရှား +pg= ပါပူအာ နယူးဂီနီ +ph= ဖီလစ်ပိုင် +pk= ပါကစ္စတန် +pl= ပိုလန် +pm= Saint Pierre and Miquelon +pn= ပစ်ကာန်းကျွန်းများ +pr= ပိုတာရီဂို +pt= ​ပေါ်တူဂီ +pw= ပလောင် +py= ပါရာဂွေး +qa= ဂွာတာ +qm= မစ်ဒ်ဝေးကျွန်းများ +qs= ဘာစ်စက်စ် ဒါ အိန္ဒိယ +qu= ဂျူအန် ဒီ နိုဗား ကျွန်း +qw= ဝိက်ကျွန်း +qx= ဂလိုရီအိုဆိုကျွန်းများ +qz= အက္ကရိုတီရီ +re= ရီယူးနီယန် +ro= ရိုမေးနီးယား +rs= ဆားဗီးယား +ru= ရုရှား +rw= ရ၀မ်ဒါ +sa= ဆော်ဒီအာရေဗျ +sb= ဆော်လမွန် ကျွန်းများ +sc= ဆေးချီးလစ် +sd= ဆူဒန် +se= ဆွီဒင် +sg= စင်ကာပူ +sh= စိန့် ဟဲလီနာ၊ အက်စ်ဆန်ရှင်း၊ နှင့် ထရစ္စတန် ဒါ ကွန်ဟာ +si= စလိုဗေးနီးယား +sk= စလိုဗက်ကီးယား +sl= ဆေးရာ လွန်း +sm= ဆန်မရီနို +sn= ဆေနီဂေး +so= ဆိုမာလီယား +sr= ဆူရီနေ +ss= တောင် ဆူဒန် +st= ဆောင် သိုမီနဲ့ ပရင်းစစ် +sv= အယ် ​ဆာလဗာဒို +sx= ဆင့် မားတန် +sy= ဆီးရီးယား +sz= ဆွာဇီလန် +tc= တတ်ခ် နဲ့ ကိုင်ကို ​ကျွန်းများ +td= ချပ် +tf= ပြင်သစ်တောင်ပိုင်းနှင့် အန္တာတိတ်ကျွန်းများ +tg= တိုဂို +th= ထိုင်း +tj= တာဂျီကစ္စတန် +tk= တိုကေးလော +tl= တီမော-လေစတီ +tm= တတ်မန်နစ္စတန် +tn= တူနီးရှား +to= တောင်ဂါး +tr= တူရကီ +tt= ထရီနီဒတ်နဲ့ တိုဘာဂို +tv= တူဗာလူ +tw= ထိုင်၀မ် +tz= တန်ဇန်နီးယား +ua= ယူဂရိန်း +ug= ယူဂန်ဒါ +us= အမေရိကန် ပြည်ထောင်စု +uy= ဥရူဂွေး +uz= ဥဇဘက်ကစ္စတန် +va= ဗာတီကန် စီးတီး +vc= စိန့် ဗင်းဆင့်နဲ့ ဂရေနာဒင်း +ve= ဗင်နဲဇွဲလား +vg= ဗာဂျင်းကျွန်းများ၊ ဗြိတိန် +vi= ဗာဂျင်းကျွန်းများ၊ အမေရိကန် +vn= ဗီယက်နမ် +vu= ဗာနူဝါသူး +wf= ဝေါလစ်နဲ့ ဖူးသူးနား +ws= ​ဆာမိုအာ +xa= အက်ရှ်မိုးနှင့် ကာတီးယားကျွန်းများ +xb= ဘေကာကျွန်း +xc= ကိုရယ်လ်ပင်လယ်ကျွန်းများ +xd= ဒယ်ခဲလီယား +xe= ယူရိုပါးကျွန်း +xg= ဂါဇာကမ်းမြှောင် +xh= ဟောင်လန်ကျွန်း +xj= ဂျန်မေယန်း +xk= ကိုဆိုဗို +xl= ပါမိုင်ရားအက်တိုးလ် +xm= ကင်းမန်းသန္တာကျောက်တန်း +xp= ပါရာဆဲလ်ကျွန်းများ +xq= ဂျာဗစ်ကျွန်း +xr= ဆဗဲလ်ဘတ်ဒ် +xs= စပရာတလီကျွန်းများ +xt= ထရိုမီလင်းကျွန်း +xu= ဂျွန်စတန်သန္တာကျောက်ကျွန်း +xv= နာဗက်စားကျွန်း +xw= အနောက်ဘက်ကမ်းပါး +ye= ယီမင် +yt= မာယောက် +za= တောင် အာဖရိက +zm= ဇန်ဘီးယား +zw= ဇင်ဘာဘွေ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/resetProfile.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/resetProfile.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/resetProfile.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/resetProfile.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,15 @@ + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/resetProfile.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/resetProfile.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/resetProfile.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/resetProfile.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,14 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE: These strings are used for profile reset. + +# LOCALIZATION NOTE (resetUnusedProfile.message): %S is brandShortName. +resetUnusedProfile.message=ကြည်ရတာ သင် %S ကိုမသုံးတာကြာပြီထင်တယ်။ ပိုပြီး ပေါ့ပါးပြီး သစ်လွင်သော ခံစားချက်မျိုးရအောင် သန့်လိုက်မလား ? ဒါနဲ့ ပြန်လာတာကိုကြိုဆိုပါတယ်! +# LOCALIZATION NOTE (resetUninstalled.message): %S is brandShortName. +resetUninstalled.message=%S ကို ပြန်လည်ထည့်သွင်းတပ်ဆင်ထားပုံရသည်။ အသစ်ကဲ့သို့ လတ်ဆတ်သည့်အတွေ့အကြုံ ရရှိစေရန်အတွက် ၎င်းကို ဖယ်ရှားစေချင်ပါသလား။ + +# LOCALIZATION NOTE (refreshProfile.resetButton.label): %S is brandShortName. +refreshProfile.resetButton.label=%S ကို ပြန်စရန်… e +refreshProfile.resetButton.accesskey=e diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/textcontext.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/textcontext.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/textcontext.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/textcontext.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,37 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/tree.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/tree.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/tree.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/tree.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,5 @@ + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/videocontrols.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/videocontrols.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/videocontrols.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/videocontrols.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,49 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + / #2"> diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/viewSource.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/viewSource.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/viewSource.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/viewSource.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,86 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/viewSource.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/viewSource.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/viewSource.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/viewSource.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,18 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +goToLineTitle = လိုင်း​ဆီ သွားပါ +goToLineText = လိုင်းနံပါတ် ရေးထည့်ပါ +invalidInputTitle = မမှန်တဲ့ ထည့်သွင်းချက် +invalidInputText = ရေးထည့်တဲ့ လိုင်းနံပါတ် မမှန်ဘူး။ +outOfRangeTitle = လိုင်းမတွေ့ရဘူး။ +outOfRangeText = သတ်မှတ်ထားတဲ့ လိုင်းကို မတွေ့ရဘူး။ +statusBarLineCol = လိုင်း %1$S, ကော်လံ %2$S +viewSelectionSourceTitle = DOM ရဲ့​ ရွေးချယ်ခြင်း အရင်းအမြစ် +viewMathMLSourceTitle = MathML ရဲ့ DOM အရင်းအမြစ် + +context_goToLine_label = ထိုလိုင်းသို့သွားပါ… +context_goToLine_accesskey = L +context_wrapLongLines_label = စာကြောင်းများကိုထုပ်ပေးပါ +context_highlightSyntax_label = Syntax Highlighting diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/wizard.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/wizard.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/wizard.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/wizard.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,24 @@ + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/wizard.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/wizard.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global/wizard.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global/wizard.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,8 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +default-first-title=%S မှ ကြိုဆိုပါသည် +default-last-title=%S ကို ပြီးဆုံးသည်အထိ ဆောင်ရွက်နေသည် +default-first-title-mac=နိဒါန်း +default-last-title-mac=နိဂုံး diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/mac/intl.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/mac/intl.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/mac/intl.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/mac/intl.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (intl.ellipsis): Use the unicode ellipsis char, \u2026, +# or use "..." if \u2026 doesn't suit traditions in your locale. +intl.ellipsis=… diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/mac/platformKeys.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/mac/platformKeys.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/mac/platformKeys.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/mac/platformKeys.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,25 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#mac +#this file defines the on screen display names for the various modifier keys +#these are used in XP menus to show keyboard shortcuts + +#the shift key - open up arrow symbol (ctrl-e) +VK_SHIFT=⇧ + +#the command key - clover leaf symbol (ctrl-q) +VK_META=⌘ + +#the win key - never generated by native key event +VK_WIN=win + +#the option/alt key - splitting tracks symbol (ctrl-g) +VK_ALT=⌥ + +#the control key. hat symbol (ctrl-f) +VK_CONTROL=⌃ + +#the separator character used between modifiers (none on Mac OS) +MODIFIER_SEPARATOR= diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/unix/intl.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/unix/intl.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/unix/intl.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/unix/intl.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (intl.ellipsis): Use the unicode ellipsis char, \u2026, +# or use "..." if \u2026 doesn't suit traditions in your locale. +intl.ellipsis=… diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/unix/platformKeys.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/unix/platformKeys.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/unix/platformKeys.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/unix/platformKeys.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,25 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#default +#this file defines the on screen display names for the various modifier keys +#these are used in XP menus to show keyboard shortcuts + +#the shift key +VK_SHIFT=Shift + +#the command key +VK_META=Meta + +#the win key (Super key and Hyper keys are mapped to DOM Win key) +VK_WIN=Win + +#the alt key +VK_ALT=Alt + +#the control key +VK_CONTROL=Ctrl + +#the separator character used between modifiers +MODIFIER_SEPARATOR=+ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/win/intl.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/win/intl.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/win/intl.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/win/intl.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (intl.ellipsis): Use the unicode ellipsis char, \u2026, +# or use "..." if \u2026 doesn't suit traditions in your locale. +intl.ellipsis=… diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/win/platformKeys.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/win/platformKeys.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/global-platform/win/platformKeys.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/global-platform/win/platformKeys.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,25 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#default +#this file defines the on screen display names for the various modifier keys +#these are used in XP menus to show keyboard shortcuts + +#the shift key +VK_SHIFT=Shift + +#the command key +VK_META=Meta + +#the win key +VK_WIN=Win + +#the alt key +VK_ALT=Alt + +#the control key +VK_CONTROL=Ctrl + +#the separator character used between modifiers +MODIFIER_SEPARATOR=+ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/downloads/downloads.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/downloads/downloads.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/downloads/downloads.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/downloads/downloads.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,124 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE (shortSeconds): Semi-colon list of plural +# forms. See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# s is the short form for seconds +shortSeconds=s;s + +# LOCALIZATION NOTE (shortMinutes): Semi-colon list of plural +# forms. See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# m is the short form for minutes +shortMinutes=m;m + +# LOCALIZATION NOTE (shortHours): Semi-colon list of plural +# forms. See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# h is the short form for hours +shortHours=h;h + +# LOCALIZATION NOTE (shortDays): Semi-colon list of plural +# forms. See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# d is the short form for days +shortDays=d;d + +# LOCALIZATION NOTE (paused): — is the "em dash" (long dash) +paused=ခေတ္တရပ်နားတယ် — #1 +downloading=ဆွဲချနေတယ် +notStarted=မစသေးဘူး +failed=ပျက်သွားတယ် +finished=ပြီးသွားပြီ +canceled=ပယ်ဖျက်ထားတယ် + +downloadErrorAlertTitle=ဆွဲချတဲ့ အမှား +downloadErrorGeneric=အမည်မသိ အမှားတခု​ ​ဖြစ်ပေါ်တဲ့အတွက် ဒီဆွဲချက်ချက်ကို သိမ်းဆည်းလို့ မရဘူး။\n\nထပ်ကြိုးစားပါ။ + +# LOCALIZATION NOTE: we don't have proper plural support in the CPP code; bug 463102 +quitCancelDownloadsAlertTitle=ဒေါင်းလုဒ်ဖိုင်များ အားလုံးကို ပယ်ဖျက်သလား။ +quitCancelDownloadsAlertMsg=သင် ယခု ထွက်ခွါရင်၊ ဆွဲချချက် ၁ ခု ပယ်ဖျက်သွားမယ်။ သင် တကယ် ထွက်ခွါလိုသလား။ +quitCancelDownloadsAlertMsgMultiple=သင် ယခု ထွက်ခွါရင်၊ %S ဆွဲချချက်များ ပယ်ဖျက်သွားမယ်။ သင် တကယ် ထွက်ခွါလိုသလား။ +quitCancelDownloadsAlertMsgMac=If you quit now, 1 download will be canceled. Are you sure you want to quit? +quitCancelDownloadsAlertMsgMacMultiple=သင် ယခု ထွက်သွားရင်၊ %S ဆွဲချချက်များ ပယ်ဖျက်သွားမယ်။ သင် တကယ် ထွက်သွားလိုသလား။ +offlineCancelDownloadsAlertTitle=ဆွဲချချက်များ အားလုံးကို ပယ်ဖျက်သလား။ +offlineCancelDownloadsAlertMsg=If you go offline now, 1 download will be canceled. Are you sure you want to go offline? +offlineCancelDownloadsAlertMsgMultiple=သင် ယခု ချိတ်ဆက်မဲ့ ပြောင်းသွားရင်၊ %S ဆွဲချချက်များ ပယ်ဖျက်သွားမယ်။ သင် တကယ် ချိတ်ဆက်မဲ့ ​ပြောင်းသွားလိုသလား။ +leavePrivateBrowsingCancelDownloadsAlertTitle=ဆွဲချချက်များ အားလုံးကို ပယ်ဖျက်သလား။ +leavePrivateBrowsingWindowsCancelDownloadsAlertMsg2=သင် ယခု သီးသန့်ဝင်းဒိုးအားလုံးကို ပိတ်လိုက်လျှင် ကူးယူနေသည့် လုပ်ငန်း ၁ခု ရပ်ဆိုင်းသွားမည်။. သင်သည် သီးသန့် ရှာဖွေကြည့်ရှုခြင်းမှ ထွက်ခွာရန် သေချာပါသလား။ +leavePrivateBrowsingWindowsCancelDownloadsAlertMsgMultiple2=သင် ယခု သီးသန့်ဝင်းဒိုးအားလုံးကို ပိတ်လိုက်လျှင် ကူးယူနေသည့်လုပ်ငန်းများ %S ခု ရပ်ဆိုင်းသွားမည်။. သင်သည် သီးသန့် ရှာဖွေကြည့်ရှုခြင်းမှ ထွက်ခွာရန် သေချာပါသလား။ +cancelDownloadsOKText=ဆွဲချချက် 1 ခု ပယ်ဖျက်ပါ +cancelDownloadsOKTextMultiple=ဆွဲချချက်များ %S ကို ပယ်ဖျက်ပါ +dontQuitButtonWin=ထွက်ခွါမသွားပါနဲ့ +dontQuitButtonMac=ထွက်မသွားပါနဲ့ +dontGoOfflineButton=အွန်လိုင်းမှာ နေပါ +dontLeavePrivateBrowsingButton2=သီးသန့် ရှာဖွေကြည့်ရှုခြင်းထဲတွင် နေပါ +downloadsCompleteTitle=ဆွဲချချက်များ ပြီးသွားပြီ +downloadsCompleteMsg=ဖိုင်များ အားလုံးကို ဆွဲချတာ ပြီးသွားပြီ။ + +# LOCALIZATION NOTE (infiniteRate): +# If download speed is a JavaScript Infinity value, this phrase is used +infiniteRate=တကယ်မြန်တယ်ဟ + +# LOCALIZATION NOTE (statusFormat3): — is the "em dash" (long dash) +# %1$S transfer progress; %2$S rate number; %3$S rate unit; %4$S time left +# example: 4 minutes left — 1.1 of 11.1 GB (2.2 MB/sec) +statusFormat3=%4$S — %1$S (%2$S %3$S/sec) + +# LOCALIZATION NOTE (statusFormatInfiniteRate): — is the "em dash" (long dash) +# %1$S transfer progress; %2$S substitute phrase for Infinity speed; %3$S time left +# example: 4 minutes left — 1.1 of 11.1 GB (Really fast) +statusFormatInfiniteRate=%3$S — %1$S (%2$S) + +# LOCALIZATION NOTE (statusFormatNoRate): — is the "em dash" (long dash) +# %1$S transfer progress; %2$S time left +# example: 4 minutes left — 1.1 of 11.1 GB +statusFormatNoRate=%2$S — %1$S + +bytes=ဘိုက်များ +kilobyte=KB +megabyte=MB +gigabyte=GB + +# LOCALIZATION NOTE (transferSameUnits2): +# %1$S progress number; %2$S total number; %3$S total unit +# example: 1.1 of 333 MB +transferSameUnits2=%1$S of %2$S %3$S +# LOCALIZATION NOTE (transferDiffUnits2): +# %1$S progress number; %2$S progress unit; %3$S total number; %4$S total unit +# example: 11.1 MB of 3.3 GB +transferDiffUnits2=%1$S %2$S of %3$S %4$S +# LOCALIZATION NOTE (transferNoTotal2): +# %1$S progress number; %2$S unit +# example: 111 KB +transferNoTotal2=%1$S %2$S + +# LOCALIZATION NOTE (timePair3): %1$S time number; %2$S time unit +# example: 1m; 11h +timePair3=%1$S%2$S +# LOCALIZATION NOTE (timeLeftSingle3): %1$S time left +# example: 1m left; 11h left +timeLeftSingle3=%1$S သာ ကျန်ပါတော့သည် +# LOCALIZATION NOTE (timeLeftDouble3): %1$S time left; %2$S time left sub units +# example: 11h 2m left; 1d 22h left +timeLeftDouble3=%1$S %2$S သာ ကျန်ပါတော့သည် +timeFewSeconds2=စက္ကန့်အနည်းငယ်သာ ကျန်ပါတော့သည် +timeUnknown2=မည်မျှကြာမည်ဆိုတာ မသိနိုင်ပါ + +# LOCALIZATION NOTE (doneSize): #1 size number; #2 size unit +doneSize=#1 #2 +# LOCALIZATION NOTE (doneScheme): #1 URI scheme like data: jar: about: +doneScheme2=%1$S resource +# LOCALIZATION NOTE (doneFileScheme): Special case of doneScheme for file: +# This is used as an eTLD replacement for local files, so make it lower case +doneFileScheme=စက်ထဲရှိ ဖိုင် + +# LOCALIZATION NOTE (yesterday): Displayed time for files finished yesterday +yesterday=မနေ့ +# LOCALIZATION NOTE (monthDate): #1 month name; #2 date number; e.g., January 22 +monthDate2=%1$S %2$S + +fileExecutableSecurityWarning="%S" ဟာ စီမံဆောင်ရွတ်တဲ့ ဖိုင်တခု ဖြစ်တယ်။ စီမံဆောင်ရွတ်တဲ့ ဖိုင်များမှာ သင်ကွန်ပျူတာကို ဒုက္ခပေးနိုင်တဲ့ ဗိုင်းရပ်စ် (သို့) အ​န္တရယ်ပြုတဲ့ အခြားကုဒ် ပါရှိနိုင်တယ်။ ဒီဖိုင်ကို ဖွင့်တဲ့အခါ သတိချပ်ပါ။ "%S" ဖွင့်ဖို့ သင် သေချာ သလား။ +fileExecutableSecurityWarningTitle=စီမံဆောင်ရွတ်နိုင်တဲ့ ဖိုင်ကို ဖွင့်ပါ။ +fileExecutableSecurityWarningDontAsk=ဒီဟာကို ထပ်မမေးပါနဲ့ + +# Desktop folder name for downloaded files +downloadsFolder=ဆွဲချချက်များ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/downloads/settingsChange.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/downloads/settingsChange.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/downloads/settingsChange.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/downloads/settingsChange.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,6 @@ + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/downloads/unknownContentType.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/downloads/unknownContentType.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/downloads/unknownContentType.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/downloads/unknownContentType.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,26 @@ + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/downloads/unknownContentType.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/downloads/unknownContentType.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/downloads/unknownContentType.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/downloads/unknownContentType.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,19 @@ +# -*- Mode: Java; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +title=%S ကိုဖွင့်နေတယ် +saveDialogTitle=သင် သိမ်းဆည်းလိုတဲ့ ဖိုင် အမည်ကို ရေးထည့်ပါ... +defaultApp=%S (စံထားချက်) +chooseAppFilePickerTitle=အကူအညီ လုပ်ငန်းသုံး ကိရိယာကို ရွေးချယ်ပါ +badApp=သင်ရွေးချယ်တဲ့ ("%S") လုပ်ငန်းသုံး ကိရိယာကို မတွေ့နိုင်ဘူး။ ဖိုင်အမည်ကို ရွေးချယ်ပါ (သို့) အခြား လုပ်ငန်းသုံး ကိရိယာကို ရွေးချယ်ပါ။ +badApp.title=လုပ်ငန်းသုံး ကိရိယာကို မတွေ့ဘူး +badPermissions=ဒီဖိုင်ကို သင့်မှာ သင့်လျှော်တဲ့ ခွင့်ပြုချက်များ မရှိတဲ့အတွက် သိမ်းဆည်းလို့ မရဘူး။ သိမ်းဆည်းမဲ့ တခြား ဖိုင်တွဲကို ရွေးပါ။ +badPermissions.title=မမှန်ကန်တဲ့ သိမ်းဆည်းရန် ခွင့်ပြုချက်များ +selectDownloadDir=ဆွဲချရန် ဖိုင်တွဲကို ရွေးချယ်ပါ +unknownAccept.label=ဖိုင်ကို သိမ်းဆည်းပါ +unknownCancel.label=ပယ်​ဖျက်ပါ +fileType=%S ဖိုင် +# LOCALIZATION NOTE (orderedFileSizeWithType): first %S is type, second %S is size, and third %S is unit +orderedFileSizeWithType=%1$S (%2$S %3$S) diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/about.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/about.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/about.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/about.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,9 @@ + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/blocklist.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/blocklist.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/blocklist.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/blocklist.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,17 @@ + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/extensions.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/extensions.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/extensions.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/extensions.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,251 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/extensions.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/extensions.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/extensions.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/extensions.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,184 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#LOCALIZATION NOTE (aboutWindowTitle) %S is the addon name +aboutWindowTitle=%S အကြောင်း +aboutWindowCloseButton=ပိတ်ပါ +#LOCALIZATION NOTE (aboutWindowVersionString) %S is the addon version +aboutWindowVersionString=%S မူအဆင့် +#LOCALIZATION NOTE (aboutAddon) %S is the addon name +aboutAddon=%S အကြောင်း + +#LOCALIZATION NOTE (uninstallNotice) %S is the add-on name +uninstallNotice=%S အားဖယ်ရှားပြီး + +#LOCALIZATION NOTE (numReviews): Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the number of reviews +numReviews=#1 review;#1 reviews + +#LOCALIZATION NOTE (dateUpdated) %S is the date the addon was last updated +dateUpdated=%S အားအဆင့်မြှင့်တင်ပြီး + +#LOCALIZATION NOTE (notification.incompatible) %1$S is the add-on name, %2$S is brand name, %3$S is application version +notification.incompatible=%1$S is incompatible with %2$S %3$S. +#LOCALIZATION NOTE (notification.unsigned, notification.unsignedAndDisabled) %1$S is the add-on name, %2$S is brand name +notification.unsignedAndDisabled=%2$S တွင် အသုံးပြုရန်အတွက် %1$S ကို အတည်မပြုနိုင်ပါ။ ထို့ကြောင့် ၄င်းကို ပိတ်ထားသည်။ +notification.unsigned=%2$S တွင် အသုံးပြုရန်အတွက် %1$S ကို အတည်မပြုနိုင်ပါ။ သတိထားပြီး ဆက်လက်ဆောင်ရွက်ပါ။ +notification.unsigned.link=အချက်အလက် ပိုမိုကြည့်ရန် +#LOCALIZATION NOTE (notification.blocked) %1$S is the add-on name +notification.blocked=%1$S has been disabled due to security or stability issues. +notification.blocked.link=နောက်ထပ်အချက်အလက်များ +#LOCALIZATION NOTE (notification.softblocked) %1$S is the add-on name +notification.softblocked=%1$S အား လုံခြုံရေး နှင့် တည်ငြိမ်မှူ အတွက် စိတ်မချရပါ +notification.softblocked.link=နောက်ထပ်အချက်အလက်များ +#LOCALIZATION NOTE (notification.outdated) %1$S is the add-on name +notification.outdated=အရေးကြီးသောအဆင့်မြှင့်တင်မှူတစ်ခုသည် %1$S အတွက်ရနေပြီဖြစ်သည်။ +notification.outdated.link=အဆင့်မြှင့်တင် +#LOCALIZATION NOTE (notification.vulnerableUpdatable) %1$S is the add-on name +notification.vulnerableUpdatable=%1$S သည်ဖောက်ထွင်းနိုင်သဖြင့် အဆင့်မြှင့်တင်ပါသည်။ +notification.vulnerableUpdatable.link=ယခုအဆင့်မြှင့်တင်ပါ +#LOCALIZATION NOTE (notification.vulnerableNoUpdate) %1$S is the add-on name +notification.vulnerableNoUpdate=%1$S သည်အန္တရာယ်ရှိသည်ဟုသိရသည်။ သတိနှင့်သုံးပါ ။ +notification.vulnerableNoUpdate.link=နောက်ထပ်အချက်အလက်များ +#LOCALIZATION NOTE (notification.enable) %1$S is the add-on name, %2$S is brand name +notification.enable=%1$S will be enabled after you restart %2$S. +#LOCALIZATION NOTE (notification.disable) %1$S is the add-on name, %2$S is brand name +notification.disable=%1$S အား သင် %2$S ကိုပြန်လည်စတင်ချိန်တွင်ပိတ်သိမ်းလိုက်မည်။ +#LOCALIZATION NOTE (notification.install) %1$S is the add-on name, %2$S is brand name +notification.install=%1$S အား သင် %2$S ကိုပြန်လည်စတင်ချိန်တွင်တပ်ဆင်လိုက်ပြီးဖြစ်မည်။ +#LOCALIZATION NOTE (notification.uninstall) %1$S is the add-on name, %2$S is brand name +notification.uninstall=%1$S will be uninstalled after you restart %2$S. +#LOCALIZATION NOTE (notification.upgrade) %1$S is the add-on name, %2$S is brand name +notification.upgrade=%1$S အားသင် %2$S ကိုပြန်လည်စတင်ချိန်တွင်အဆင့်မြှင့်ပြီးဖြစ်လိမ့်မည်။ +#LOCALIZATION NOTE (notification.downloadError) %1$S is the add-on name. +notification.downloadError=%1$S အားဒေါင်းလုဒ်ချရတွင်အခက်အခဲတစ်ခုရှိခဲ့သည်။ +notification.downloadError.retry=ထပ်ကြိုးစားကြည့်ပါ +notification.downloadError.retry.tooltip=ယခုအတ်အွန်အားနောက်တစ်ကြိမ်ဒေါင်းလုဒ်ချခြင်းအားထပ်ကြိုးစားကြည့်ပါ။ +#LOCALIZATION NOTE (notification.installError) %1$S is the add-on name. +notification.installError=%1$S အားတပ်ဆင်ရာတွင်အခက်အခဲတစ်ခုရှိခဲ့သည်။ +notification.installError.retry=ထပ်ကြိုးစားကြည့်ပါ။ +notification.installError.retry.tooltip=ယခုအတ်အွန်အားဒေါင်းလုဒ်ချခြင်းတပ်ဆင်ခြင်းအားထပ်မံကြိုးစားကြည့်ပါ။ +#LOCALIZATION NOTE (notification.gmpPending) %1$S is the add-on name. +notification.gmpPending=%1$S ကို အချိန်တိုအတွင်း ထည့်သွင်းတပ်ဆင်ပါမည်။ + +#LOCALIZATION NOTE (contributionAmount2) %S is the currency amount recommended for contributions +contributionAmount2=သင့်လျော်သောမျှဝေမှူ : %S + +installDownloading=ဆွဲချနေတယ် +installDownloaded=ဆွဲချပြီးသား +installDownloadFailed=ဒေါင်းလုဒ်ချရာတွင်အခက်အခဲပြသည် +installVerifying=စစ်ဆေးအတည်ပြုနေသည်။ +installInstalling=တပ်ဆင်နေသည်။ +installEnablePending=Enable လုပ်ရန် Restart လုပ်ပါ +installDisablePending=ပိတ်ထားရန်ဘယောက်ဆာအားပြန်စလိုက်ပါ။ +installFailed=တပ်ဆင်ရာတွင်အက်အခဲပြသည်။ +installCancelled=တပ်ဆင်ခြင်းအားမလုပ်တော့ပါ + +#LOCALIZATION NOTE (details.notification.incompatible) %1$S is the add-on name, %2$S is brand name, %3$S is application version +details.notification.incompatible=%1$S is incompatible with %2$S %3$S. +#LOCALIZATION NOTE (details.notification.unsigned, details.notification.unsignedAndDisabled) %1$S is the add-on name, %2$S is brand name +details.notification.unsignedAndDisabled=%2$S တွင် အသုံးပြုရန်အတွက် %1$S ကို အတည်မပြုနိုင်ပါ။ ထို့ကြောင့် ၄င်းကို ပိတ်ထားသည်။ +details.notification.unsigned=%2$S တွင် အသုံးပြုရန်အတွက် %1$S ကို အတည်မပြုနိုင်ပါ။ သတိထားပြီး ဆက်လက်ဆောင်ရွက်ပါ။ +details.notification.unsigned.link=အချက်အလက် ပိုမိုကြည့်ရန် +#LOCALIZATION NOTE (details.notification.blocked) %1$S is the add-on name +details.notification.blocked=%1$S has been disabled due to security or stability issues. +details.notification.blocked.link=နောက်ထပ်အချက်အလက်များ +#LOCALIZATION NOTE (details.notification.softblocked) %1$S is the add-on name +details.notification.softblocked=%1$S is known to cause security or stability issues. +details.notification.softblocked.link=နောက်ထပ်အချက်အလက်များ +#LOCALIZATION NOTE (details.notification.outdated) %1$S is the add-on name +details.notification.outdated=အရေးကြီးသောအဆင့်မြှင့်တင်မှူတစ်ခုသည် %1$S အတွက်ရနေပြီဖြစ်သည်။ +details.notification.outdated.link=ယခုအဆင့်မြှင့်တင်ပါ +#LOCALIZATION NOTE (details.notification.vulnerableUpdatable) %1$S is the add-on name +details.notification.vulnerableUpdatable=%1$S is known to be vulnerable and should be updated. +details.notification.vulnerableUpdatable.link=ယခုအဆင့်မြှင့်တင်ပါ +#LOCALIZATION NOTE (details.notification.vulnerableNoUpdate) %1$S is the add-on name +details.notification.vulnerableNoUpdate=%1$S သည်မလုံခြုံသဖြင့် သတိနှင့်သုံးစေချင်ပါသည်။ +details.notification.vulnerableNoUpdate.link=နောက်ထပ် အချက်အလက် +#LOCALIZATION NOTE (details.notification.enable) %1$S is the add-on name, %2$S is brand name +details.notification.enable=%1$S အား သင် %2$S ကိုပြန်လည်စတင်ချိန်တွင်အသက်သွင်းလိုက်မည်။ +#LOCALIZATION NOTE (details.notification.disable) %1$S is the add-on name, %2$S is brand name +details.notification.disable=%1$S အား သင် %2$S ကိုပြန်လည်စတင်ချိန်တွင်ပိတ်သိမ်းလိုက်မည်။ +#LOCALIZATION NOTE (details.notification.install) %1$S is the add-on name, %2$S is brand name +details.notification.install=%1$S အား သင် %2$S ကိုပြန်လည်စတင်ချိန်တွင်တပ်ဆင်လိုက်ပြီးဖြစ်မည်။ +#LOCALIZATION NOTE (details.notification.uninstall) %1$S is the add-on name, %2$S is brand name +details.notification.uninstall=%1$S will be uninstalled after you restart %2$S. +#LOCALIZATION NOTE (details.notification.upgrade) %1$S is the add-on name, %2$S is brand name +details.notification.upgrade=%1$S အားသင် %2$S ကိုပြန်လည်စတင်ချိန်တွင်အဆင့်မြှင့်ပြီးဖြစ်လိမ့်မည်။ +#LOCALIZATION NOTE (details.notification.gmpPending) %1$S is the add-on name +details.notification.gmpPending=%1$S ကို အချိန်တိုအတွင်း ထည့်သွင်းတပ်ဆင်ပါမည်။ + +# LOCALIZATION NOTE (details.experiment.time.daysRemaining): +# Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the number of days from now that the experiment will remain active (detail view). +details.experiment.time.daysRemaining=#1 ရက် ကျန်;#1 ရက် ကျန် +#LOCALIZATION NOTE (details.experiment.time.endsToday) The experiment will end in less than a day (detail view). +details.experiment.time.endsToday=တစ်ရက်တောင်မကျန်တော့ပါဘူး +# LOCALIZATION NOTE (details.experiment.time.daysPassed): +# Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the number of days since the experiment ran (detail view). +details.experiment.time.daysPassed=#1 day ago;#1 days ago +#LOCALIZATION NOTE (details.experiment.time.endedToday) The experiment ended less than a day ago (detail view). +details.experiment.time.endedToday=လွန်ခဲ့တဲ့ တစ်ရက်အတွင်းက +#LOCALIZATION NOTE (details.experiment.state.active) This experiment is active (detail view). +details.experiment.state.active=ဖွင့်ထား +#LOCALIZATION NOTE (details.experiment.state.complete) This experiment is complete (it was previously active) (detail view). +details.experiment.state.complete=လုပ်ဆောင်ပြီး + +# LOCALIZATION NOTE (experiment.time.daysRemaining): +# Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the number of days from now that the experiment will remain active (list view item). +experiment.time.daysRemaining=#1 day remaining;#1 days remaining +#LOCALIZATION NOTE (experiment.time.endsToday) The experiment will end in less than a day (list view item). +experiment.time.endsToday=တစ်ရက်တောင် မလို်တော့ပါ +# LOCALIZATION NOTE (experiment.time.daysPassed): +# Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the number of days since the experiment ran (list view item). +experiment.time.daysPassed=#1 day ago;#1 days ago +#LOCALIZATION NOTE (experiment.time.endedToday) The experiment ended less than a day ago (list view item). +experiment.time.endedToday=လွန်ခဲ့တဲ့ တစ်ရက်အတွင်းက +#LOCALIZATION NOTE (experiment.state.active) This experiment is active (list view item). +experiment.state.active=သုံး +#LOCALIZATION NOTE (experiment.state.complete) This experiment is complete (it was previously active) (list view item). +experiment.state.complete=လုပ်ဆောင်ပြီး + +installFromFile.dialogTitle=တပ်ဆင်ရန်အတ်အွန်အားရွေးချယ်ပါ။ +installFromFile.filterName=ပေါင်းထည့် ဆော့ဗ်ဝဲများ + +uninstallAddonTooltip=ဤအတ်အွန်အားဖြုတ်ပါ။ +uninstallAddonRestartRequiredTooltip=ဤအတ်အွန်အားဖြုတ်ပါ( ပြန်လည်စတင်ခြင်းလိုအပ်မည်) +enableAddonTooltip=ဤအတ်အွန်အားအသုံးပြုထားမည်။ +enableAddonRestartRequiredTooltip=ဤအတ်အွန်အားသုံးမည်(ပြန်စသုံးသည့်အချိန်တွင်) +disableAddonTooltip=ဤအတ်အွန်အားပြန်ဖြုတ်မည်။ +disableAddonRestartRequiredTooltip=ဤအတ်အွန်အားဖြုတ်မည်(ပြန်စသုံးသည့်အချိန်တွင်) + +#LOCALIZATION NOTE (showAllSearchResults): Semicolon-separated list of plural forms. +# See: http://developer.mozilla.org/en/docs/Localization_and_Plurals +# #1 is the total number of search results +showAllSearchResults=See one result;See all #1 results + +#LOCALIZATION NOTE (addon.purchase.label) displayed on a button in the list +# view, %S is the price of the add-on including currency symbol +addon.purchase.label=%S အတွက်ဝယ်… +addon.purchase.tooltip=အတ်အွန် ပြခန်းသို့သွားပြီ ဤ အတ်အွန်အား ငွေပေးချေပါ +#LOCALIZATION NOTE (cmd.purchaseAddon.label) displayed on a button in the detail +# view, %S is the price of the add-on including currency symbol +cmd.purchaseAddon.label=%S အား ဝယ်ပေးမည်… +cmd.purchaseAddon.accesskey=u + +#LOCALIZATION NOTE (eulaHeader) %S is name of the add-on asking the user to agree to the EULA +eulaHeader=%S သည်သင်မတပ်ဆင်ခင် အောက်ပါသုံးဆွဲသူလိုက်နာရန်စည်းမျဉ်းများအား လက်ခံရန်မေးနေပါသည်: + +type.extension.name=တိုးချဲ့ချက်များ +type.theme.name=ပုံပန်းသဏ္ဍာန် +type.locale.name=ဘာသာ စကားများ +type.plugin.name=ပလပ်အင် +type.dictionary.name=အဘိဓာန်များ +type.service.name=၀န်ဆောင်မှုများ +type.experiment.name=စမ်းသပ်ချက်များ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/newaddon.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/newaddon.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/newaddon.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/newaddon.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,13 @@ + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/newaddon.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/newaddon.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/newaddon.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/newaddon.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,10 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#LOCALIZATION NOTE (name) %1$S is the add-on name, %2$S is the add-on version +name=%1$S %2$S +#LOCALIZATION NOTE (author) %S is the author of the add-on +author=%S အားဖြင့် +#LOCALIZATION NOTE (location) %S is the path the add-on is installed in +location=တည်နေရာ- %S diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/update.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/update.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/update.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/update.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,52 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/update.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/update.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/update.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/update.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,21 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +mismatchCheckNow=ယခု စစ်ဆေးပါ +mismatchCheckNowAccesskey=C +mismatchDontCheck=မစစ်ဆေးပါနဲ့ +mismatchDontCheckAccesskey=D +installButtonText=ယခု တပ်ဆင်ပါ +installButtonTextAccesskey=I +nextButtonText=နောက်တခု> +nextButtonTextAccesskey=N +cancelButtonText=ပယ်​ဖျက်ပါ +cancelButtonTextAccesskey=C +statusPrefix=%S ကို စစ်ဆေးမှု ပြီးဆုံးပြီ +downloadingPrefix=%S - ဆွဲချနေတယ် +installingPrefix=%S တပ်ဆင်နေတယ် +closeButton=ပိတ်ပါ +installErrors=အောက်ပါ ပေါင်းထည့်ချက်များအတွက် မွမ်းမံချက်များကို %S က မတပ်ဆင်နိုင်ဘူး - +checkingErrors=အောက်ပါ ပေါင်းထည့်ချက်များအတါက် မွမ်းမံချက်များကို %S က မ​စစ်ဆေးနိုင်ဘူး - +installErrorItemFormat=%S (%S) diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/xpinstallConfirm.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/xpinstallConfirm.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/xpinstallConfirm.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/xpinstallConfirm.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,13 @@ + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/xpinstallConfirm.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/xpinstallConfirm.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/extensions/xpinstallConfirm.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/extensions/xpinstallConfirm.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,11 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +unverified=(အတည်ပြုမထားတဲ့ ရေးသားသူ) +signed=(%S) + +itemWarnIntroMultiple=အောက်ပါ %S အချက်များကို တပ်ဆင်ဖို့ သင်တောင်းဆိုထားတယ် - +itemWarnIntroSingle=အောက်ပါ အချက်များကို တပ်ဆင်ဖို့ သင်တောင်းဆိုထားတယ် - +installButtonDisabledLabel=(%S) ကို တပ်ဆင်ပါ +installButtonLabel=ယခု တပ်ဆင်ပါ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/handling/handling.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/handling/handling.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/handling/handling.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/handling/handling.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,10 @@ + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/handling/handling.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/handling/handling.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/handling/handling.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/handling/handling.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,12 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +protocol.title=လုပ်ငန်းသုံးကိရိယာကို စဖွင့်ပါ +protocol.description=ဒီအချိတ်အဆက်ကို လုပ်ငန်းသုံးကိရိယာတခုနဲ့ ဖွင့်ဖို့ လိုအပ်တယ်။ +protocol.choices.label=ပေးပို့ရန် နေရာ - +protocol.checkbox.label=%S အတွက်ရွေးချယ်ချက်ကို မှတ်ထားပေးပါ +protocol.checkbox.accesskey=R +protocol.checkbox.extra=%Sရဲ့ ဦးစားပေးချက်များမှာ ဒီကို ပြင်ဆင်နိုင်တယ်။ + +choose.application.title=တခြား လုပ်ငန်းသုံးကိရိယာ... diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/preferences/changemp.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/preferences/changemp.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/preferences/changemp.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/preferences/changemp.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,13 @@ + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/preferences/preferences.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/preferences/preferences.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/preferences/preferences.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/preferences/preferences.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,17 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +#### Master Password + +password_not_set=(ချမှတ်မထားဘူး) +failed_pw_change=ပင်မ စကားဝှက်ကို ​မပြောင်းလဲနိုင်ဘူး။ +incorrect_pw=မှန်ကန်တဲ့ လက်ရှိ ပင်မ စာဝှက်စနစ်ကို သင် ရေးထည့်မထားဘူး။ ထပ်ကြိုးစားပါ။ +pw_change_ok=ပင်မ စကားဝှက်ကို အောင်မြင်စွာ ပြောင်းလဲထားပြီ။ +pw_erased_ok=သင့်ရဲ့ ပင်ရင်း စကားဝှက်ကို သင်ပယ်ဖျက်လိုက်ပြီ။ +pw_not_wanted=သတိပေးချက်။ ပင်မ စကားဝှက်ကို မသုံးစွဲဖို့ သင် ဆုံးဖြတ်လိုက်ပြီ။ +pw_empty_warning=သင်သိုထားတဲ့ ကွန်ရက်နဲ့ အီးမေးလ် စကားဝှက်များ၊ ဖြည့်စွက်ပုံစံ အချက်အလက်ကြမ်းနဲ့၊ သီးသန့် သော့ချက်များကို ကာကွယ်မှာ မဟုတ်ဘူး။ +pw_change2empty_in_fips_mode=လတ်တလော FIPS အသွင်အတွင်း ရှိသည်။ FIPSသည် ‌ဗလာမဖြစ်သော ပင်မစကားဝှက်တစ်ခု လိုအပ်နေသည်။ +pw_change_success_title=စကားဝှက် ပြောင်းတာ အောင်မြင်သွားပြီ +pw_change_failed_title=စကားဝှက် ပြောင်းလဲတာ မအောင်မြင်ဘူး +pw_remove_button=ဖယ်ရှားပါ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/preferences/removemp.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/preferences/removemp.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/preferences/removemp.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/preferences/removemp.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,10 @@ + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/profile/createProfileWizard.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/profile/createProfileWizard.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/profile/createProfileWizard.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/profile/createProfileWizard.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,25 @@ + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/profile/profileSelection.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/profile/profileSelection.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/profile/profileSelection.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/profile/profileSelection.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,31 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/profile/profileSelection.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/profile/profileSelection.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/profile/profileSelection.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/profile/profileSelection.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,51 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE: These strings are used for startup/profile problems and the profile manager. + +# Application not responding +# LOCALIZATION NOTE (restartTitle, restartMessageNoUnlocker, restartMessageUnlocker, restartMessageNoUnlockerMac, restartMessageUnlockerMac): Messages displayed when the application is running but is not responding to commands. %S is the application name. +restartTitle=%S ကို ပိတ်ပါ +restartMessageNoUnlocker=%S ဟာ လည်ပတ်နေပြီ၊ ဒါပေမဲ့ တုန့်ပြန်မှု မပေးဘူး။ ဝင်းဒိုးသစ်ကို ဖွင့်ဖို့၊ တည်ရှိနေတဲ့ %S လုပ်ငန်းစဉ်ကို သင်အရင်ဆုံး ပိတ်ထား သို့ သင့်ရဲ့ စက်ကို ပြန်ဖွင့်ရမယ်။ +restartMessageUnlocker=%S ဟာ လည်ပတ်နေပြီ၊ ဒါပေမဲ့ တုံ့ပြန်မှု မပေးဘူး။ ၀င်းဒိုးသစ်ကို ဖွင့်ဖို့ %S လုပ်ငန်းစဉ် အဟောင်းကို ပိတ်ထားရမယ်။ +restartMessageNoUnlockerMac=%S မိတ္တူးတခုကို ဖွင့်ထားပြီ။ တချိန်ထဲမှာ %S မိတ္တူတခုကိုပဲ ဖွင့်နိုင်တယ်။ +restartMessageUnlockerMac=%S မိတ္တူးတခုကို ဖွင့်ထားပြီ။ ဒီတခုကို ဖွင့်ဖို့ရန် လည်ပတ်နေတဲ့ %S မိတ္တူ ပိတ်သွားမယ်။ + +# Profile manager +# LOCALIZATION NOTE (profileTooltip): First %S is the profile name, second %S is the path to the profile folder. +profileTooltip=ကိုယ်ရေးမှတ်တမ်း၊ '%S' - လမ်းကြောင်း၊ '%S' + +pleaseSelectTitle=ရွေးပိုင်သုံးစွဲမှု ရွေးချယ်ပါ +pleaseSelect=%S ကို စတင်ဖို့ ကိုယ်ရေးမှတ်တမ်း တခုကို ရွေးချယ်ပါ၊ (သို့) ကိုယ်ရေးမှတ်တမ်းသစ် တခုကို ဖန်တီးပါ။ + +profileLockedTitle=သုံးစွဲနေတဲ့ ကိုယ်ရေးမှတ်တမ်း +profileLocked2=%S က "%S" ကို သုံးစွဲနေတဲ့အတွက် ကိုယ်​ရေးမှတ်တမ်းကို မသုံးစွဲနိုင်ဘူး။\n\nဆက်လုပ်ဖို့၊ လည်ပတ်နေတဲ့ %S ဖြစ်စဉ်ကို ပိတ်ပါ (သို့) ခြားနားတဲ့ ကိုယ်ရေးမှတ်တမ်း တခုကို ရွေးပါ + +renameProfileTitle=ကိုယ်ရေးမှတ်တမ်းကို အမည်ပြောင်းပါ +renameProfilePrompt=ပရိုဖိုင် "%S" အားနာမည်ပြောင်း : + +profileNameInvalidTitle=မမှန်ကန်တဲ့ ကိုယ်ရေးမှတ်တမ်း အမည် +profileNameInvalid=ပရိုဖိုင်နာမည်အား "%S" ဖြင့် ခွင့်မပြုဘူး။ + +chooseFolder=ဖိုင်တွဲ ကိုယ်ရေးမှတ်တမ်းကို ရွေးပါ +profileNameEmpty=ဗလာ ကိုယ်ရေးမှတ်တမ်း အမည်တခုကို ခွင့်မပြုဘူး။ +invalidChar=အက္ခရာ "%S" ကို ကိုယ်ရေးမှတ်တမ်း အမည်များမှာ ခွင့်မပြုဘူး။ ခြားနားတဲ့ အမည်တခုကို ရွေးပါ။ + +deleteTitle=ကိုယ်ရေးမှတ်တမ်းကို ပယ်ဖျက်ပါ +deleteProfileConfirm=ကိုယ်ရေးမှတ်တမ်း တခု ပယ်ဖျက်ခြင်းက ရနိုင်တဲ့ ကိုယ်ရေးမှတ်တမ်းများ စာရင်းထဲမှ ကိုယ်ရေးမှတ်တမ်းများကို ဖယ်ရှားမှာ ဖြစ်ပြီး၊ ၄င်းကို ပြန်ဖြည်လို့ မရနိုင်ဘူး။\nသင့်ရဲ့ အပြင်အဆင်များ၊ လက်မှတ်များနဲ့ အခြား သုံးစွဲသူ အချက်အလက်ကြမ်း အပါအ၀င် ကိုယ်ရေးမှတ်တမ်း အချက်အလက်ကြမ်း ဖိုင်များကိုလည်း ပယ်ဖျက်ဖို့ သင်ရွေးချယ်နိုင်သေးတယ်။ ဒီရွေးစရာက "%S" ဖိုင်တွဲကို ပယ်ဖျက်ပေးမှာ ဖြစ်ပြီး ပြန်ဖြည်လို့ မရနိုင်ဘူး။\n +deleteFiles=ဖိုင်များကို ပယ်ဖျက်ပါ +dontDeleteFiles=ဖိုင်များကို မပယ်ဖျက်ပါနဲ့ + +profileCreationFailed=ကိုယ်ရေးမှတ်တမ်းကို ဖန်တီးလို့ မရနိုင်ဘူး။ ရွေးထားတဲ့ ဖိုင်တွဲဟာ ရေးလို့ မရနိုင်တာကြောင့် ဖြစ်နိုင်တယ်။ +profileCreationFailedTitle=ကိုယ်ရေးမှတ်တမ်း ဖန်တီးမှု ပျက်သွားတယ် +profileExists=ဒီအမည်နဲ့ ကိုယ်ရေးမှတ်တမ်း တခု တည်ရှိနေပြီ။ တခြားအမည်ကို ရွေးချယ်ပါ။ +profileExistsTitle=ကိုယ်ရေးမှတ်တမ်း တည်ရှိတယ် +profileFinishText=ဒီကိုယ်ရေးမှတ်တမ်း အသစ်ကို ဖန်တီးဖို့ ပြီးပြီ ကို နှိုပ်ပါ။ +profileFinishTextMac=ဒီကိုယ်ရေးမှတ်တမ်း အသစ်ကို ဖန်တီးဖို့ ပြီးသွားပြီ ကို နှိုပ်ပါ။ +profileMissing=သင့်ရဲ့ %S ပရိုဖိုင် ကို ဆွဲတင်လို့မရပါ။ ပရိုဖိုင် ပျောက်ဆုံးနေတာသော်လည်းကောင်း အသုံးပြုခွင့်မရတာသော်လည်းကောင်း ဖြစ်နိုင်ပါတယ်။ +profileMissingTitle=ပရိုဖိုင် ပျောက်ဆုံးနေပါတယ် + +# Profile reset +# LOCALIZATION NOTE (resetBackupDirectory): Directory name for the profile directory backup created during reset. This directory is placed in a location users will see it (ie. their desktop). %S is the application name. +resetBackupDirectory=%S ဒေတာ အဟောင်း diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/update/history.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/update/history.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/update/history.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/update/history.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/update/updates.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/update/updates.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/update/updates.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/update/updates.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,56 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/update/updates.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/update/updates.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/mozapps/update/updates.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/mozapps/update/updates.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,95 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +# LOCALIZATION NOTE: The 1st %S is the update name and the 2nd %S is the build +# identifier from the local updates.xml for displaying update history +# example: MyApplication (20081022033543) +updateFullName=%S (%S) + +# LOCALIZATION NOTE: The 1st %S is brandShortName and 2nd %S is update version +# where update version from the update xml +# example: MyApplication 10.0.5 +updateName=%S %S + +# LOCALIZATION NOTE: When present +# %1$S is the brandShortName. Ex: MyApplication +# %2$S is the update version - provided by the update xml. Ex: version 10.0.5 +# %3$S is the build identifier - provided by the update xml. Ex: 20081022033543 +updateNightlyName=%1$S %2$S %3$S nightly +intro_major=ယခု %1$S %2$S ကို ပြုပြင်ပြောင်းလဲလိုပါသလား +intro_minor=%1$S အတွက် လုံခြုံမှုနဲ့ တည်ငြိမ်မှု အပ်ဒိပ်တစ်ခု ရနိုင်ပါပြီ -\u0020 + +updateType_major=မူအဆင့် အသစ် +updateType_minor=လုံခြုံရေး မွမ်းမံချက် + +# LOCALIZATION NOTE: When present %S is brandShortName +verificationError=%S ဟာ မွမ်းမံချက် ထုတ်ကုန်ပစ္စည်းရဲ့ ခိုင်မြဲမှုကို အတည်မပြုနိုင်ဘူး။ +resumePausedAfterCloseTitle=ဆော့ဗ်ဝဲ မွမ်းမံချက် +resumePausedAfterCloseMsg=ဒီမွမ်းမံချက် ဆွဲချနေတာကို သင် ရပ်တန့်လိုက်တယ်။ %S ကို သင် ဆက်လက် သုံးစွဲနေစဉ် နောက်ခံမှာ မွမ်းမံချက်ကို ဆွဲချလိုသလား။ +updaterIOErrorTitle=ဆော့ဗ်ဝဲ မွမ်းမံချက် မအောင်မြင်ဘူး +updaterIOErrorMsg=မွမ်းမံချက်ကို တပ်ဆင်လို့ မရနိုင်ဘူး။ အခြား %S မွမ်းမံချက်များ သင့်ကွန်ပျူတာထဲမှာ မရှိဖို့ သေချာစေပြီး၊ %S ထပ်ကြိုးစားဖို့ ပြန်ဖွင့်လိုက်ပါ။ +okButton=ကောင်းပြီ +okButton.accesskey=O +askLaterButton=နောက်တခါမှ မေးပါ +askLaterButton.accesskey=A +noThanksButton=မလိုဘူး၊ ကျေးဇူးတင်ပါတယ် +noThanksButton.accesskey=N +updateButton_minor=မွမ်းမံချက် %S +updateButton_minor.accesskey=S +updateButton_major=မူအဆင့် အသစ် ရယူပါ +updateButton_major.accesskey=G +backButton=နောက်သို့ +backButton.accesskey=B +acceptTermsButton=စကားရပ်များကို လက်ခံပါ +acceptTermsButton.accesskey=A +# NOTE: The restartLaterButton string is also used in +# mozapps/extensions/content/blocklist.js +restartLaterButton=နောက်မှ ပြန်ဖွင့်ပါ +restartLaterButton.accesskey=L +restartNowButton=%S ပြန်ဖွင့်ပါ +restartNowButton.accesskey=S + +# LOCALIZATION NOTE: %S is the date the update was installed from the local +# updates.xml for displaying update history +statusSucceededFormat=တပ်ဆင်တဲ့နရာ - %S + +statusFailed=တပ်ဆင်မှု မအောင်မြင်ဘူး +pauseButtonPause=ခေတ္တရပ်တန့်တယ် +pauseButtonResume=ပြန်စပါ +hideButton=ဖျောက်ထားပါ +hideButton.accesskey=H + +applyingUpdate=အပ်ဒိတ် လုပ်နေပါတယ် + +updatesfound_minor.title=မွမ်းမံချက် ရနိုင်တယ် +updatesfound_major.title=မွမ်းမံချက်အသစ် ရနိုင်တယ် + +installSuccess=မွမ်းမံချက်ကို အောင်မြင်စွာ တပ်ဆင်ထားတယ် +installPending=တပ်ဆင်မှု ဆိုင်းငံ့နေတယ် +patchApplyFailure=မွမ်းမံချက်ကို မတပ်ဆင်နိုင်ဘူး (ပြင်ဆင်ပြုပြင်မှု အသုံးချတာ မအောင်မြင်ဘူး) +elevationFailure=ဒီမွမ်းမံချက်ကို ထည့်သွင်းရန် လိုအပ်သော လုပ်ပိုင်ခွင့် သင့်မှာ မရှိပါ။ ကျေးဇူးပြု၍ စနစ်အုပ်ချုပ်ရေးမှုးနှင့် ဆက်သွယ်ပါ။ + +# LOCALIZATION NOTE: %S is the amount downloaded so far +# example: Paused — 879 KB of 2.1 MB +downloadPausedStatus=ရပ်နားထားပါ — %S + +check_error-200=ပုံပျက်တဲ့ XML ဖိုင်ကို မွမ်းမံပါ ( 200 ) +check_error-403=၀င်ရောက်မှု ငြင်းပယ်ထားတယ် ( 403 ) +check_error-404=မွမ်းမံထားတဲ့ XML ဖိုင်ကို မတွေ့ရဘူး ( 404 ) +check_error-500=ဆာဗာအတွင်းပိုင်း အမှား ( 500 ) +check_error-2152398849=ပျက်သွားတယ် (အမည်မသိတဲ့ အကြောင်းရင်း) +check_error-2152398861=ချိတ်ဆက်မှု ငြင်းပယ်ထားတယ် +check_error-2152398862=ချိတ်ဆက်မှု အချိန်ကုန်သွားတယ် +# NS_ERROR_OFFLINE +check_error-2152398864=ကွန်ရက်ချိတ်ဆက်မှုဟာ ချိတ်ဆက်မဲ့ ဖြစ်သွားတယ် (အိုင်လိုင်းသွားပါ) +check_error-2152398867=အခံကို ခွင့်မပြုဘူး +check_error-2152398868=အချက်အလက်ကြမ်းကို မရရှိဘူး (ထပ်ကြိုးစားပါ) +check_error-2152398878=မွမ်းမံတဲ့ ဆာဗာကို မတွေ့ရဘူး (သင့်ရဲ့ အင်တာနက် ချိတ်ဆက်မှုကို စစ်ဆေးပါ) +check_error-2152398890=ကြားခံ ဆာဗာကို မတွေ့ရဘူး (သင့်ရဲ့ အင်တာနက် ချိတ်ဆက်မှုကို စစ်ဆေးပါ) +# NS_ERROR_DOCUMENT_NOT_CACHED +check_error-2152398918=ကွန်ရက်ချိတ်ဆက်မှုဟာ ချိတ်ဆက်မဲ့ ဖြစ်သွားတယ် (အိုင်လိုင်းသွားပါ) +check_error-2152398919=အချက်အလက်ကြမ်း လွှဲပြောင်းမှုကို ဟန့်တားခံရတယ် (ထပ်ကြိုးစားပါ) +check_error-2152398920=ကြားခံ ဆာဗာ ချိတ်ဆက်မှု ငြင်းပယ်ခံရတယ် +check_error-2153390069=ဆာဗာ လက်မှတ်ဟာ သက်တမ်းကုန်သွားပြီ (သင့်စက်ရဲ့ လက်ရှိ နေ့စွဲနဲ့ အချိန်ကို မှန်ကန်မှု မရှိရင် ညှိလိုက်ပါ) +check_error-verification_failed=မွမ်းမံချက်ရဲ့ ခိုင်မြဲမှုကို အတည်မပြုနိုင်ဘူး diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/passwordmgr/passwordManager.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/passwordmgr/passwordManager.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/passwordmgr/passwordManager.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/passwordmgr/passwordManager.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,44 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/passwordmgr/passwordmgr.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/passwordmgr/passwordmgr.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/passwordmgr/passwordmgr.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/passwordmgr/passwordmgr.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,89 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +rememberValue = ဒီတန်ဖိုးကို မှတ်ထားဖို့ စကားဝှက် စီမံခန့်ခွဲ ကိရိယာကို သုံးစွဲပါ။ +rememberPassword = ဒီစကားဝှက်ကို မှတ်ထားဖို့ စကားဝှက် စီမံခန့်ခွဲ ကိရိယာကို သုံးစွဲပါ။ +savePasswordTitle = အတည်ပြုပါ +# LOCALIZATION NOTE (saveLoginMsg, saveLoginMsgNoUser): +# %1$S is brandShortName, %2$S is the login's hostname. +saveLoginMsg = %1$S အား %2$S သို့ အဝင်အား မှတ်ထားမလား ? +saveLoginMsgNoUser = %1$S အား %2$S အတွက် စကားဝှက်အား မှတ်ထားစေမလား ? +saveLoginButtonAllow.label = သိမ်း +saveLoginButtonAllow.accesskey = S +saveLoginButtonDeny.label = မသိမ်းပါ +saveLoginButtonDeny.accesskey = D +updateLoginMsg = သင် ဒီဝင်ရောက်မှုအချက်အလက်ကို ပြောင်းလဲမှတ်သားလိုပါသလား။ +updateLoginMsgNoUser = သင် ဒီစကားဝှက်ကို ပြောင်းလဲမှတ်သားလိုပါသလား။ +updateLoginButtonText = မွမ်းမံချက် +updateLoginButtonAccessKey = U +updateLoginButtonDeny.label = အဆင့်မမြှင့်ပါ နှင့် +updateLoginButtonDeny.accesskey = D +# LOCALIZATION NOTE (rememberPasswordMsg): +# 1st string is the username for the login, 2nd is the login's hostname. +# Note that long usernames may be truncated. +rememberPasswordMsg = "%1$S" အတွက် စကားဝှက်ကို %2$S ပေါ်မှာ မှတ်ထားလိုပါသလား။ +# LOCALIZATION NOTE (rememberPasswordMsgNoUsername): +# String is the login's hostname. +rememberPasswordMsgNoUsername = သင့်၏ လျှိုက်၀က်နံပါတ်အား မှတ်မိထားလိုပါသလား %S? +# LOCALIZATION NOTE (noUsernamePlaceholder): +# This is displayed in place of the username when it is missing. +noUsernamePlaceholder=အသုံးပြုသူအမည် မပေးထားပါ +togglePasswordLabel=စကားဝှက်များကို ဖေါ်ပြပါ +togglePasswordAccessKey2=h +notNowButtonText = ယခု မဟုတ်သေးဘူး +notifyBarNotNowButtonText = ယခု မဟုတ်သေးဘူး +notifyBarNotNowButtonAccessKey = N +neverForSiteButtonText = ဒီကွန်ရက်တွက် လုံး၀ မလုပ်ပါ +notifyBarNeverRememberButtonText2 = ဘယ်တော့မှ မသိမ်းပါနှင့် +notifyBarNeverRememberButtonAccessKey2 = e +rememberButtonText = မှတ်ထားပါ +notifyBarRememberPasswordButtonText = လျှို့၀က်စကားလုံးအားမှတ်ထားပါ။ +notifyBarRememberPasswordButtonAccessKey = R +passwordChangeTitle = စကားဝှက် ပြင်ဆင်ချက်ကို အတည်ပြုပါ +# LOCALIZATION NOTE (updatePasswordMsg): +# String is the username for the login. +updatePasswordMsg = "%S" အတွက် သိမ်းထားတဲ့ စကားဝှက်ကို အပ်ဒိတ် လုပ်လိုပါသလား။ +updatePasswordMsgNoUser = သိမ်းထားတဲ့ စကားဝှက်ကို အပ်ဒိတ် လုပ်လိုပါသလား။ +notifyBarUpdateButtonText = လျှို့ဝှက်စကားလုံးအားအသစ်ပြင်မည် +notifyBarUpdateButtonAccessKey = U +notifyBarDontChangeButtonText = မပြင်ဆင်ပါနဲ့ +notifyBarDontChangeButtonAccessKey = D +userSelectText = ဘယ် သုံးစွဲသူရဲ့ စကားဝှက် သင်ပြောင်းလဲ​နေတာကို အတည်ပြုပါ +hidePasswords=စကားဝှက်များကို ဖျောက်ထားပါ +hidePasswordsAccessKey=P +showPasswords=စကားဝှက်များကို ဖေါ်ပြပါ +showPasswordsAccessKey=P +noMasterPasswordPrompt=သင့်ရဲ့ စကားဝှက်များကို ဖေါ်ပြဖို့ သင်တကယ် ဆန္ဒရှိသလား။ +removeAllPasswordsPrompt=စကားဝှက်များ အားလုံးကို ဖေါ်ပြဖို့ သင်တကယ် ဆန္ဒရှိသလား။ +removeAllPasswordsTitle=စကားဝှက်များ အားလုံးကို ဖယ်ရှားပါ +removeLoginPrompt=သင် ဒီဝင်ရောက်မှုအချက်အလက်ကို ဖျက်ရန် သေချာပါသလား။ +removeLoginTitle=ဝင်ရောက်မှုအချက်အလက်ကို ဖျက်ရန် +loginsDescriptionAll=အောက်ပါဆိုက်များအတွက် ဝင်ရောက်မှု အချက်အလက်များကို သင့်ကွန်ပျူတာထဲတွင် သိမ်းထားသည်။: +loginsDescriptionFiltered=အောက်ပါဝင်ရောက်မှု အချက်အလက်များသည် သင့်ရှာဖွေမှုနှင့် ကိုက်ညီသည်။: +# LOCALIZATION NOTE (loginHostAge): +# This is used to show the context menu login items with their age. +# 1st string is the username for the login, 2nd is the login's age. +loginHostAge=%1$S (%2$S) +# LOCALIZATION NOTE (noUsername): +# String is used on the context menu when a login doesn't have a username. +noUsername=အသုံးပြုသူအမည် မပေးထားပါ +duplicateLoginTitle=ဝင်ရောက်မှုအချက်အလက် ရှိပြီးသား ဖြစ်နေသည် +duplicateLogin=ပုံစံတူ ဝင်ရောက်မှုအချက်အလက် ရှိပြီးသား ဖြစ်နေသည်။ + +# LOCALIZATION NOTE (insecureFieldWarningDescription2, insecureFieldWarningDescription3): +# %1$S will contain insecureFieldWarningLearnMore and look like a link to indicate that clicking will open a tab with support information. +insecureFieldWarningDescription2 = ယခုချိတ်ဆက်မှုသည် လုံခြုံမှုမရှိပါ။ ယခုနေရာတွင် ဝင်ရောက်သည့် မှတ်တမ်းများသည် ထိခိုက်ခံရနိုင်ဖွယ် ရှိနိုင်သည်။ %1$S +insecureFieldWarningDescription3 = ယခုနေရာတွင် ဝင်ရောက်သည့်မှတ်တမ်းများသည် ထိခိုက်ခံရနိုင်ဖွယ် ရှိနိုင်သည်။ %1$S +insecureFieldWarningLearnMore = ပိုမိုလေ့လာရန် + +# LOCALIZATION NOTE (removeAll, removeAllShown): +# removeAll and removeAllShown are both used on the same one button, +# never displayed together and can share the same accesskey. +# When only partial sites are shown as a result of keyword search, +# removeAllShown is displayed as button label. +# removeAll is displayed when no keyword search and all sites are shown. +removeAll.label=အားလုံးကိုဖယ်ပါ +removeAll.accesskey=A +removeAllShown.label=ပြထားသမျှ ဖျက်ပါ +removeAllShown.accesskey=A diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/places/places.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/places/places.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/places/places.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/places/places.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,29 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +BookmarksMenuFolderTitle=မှတ်သားချက်များ စာရင်း +BookmarksToolbarFolderTitle=မှတ်သားချက်များ ခလုတ်တန်း +OtherBookmarksFolderTitle=အခြား စာမှတ်များ +TagsFolderTitle=စာအမှတ်များ +MobileBookmarksFolderTitle=မိုဘိုင်းမှ စာအမှတ်များ + +# LOCALIZATION NOTE (dateName): +# These are used to generate history containers when history is grouped by date +finduri-AgeInDays-is-0=ဒီနေ့ +finduri-AgeInDays-is-1=မနေ့ +finduri-AgeInDays-is=%S ရက်တွေတုန်းက +finduri-AgeInDays-last-is=လွန်ခဲ့တဲ့ %S များ +finduri-AgeInDays-isgreater=%S ရက်ထက် ပိုကြာတယ် +finduri-AgeInMonths-is-0=ဒီလ +finduri-AgeInMonths-isgreater=%S လထက် ပိုကြာတယ် + +# LOCALIZATION NOTE (localFiles): +# This is used to generate local files container when history is grouped by site +localhost=(စက်ထဲရှိ ဖိုင်များ) + +# LOCALIZATION NOTE +# The string is used for showing file size of each backup in the "fileRestorePopup" popup +# %1$S is the file size +# %2$S is the file size unit +backupFileSizeText=%1$S %2$S diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/pluginproblem/pluginproblem.dtd firefox-54.0~b2+build1/l10n/my/toolkit/chrome/pluginproblem/pluginproblem.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/pluginproblem/pluginproblem.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/pluginproblem/pluginproblem.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,31 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/chrome/search/search.properties firefox-54.0~b2+build1/l10n/my/toolkit/chrome/search/search.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/chrome/search/search.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/chrome/search/search.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,20 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +addEngineConfirmTitle=ရှာဖွေရေး ယန္တရားကို ထည့်သွင်းပါ +addEngineConfirmation=Add "%S" to the list of engines available in the search bar?\n\nFrom: %S +addEngineAsCurrentText=&u ယခု ဝတ်ဆိုဒ်အား ရှာဖွေရေးယန္တရားအဖြစ်သုံး +addEngineAddButtonLabel=ပေါင်းထည့်ပါ + +error_loading_engine_title=ဆွဲချတဲ့ အမှား +# LOCALIZATION NOTE (error_loading_engine_msg2): %1$S = brandShortName, %2$S = location +error_loading_engine_msg2=%S က ဆွဲချလို့ မရနိုင်တဲ့ ရှာဖွေရေး ယန္တရားငယ် တည်ရှိရာ -\n%S +error_duplicate_engine_msg=နာမည်တူ ​ယန္တရားတခု ရှိနေတဲ့အတွက် %S က "%S" မှ ရှာဖွေရေး ယန္တရားငယ်ကို တပ်ဆင်လို့ မရဘူး။ + +error_invalid_engine_title=တပ်ဆင်မှု အမှား +error_invalid_format_title=မှားယွင်းပုံစံ +# LOCALIZATION NOTE (error_invalid_engine_msg2): %1$S = brandShortName, %2$S = location (url) +error_invalid_engine_msg2=%1$S သည် %2$S မှ ရှာဖွေရေးအင်ဂျင်အား မတပ်ဆင်နိုင်ပါ + +suggestion_label=အကြံပြုချက်များ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/crashreporter/crashes.dtd firefox-54.0~b2+build1/l10n/my/toolkit/crashreporter/crashes.dtd --- firefox-54.0~b1+build1/l10n/my/toolkit/crashreporter/crashes.dtd 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/crashreporter/crashes.dtd 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,13 @@ + + + + + + + + + +breakpad.reportURL ကို ချမှတ်ရမယ်။"> + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/crashreporter/crashes.properties firefox-54.0~b2+build1/l10n/my/toolkit/crashreporter/crashes.properties --- firefox-54.0~b1+build1/l10n/my/toolkit/crashreporter/crashes.properties 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/crashreporter/crashes.properties 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,7 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +deleteconfirm.title=သင် သေချာသလား။ +deleteconfirm.description=ဒီအရာက ထုတ်ပြန်ချက်များ အားလုံးကို ပယ်ဖျက်ပြီ ပြန်ဖြည်လို့ မရနိုင်တော့ဘူး။ + diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/crashreporter/crashreporter.ini firefox-54.0~b2+build1/l10n/my/toolkit/crashreporter/crashreporter.ini --- firefox-54.0~b1+build1/l10n/my/toolkit/crashreporter/crashreporter.ini 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/crashreporter/crashreporter.ini 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1,57 @@ +; This Source Code Form is subject to the terms of the Mozilla Public +; License, v. 2.0. If a copy of the MPL was not distributed with this +; file, You can obtain one at http://mozilla.org/MPL/2.0/. +; This file is in the UTF-8 encoding +[Strings] +; LOCALIZATION NOTE (isRTL): +; Leave this entry empty unless your language requires right-to-left layout, +; for example like Arabic, Hebrew, Persian. If your language needs RTL, please +; use the untranslated English word "yes" as value +isRTL=\u0020\u0020 +CrashReporterTitle=ပျက်ဆီးချက်တင်ပြသူ +; LOCALIZATION NOTE (CrashReporterVendorTitle): %s is replaced with the vendor name. (i.e. "Mozilla") +CrashReporterVendorTitle=%s ပြသာနာတင်ပြပေးသူ +; LOCALIZATION NOTE (CrashReporterErrorText): %s is replaced with another string containing detailed information. +CrashReporterErrorText=ဤအက်ပလီကေးရှင်းသည်ပြသာနာတစ်ခုရှိခဲ့ပြီးရပ်တန့်သွားခဲ့သည်။\n\nမမျှော်လင့်ပဲ ပြသာနာတင်ပြသူသည် တင်ပြချက်အား ဤပြသာနာအတွက် မတင်ပြပေးနိုင်ခဲ့ပါ။ \n\nအသေးစိတ် %s +; LOCALIZATION NOTE (CrashReporterProductErrorText2): The first %s is replaced with the product name (i.e. "Firefox"), the second is replaced with another string containing detailed information. These two substitutions can not be reordered! +CrashReporterProductErrorText2=%sသည်ပြသာနာတစ်ခုဖြင့်ကြုံတွေ့ရပြီးပိတ်သိမ်းသွားသည်။\n\nမမျှော်လင့်ပဲတိုင်ကြားချက်အားမပေးပို့နိုင်ပါ။\n\nအသေးစိတ် %s +CrashReporterSorry=၀မ်းနည်းပါတယ်။ +; LOCALIZATION NOTE (CrashReporterDescriptionText2): The %s is replaced with the product name. +CrashReporterDescriptionText2=%sသည်ပြသာနာတစ်ခုဖြင့်ကြုံတွေ့ရပြီးပိတ်သိမ်းသွားသည်။\n\nကျွန်ုပ်တို့အားကူညီရန်ဤဖြစ်ရပ်အားတိုင်ကြားပေးနိုင်ပါသည်။ +CrashReporterDefault=This application is run after a crash to report the problem to the application vendor. It should not be run directly. +Details=အသေးစိတ်... +ViewReportTitle=ပါ၀င်ချက်များအားတိုင်ကြားမည်။ +CommentGrayText=မှတ်ချက်ပေးပါ(မှတ်ချက်များအားအများပြည်သူမြင်ရသည်) +ExtraReportInfo=ဤတိုင်ကြားချက်တွင် အက်ပလီကေးရှင်းပျက်ဆီးသွားချိန်အခြေအနေ၏နည်းပညာရှင်းလင်းချက်များလဲပါ၀င်မည်။ +; LOCALIZATION NOTE (CheckSendReport): The %s is replaced with the vendor name. +CheckSendReport=%s အားယခုဖြစ်ရပ်အားပြင်ဆင်နိုင်စေရန်ဆက်သွယ်စေလိုပါ။ +CheckIncludeURL=ကျွန်ုပ်ရောက်နေခဲ့သောစာမျက်နှာလိပ်စာပါထည့်ပေးလိုက်မည်။ +CheckAllowEmail=%sအား တိုင်ကြားချက်ဖြင့်ပတ်သတ်ပြီးကျွန်ုပ်အားဆက်သွယ်ခွင့်ပေးမည်။ +EmailGrayText=သင့်အီမေလ်းလိပ်စာအားဤတွင်ထည့်ပါ။ +ReportPreSubmit2=သင်၏တိုင်ကြားချက်အားသင် ရီစတတ်မလုပ်ခင် တင်ပို့သွားမည်ဖြစ်သည်။ +ReportDuringSubmit2=သင်၏ တိုင်ကြားချက်အားပို့နေသည်။ +ReportSubmitSuccess=တိုင်ကြားချက်အားအောင်မြင်စွာတင်ပို့ပြီးဖြစ်သည်။ +ReportSubmitFailed=သင်၏တိုင်ကြားချက်အားတင်ပို့ရာတွင်ပြသာနာရှိခဲ့သည်။ +ReportResubmit=မအောင်မြင်ခဲ့သောတိုင်ကြားချက်ပေးပို့ခြင်းအားပြန်လုပ်ဆောင်နေသည်။ +; LOCALIZATION NOTE (Quit2): The %s is replaced with the product name. +Quit2=%s ထွက်ပါ။ +; LOCALIZATION NOTE (Restart): The %s is replaced with the product name. +Restart=%s ပြန်စသုံးပါ။ +Ok=OK +Close=ပိတ်ပါ +; LOCALIZATION NOTE (CrashID): The %s is replaced with the Crash ID from the server, which is a string like abc12345-6789-0abc-def1-23456abcdef1 +CrashID=ပျက်စီးမှူအိုင်ဒီ ID : %s +; LOCALIZATION NOTE (CrashDetailsURL): The %s is replaced with a URL that the user can visit to view the crash details. +CrashDetailsURL=သင်ယခုရုတ်ချည်းပျက်စီးအသေးစိတ်အား %s တွင်ကြည့်ပါ။ +ErrorBadArguments=ဤအက်ပလီကေးရှင်းသည် မခိုင်လုံသော အထောက်အထားကိုကျော်ဖြတ်ပြီးဖြစ်သည်။ +ErrorExtraFileExists=အက်ပလီကေးရှင်းသည် မည်သည့်အသုံးချအချက်အလက်ဖိုင်ကိုမျှချန်မသွားပါ။ +ErrorExtraFileRead=အသုံးချအချက်အလက်ဖိုင်အားဖတ်မရပါ။ +ErrorExtraFileMove=အသုံးချအချက်အလက်ဖိုင်အား ရွေ့မရပါ။ +ErrorDumpFileExists=အက်ပလီကေးရှင်းသည် ဒမ့်ဖိုင်အားချန်မသွားပါ။ +ErrorDumpFileMove=ဒမ့်ဖိုင်အားရွေ့မရပါ။ +ErrorNoProductName=၄င်းအားအက်ပလီကေးရှင်းကိုယ်တိုင်အတည်မပြုနိုင်ပါ။ +ErrorNoServerURL=အက်ပလီကေးရှင်းသည် တိုင်ကြားချက်ဆာဗာအားမသိရှိနိုင်ပါ။ +ErrorNoSettingsPath=ပျက်စီးချက်တိုင်ကြားပရိုဂရမ်ဖိုင်များအားရှာမတွေ့ပါ။ +ErrorCreateDumpDir=သိမ်းဆည်းထားနိုင်သောဒမ့်ဖိုင်ဒါရိုက်ရှင်နယ်ရီအားမတည်ဆောက်နိုင်ပါ။ +; LOCALIZATION NOTE (ErrorEndOfLife): The %s is replaced with the product name. +ErrorEndOfLife=ယခု %s ဗားရှင်း အားနောက်ထပ်အထောက်အပံ့မပေးတော့ပါ။ရုတ်ချည်းပျက်စီးတင်ပြပေးသူသည်ဗားရှင်းအားအလုပ်လုပ်မပေးတော့ပါ။ထောက်ပံ့ပေးသောဗားရှင်းအားအဆင့်တိုးမြှင့်မည်လားဆုံးဖြတ်ပါ။ diff -Nru firefox-54.0~b1+build1/l10n/my/toolkit/defines.inc firefox-54.0~b2+build1/l10n/my/toolkit/defines.inc --- firefox-54.0~b1+build1/l10n/my/toolkit/defines.inc 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/l10n/my/toolkit/defines.inc 2017-04-25 05:37:01.000000000 +0000 @@ -0,0 +1 @@ +#define MOZ_LANG_TITLE Burmese diff -Nru firefox-54.0~b1+build1/layout/generic/nsContainerFrame.cpp firefox-54.0~b2+build1/layout/generic/nsContainerFrame.cpp --- firefox-54.0~b1+build1/layout/generic/nsContainerFrame.cpp 2017-04-20 12:54:13.000000000 +0000 +++ firefox-54.0~b2+build1/layout/generic/nsContainerFrame.cpp 2017-04-25 05:28:26.000000000 +0000 @@ -999,8 +999,8 @@ void nsContainerFrame::ReflowChild(nsIFrame* aKidFrame, nsPresContext* aPresContext, - ReflowOutput& aDesiredSize, - const ReflowInput& aReflowInput, + ReflowOutput& aDesiredSize, + const ReflowInput& aReflowInput, const WritingMode& aWM, const LogicalPoint& aPos, const nsSize& aContainerSize, @@ -1013,6 +1013,9 @@ NS_ASSERTION(aContainerSize.width != NS_UNCONSTRAINEDSIZE, "ReflowChild with unconstrained container width!"); } + MOZ_ASSERT(aDesiredSize.VisualOverflow() == nsRect(0,0,0,0) && + aDesiredSize.ScrollableOverflow() == nsRect(0,0,0,0), + "please reset the overflow areas before calling ReflowChild"); // Position the child frame and its view if requested. if (NS_FRAME_NO_MOVE_FRAME != (aFlags & NS_FRAME_NO_MOVE_FRAME)) { diff -Nru firefox-54.0~b1+build1/layout/generic/nsFrame.cpp firefox-54.0~b2+build1/layout/generic/nsFrame.cpp --- firefox-54.0~b1+build1/layout/generic/nsFrame.cpp 2017-04-20 12:54:13.000000000 +0000 +++ firefox-54.0~b2+build1/layout/generic/nsFrame.cpp 2017-04-25 05:28:27.000000000 +0000 @@ -4958,7 +4958,7 @@ ComputeISizeValue(aRenderingContext, aCBSize.ISize(aWM), boxSizingAdjust.ISize(aWM), boxSizingToMarginEdgeISize, minISizeCoord, aFlags); - } else if (MOZ_UNLIKELY(isGridItem)) { + } else if (MOZ_UNLIKELY(aFlags & eIApplyAutoMinSize)) { // This implements "Implied Minimum Size of Grid Items". // https://drafts.csswg.org/css-grid/#min-size-auto minISize = std::min(maxISize, GetMinISize(aRenderingContext)); diff -Nru firefox-54.0~b1+build1/layout/generic/nsGfxScrollFrame.cpp firefox-54.0~b2+build1/layout/generic/nsGfxScrollFrame.cpp --- firefox-54.0~b1+build1/layout/generic/nsGfxScrollFrame.cpp 2017-04-20 12:54:13.000000000 +0000 +++ firefox-54.0~b2+build1/layout/generic/nsGfxScrollFrame.cpp 2017-04-25 05:28:27.000000000 +0000 @@ -341,6 +341,7 @@ nsLayoutUtils::MarkIntrinsicISizesDirtyIfDependentOnBSize( mHelper.mScrolledFrame); } + aKidMetrics->mOverflowAreas.Clear(); ReflowScrolledFrame(aState, aAssumeHScroll, aAssumeVScroll, aKidMetrics, false); } @@ -694,6 +695,7 @@ insideBorderSize); if (nsRect(nsPoint(0, 0), insideBorderSize).Contains(scrolledRect)) { // Let's pretend we had no scrollbars coming in here + kidDesiredSize.mOverflowAreas.Clear(); ReflowScrolledFrame(aState, false, false, &kidDesiredSize, false); } } diff -Nru firefox-54.0~b1+build1/layout/generic/nsGridContainerFrame.cpp firefox-54.0~b2+build1/layout/generic/nsGridContainerFrame.cpp --- firefox-54.0~b1+build1/layout/generic/nsGridContainerFrame.cpp 2017-04-20 12:54:12.000000000 +0000 +++ firefox-54.0~b2+build1/layout/generic/nsGridContainerFrame.cpp 2017-04-25 05:28:26.000000000 +0000 @@ -818,8 +818,11 @@ // Ditto *-content:[last ]baseline. Mutually exclusive w. eSelfBaseline. eContentBaseline = 0x10, eAllBaselineBits = eIsBaselineAligned | eSelfBaseline | eContentBaseline, + // Should apply Automatic Minimum Size per: + // https://drafts.csswg.org/css-grid/#min-size-auto + eApplyAutoMinSize = 0x20, // Clamp per https://drafts.csswg.org/css-grid/#min-size-auto - eClampMarginBoxMinSize = 0x20, + eClampMarginBoxMinSize = 0x40, }; explicit GridItemInfo(nsIFrame* aFrame, @@ -851,11 +854,11 @@ return aAlign; } - // Return true if we should we clamp this item's Automatic Minimum Size. + // Return true if we should apply Automatic Minimum Size to this item. // https://drafts.csswg.org/css-grid/#min-size-auto - bool ShouldClampMinSize(WritingMode aContainerWM, - LogicalAxis aContainerAxis, - nscoord aPercentageBasis) const + bool ShouldApplyAutoMinSize(WritingMode aContainerWM, + LogicalAxis aContainerAxis, + nscoord aPercentageBasis) const { const auto pos = mFrame->StylePosition(); const auto& size = aContainerAxis == eLogicalAxisInline ? @@ -3699,8 +3702,11 @@ parent->Properties().Set( nsContainerFrame::DebugReflowingWithInfiniteISize(), true); #endif - uint32_t riFlags = ReflowInput::COMPUTE_SIZE_SHRINK_WRAP | - ReflowInput::COMPUTE_SIZE_USE_AUTO_BSIZE; + auto wm = aChild->GetWritingMode(); + uint32_t riFlags = ReflowInput::COMPUTE_SIZE_USE_AUTO_BSIZE; + if (aAvailableSize.ISize(wm) == INFINITE_ISIZE_COORD) { + riFlags |= ReflowInput::COMPUTE_SIZE_SHRINK_WRAP; + } if (aIMinSizeClamp != NS_MAXSIZE) { riFlags |= ReflowInput::I_CLAMP_MARGIN_BOX_MIN_SIZE; } @@ -3725,7 +3731,6 @@ ReflowOutput childSize(childRI); nsReflowStatus childStatus; const uint32_t flags = NS_FRAME_NO_MOVE_FRAME | NS_FRAME_NO_SIZE_VIEW; - WritingMode wm = childRI.GetWritingMode(); parent->ReflowChild(aChild, pc, childSize, childRI, wm, LogicalPoint(wm), nsSize(), flags, childStatus); parent->FinishReflowChild(aChild, pc, childSize, &childRI, wm, @@ -3987,9 +3992,9 @@ WritingMode wm = aState.mWM; // Calculate data for "Automatic Minimum Size" clamping, if needed. bool needed = ((sz.mState & TrackSize::eIntrinsicMinSizing) || - aConstraint == SizingConstraint::eNoConstraint); - if (needed && TrackSize::IsDefiniteMaxSizing(sz.mState) && - aGridItem.ShouldClampMinSize(wm, mAxis, aPercentageBasis)) { + aConstraint == SizingConstraint::eNoConstraint) && + (aGridItem.mState[mAxis] & ItemState::eApplyAutoMinSize); + if (needed && TrackSize::IsDefiniteMaxSizing(sz.mState)) { if (sz.mState & TrackSize::eIntrinsicMinSizing) { auto maxCoord = aFunctions.MaxSizingFor(aRange.mStart); cache.mMinSizeClamp = @@ -4392,6 +4397,14 @@ iter.Reset(); for (; !iter.AtEnd(); iter.Next()) { auto& gridItem = aGridItems[iter.GridItemIndex()]; + + // Check if we need to apply "Automatic Minimum Size" and cache it. + MOZ_ASSERT(!(gridItem.mState[mAxis] & ItemState::eApplyAutoMinSize), + "Why is eApplyAutoMinSize set already?"); + if (gridItem.ShouldApplyAutoMinSize(wm, mAxis, aPercentageBasis)) { + gridItem.mState[mAxis] |= ItemState::eApplyAutoMinSize; + } + const GridArea& area = gridItem.mArea; const LineRange& lineRange = area.*aRange; uint32_t span = lineRange.Extent(); @@ -4417,9 +4430,9 @@ CachedIntrinsicSizes cache; // Calculate data for "Automatic Minimum Size" clamping, if needed. bool needed = ((state & TrackSize::eIntrinsicMinSizing) || - aConstraint == SizingConstraint::eNoConstraint); - if (needed && TrackSize::IsDefiniteMaxSizing(state) && - gridItem.ShouldClampMinSize(wm, mAxis, aPercentageBasis)) { + aConstraint == SizingConstraint::eNoConstraint) && + (gridItem.mState[mAxis] & ItemState::eApplyAutoMinSize); + if (needed && TrackSize::IsDefiniteMaxSizing(state)) { nscoord minSizeClamp = 0; for (auto i = lineRange.mStart, end = lineRange.mEnd; i < end; ++i) { auto maxCoord = aFunctions.MaxSizingFor(i); @@ -4455,11 +4468,14 @@ gridItem.mState[mAxis] |= ItemState::eIsFlexing; } else if (aConstraint == SizingConstraint::eNoConstraint && TrackSize::IsDefiniteMaxSizing(state) && - gridItem.ShouldClampMinSize(wm, mAxis, aPercentageBasis)) { + (gridItem.mState[mAxis] & ItemState::eApplyAutoMinSize)) { gridItem.mState[mAxis] |= ItemState::eClampMarginBoxMinSize; } } } + MOZ_ASSERT(!(gridItem.mState[mAxis] & ItemState::eClampMarginBoxMinSize) || + (gridItem.mState[mAxis] & ItemState::eApplyAutoMinSize), + "clamping only applies to Automatic Minimum Size"); } // Step 2. @@ -5241,6 +5257,9 @@ } else { aChild->Properties().Delete(BClampMarginBoxMinSizeProperty()); } + if ((aGridItemInfo->mState[childIAxis] & ItemState::eApplyAutoMinSize)) { + flags |= ReflowInput::I_APPLY_AUTO_MIN_SIZE; + } } if (!isConstrainedBSize) { diff -Nru firefox-54.0~b1+build1/layout/generic/nsIFrame.h firefox-54.0~b2+build1/layout/generic/nsIFrame.h --- firefox-54.0~b1+build1/layout/generic/nsIFrame.h 2017-04-20 12:54:13.000000000 +0000 +++ firefox-54.0~b2+build1/layout/generic/nsIFrame.h 2017-04-25 05:28:27.000000000 +0000 @@ -2210,6 +2210,14 @@ */ eIClampMarginBoxMinSize = 1 << 2, // clamp in our inline axis eBClampMarginBoxMinSize = 1 << 3, // clamp in our block axis + /** + * The frame is stretching (per CSS Box Alignment) and doesn't have an + * Automatic Minimum Size in the indicated axis. + * (may be used for both flex/grid items, but currently only used for Grid) + * https://drafts.csswg.org/css-grid/#min-size-auto + * https://drafts.csswg.org/css-align-3/#valdef-justify-self-stretch + */ + eIApplyAutoMinSize = 1 << 4, // only has an effect when eShrinkWrap is false }; /** diff -Nru firefox-54.0~b1+build1/layout/generic/ReflowInput.cpp firefox-54.0~b2+build1/layout/generic/ReflowInput.cpp --- firefox-54.0~b1+build1/layout/generic/ReflowInput.cpp 2017-04-20 12:54:12.000000000 +0000 +++ firefox-54.0~b2+build1/layout/generic/ReflowInput.cpp 2017-04-25 05:28:26.000000000 +0000 @@ -93,6 +93,9 @@ if (aFlags & B_CLAMP_MARGIN_BOX_MIN_SIZE) { mFlags.mBClampMarginBoxMinSize = true; } + if (aFlags & I_APPLY_AUTO_MIN_SIZE) { + mFlags.mApplyAutoMinSize = true; + } if (!(aFlags & CALLER_WILL_INIT)) { Init(aPresContext); @@ -242,6 +245,7 @@ mFlags.mIOffsetsNeedCSSAlign = mFlags.mBOffsetsNeedCSSAlign = false; mFlags.mIClampMarginBoxMinSize = !!(aFlags & I_CLAMP_MARGIN_BOX_MIN_SIZE); mFlags.mBClampMarginBoxMinSize = !!(aFlags & B_CLAMP_MARGIN_BOX_MIN_SIZE); + mFlags.mApplyAutoMinSize = !!(aFlags & I_APPLY_AUTO_MIN_SIZE); mDiscoveredClearance = nullptr; mPercentBSizeObserver = (aParentReflowInput.mPercentBSizeObserver && @@ -1663,6 +1667,10 @@ computeSizeFlags = ComputeSizeFlags(computeSizeFlags | ComputeSizeFlags::eBClampMarginBoxMinSize); } + if (mFlags.mApplyAutoMinSize) { + computeSizeFlags = ComputeSizeFlags(computeSizeFlags | + ComputeSizeFlags::eIApplyAutoMinSize); + } if (mFlags.mShrinkWrap) { computeSizeFlags = ComputeSizeFlags(computeSizeFlags | ComputeSizeFlags::eShrinkWrap); @@ -2376,6 +2384,10 @@ computeSizeFlags = ComputeSizeFlags(computeSizeFlags | ComputeSizeFlags::eBClampMarginBoxMinSize); } + if (mFlags.mApplyAutoMinSize) { + computeSizeFlags = ComputeSizeFlags(computeSizeFlags | + ComputeSizeFlags::eIApplyAutoMinSize); + } if (mFlags.mShrinkWrap) { computeSizeFlags = ComputeSizeFlags(computeSizeFlags | ComputeSizeFlags::eShrinkWrap); diff -Nru firefox-54.0~b1+build1/layout/generic/ReflowInput.h firefox-54.0~b2+build1/layout/generic/ReflowInput.h --- firefox-54.0~b1+build1/layout/generic/ReflowInput.h 2017-04-20 12:54:13.000000000 +0000 +++ firefox-54.0~b2+build1/layout/generic/ReflowInput.h 2017-04-25 05:28:26.000000000 +0000 @@ -220,6 +220,7 @@ bool mStaticPosIsCBOrigin : 1; // the STATIC_POS_IS_CB_ORIGIN ctor flag bool mIClampMarginBoxMinSize : 1; // the I_CLAMP_MARGIN_BOX_MIN_SIZE ctor flag bool mBClampMarginBoxMinSize : 1; // the B_CLAMP_MARGIN_BOX_MIN_SIZE ctor flag + bool mApplyAutoMinSize : 1; // the I_APPLY_AUTO_MIN_SIZE ctor flag // If set, the following two flags indicate that: // (1) this frame is absolutely-positioned (or fixed-positioned). @@ -739,6 +740,9 @@ // Pass ComputeSizeFlags::eBClampMarginBoxMinSize to ComputeSize(). B_CLAMP_MARGIN_BOX_MIN_SIZE = (1<<6), + + // Pass ComputeSizeFlags::eIApplyAutoMinSize to ComputeSize(). + I_APPLY_AUTO_MIN_SIZE = (1<<7), }; // This method initializes various data members. It is automatically diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/bug1349571.html firefox-54.0~b2+build1/layout/reftests/css-grid/bug1349571.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/bug1349571.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/bug1349571.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,38 @@ + + + + + Testcase for bug 1349571 + + + + +
    +
    +
    +
    +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/bug1349571-ref.html firefox-54.0~b2+build1/layout/reftests/css-grid/bug1349571-ref.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/bug1349571-ref.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/bug1349571-ref.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,34 @@ + + + + + Testcase for bug 1349571 + + + + +
    +
    +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/bug1350925.html firefox-54.0~b2+build1/layout/reftests/css-grid/bug1350925.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/bug1350925.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/bug1350925.html 2017-04-25 05:28:26.000000000 +0000 @@ -0,0 +1,32 @@ + + + + + Testcase for bug 1350925 + + + + +
    +
    +
    + +
    +
    +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/bug1350925-ref.html firefox-54.0~b2+build1/layout/reftests/css-grid/bug1350925-ref.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/bug1350925-ref.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/bug1350925-ref.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,32 @@ + + + + + Testcase for bug 1350925 + + + + +
    +
    +
    + +
    +
    +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/bug1356820.html firefox-54.0~b2+build1/layout/reftests/css-grid/bug1356820.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/bug1356820.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/bug1356820.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,25 @@ + +
    +
    + first item with a longlonglongword +
    +
    + second item +
    +
    +
    +
    + first item with a longlonglongword +
    +
    + second item +
    +
    +
    +
    + first item with a longlonglongword +
    +
    + second item +
    +
    diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/bug1356820-ref.html firefox-54.0~b2+build1/layout/reftests/css-grid/bug1356820-ref.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/bug1356820-ref.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/bug1356820-ref.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,25 @@ + +
    +
    + first item with a longlonglongword +
    +
    + second item +
    +
    +
    +
    + first item with a longlonglongword +
    +
    + second item +
    +
    +
    +
    + first item with a longlonglongword +
    +
    + second item +
    +
    diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-001.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-001.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-001.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-001.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,74 @@ + + + + + CSS Grid Test: stretching overflow!=visible items + + + + + + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-001-ref.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-001-ref.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-001-ref.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-001-ref.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,78 @@ + + + + + CSS Grid Reference: stretching overflow!=visible items + + + + + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-002.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-002.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-002.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-002.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,75 @@ + + + + + CSS Grid Test: stretching overflow!=visible vertical-rl items + + + + + + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-002-ref.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-002-ref.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-002-ref.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-002-ref.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,79 @@ + + + + + CSS Grid Reference: stretching overflow!=visible vertical-rl items + + + + + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-003.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-003.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-003.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-003.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,75 @@ + + + + + CSS Grid Test: margin:auto stretch items + + + + + + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-003-ref.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-003-ref.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-003-ref.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-003-ref.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,84 @@ + + + + + CSS Grid Reference: margin:auto stretch items + + + + + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-004.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-004.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-004.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-004.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,82 @@ + + + + + CSS Grid Test: stretching items + + + + + + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-004-ref.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-004-ref.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-004-ref.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-004-ref.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,88 @@ + + + + + CSS Grid Reference: stretching items + + + + + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-005.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-005.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-005.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-005.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,77 @@ + + + + + CSS Grid Test: stretching overflow!=visible items + + + + + + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-005-ref.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-005-ref.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-005-ref.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-005-ref.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,83 @@ + + + + + CSS Grid Reference: stretching overflow!=visible items + + + + + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + +
    +
    +
    +
    + +
    + +
    +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-006.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-006.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-006.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-006.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,56 @@ + + + + + CSS Grid Test: stretching overflow visible items + + + + + + +
    +
    +
    + +
    + +
    + +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-006-ref.html firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-006-ref.html --- firefox-54.0~b1+build1/layout/reftests/css-grid/grid-item-overflow-stretch-006-ref.html 1970-01-01 00:00:00.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/grid-item-overflow-stretch-006-ref.html 2017-04-25 05:28:27.000000000 +0000 @@ -0,0 +1,54 @@ + + + + + CSS Grid Reference: stretching overflow visible items + + + + + +
    +
    +
    + +
    + +
    + +
    +
    +
    + +
    + +
    + + + diff -Nru firefox-54.0~b1+build1/layout/reftests/css-grid/reftest.list firefox-54.0~b2+build1/layout/reftests/css-grid/reftest.list --- firefox-54.0~b1+build1/layout/reftests/css-grid/reftest.list 2017-04-20 12:54:13.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/css-grid/reftest.list 2017-04-25 05:28:27.000000000 +0000 @@ -116,6 +116,12 @@ == grid-item-auto-min-size-clamp-005.html grid-item-auto-min-size-clamp-005-ref.html == grid-item-auto-min-size-clamp-006.html grid-item-auto-min-size-clamp-006-ref.html == grid-item-auto-min-size-clamp-007.html grid-item-auto-min-size-clamp-007-ref.html +== grid-item-overflow-stretch-001.html grid-item-overflow-stretch-001-ref.html +== grid-item-overflow-stretch-002.html grid-item-overflow-stretch-002-ref.html +== grid-item-overflow-stretch-003.html grid-item-overflow-stretch-003-ref.html +== grid-item-overflow-stretch-004.html grid-item-overflow-stretch-004-ref.html +== grid-item-overflow-stretch-005.html grid-item-overflow-stretch-005-ref.html +== grid-item-overflow-stretch-006.html grid-item-overflow-stretch-006-ref.html == grid-item-canvas-001.html grid-item-canvas-001-ref.html skip-if(Android) == grid-item-button-001.html grid-item-button-001-ref.html == grid-item-table-stretch-001.html grid-item-table-stretch-001-ref.html @@ -277,3 +283,6 @@ == grid-percent-intrinsic-sizing-001.html grid-percent-intrinsic-sizing-001-ref.html == grid-measuring-reflow-resize-static-001.html grid-measuring-reflow-resize-001-ref.html == grid-measuring-reflow-resize-dynamic-001.html grid-measuring-reflow-resize-001-ref.html +== bug1349571.html bug1349571-ref.html +== bug1356820.html bug1356820-ref.html +== bug1350925.html bug1350925-ref.html diff -Nru firefox-54.0~b1+build1/layout/reftests/native-theme/progress-overflow-small.html firefox-54.0~b2+build1/layout/reftests/native-theme/progress-overflow-small.html --- firefox-54.0~b1+build1/layout/reftests/native-theme/progress-overflow-small.html 2017-04-20 12:54:14.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/native-theme/progress-overflow-small.html 2017-04-25 05:28:27.000000000 +0000 @@ -1,8 +1,8 @@ -
    -
    +
    +
    diff -Nru firefox-54.0~b1+build1/layout/reftests/native-theme/reftest.list firefox-54.0~b2+build1/layout/reftests/native-theme/reftest.list --- firefox-54.0~b1+build1/layout/reftests/native-theme/reftest.list 2017-04-20 12:54:14.000000000 +0000 +++ firefox-54.0~b2+build1/layout/reftests/native-theme/reftest.list 2017-04-25 05:28:27.000000000 +0000 @@ -78,7 +78,7 @@ # animated progress bars. # Nothing shows up on Android, presumably because that appearance type is # not implemented. -pref(layout.css.moz-appearance.enabled,true) skip-if(cocoaWidget) skip-if(winWidget) == progress-overflow.html progress-overflow-ref.html -pref(layout.css.moz-appearance.enabled,true) fails-if(Android) skip-if(cocoaWidget) skip-if(winWidget) != progress-overflow-small.html progress-nobar.html +pref(layout.css.moz-appearance.enabled,true) pref(layout.css.appearance.enabled,true) skip-if(cocoaWidget) skip-if(winWidget) == progress-overflow.html progress-overflow-ref.html +pref(layout.css.moz-appearance.enabled,true) pref(layout.css.appearance.enabled,true) fails-if(Android) skip-if(cocoaWidget) skip-if(winWidget) != progress-overflow-small.html progress-nobar.html == 676387-1.xul 676387-1-ref.xul diff -Nru firefox-54.0~b1+build1/layout/style/nsCSSProps.cpp firefox-54.0~b2+build1/layout/style/nsCSSProps.cpp --- firefox-54.0~b1+build1/layout/style/nsCSSProps.cpp 2017-04-20 12:54:15.000000000 +0000 +++ firefox-54.0~b2+build1/layout/style/nsCSSProps.cpp 2017-04-25 05:28:28.000000000 +0000 @@ -744,8 +744,8 @@ }; const KTableEntry nsCSSProps::kAppearanceKTable[] = { - { eCSSKeyword_auto, NS_THEME_AUTO }, { eCSSKeyword_none, NS_THEME_NONE }, + { eCSSKeyword_auto, NS_THEME_AUTO }, { eCSSKeyword_UNKNOWN, -1 } }; diff -Nru firefox-54.0~b1+build1/layout/style/nsRuleNode.cpp firefox-54.0~b2+build1/layout/style/nsRuleNode.cpp --- firefox-54.0~b1+build1/layout/style/nsRuleNode.cpp 2017-04-20 12:54:14.000000000 +0000 +++ firefox-54.0~b2+build1/layout/style/nsRuleNode.cpp 2017-04-25 05:28:28.000000000 +0000 @@ -6156,12 +6156,12 @@ parentDisplay->mMozAppearance, NS_THEME_NONE); - // appearance: auto | none + // appearance: none | auto SetValue(*aRuleData->ValueForAppearance(), display->mAppearance, conditions, SETVAL_ENUMERATED | SETVAL_UNSET_INITIAL, parentDisplay->mAppearance, - NS_THEME_AUTO); + NS_THEME_NONE); // binding: url, none, inherit const nsCSSValue* bindingValue = aRuleData->ValueForBinding(); diff -Nru firefox-54.0~b1+build1/layout/style/nsStyleStruct.cpp firefox-54.0~b2+build1/layout/style/nsStyleStruct.cpp --- firefox-54.0~b1+build1/layout/style/nsStyleStruct.cpp 2017-04-20 12:54:15.000000000 +0000 +++ firefox-54.0~b2+build1/layout/style/nsStyleStruct.cpp 2017-04-25 05:28:28.000000000 +0000 @@ -3209,7 +3209,7 @@ , mOriginalDisplay(StyleDisplay::Inline) , mContain(NS_STYLE_CONTAIN_NONE) , mMozAppearance(NS_THEME_NONE) - , mAppearance(NS_THEME_AUTO) + , mAppearance(NS_THEME_NONE) , mPosition(NS_STYLE_POSITION_STATIC) , mFloat(StyleFloat::None) , mOriginalFloat(StyleFloat::None) diff -Nru firefox-54.0~b1+build1/layout/style/res/forms.css firefox-54.0~b2+build1/layout/style/res/forms.css --- firefox-54.0~b1+build1/layout/style/res/forms.css 2017-04-20 12:54:14.000000000 +0000 +++ firefox-54.0~b2+build1/layout/style/res/forms.css 2017-04-25 05:28:28.000000000 +0000 @@ -88,6 +88,7 @@ input { -moz-appearance: textfield; + appearance: auto; /* The sum of border and padding on block-start and block-end must be the same here, for buttons, and for . Note -moz-focus-inner padding does not affect button size. */ @@ -921,6 +930,7 @@ progress { -moz-appearance: progressbar; + appearance: auto; display: inline-block; vertical-align: -0.2em; @@ -943,6 +953,7 @@ box-sizing: border-box ! important; -moz-appearance: progresschunk; + appearance: auto; height: 100%; width: 100%; @@ -952,6 +963,7 @@ meter { -moz-appearance: meterbar; + appearance: auto; display: inline-block; vertical-align: -0.2em; @@ -966,6 +978,7 @@ overflow: visible ! important; -moz-appearance: meterchunk; + appearance: auto; height: 100%; width: 100%; } @@ -985,6 +998,7 @@ input[type=range] { -moz-appearance: range; + appearance: auto; display: inline-block; inline-size: 12em; block-size: 1.3em; @@ -1102,6 +1116,7 @@ * to get rid of it. The thumb's -moz-appearance is fixed. */ -moz-appearance: range-thumb !important; + appearance: auto !important; /* Prevent styling that would change the type of frame we construct. */ display: inline-block !important; float: none !important; @@ -1174,6 +1189,7 @@ input[type=number]::-moz-number-spin-up { writing-mode: horizontal-tb; -moz-appearance: spinner-upbutton; + appearance: auto; display: block; /* bug 926670 */ flex: none; cursor: default; @@ -1192,6 +1208,7 @@ input[type=number]::-moz-number-spin-down { writing-mode: horizontal-tb; -moz-appearance: spinner-downbutton; + appearance: auto; display: block; /* bug 926670 */ flex: none; cursor: default; diff -Nru firefox-54.0~b1+build1/layout/style/res/number-control.css firefox-54.0~b2+build1/layout/style/res/number-control.css --- firefox-54.0~b1+build1/layout/style/res/number-control.css 2017-04-20 12:54:15.000000000 +0000 +++ firefox-54.0~b2+build1/layout/style/res/number-control.css 2017-04-25 05:28:28.000000000 +0000 @@ -9,6 +9,7 @@ input[type="number"] { -moz-appearance: number-input; + appearance: auto; /* Has to revert some properties applied by the generic input rule. */ -moz-binding: none; inline-size: 20ch; /* It'd be nice if this matched the default inline-size diff -Nru firefox-54.0~b1+build1/layout/style/test/property_database.js firefox-54.0~b2+build1/layout/style/test/property_database.js --- firefox-54.0~b1+build1/layout/style/test/property_database.js 2017-04-20 12:54:14.000000000 +0000 +++ firefox-54.0~b2+build1/layout/style/test/property_database.js 2017-04-25 05:28:28.000000000 +0000 @@ -7783,8 +7783,8 @@ domProp: "appearance", inherited: false, type: CSS_TYPE_LONGHAND, - initial_values: [ "auto" ], - other_values: [ "none" ], + initial_values: [ "none" ], + other_values: [ "auto" ], invalid_values: [ "button" ] }; gCSSProperties["-webkit-appearance"] = { diff -Nru firefox-54.0~b1+build1/mobile/android/base/java/org/mozilla/gecko/media/CodecProxy.java firefox-54.0~b2+build1/mobile/android/base/java/org/mozilla/gecko/media/CodecProxy.java --- firefox-54.0~b1+build1/mobile/android/base/java/org/mozilla/gecko/media/CodecProxy.java 2017-04-20 12:54:16.000000000 +0000 +++ firefox-54.0~b2+build1/mobile/android/base/java/org/mozilla/gecko/media/CodecProxy.java 2017-04-25 05:28:29.000000000 +0000 @@ -54,6 +54,7 @@ private class CallbacksForwarder extends ICodecCallbacks.Stub { private final Callbacks mCallbacks; private boolean mEndOfInput; + private boolean mCodecProxyReleased; CallbacksForwarder(Callbacks callbacks) { mCallbacks = callbacks; @@ -61,25 +62,31 @@ @Override public synchronized void onInputQueued(long timestamp) throws RemoteException { - if (!mEndOfInput) { + if (!mEndOfInput && !mCodecProxyReleased) { mCallbacks.onInputStatus(timestamp, true /* processed */); } } @Override public synchronized void onInputPending(long timestamp) throws RemoteException { - if (!mEndOfInput) { + if (!mEndOfInput && !mCodecProxyReleased) { mCallbacks.onInputStatus(timestamp, false /* processed */); } } @Override - public void onOutputFormatChanged(FormatParam format) throws RemoteException { - mCallbacks.onOutputFormatChanged(format.asFormat()); + public synchronized void onOutputFormatChanged(FormatParam format) throws RemoteException { + if (!mCodecProxyReleased) { + mCallbacks.onOutputFormatChanged(format.asFormat()); + } } @Override - public void onOutput(Sample sample) throws RemoteException { + public synchronized void onOutput(Sample sample) throws RemoteException { + if (mCodecProxyReleased) { + sample.dispose(); + return; + } if (mOutputSurface != null) { // Don't render to surface just yet. Callback will make that happen when it's time. mSurfaceOutputs.offer(sample); @@ -97,13 +104,19 @@ reportError(fatal); } - private void reportError(boolean fatal) { - mCallbacks.onError(fatal); + private synchronized void reportError(boolean fatal) { + if (!mCodecProxyReleased) { + mCallbacks.onError(fatal); + } } private void setEndOfInput(boolean end) { mEndOfInput = end; } + + private synchronized void setCodecProxyReleased() { + mCodecProxyReleased = true; + } } @WrapForJNI @@ -230,36 +243,39 @@ } @WrapForJNI - public synchronized boolean release() { - if (mRemote == null) { - Log.w(LOGTAG, "codec already ended"); - return true; - } - if (DEBUG) { Log.d(LOGTAG, "release " + this); } + public boolean release() { + mCallbacks.setCodecProxyReleased(); + synchronized (this) { + if (mRemote == null) { + Log.w(LOGTAG, "codec already ended"); + return true; + } + if (DEBUG) { Log.d(LOGTAG, "release " + this); } + + if (!mSurfaceOutputs.isEmpty()) { + // Flushing output buffers to surface may cause some frames to be skipped and + // should not happen unless caller release codec before processing all buffers. + Log.w(LOGTAG, "release codec when " + mSurfaceOutputs.size() + " output buffers unhandled"); + try { + for (Sample s : mSurfaceOutputs) { + mRemote.releaseOutput(s, true); + } + } catch (RemoteException e) { + e.printStackTrace(); + } + mSurfaceOutputs.clear(); + } - if (!mSurfaceOutputs.isEmpty()) { - // Flushing output buffers to surface may cause some frames to be skipped and - // should not happen unless caller release codec before processing all buffers. - Log.w(LOGTAG, "release codec when " + mSurfaceOutputs.size() + " output buffers unhandled"); try { - for (Sample s : mSurfaceOutputs) { - mRemote.releaseOutput(s, true); - } + RemoteManager.getInstance().releaseCodec(this); + } catch (DeadObjectException e) { + return false; } catch (RemoteException e) { e.printStackTrace(); + return false; } - mSurfaceOutputs.clear(); - } - - try { - RemoteManager.getInstance().releaseCodec(this); - } catch (DeadObjectException e) { - return false; - } catch (RemoteException e) { - e.printStackTrace(); - return false; + return true; } - return true; } @WrapForJNI diff -Nru firefox-54.0~b1+build1/mobile/locales/l10n-changesets.json firefox-54.0~b2+build1/mobile/locales/l10n-changesets.json --- firefox-54.0~b1+build1/mobile/locales/l10n-changesets.json 2017-04-20 12:54:32.000000000 +0000 +++ firefox-54.0~b2+build1/mobile/locales/l10n-changesets.json 2017-04-25 05:28:29.000000000 +0000 @@ -522,7 +522,7 @@ "android-api-15", "android-multilocale" ], - "revision": "0e60b7758388" + "revision": "23a867d7a861" }, "pt-PT": { "platforms": [ @@ -530,7 +530,7 @@ "android-api-15", "android-multilocale" ], - "revision": "5bb3c2b540bf" + "revision": "555ec87449af" }, "rm": { "platforms": [ @@ -562,7 +562,7 @@ "android-api-15", "android-multilocale" ], - "revision": "cea246875217" + "revision": "0c05a55b0dc2" }, "sl": { "platforms": [ @@ -570,7 +570,7 @@ "android-api-15", "android-multilocale" ], - "revision": "c4edb8fa7d69" + "revision": "b436442f6650" }, "son": { "platforms": [ @@ -586,7 +586,7 @@ "android-api-15", "android-multilocale" ], - "revision": "b991c8ee1b2a" + "revision": "f80aa499a9a8" }, "sr": { "platforms": [ @@ -594,7 +594,7 @@ "android-api-15", "android-multilocale" ], - "revision": "db15963239a7" + "revision": "4d8424f5d51f" }, "sv-SE": { "platforms": [ @@ -602,7 +602,7 @@ "android-api-15", "android-multilocale" ], - "revision": "d938d161ff41" + "revision": "163e033a8d03" }, "ta": { "platforms": [ @@ -618,7 +618,7 @@ "android-api-15", "android-multilocale" ], - "revision": "137d5b848c73" + "revision": "c88643fdaa54" }, "th": { "platforms": [ @@ -626,7 +626,7 @@ "android-api-15", "android-multilocale" ], - "revision": "7a92e3d122d3" + "revision": "92681bccc461" }, "tr": { "platforms": [ @@ -641,7 +641,7 @@ "android", "android-api-15" ], - "revision": "3e5a2e8390e6" + "revision": "5e38c3824393" }, "uk": { "platforms": [ @@ -649,7 +649,7 @@ "android-api-15", "android-multilocale" ], - "revision": "c44fd6668949" + "revision": "883cef864f83" }, "ur": { "platforms": [ @@ -657,7 +657,7 @@ "android-api-15", "android-multilocale" ], - "revision": "4cef697710d6" + "revision": "b800a594d871" }, "uz": { "platforms": [ @@ -680,7 +680,7 @@ "android-api-15", "android-multilocale" ], - "revision": "5e187cde4009" + "revision": "27e442d1b183" }, "zam": { "platforms": [ @@ -695,7 +695,7 @@ "android-api-15", "android-multilocale" ], - "revision": "2e899b3bedd6" + "revision": "d25b5181a2db" }, "zh-TW": { "platforms": [ diff -Nru firefox-54.0~b1+build1/old-configure.in firefox-54.0~b2+build1/old-configure.in --- firefox-54.0~b1+build1/old-configure.in 2017-04-20 12:54:18.000000000 +0000 +++ firefox-54.0~b2+build1/old-configure.in 2017-04-25 05:28:30.000000000 +0000 @@ -2005,7 +2005,7 @@ _USE_SYSTEM_NSS=1 ) if test -n "$_USE_SYSTEM_NSS"; then - AM_PATH_NSS(3.30.1, [MOZ_SYSTEM_NSS=1], [AC_MSG_ERROR([you don't have NSS installed or your version is too old])]) + AM_PATH_NSS(3.30.2, [MOZ_SYSTEM_NSS=1], [AC_MSG_ERROR([you don't have NSS installed or your version is too old])]) fi if test -n "$MOZ_SYSTEM_NSS"; then diff -Nru firefox-54.0~b1+build1/security/nss/coreconf/coreconf.dep firefox-54.0~b2+build1/security/nss/coreconf/coreconf.dep --- firefox-54.0~b1+build1/security/nss/coreconf/coreconf.dep 2017-04-20 12:54:18.000000000 +0000 +++ firefox-54.0~b2+build1/security/nss/coreconf/coreconf.dep 2017-04-25 05:28:30.000000000 +0000 @@ -10,4 +10,3 @@ */ #error "Do not include this header file." - diff -Nru firefox-54.0~b1+build1/security/nss/lib/certdb/genname.c firefox-54.0~b2+build1/security/nss/lib/certdb/genname.c --- firefox-54.0~b1+build1/security/nss/lib/certdb/genname.c 2017-04-20 12:54:19.000000000 +0000 +++ firefox-54.0~b2+build1/security/nss/lib/certdb/genname.c 2017-04-25 05:28:31.000000000 +0000 @@ -1588,10 +1588,10 @@ STRING_TO_SECITEM(CA##_NAME_CONSTRAINTS) \ } -/* Agence Nationale de la Securite des Systemes d'Information (ANSSI) */ - /* clang-format off */ +/* Agence Nationale de la Securite des Systemes d'Information (ANSSI) */ + #define ANSSI_SUBJECT_DN \ "\x30\x81\x85" \ "\x31\x0B\x30\x09\x06\x03\x55\x04\x06\x13\x02" "FR" /* C */ \ @@ -1619,10 +1619,39 @@ "\x30\x05\x82\x03" ".nc" \ "\x30\x05\x82\x03" ".tf" +/* TUBITAK Kamu SM SSL Kok Sertifikasi - Surum 1 */ + +#define TUBITAK1_SUBJECT_DN \ + "\x30\x81\xd2" \ + "\x31\x0b\x30\x09\x06\x03\x55\x04\x06\x13\x02" \ + /* C */ "TR" \ + "\x31\x18\x30\x16\x06\x03\x55\x04\x07\x13\x0f" \ + /* L */ "Gebze - Kocaeli" \ + "\x31\x42\x30\x40\x06\x03\x55\x04\x0a\x13\x39" \ + /* O */ "Turkiye Bilimsel ve Teknolojik Arastirma Kurumu - TUBITAK" \ + "\x31\x2d\x30\x2b\x06\x03\x55\x04\x0b\x13\x24" \ + /* OU */ "Kamu Sertifikasyon Merkezi - Kamu SM" \ + "\x31\x36\x30\x34\x06\x03\x55\x04\x03\x13\x2d" \ + /* CN */ "TUBITAK Kamu SM SSL Kok Sertifikasi - Surum 1" + +#define TUBITAK1_NAME_CONSTRAINTS \ + "\x30\x65\xa0\x63" \ + "\x30\x09\x82\x07" ".gov.tr" \ + "\x30\x09\x82\x07" ".k12.tr" \ + "\x30\x09\x82\x07" ".pol.tr" \ + "\x30\x09\x82\x07" ".mil.tr" \ + "\x30\x09\x82\x07" ".tsk.tr" \ + "\x30\x09\x82\x07" ".kep.tr" \ + "\x30\x09\x82\x07" ".bel.tr" \ + "\x30\x09\x82\x07" ".edu.tr" \ + "\x30\x09\x82\x07" ".org.tr" + /* clang-format on */ -static const SECItem builtInNameConstraints[][2] = { NAME_CONSTRAINTS_ENTRY( - ANSSI) }; +static const SECItem builtInNameConstraints[][2] = { + NAME_CONSTRAINTS_ENTRY(ANSSI), + NAME_CONSTRAINTS_ENTRY(TUBITAK1) +}; SECStatus CERT_GetImposedNameConstraints(const SECItem *derSubject, SECItem *extensions) diff -Nru firefox-54.0~b1+build1/security/nss/lib/ckfw/builtins/certdata.txt firefox-54.0~b2+build1/security/nss/lib/ckfw/builtins/certdata.txt --- firefox-54.0~b1+build1/security/nss/lib/ckfw/builtins/certdata.txt 2017-04-20 12:54:18.000000000 +0000 +++ firefox-54.0~b2+build1/security/nss/lib/ckfw/builtins/certdata.txt 2017-04-25 05:28:30.000000000 +0000 @@ -8246,168 +8246,6 @@ CKA_TRUST_STEP_UP_APPROVED CK_BBOOL CK_FALSE # -# Certificate "WellsSecure Public Root Certificate Authority" -# -# Issuer: CN=WellsSecure Public Root Certificate Authority,OU=Wells Fargo Bank NA,O=Wells Fargo WellsSecure,C=US -# Serial Number: 1 (0x1) -# Subject: CN=WellsSecure Public Root Certificate Authority,OU=Wells Fargo Bank NA,O=Wells Fargo WellsSecure,C=US -# Not Valid Before: Thu Dec 13 17:07:54 2007 -# Not Valid After : Wed Dec 14 00:07:54 2022 -# Fingerprint (MD5): 15:AC:A5:C2:92:2D:79:BC:E8:7F:CB:67:ED:02:CF:36 -# Fingerprint (SHA1): E7:B4:F6:9D:61:EC:90:69:DB:7E:90:A7:40:1A:3C:F4:7D:4F:E8:EE -CKA_CLASS CK_OBJECT_CLASS CKO_CERTIFICATE -CKA_TOKEN CK_BBOOL CK_TRUE -CKA_PRIVATE CK_BBOOL CK_FALSE -CKA_MODIFIABLE CK_BBOOL CK_FALSE -CKA_LABEL UTF8 "WellsSecure Public Root Certificate Authority" -CKA_CERTIFICATE_TYPE CK_CERTIFICATE_TYPE CKC_X_509 -CKA_SUBJECT MULTILINE_OCTAL -\060\201\205\061\013\060\011\006\003\125\004\006\023\002\125\123 -\061\040\060\036\006\003\125\004\012\014\027\127\145\154\154\163 -\040\106\141\162\147\157\040\127\145\154\154\163\123\145\143\165 -\162\145\061\034\060\032\006\003\125\004\013\014\023\127\145\154 -\154\163\040\106\141\162\147\157\040\102\141\156\153\040\116\101 -\061\066\060\064\006\003\125\004\003\014\055\127\145\154\154\163 -\123\145\143\165\162\145\040\120\165\142\154\151\143\040\122\157 -\157\164\040\103\145\162\164\151\146\151\143\141\164\145\040\101 -\165\164\150\157\162\151\164\171 -END -CKA_ID UTF8 "0" -CKA_ISSUER MULTILINE_OCTAL -\060\201\205\061\013\060\011\006\003\125\004\006\023\002\125\123 -\061\040\060\036\006\003\125\004\012\014\027\127\145\154\154\163 -\040\106\141\162\147\157\040\127\145\154\154\163\123\145\143\165 -\162\145\061\034\060\032\006\003\125\004\013\014\023\127\145\154 -\154\163\040\106\141\162\147\157\040\102\141\156\153\040\116\101 -\061\066\060\064\006\003\125\004\003\014\055\127\145\154\154\163 -\123\145\143\165\162\145\040\120\165\142\154\151\143\040\122\157 -\157\164\040\103\145\162\164\151\146\151\143\141\164\145\040\101 -\165\164\150\157\162\151\164\171 -END -CKA_SERIAL_NUMBER MULTILINE_OCTAL -\002\001\001 -END -CKA_VALUE MULTILINE_OCTAL -\060\202\004\275\060\202\003\245\240\003\002\001\002\002\001\001 -\060\015\006\011\052\206\110\206\367\015\001\001\005\005\000\060 -\201\205\061\013\060\011\006\003\125\004\006\023\002\125\123\061 -\040\060\036\006\003\125\004\012\014\027\127\145\154\154\163\040 -\106\141\162\147\157\040\127\145\154\154\163\123\145\143\165\162 -\145\061\034\060\032\006\003\125\004\013\014\023\127\145\154\154 -\163\040\106\141\162\147\157\040\102\141\156\153\040\116\101\061 -\066\060\064\006\003\125\004\003\014\055\127\145\154\154\163\123 -\145\143\165\162\145\040\120\165\142\154\151\143\040\122\157\157 -\164\040\103\145\162\164\151\146\151\143\141\164\145\040\101\165 -\164\150\157\162\151\164\171\060\036\027\015\060\067\061\062\061 -\063\061\067\060\067\065\064\132\027\015\062\062\061\062\061\064 -\060\060\060\067\065\064\132\060\201\205\061\013\060\011\006\003 -\125\004\006\023\002\125\123\061\040\060\036\006\003\125\004\012 -\014\027\127\145\154\154\163\040\106\141\162\147\157\040\127\145 -\154\154\163\123\145\143\165\162\145\061\034\060\032\006\003\125 -\004\013\014\023\127\145\154\154\163\040\106\141\162\147\157\040 -\102\141\156\153\040\116\101\061\066\060\064\006\003\125\004\003 -\014\055\127\145\154\154\163\123\145\143\165\162\145\040\120\165 -\142\154\151\143\040\122\157\157\164\040\103\145\162\164\151\146 -\151\143\141\164\145\040\101\165\164\150\157\162\151\164\171\060 -\202\001\042\060\015\006\011\052\206\110\206\367\015\001\001\001 -\005\000\003\202\001\017\000\060\202\001\012\002\202\001\001\000 -\356\157\264\275\171\342\217\010\041\236\070\004\101\045\357\253 -\133\034\123\222\254\155\236\335\302\304\056\105\224\003\065\210 -\147\164\127\343\337\214\270\247\166\217\073\367\250\304\333\051 -\143\016\221\150\066\212\227\216\212\161\150\011\007\344\350\324 -\016\117\370\326\053\114\244\026\371\357\103\230\217\263\236\122 -\337\155\221\071\217\070\275\167\213\103\143\353\267\223\374\060 -\114\034\001\223\266\023\373\367\241\037\277\045\341\164\067\054 -\036\244\136\074\150\370\113\277\015\271\036\056\066\350\251\344 -\247\370\017\313\202\165\174\065\055\042\326\302\277\013\363\264 -\374\154\225\141\036\127\327\004\201\062\203\122\171\346\203\143 -\317\267\313\143\213\021\342\275\136\353\366\215\355\225\162\050 -\264\254\022\142\351\112\063\346\203\062\256\005\165\225\275\204 -\225\333\052\134\233\216\056\014\270\201\053\101\346\070\126\237 -\111\233\154\166\372\212\135\367\001\171\201\174\301\203\100\005 -\376\161\375\014\077\314\116\140\011\016\145\107\020\057\001\300 -\005\077\217\370\263\101\357\132\102\176\131\357\322\227\014\145 -\002\003\001\000\001\243\202\001\064\060\202\001\060\060\017\006 -\003\125\035\023\001\001\377\004\005\060\003\001\001\377\060\071 -\006\003\125\035\037\004\062\060\060\060\056\240\054\240\052\206 -\050\150\164\164\160\072\057\057\143\162\154\056\160\153\151\056 -\167\145\154\154\163\146\141\162\147\157\056\143\157\155\057\167 -\163\160\162\143\141\056\143\162\154\060\016\006\003\125\035\017 -\001\001\377\004\004\003\002\001\306\060\035\006\003\125\035\016 -\004\026\004\024\046\225\031\020\331\350\241\227\221\377\334\031 -\331\265\004\076\322\163\012\152\060\201\262\006\003\125\035\043 -\004\201\252\060\201\247\200\024\046\225\031\020\331\350\241\227 -\221\377\334\031\331\265\004\076\322\163\012\152\241\201\213\244 -\201\210\060\201\205\061\013\060\011\006\003\125\004\006\023\002 -\125\123\061\040\060\036\006\003\125\004\012\014\027\127\145\154 -\154\163\040\106\141\162\147\157\040\127\145\154\154\163\123\145 -\143\165\162\145\061\034\060\032\006\003\125\004\013\014\023\127 -\145\154\154\163\040\106\141\162\147\157\040\102\141\156\153\040 -\116\101\061\066\060\064\006\003\125\004\003\014\055\127\145\154 -\154\163\123\145\143\165\162\145\040\120\165\142\154\151\143\040 -\122\157\157\164\040\103\145\162\164\151\146\151\143\141\164\145 -\040\101\165\164\150\157\162\151\164\171\202\001\001\060\015\006 -\011\052\206\110\206\367\015\001\001\005\005\000\003\202\001\001 -\000\271\025\261\104\221\314\043\310\053\115\167\343\370\232\173 -\047\015\315\162\273\231\000\312\174\146\031\120\306\325\230\355 -\253\277\003\132\345\115\345\036\310\117\161\227\206\325\343\035 -\375\220\311\074\165\167\127\172\175\370\336\364\324\325\367\225 -\346\164\156\035\074\256\174\235\333\002\003\005\054\161\113\045 -\076\007\343\136\232\365\146\027\051\210\032\070\237\317\252\101 -\003\204\227\153\223\070\172\312\060\104\033\044\104\063\320\344 -\321\334\050\070\364\023\103\065\065\051\143\250\174\242\265\255 -\070\244\355\255\375\306\232\037\377\227\163\376\373\263\065\247 -\223\206\306\166\221\000\346\254\121\026\304\047\062\134\333\163 -\332\245\223\127\216\076\155\065\046\010\131\325\347\104\327\166 -\040\143\347\254\023\147\303\155\261\160\106\174\325\226\021\075 -\211\157\135\250\241\353\215\012\332\303\035\063\154\243\352\147 -\031\232\231\177\113\075\203\121\052\035\312\057\206\014\242\176 -\020\055\053\324\026\225\013\007\252\056\024\222\111\267\051\157 -\330\155\061\175\365\374\241\020\007\207\316\057\131\334\076\130 -\333 -END -CKA_NSS_MOZILLA_CA_POLICY CK_BBOOL CK_TRUE - -# Trust for Certificate "WellsSecure Public Root Certificate Authority" -# Issuer: CN=WellsSecure Public Root Certificate Authority,OU=Wells Fargo Bank NA,O=Wells Fargo WellsSecure,C=US -# Serial Number: 1 (0x1) -# Subject: CN=WellsSecure Public Root Certificate Authority,OU=Wells Fargo Bank NA,O=Wells Fargo WellsSecure,C=US -# Not Valid Before: Thu Dec 13 17:07:54 2007 -# Not Valid After : Wed Dec 14 00:07:54 2022 -# Fingerprint (MD5): 15:AC:A5:C2:92:2D:79:BC:E8:7F:CB:67:ED:02:CF:36 -# Fingerprint (SHA1): E7:B4:F6:9D:61:EC:90:69:DB:7E:90:A7:40:1A:3C:F4:7D:4F:E8:EE -CKA_CLASS CK_OBJECT_CLASS CKO_NSS_TRUST -CKA_TOKEN CK_BBOOL CK_TRUE -CKA_PRIVATE CK_BBOOL CK_FALSE -CKA_MODIFIABLE CK_BBOOL CK_FALSE -CKA_LABEL UTF8 "WellsSecure Public Root Certificate Authority" -CKA_CERT_SHA1_HASH MULTILINE_OCTAL -\347\264\366\235\141\354\220\151\333\176\220\247\100\032\074\364 -\175\117\350\356 -END -CKA_CERT_MD5_HASH MULTILINE_OCTAL -\025\254\245\302\222\055\171\274\350\177\313\147\355\002\317\066 -END -CKA_ISSUER MULTILINE_OCTAL -\060\201\205\061\013\060\011\006\003\125\004\006\023\002\125\123 -\061\040\060\036\006\003\125\004\012\014\027\127\145\154\154\163 -\040\106\141\162\147\157\040\127\145\154\154\163\123\145\143\165 -\162\145\061\034\060\032\006\003\125\004\013\014\023\127\145\154 -\154\163\040\106\141\162\147\157\040\102\141\156\153\040\116\101 -\061\066\060\064\006\003\125\004\003\014\055\127\145\154\154\163 -\123\145\143\165\162\145\040\120\165\142\154\151\143\040\122\157 -\157\164\040\103\145\162\164\151\146\151\143\141\164\145\040\101 -\165\164\150\157\162\151\164\171 -END -CKA_SERIAL_NUMBER MULTILINE_OCTAL -\002\001\001 -END -CKA_TRUST_SERVER_AUTH CK_TRUST CKT_NSS_TRUSTED_DELEGATOR -CKA_TRUST_EMAIL_PROTECTION CK_TRUST CKT_NSS_MUST_VERIFY_TRUST -CKA_TRUST_CODE_SIGNING CK_TRUST CKT_NSS_MUST_VERIFY_TRUST -CKA_TRUST_STEP_UP_APPROVED CK_BBOOL CK_FALSE - -# # Certificate "COMODO ECC Certification Authority" # # Issuer: CN=COMODO ECC Certification Authority,O=COMODO CA Limited,L=Salford,ST=Greater Manchester,C=GB @@ -8992,213 +8830,6 @@ CKA_TRUST_STEP_UP_APPROVED CK_BBOOL CK_FALSE # -# Certificate "Microsec e-Szigno Root CA" -# -# Issuer: CN=Microsec e-Szigno Root CA,OU=e-Szigno CA,O=Microsec Ltd.,L=Budapest,C=HU -# Serial Number:00:cc:b8:e7:bf:4e:29:1a:fd:a2:dc:66:a5:1c:2c:0f:11 -# Subject: CN=Microsec e-Szigno Root CA,OU=e-Szigno CA,O=Microsec Ltd.,L=Budapest,C=HU -# Not Valid Before: Wed Apr 06 12:28:44 2005 -# Not Valid After : Thu Apr 06 12:28:44 2017 -# Fingerprint (MD5): F0:96:B6:2F:C5:10:D5:67:8E:83:25:32:E8:5E:2E:E5 -# Fingerprint (SHA1): 23:88:C9:D3:71:CC:9E:96:3D:FF:7D:3C:A7:CE:FC:D6:25:EC:19:0D -CKA_CLASS CK_OBJECT_CLASS CKO_CERTIFICATE -CKA_TOKEN CK_BBOOL CK_TRUE -CKA_PRIVATE CK_BBOOL CK_FALSE -CKA_MODIFIABLE CK_BBOOL CK_FALSE -CKA_LABEL UTF8 "Microsec e-Szigno Root CA" -CKA_CERTIFICATE_TYPE CK_CERTIFICATE_TYPE CKC_X_509 -CKA_SUBJECT MULTILINE_OCTAL -\060\162\061\013\060\011\006\003\125\004\006\023\002\110\125\061 -\021\060\017\006\003\125\004\007\023\010\102\165\144\141\160\145 -\163\164\061\026\060\024\006\003\125\004\012\023\015\115\151\143 -\162\157\163\145\143\040\114\164\144\056\061\024\060\022\006\003 -\125\004\013\023\013\145\055\123\172\151\147\156\157\040\103\101 -\061\042\060\040\006\003\125\004\003\023\031\115\151\143\162\157 -\163\145\143\040\145\055\123\172\151\147\156\157\040\122\157\157 -\164\040\103\101 -END -CKA_ID UTF8 "0" -CKA_ISSUER MULTILINE_OCTAL -\060\162\061\013\060\011\006\003\125\004\006\023\002\110\125\061 -\021\060\017\006\003\125\004\007\023\010\102\165\144\141\160\145 -\163\164\061\026\060\024\006\003\125\004\012\023\015\115\151\143 -\162\157\163\145\143\040\114\164\144\056\061\024\060\022\006\003 -\125\004\013\023\013\145\055\123\172\151\147\156\157\040\103\101 -\061\042\060\040\006\003\125\004\003\023\031\115\151\143\162\157 -\163\145\143\040\145\055\123\172\151\147\156\157\040\122\157\157 -\164\040\103\101 -END -CKA_SERIAL_NUMBER MULTILINE_OCTAL -\002\021\000\314\270\347\277\116\051\032\375\242\334\146\245\034 -\054\017\021 -END -CKA_VALUE MULTILINE_OCTAL -\060\202\007\250\060\202\006\220\240\003\002\001\002\002\021\000 -\314\270\347\277\116\051\032\375\242\334\146\245\034\054\017\021 -\060\015\006\011\052\206\110\206\367\015\001\001\005\005\000\060 -\162\061\013\060\011\006\003\125\004\006\023\002\110\125\061\021 -\060\017\006\003\125\004\007\023\010\102\165\144\141\160\145\163 -\164\061\026\060\024\006\003\125\004\012\023\015\115\151\143\162 -\157\163\145\143\040\114\164\144\056\061\024\060\022\006\003\125 -\004\013\023\013\145\055\123\172\151\147\156\157\040\103\101\061 -\042\060\040\006\003\125\004\003\023\031\115\151\143\162\157\163 -\145\143\040\145\055\123\172\151\147\156\157\040\122\157\157\164 -\040\103\101\060\036\027\015\060\065\060\064\060\066\061\062\062 -\070\064\064\132\027\015\061\067\060\064\060\066\061\062\062\070 -\064\064\132\060\162\061\013\060\011\006\003\125\004\006\023\002 -\110\125\061\021\060\017\006\003\125\004\007\023\010\102\165\144 -\141\160\145\163\164\061\026\060\024\006\003\125\004\012\023\015 -\115\151\143\162\157\163\145\143\040\114\164\144\056\061\024\060 -\022\006\003\125\004\013\023\013\145\055\123\172\151\147\156\157 -\040\103\101\061\042\060\040\006\003\125\004\003\023\031\115\151 -\143\162\157\163\145\143\040\145\055\123\172\151\147\156\157\040 -\122\157\157\164\040\103\101\060\202\001\042\060\015\006\011\052 -\206\110\206\367\015\001\001\001\005\000\003\202\001\017\000\060 -\202\001\012\002\202\001\001\000\355\310\000\325\201\173\315\070 -\000\107\314\333\204\301\041\151\054\164\220\014\041\331\123\207 -\355\076\103\104\123\257\253\370\200\233\074\170\215\324\215\256 -\270\357\323\021\334\201\346\317\073\226\214\326\157\025\306\167 -\176\241\057\340\137\222\266\047\327\166\232\035\103\074\352\331 -\354\057\356\071\363\152\147\113\213\202\317\042\370\145\125\376 -\054\313\057\175\110\172\075\165\371\252\240\047\273\170\302\006 -\312\121\302\176\146\113\257\315\242\247\115\002\202\077\202\254 -\205\306\341\017\220\107\231\224\012\161\162\223\052\311\246\300 -\276\074\126\114\163\222\047\361\153\265\365\375\374\060\005\140 -\222\306\353\226\176\001\221\302\151\261\036\035\173\123\105\270 -\334\101\037\311\213\161\326\124\024\343\213\124\170\077\276\364 -\142\073\133\365\243\354\325\222\164\342\164\060\357\001\333\341 -\324\253\231\233\052\153\370\275\246\034\206\043\102\137\354\111 -\336\232\213\133\364\162\072\100\305\111\076\245\276\216\252\161 -\353\154\372\365\032\344\152\375\173\175\125\100\357\130\156\346 -\331\325\274\044\253\301\357\267\002\003\001\000\001\243\202\004 -\067\060\202\004\063\060\147\006\010\053\006\001\005\005\007\001 -\001\004\133\060\131\060\050\006\010\053\006\001\005\005\007\060 -\001\206\034\150\164\164\160\163\072\057\057\162\143\141\056\145 -\055\163\172\151\147\156\157\056\150\165\057\157\143\163\160\060 -\055\006\010\053\006\001\005\005\007\060\002\206\041\150\164\164 -\160\072\057\057\167\167\167\056\145\055\163\172\151\147\156\157 -\056\150\165\057\122\157\157\164\103\101\056\143\162\164\060\017 -\006\003\125\035\023\001\001\377\004\005\060\003\001\001\377\060 -\202\001\163\006\003\125\035\040\004\202\001\152\060\202\001\146 -\060\202\001\142\006\014\053\006\001\004\001\201\250\030\002\001 -\001\001\060\202\001\120\060\050\006\010\053\006\001\005\005\007 -\002\001\026\034\150\164\164\160\072\057\057\167\167\167\056\145 -\055\163\172\151\147\156\157\056\150\165\057\123\132\123\132\057 -\060\202\001\042\006\010\053\006\001\005\005\007\002\002\060\202 -\001\024\036\202\001\020\000\101\000\040\000\164\000\141\000\156 -\000\372\000\163\000\355\000\164\000\166\000\341\000\156\000\171 -\000\040\000\351\000\162\000\164\000\145\000\154\000\155\000\145 -\000\172\000\351\000\163\000\351\000\150\000\145\000\172\000\040 -\000\351\000\163\000\040\000\145\000\154\000\146\000\157\000\147 -\000\141\000\144\000\341\000\163\000\341\000\150\000\157\000\172 -\000\040\000\141\000\040\000\123\000\172\000\157\000\154\000\147 -\000\341\000\154\000\164\000\141\000\164\000\363\000\040\000\123 -\000\172\000\157\000\154\000\147\000\341\000\154\000\164\000\141 -\000\164\000\341\000\163\000\151\000\040\000\123\000\172\000\141 -\000\142\000\341\000\154\000\171\000\172\000\141\000\164\000\141 -\000\040\000\163\000\172\000\145\000\162\000\151\000\156\000\164 -\000\040\000\153\000\145\000\154\000\154\000\040\000\145\000\154 -\000\152\000\341\000\162\000\156\000\151\000\072\000\040\000\150 -\000\164\000\164\000\160\000\072\000\057\000\057\000\167\000\167 -\000\167\000\056\000\145\000\055\000\163\000\172\000\151\000\147 -\000\156\000\157\000\056\000\150\000\165\000\057\000\123\000\132 -\000\123\000\132\000\057\060\201\310\006\003\125\035\037\004\201 -\300\060\201\275\060\201\272\240\201\267\240\201\264\206\041\150 -\164\164\160\072\057\057\167\167\167\056\145\055\163\172\151\147 -\156\157\056\150\165\057\122\157\157\164\103\101\056\143\162\154 -\206\201\216\154\144\141\160\072\057\057\154\144\141\160\056\145 -\055\163\172\151\147\156\157\056\150\165\057\103\116\075\115\151 -\143\162\157\163\145\143\045\062\060\145\055\123\172\151\147\156 -\157\045\062\060\122\157\157\164\045\062\060\103\101\054\117\125 -\075\145\055\123\172\151\147\156\157\045\062\060\103\101\054\117 -\075\115\151\143\162\157\163\145\143\045\062\060\114\164\144\056 -\054\114\075\102\165\144\141\160\145\163\164\054\103\075\110\125 -\077\143\145\162\164\151\146\151\143\141\164\145\122\145\166\157 -\143\141\164\151\157\156\114\151\163\164\073\142\151\156\141\162 -\171\060\016\006\003\125\035\017\001\001\377\004\004\003\002\001 -\006\060\201\226\006\003\125\035\021\004\201\216\060\201\213\201 -\020\151\156\146\157\100\145\055\163\172\151\147\156\157\056\150 -\165\244\167\060\165\061\043\060\041\006\003\125\004\003\014\032 -\115\151\143\162\157\163\145\143\040\145\055\123\172\151\147\156 -\303\263\040\122\157\157\164\040\103\101\061\026\060\024\006\003 -\125\004\013\014\015\145\055\123\172\151\147\156\303\263\040\110 -\123\132\061\026\060\024\006\003\125\004\012\023\015\115\151\143 -\162\157\163\145\143\040\113\146\164\056\061\021\060\017\006\003 -\125\004\007\023\010\102\165\144\141\160\145\163\164\061\013\060 -\011\006\003\125\004\006\023\002\110\125\060\201\254\006\003\125 -\035\043\004\201\244\060\201\241\200\024\307\240\111\165\026\141 -\204\333\061\113\204\322\361\067\100\220\357\116\334\367\241\166 -\244\164\060\162\061\013\060\011\006\003\125\004\006\023\002\110 -\125\061\021\060\017\006\003\125\004\007\023\010\102\165\144\141 -\160\145\163\164\061\026\060\024\006\003\125\004\012\023\015\115 -\151\143\162\157\163\145\143\040\114\164\144\056\061\024\060\022 -\006\003\125\004\013\023\013\145\055\123\172\151\147\156\157\040 -\103\101\061\042\060\040\006\003\125\004\003\023\031\115\151\143 -\162\157\163\145\143\040\145\055\123\172\151\147\156\157\040\122 -\157\157\164\040\103\101\202\021\000\314\270\347\277\116\051\032 -\375\242\334\146\245\034\054\017\021\060\035\006\003\125\035\016 -\004\026\004\024\307\240\111\165\026\141\204\333\061\113\204\322 -\361\067\100\220\357\116\334\367\060\015\006\011\052\206\110\206 -\367\015\001\001\005\005\000\003\202\001\001\000\323\023\234\146 -\143\131\056\312\134\160\014\374\203\274\125\261\364\216\007\154 -\146\047\316\301\073\040\251\034\273\106\124\160\356\132\314\240 -\167\352\150\104\047\353\362\051\335\167\251\325\373\343\324\247 -\004\304\225\270\013\341\104\150\140\007\103\060\061\102\141\345 -\356\331\345\044\325\033\337\341\112\033\252\237\307\137\370\172 -\021\352\023\223\000\312\212\130\261\356\355\016\115\264\327\250 -\066\046\174\340\072\301\325\127\202\361\165\266\375\211\137\332 -\363\250\070\237\065\006\010\316\042\225\276\315\325\374\276\133 -\336\171\153\334\172\251\145\146\276\261\045\132\137\355\176\323 -\254\106\155\114\364\062\207\264\040\004\340\154\170\260\167\321 -\205\106\113\246\022\267\165\350\112\311\126\154\327\222\253\235 -\365\111\070\322\117\123\343\125\220\021\333\230\226\306\111\362 -\076\364\237\033\340\367\210\334\045\142\231\104\330\163\277\077 -\060\363\014\067\076\324\302\050\200\163\261\001\267\235\132\226 -\024\001\113\251\021\235\051\152\056\320\135\201\300\317\262\040 -\103\307\003\340\067\116\135\012\334\131\040\045 -END -CKA_NSS_MOZILLA_CA_POLICY CK_BBOOL CK_TRUE - -# Trust for Certificate "Microsec e-Szigno Root CA" -# Issuer: CN=Microsec e-Szigno Root CA,OU=e-Szigno CA,O=Microsec Ltd.,L=Budapest,C=HU -# Serial Number:00:cc:b8:e7:bf:4e:29:1a:fd:a2:dc:66:a5:1c:2c:0f:11 -# Subject: CN=Microsec e-Szigno Root CA,OU=e-Szigno CA,O=Microsec Ltd.,L=Budapest,C=HU -# Not Valid Before: Wed Apr 06 12:28:44 2005 -# Not Valid After : Thu Apr 06 12:28:44 2017 -# Fingerprint (MD5): F0:96:B6:2F:C5:10:D5:67:8E:83:25:32:E8:5E:2E:E5 -# Fingerprint (SHA1): 23:88:C9:D3:71:CC:9E:96:3D:FF:7D:3C:A7:CE:FC:D6:25:EC:19:0D -CKA_CLASS CK_OBJECT_CLASS CKO_NSS_TRUST -CKA_TOKEN CK_BBOOL CK_TRUE -CKA_PRIVATE CK_BBOOL CK_FALSE -CKA_MODIFIABLE CK_BBOOL CK_FALSE -CKA_LABEL UTF8 "Microsec e-Szigno Root CA" -CKA_CERT_SHA1_HASH MULTILINE_OCTAL -\043\210\311\323\161\314\236\226\075\377\175\074\247\316\374\326 -\045\354\031\015 -END -CKA_CERT_MD5_HASH MULTILINE_OCTAL -\360\226\266\057\305\020\325\147\216\203\045\062\350\136\056\345 -END -CKA_ISSUER MULTILINE_OCTAL -\060\162\061\013\060\011\006\003\125\004\006\023\002\110\125\061 -\021\060\017\006\003\125\004\007\023\010\102\165\144\141\160\145 -\163\164\061\026\060\024\006\003\125\004\012\023\015\115\151\143 -\162\157\163\145\143\040\114\164\144\056\061\024\060\022\006\003 -\125\004\013\023\013\145\055\123\172\151\147\156\157\040\103\101 -\061\042\060\040\006\003\125\004\003\023\031\115\151\143\162\157 -\163\145\143\040\145\055\123\172\151\147\156\157\040\122\157\157 -\164\040\103\101 -END -CKA_SERIAL_NUMBER MULTILINE_OCTAL -\002\021\000\314\270\347\277\116\051\032\375\242\334\146\245\034 -\054\017\021 -END -CKA_TRUST_SERVER_AUTH CK_TRUST CKT_NSS_TRUSTED_DELEGATOR -CKA_TRUST_EMAIL_PROTECTION CK_TRUST CKT_NSS_TRUSTED_DELEGATOR -CKA_TRUST_CODE_SIGNING CK_TRUST CKT_NSS_TRUSTED_DELEGATOR -CKA_TRUST_STEP_UP_APPROVED CK_BBOOL CK_FALSE - -# # Certificate "Certigna" # # Issuer: CN=Certigna,O=Dhimyotis,C=FR @@ -10816,138 +10447,6 @@ CKA_TRUST_STEP_UP_APPROVED CK_BBOOL CK_FALSE # -# Certificate "ApplicationCA - Japanese Government" -# -# Issuer: OU=ApplicationCA,O=Japanese Government,C=JP -# Serial Number: 49 (0x31) -# Subject: OU=ApplicationCA,O=Japanese Government,C=JP -# Not Valid Before: Wed Dec 12 15:00:00 2007 -# Not Valid After : Tue Dec 12 15:00:00 2017 -# Fingerprint (MD5): 7E:23:4E:5B:A7:A5:B4:25:E9:00:07:74:11:62:AE:D6 -# Fingerprint (SHA1): 7F:8A:B0:CF:D0:51:87:6A:66:F3:36:0F:47:C8:8D:8C:D3:35:FC:74 -CKA_CLASS CK_OBJECT_CLASS CKO_CERTIFICATE -CKA_TOKEN CK_BBOOL CK_TRUE -CKA_PRIVATE CK_BBOOL CK_FALSE -CKA_MODIFIABLE CK_BBOOL CK_FALSE -CKA_LABEL UTF8 "ApplicationCA - Japanese Government" -CKA_CERTIFICATE_TYPE CK_CERTIFICATE_TYPE CKC_X_509 -CKA_SUBJECT MULTILINE_OCTAL -\060\103\061\013\060\011\006\003\125\004\006\023\002\112\120\061 -\034\060\032\006\003\125\004\012\023\023\112\141\160\141\156\145 -\163\145\040\107\157\166\145\162\156\155\145\156\164\061\026\060 -\024\006\003\125\004\013\023\015\101\160\160\154\151\143\141\164 -\151\157\156\103\101 -END -CKA_ID UTF8 "0" -CKA_ISSUER MULTILINE_OCTAL -\060\103\061\013\060\011\006\003\125\004\006\023\002\112\120\061 -\034\060\032\006\003\125\004\012\023\023\112\141\160\141\156\145 -\163\145\040\107\157\166\145\162\156\155\145\156\164\061\026\060 -\024\006\003\125\004\013\023\015\101\160\160\154\151\143\141\164 -\151\157\156\103\101 -END -CKA_SERIAL_NUMBER MULTILINE_OCTAL -\002\001\061 -END -CKA_VALUE MULTILINE_OCTAL -\060\202\003\240\060\202\002\210\240\003\002\001\002\002\001\061 -\060\015\006\011\052\206\110\206\367\015\001\001\005\005\000\060 -\103\061\013\060\011\006\003\125\004\006\023\002\112\120\061\034 -\060\032\006\003\125\004\012\023\023\112\141\160\141\156\145\163 -\145\040\107\157\166\145\162\156\155\145\156\164\061\026\060\024 -\006\003\125\004\013\023\015\101\160\160\154\151\143\141\164\151 -\157\156\103\101\060\036\027\015\060\067\061\062\061\062\061\065 -\060\060\060\060\132\027\015\061\067\061\062\061\062\061\065\060 -\060\060\060\132\060\103\061\013\060\011\006\003\125\004\006\023 -\002\112\120\061\034\060\032\006\003\125\004\012\023\023\112\141 -\160\141\156\145\163\145\040\107\157\166\145\162\156\155\145\156 -\164\061\026\060\024\006\003\125\004\013\023\015\101\160\160\154 -\151\143\141\164\151\157\156\103\101\060\202\001\042\060\015\006 -\011\052\206\110\206\367\015\001\001\001\005\000\003\202\001\017 -\000\060\202\001\012\002\202\001\001\000\247\155\340\164\116\207 -\217\245\006\336\150\242\333\206\231\113\144\015\161\360\012\005 -\233\216\252\341\314\056\322\152\073\301\172\264\227\141\215\212 -\276\306\232\234\006\264\206\121\344\067\016\164\170\176\137\212 -\177\224\244\327\107\010\375\120\132\126\344\150\254\050\163\240 -\173\351\177\030\222\100\117\055\235\365\256\104\110\163\066\006 -\236\144\054\073\064\043\333\134\046\344\161\171\217\324\156\171 -\042\271\223\301\312\315\301\126\355\210\152\327\240\071\041\004 -\127\054\242\365\274\107\101\117\136\064\042\225\265\037\051\155 -\136\112\363\115\162\276\101\126\040\207\374\351\120\107\327\060 -\024\356\134\214\125\272\131\215\207\374\043\336\223\320\004\214 -\375\357\155\275\320\172\311\245\072\152\162\063\306\112\015\005 -\027\052\055\173\261\247\330\326\360\276\364\077\352\016\050\155 -\101\141\043\166\170\303\270\145\244\363\132\256\314\302\252\331 -\347\130\336\266\176\235\205\156\237\052\012\157\237\003\051\060 -\227\050\035\274\267\317\124\051\116\121\061\371\047\266\050\046 -\376\242\143\346\101\026\360\063\230\107\002\003\001\000\001\243 -\201\236\060\201\233\060\035\006\003\125\035\016\004\026\004\024 -\124\132\313\046\077\161\314\224\106\015\226\123\352\153\110\320 -\223\376\102\165\060\016\006\003\125\035\017\001\001\377\004\004 -\003\002\001\006\060\131\006\003\125\035\021\004\122\060\120\244 -\116\060\114\061\013\060\011\006\003\125\004\006\023\002\112\120 -\061\030\060\026\006\003\125\004\012\014\017\346\227\245\346\234 -\254\345\233\275\346\224\277\345\272\234\061\043\060\041\006\003 -\125\004\013\014\032\343\202\242\343\203\227\343\203\252\343\202 -\261\343\203\274\343\202\267\343\203\247\343\203\263\103\101\060 -\017\006\003\125\035\023\001\001\377\004\005\060\003\001\001\377 -\060\015\006\011\052\206\110\206\367\015\001\001\005\005\000\003 -\202\001\001\000\071\152\104\166\167\070\072\354\243\147\106\017 -\371\213\006\250\373\152\220\061\316\176\354\332\321\211\174\172 -\353\056\014\275\231\062\347\260\044\326\303\377\365\262\210\011 -\207\054\343\124\341\243\246\262\010\013\300\205\250\310\322\234 -\161\366\035\237\140\374\070\063\023\341\236\334\013\137\332\026 -\120\051\173\057\160\221\017\231\272\064\064\215\225\164\305\176 -\170\251\146\135\275\312\041\167\102\020\254\146\046\075\336\221 -\253\375\025\360\157\355\154\137\020\370\363\026\366\003\212\217 -\247\022\021\014\313\375\077\171\301\234\375\142\356\243\317\124 -\014\321\053\137\027\076\343\076\277\300\053\076\011\233\376\210 -\246\176\264\222\027\374\043\224\201\275\156\247\305\214\302\353 -\021\105\333\370\101\311\226\166\352\160\137\171\022\153\344\243 -\007\132\005\357\047\111\317\041\237\212\114\011\160\146\251\046 -\301\053\021\116\063\322\016\374\326\154\322\016\062\144\150\377 -\255\005\170\137\003\035\250\343\220\254\044\340\017\100\247\113 -\256\213\050\267\202\312\030\007\346\267\133\164\351\040\031\177 -\262\033\211\124 -END -CKA_NSS_MOZILLA_CA_POLICY CK_BBOOL CK_TRUE - -# Trust for Certificate "ApplicationCA - Japanese Government" -# Issuer: OU=ApplicationCA,O=Japanese Government,C=JP -# Serial Number: 49 (0x31) -# Subject: OU=ApplicationCA,O=Japanese Government,C=JP -# Not Valid Before: Wed Dec 12 15:00:00 2007 -# Not Valid After : Tue Dec 12 15:00:00 2017 -# Fingerprint (MD5): 7E:23:4E:5B:A7:A5:B4:25:E9:00:07:74:11:62:AE:D6 -# Fingerprint (SHA1): 7F:8A:B0:CF:D0:51:87:6A:66:F3:36:0F:47:C8:8D:8C:D3:35:FC:74 -CKA_CLASS CK_OBJECT_CLASS CKO_NSS_TRUST -CKA_TOKEN CK_BBOOL CK_TRUE -CKA_PRIVATE CK_BBOOL CK_FALSE -CKA_MODIFIABLE CK_BBOOL CK_FALSE -CKA_LABEL UTF8 "ApplicationCA - Japanese Government" -CKA_CERT_SHA1_HASH MULTILINE_OCTAL -\177\212\260\317\320\121\207\152\146\363\066\017\107\310\215\214 -\323\065\374\164 -END -CKA_CERT_MD5_HASH MULTILINE_OCTAL -\176\043\116\133\247\245\264\045\351\000\007\164\021\142\256\326 -END -CKA_ISSUER MULTILINE_OCTAL -\060\103\061\013\060\011\006\003\125\004\006\023\002\112\120\061 -\034\060\032\006\003\125\004\012\023\023\112\141\160\141\156\145 -\163\145\040\107\157\166\145\162\156\155\145\156\164\061\026\060 -\024\006\003\125\004\013\023\015\101\160\160\154\151\143\141\164 -\151\157\156\103\101 -END -CKA_SERIAL_NUMBER MULTILINE_OCTAL -\002\001\061 -END -CKA_TRUST_SERVER_AUTH CK_TRUST CKT_NSS_TRUSTED_DELEGATOR -CKA_TRUST_EMAIL_PROTECTION CK_TRUST CKT_NSS_MUST_VERIFY_TRUST -CKA_TRUST_CODE_SIGNING CK_TRUST CKT_NSS_TRUSTED_DELEGATOR -CKA_TRUST_STEP_UP_APPROVED CK_BBOOL CK_FALSE - -# # Certificate "GeoTrust Primary Certification Authority - G3" # # Issuer: CN=GeoTrust Primary Certification Authority - G3,OU=(c) 2008 GeoTrust Inc. - For authorized use only,O=GeoTrust Inc.,C=US @@ -26425,167 +25924,6 @@ CKA_TRUST_STEP_UP_APPROVED CK_BBOOL CK_FALSE # -# Certificate "TÜRKTRUST Elektronik Sertifika Hizmet Sağlayıcısı H6" -# -# Issuer: CN=T..RKTRUST Elektronik Sertifika Hizmet Sa..lay..c..s.. H6,O=T..RKTRUST Bilgi ..leti..im ve Bili..im G..venli..i Hizmetleri A....,L=Ankara,C=TR -# Serial Number:7d:a1:f2:65:ec:8a -# Subject: CN=T..RKTRUST Elektronik Sertifika Hizmet Sa..lay..c..s.. H6,O=T..RKTRUST Bilgi ..leti..im ve Bili..im G..venli..i Hizmetleri A....,L=Ankara,C=TR -# Not Valid Before: Wed Dec 18 09:04:10 2013 -# Not Valid After : Sat Dec 16 09:04:10 2023 -# Fingerprint (SHA-256): 8D:E7:86:55:E1:BE:7F:78:47:80:0B:93:F6:94:D2:1D:36:8C:C0:6E:03:3E:7F:AB:04:BB:5E:B9:9D:A6:B7:00 -# Fingerprint (SHA1): 8A:5C:8C:EE:A5:03:E6:05:56:BA:D8:1B:D4:F6:C9:B0:ED:E5:2F:E0 -CKA_CLASS CK_OBJECT_CLASS CKO_CERTIFICATE -CKA_TOKEN CK_BBOOL CK_TRUE -CKA_PRIVATE CK_BBOOL CK_FALSE -CKA_MODIFIABLE CK_BBOOL CK_FALSE -CKA_LABEL UTF8 "TÜRKTRUST Elektronik Sertifika Hizmet Sağlayıcısı H6" -CKA_CERTIFICATE_TYPE CK_CERTIFICATE_TYPE CKC_X_509 -CKA_SUBJECT MULTILINE_OCTAL -\060\201\261\061\013\060\011\006\003\125\004\006\023\002\124\122 -\061\017\060\015\006\003\125\004\007\014\006\101\156\153\141\162 -\141\061\115\060\113\006\003\125\004\012\014\104\124\303\234\122 -\113\124\122\125\123\124\040\102\151\154\147\151\040\304\260\154 -\145\164\151\305\237\151\155\040\166\145\040\102\151\154\151\305 -\237\151\155\040\107\303\274\166\145\156\154\151\304\237\151\040 -\110\151\172\155\145\164\154\145\162\151\040\101\056\305\236\056 -\061\102\060\100\006\003\125\004\003\014\071\124\303\234\122\113 -\124\122\125\123\124\040\105\154\145\153\164\162\157\156\151\153 -\040\123\145\162\164\151\146\151\153\141\040\110\151\172\155\145 -\164\040\123\141\304\237\154\141\171\304\261\143\304\261\163\304 -\261\040\110\066 -END -CKA_ID UTF8 "0" -CKA_ISSUER MULTILINE_OCTAL -\060\201\261\061\013\060\011\006\003\125\004\006\023\002\124\122 -\061\017\060\015\006\003\125\004\007\014\006\101\156\153\141\162 -\141\061\115\060\113\006\003\125\004\012\014\104\124\303\234\122 -\113\124\122\125\123\124\040\102\151\154\147\151\040\304\260\154 -\145\164\151\305\237\151\155\040\166\145\040\102\151\154\151\305 -\237\151\155\040\107\303\274\166\145\156\154\151\304\237\151\040 -\110\151\172\155\145\164\154\145\162\151\040\101\056\305\236\056 -\061\102\060\100\006\003\125\004\003\014\071\124\303\234\122\113 -\124\122\125\123\124\040\105\154\145\153\164\162\157\156\151\153 -\040\123\145\162\164\151\146\151\153\141\040\110\151\172\155\145 -\164\040\123\141\304\237\154\141\171\304\261\143\304\261\163\304 -\261\040\110\066 -END -CKA_SERIAL_NUMBER MULTILINE_OCTAL -\002\006\175\241\362\145\354\212 -END -CKA_VALUE MULTILINE_OCTAL -\060\202\004\046\060\202\003\016\240\003\002\001\002\002\006\175 -\241\362\145\354\212\060\015\006\011\052\206\110\206\367\015\001 -\001\013\005\000\060\201\261\061\013\060\011\006\003\125\004\006 -\023\002\124\122\061\017\060\015\006\003\125\004\007\014\006\101 -\156\153\141\162\141\061\115\060\113\006\003\125\004\012\014\104 -\124\303\234\122\113\124\122\125\123\124\040\102\151\154\147\151 -\040\304\260\154\145\164\151\305\237\151\155\040\166\145\040\102 -\151\154\151\305\237\151\155\040\107\303\274\166\145\156\154\151 -\304\237\151\040\110\151\172\155\145\164\154\145\162\151\040\101 -\056\305\236\056\061\102\060\100\006\003\125\004\003\014\071\124 -\303\234\122\113\124\122\125\123\124\040\105\154\145\153\164\162 -\157\156\151\153\040\123\145\162\164\151\146\151\153\141\040\110 -\151\172\155\145\164\040\123\141\304\237\154\141\171\304\261\143 -\304\261\163\304\261\040\110\066\060\036\027\015\061\063\061\062 -\061\070\060\071\060\064\061\060\132\027\015\062\063\061\062\061 -\066\060\071\060\064\061\060\132\060\201\261\061\013\060\011\006 -\003\125\004\006\023\002\124\122\061\017\060\015\006\003\125\004 -\007\014\006\101\156\153\141\162\141\061\115\060\113\006\003\125 -\004\012\014\104\124\303\234\122\113\124\122\125\123\124\040\102 -\151\154\147\151\040\304\260\154\145\164\151\305\237\151\155\040 -\166\145\040\102\151\154\151\305\237\151\155\040\107\303\274\166 -\145\156\154\151\304\237\151\040\110\151\172\155\145\164\154\145 -\162\151\040\101\056\305\236\056\061\102\060\100\006\003\125\004 -\003\014\071\124\303\234\122\113\124\122\125\123\124\040\105\154 -\145\153\164\162\157\156\151\153\040\123\145\162\164\151\146\151 -\153\141\040\110\151\172\155\145\164\040\123\141\304\237\154\141 -\171\304\261\143\304\261\163\304\261\040\110\066\060\202\001\042 -\060\015\006\011\052\206\110\206\367\015\001\001\001\005\000\003 -\202\001\017\000\060\202\001\012\002\202\001\001\000\235\260\150 -\326\350\275\024\226\243\000\012\232\361\364\307\314\221\115\161 -\170\167\271\367\041\046\025\163\121\026\224\011\107\005\342\063 -\365\150\232\065\377\334\113\057\062\307\260\355\342\202\345\157 -\332\332\352\254\306\006\317\045\015\101\201\366\301\070\042\275 -\371\261\245\246\263\001\274\077\120\027\053\366\351\146\125\324 -\063\263\134\370\103\040\170\223\125\026\160\031\062\346\211\327 -\144\353\275\110\120\375\366\320\101\003\302\164\267\375\366\200 -\317\133\305\253\244\326\225\022\233\347\227\023\062\003\351\324 -\253\103\133\026\355\063\042\144\051\266\322\223\255\057\154\330 -\075\266\366\035\016\064\356\322\175\251\125\017\040\364\375\051 -\273\221\133\034\175\306\102\070\155\102\050\155\324\001\373\315 -\210\227\111\176\270\363\203\370\265\230\057\263\047\013\110\136 -\126\347\116\243\063\263\104\326\245\362\030\224\355\034\036\251 -\225\134\142\112\370\015\147\121\251\257\041\325\370\062\235\171 -\272\032\137\345\004\125\115\023\106\377\362\317\164\307\032\143 -\155\303\037\027\022\303\036\020\076\140\010\263\061\002\003\001 -\000\001\243\102\060\100\060\035\006\003\125\035\016\004\026\004 -\024\335\125\027\023\366\254\350\110\041\312\357\265\257\321\000 -\062\355\236\214\265\060\016\006\003\125\035\017\001\001\377\004 -\004\003\002\001\006\060\017\006\003\125\035\023\001\001\377\004 -\005\060\003\001\001\377\060\015\006\011\052\206\110\206\367\015 -\001\001\013\005\000\003\202\001\001\000\157\130\015\227\103\252 -\026\124\076\277\251\337\222\105\077\205\013\273\126\323\014\122 -\314\310\277\166\147\136\346\252\263\247\357\271\254\264\020\024 -\015\164\176\075\155\255\321\175\320\232\251\245\312\030\073\002 -\100\056\052\234\120\024\213\376\127\176\127\134\021\011\113\066 -\105\122\367\075\254\024\375\104\337\213\227\043\324\303\301\356 -\324\123\225\376\054\112\376\015\160\252\273\213\057\055\313\062 -\243\202\362\124\337\330\362\335\327\110\162\356\112\243\051\226 -\303\104\316\156\265\222\207\166\244\273\364\222\154\316\054\024 -\011\146\216\215\255\026\265\307\033\011\141\073\343\040\242\003 -\200\216\255\176\121\000\116\307\226\206\373\103\230\167\175\050 -\307\217\330\052\156\347\204\157\227\101\051\000\026\136\115\342 -\023\352\131\300\143\147\072\104\373\230\374\004\323\060\162\246 -\366\207\011\127\255\166\246\035\143\232\375\327\145\310\170\203 -\053\165\073\245\133\270\015\135\177\276\043\256\126\125\224\130 -\357\037\201\214\052\262\315\346\233\143\236\030\274\345\153\006 -\264\013\230\113\050\136\257\210\130\313 -END -CKA_NSS_MOZILLA_CA_POLICY CK_BBOOL CK_TRUE - -# Trust for "TÜRKTRUST Elektronik Sertifika Hizmet Sağlayıcısı H6" -# Issuer: CN=T..RKTRUST Elektronik Sertifika Hizmet Sa..lay..c..s.. H6,O=T..RKTRUST Bilgi ..leti..im ve Bili..im G..venli..i Hizmetleri A....,L=Ankara,C=TR -# Serial Number:7d:a1:f2:65:ec:8a -# Subject: CN=T..RKTRUST Elektronik Sertifika Hizmet Sa..lay..c..s.. H6,O=T..RKTRUST Bilgi ..leti..im ve Bili..im G..venli..i Hizmetleri A....,L=Ankara,C=TR -# Not Valid Before: Wed Dec 18 09:04:10 2013 -# Not Valid After : Sat Dec 16 09:04:10 2023 -# Fingerprint (SHA-256): 8D:E7:86:55:E1:BE:7F:78:47:80:0B:93:F6:94:D2:1D:36:8C:C0:6E:03:3E:7F:AB:04:BB:5E:B9:9D:A6:B7:00 -# Fingerprint (SHA1): 8A:5C:8C:EE:A5:03:E6:05:56:BA:D8:1B:D4:F6:C9:B0:ED:E5:2F:E0 -CKA_CLASS CK_OBJECT_CLASS CKO_NSS_TRUST -CKA_TOKEN CK_BBOOL CK_TRUE -CKA_PRIVATE CK_BBOOL CK_FALSE -CKA_MODIFIABLE CK_BBOOL CK_FALSE -CKA_LABEL UTF8 "TÜRKTRUST Elektronik Sertifika Hizmet Sağlayıcısı H6" -CKA_CERT_SHA1_HASH MULTILINE_OCTAL -\212\134\214\356\245\003\346\005\126\272\330\033\324\366\311\260 -\355\345\057\340 -END -CKA_CERT_MD5_HASH MULTILINE_OCTAL -\370\305\356\052\153\276\225\215\010\367\045\112\352\161\076\106 -END -CKA_ISSUER MULTILINE_OCTAL -\060\201\261\061\013\060\011\006\003\125\004\006\023\002\124\122 -\061\017\060\015\006\003\125\004\007\014\006\101\156\153\141\162 -\141\061\115\060\113\006\003\125\004\012\014\104\124\303\234\122 -\113\124\122\125\123\124\040\102\151\154\147\151\040\304\260\154 -\145\164\151\305\237\151\155\040\166\145\040\102\151\154\151\305 -\237\151\155\040\107\303\274\166\145\156\154\151\304\237\151\040 -\110\151\172\155\145\164\154\145\162\151\040\101\056\305\236\056 -\061\102\060\100\006\003\125\004\003\014\071\124\303\234\122\113 -\124\122\125\123\124\040\105\154\145\153\164\162\157\156\151\153 -\040\123\145\162\164\151\146\151\153\141\040\110\151\172\155\145 -\164\040\123\141\304\237\154\141\171\304\261\143\304\261\163\304 -\261\040\110\066 -END -CKA_SERIAL_NUMBER MULTILINE_OCTAL -\002\006\175\241\362\145\354\212 -END -CKA_TRUST_SERVER_AUTH CK_TRUST CKT_NSS_TRUSTED_DELEGATOR -CKA_TRUST_EMAIL_PROTECTION CK_TRUST CKT_NSS_MUST_VERIFY_TRUST -CKA_TRUST_CODE_SIGNING CK_TRUST CKT_NSS_MUST_VERIFY_TRUST -CKA_TRUST_STEP_UP_APPROVED CK_BBOOL CK_FALSE - -# # Certificate "Certinomis - Root CA" # # Issuer: CN=Certinomis - Root CA,OU=0002 433998903,O=Certinomis,C=FR @@ -30027,3 +29365,313 @@ CKA_TRUST_EMAIL_PROTECTION CK_TRUST CKT_NSS_TRUSTED_DELEGATOR CKA_TRUST_CODE_SIGNING CK_TRUST CKT_NSS_MUST_VERIFY_TRUST CKA_TRUST_STEP_UP_APPROVED CK_BBOOL CK_FALSE + +# +# Certificate "D-TRUST Root CA 3 2013" +# +# Issuer: CN=D-TRUST Root CA 3 2013,O=D-Trust GmbH,C=DE +# Serial Number: 1039788 (0xfddac) +# Subject: CN=D-TRUST Root CA 3 2013,O=D-Trust GmbH,C=DE +# Not Valid Before: Fri Sep 20 08:25:51 2013 +# Not Valid After : Wed Sep 20 08:25:51 2028 +# Fingerprint (SHA-256): A1:A8:6D:04:12:1E:B8:7F:02:7C:66:F5:33:03:C2:8E:57:39:F9:43:FC:84:B3:8A:D6:AF:00:90:35:DD:94:57 +# Fingerprint (SHA1): 6C:7C:CC:E7:D4:AE:51:5F:99:08:CD:3F:F6:E8:C3:78:DF:6F:EF:97 +CKA_CLASS CK_OBJECT_CLASS CKO_CERTIFICATE +CKA_TOKEN CK_BBOOL CK_TRUE +CKA_PRIVATE CK_BBOOL CK_FALSE +CKA_MODIFIABLE CK_BBOOL CK_FALSE +CKA_LABEL UTF8 "D-TRUST Root CA 3 2013" +CKA_CERTIFICATE_TYPE CK_CERTIFICATE_TYPE CKC_X_509 +CKA_SUBJECT MULTILINE_OCTAL +\060\105\061\013\060\011\006\003\125\004\006\023\002\104\105\061 +\025\060\023\006\003\125\004\012\014\014\104\055\124\162\165\163 +\164\040\107\155\142\110\061\037\060\035\006\003\125\004\003\014 +\026\104\055\124\122\125\123\124\040\122\157\157\164\040\103\101 +\040\063\040\062\060\061\063 +END +CKA_ID UTF8 "0" +CKA_ISSUER MULTILINE_OCTAL +\060\105\061\013\060\011\006\003\125\004\006\023\002\104\105\061 +\025\060\023\006\003\125\004\012\014\014\104\055\124\162\165\163 +\164\040\107\155\142\110\061\037\060\035\006\003\125\004\003\014 +\026\104\055\124\122\125\123\124\040\122\157\157\164\040\103\101 +\040\063\040\062\060\061\063 +END +CKA_SERIAL_NUMBER MULTILINE_OCTAL +\002\003\017\335\254 +END +CKA_VALUE MULTILINE_OCTAL +\060\202\004\016\060\202\002\366\240\003\002\001\002\002\003\017 +\335\254\060\015\006\011\052\206\110\206\367\015\001\001\013\005 +\000\060\105\061\013\060\011\006\003\125\004\006\023\002\104\105 +\061\025\060\023\006\003\125\004\012\014\014\104\055\124\162\165 +\163\164\040\107\155\142\110\061\037\060\035\006\003\125\004\003 +\014\026\104\055\124\122\125\123\124\040\122\157\157\164\040\103 +\101\040\063\040\062\060\061\063\060\036\027\015\061\063\060\071 +\062\060\060\070\062\065\065\061\132\027\015\062\070\060\071\062 +\060\060\070\062\065\065\061\132\060\105\061\013\060\011\006\003 +\125\004\006\023\002\104\105\061\025\060\023\006\003\125\004\012 +\014\014\104\055\124\162\165\163\164\040\107\155\142\110\061\037 +\060\035\006\003\125\004\003\014\026\104\055\124\122\125\123\124 +\040\122\157\157\164\040\103\101\040\063\040\062\060\061\063\060 +\202\001\042\060\015\006\011\052\206\110\206\367\015\001\001\001 +\005\000\003\202\001\017\000\060\202\001\012\002\202\001\001\000 +\304\173\102\222\202\037\354\355\124\230\216\022\300\312\011\337 +\223\156\072\223\134\033\344\020\167\236\116\151\210\154\366\341 +\151\362\366\233\242\141\261\275\007\040\164\230\145\361\214\046 +\010\315\250\065\312\200\066\321\143\155\350\104\172\202\303\154 +\136\336\273\350\066\322\304\150\066\214\237\062\275\204\042\340 +\334\302\356\020\106\071\155\257\223\071\256\207\346\303\274\011 +\311\054\153\147\133\331\233\166\165\114\013\340\273\305\327\274 +\076\171\362\137\276\321\220\127\371\256\366\146\137\061\277\323 +\155\217\247\272\112\363\043\145\273\267\357\243\045\327\012\352 +\130\266\357\210\372\372\171\262\122\130\325\360\254\214\241\121 +\164\051\225\252\121\073\220\062\003\237\034\162\164\220\336\075 +\355\141\322\345\343\375\144\107\345\271\267\112\251\367\037\256 +\226\206\004\254\057\343\244\201\167\267\132\026\377\330\017\077 +\366\267\170\314\244\257\372\133\074\022\133\250\122\211\162\357 +\210\363\325\104\201\206\225\043\237\173\335\274\331\064\357\174 +\224\074\252\300\101\302\343\235\120\032\300\344\031\042\374\263 +\002\003\001\000\001\243\202\001\005\060\202\001\001\060\017\006 +\003\125\035\023\001\001\377\004\005\060\003\001\001\377\060\035 +\006\003\125\035\016\004\026\004\024\077\220\310\175\307\025\157 +\363\044\217\251\303\057\113\242\017\041\262\057\347\060\016\006 +\003\125\035\017\001\001\377\004\004\003\002\001\006\060\201\276 +\006\003\125\035\037\004\201\266\060\201\263\060\164\240\162\240 +\160\206\156\154\144\141\160\072\057\057\144\151\162\145\143\164 +\157\162\171\056\144\055\164\162\165\163\164\056\156\145\164\057 +\103\116\075\104\055\124\122\125\123\124\045\062\060\122\157\157 +\164\045\062\060\103\101\045\062\060\063\045\062\060\062\060\061 +\063\054\117\075\104\055\124\162\165\163\164\045\062\060\107\155 +\142\110\054\103\075\104\105\077\143\145\162\164\151\146\151\143 +\141\164\145\162\145\166\157\143\141\164\151\157\156\154\151\163 +\164\060\073\240\071\240\067\206\065\150\164\164\160\072\057\057 +\143\162\154\056\144\055\164\162\165\163\164\056\156\145\164\057 +\143\162\154\057\144\055\164\162\165\163\164\137\162\157\157\164 +\137\143\141\137\063\137\062\060\061\063\056\143\162\154\060\015 +\006\011\052\206\110\206\367\015\001\001\013\005\000\003\202\001 +\001\000\016\131\016\130\344\164\110\043\104\317\064\041\265\234 +\024\032\255\232\113\267\263\210\155\134\251\027\160\360\052\237 +\215\173\371\173\205\372\307\071\350\020\010\260\065\053\137\317 +\002\322\323\234\310\013\036\356\005\124\256\067\223\004\011\175 +\154\217\302\164\274\370\034\224\276\061\001\100\055\363\044\040 +\267\204\125\054\134\310\365\164\112\020\031\213\243\307\355\065 +\326\011\110\323\016\300\272\071\250\260\106\002\260\333\306\210 +\131\302\276\374\173\261\053\317\176\142\207\125\226\314\001\157 +\233\147\041\225\065\213\370\020\374\161\033\267\113\067\151\246 +\073\326\354\213\356\301\260\363\045\311\217\222\175\241\352\303 +\312\104\277\046\245\164\222\234\343\164\353\235\164\331\313\115 +\207\330\374\264\151\154\213\240\103\007\140\170\227\351\331\223 +\174\302\106\274\233\067\122\243\355\212\074\023\251\173\123\113 +\111\232\021\005\054\013\156\126\254\037\056\202\154\340\151\147 +\265\016\155\055\331\344\300\025\361\077\372\030\162\341\025\155 +\047\133\055\060\050\053\237\110\232\144\053\231\357\362\165\111 +\137\134 +END +CKA_NSS_MOZILLA_CA_POLICY CK_BBOOL CK_TRUE + +# Trust for "D-TRUST Root CA 3 2013" +# Issuer: CN=D-TRUST Root CA 3 2013,O=D-Trust GmbH,C=DE +# Serial Number: 1039788 (0xfddac) +# Subject: CN=D-TRUST Root CA 3 2013,O=D-Trust GmbH,C=DE +# Not Valid Before: Fri Sep 20 08:25:51 2013 +# Not Valid After : Wed Sep 20 08:25:51 2028 +# Fingerprint (SHA-256): A1:A8:6D:04:12:1E:B8:7F:02:7C:66:F5:33:03:C2:8E:57:39:F9:43:FC:84:B3:8A:D6:AF:00:90:35:DD:94:57 +# Fingerprint (SHA1): 6C:7C:CC:E7:D4:AE:51:5F:99:08:CD:3F:F6:E8:C3:78:DF:6F:EF:97 +CKA_CLASS CK_OBJECT_CLASS CKO_NSS_TRUST +CKA_TOKEN CK_BBOOL CK_TRUE +CKA_PRIVATE CK_BBOOL CK_FALSE +CKA_MODIFIABLE CK_BBOOL CK_FALSE +CKA_LABEL UTF8 "D-TRUST Root CA 3 2013" +CKA_CERT_SHA1_HASH MULTILINE_OCTAL +\154\174\314\347\324\256\121\137\231\010\315\077\366\350\303\170 +\337\157\357\227 +END +CKA_CERT_MD5_HASH MULTILINE_OCTAL +\267\042\146\230\176\326\003\340\301\161\346\165\315\126\105\277 +END +CKA_ISSUER MULTILINE_OCTAL +\060\105\061\013\060\011\006\003\125\004\006\023\002\104\105\061 +\025\060\023\006\003\125\004\012\014\014\104\055\124\162\165\163 +\164\040\107\155\142\110\061\037\060\035\006\003\125\004\003\014 +\026\104\055\124\122\125\123\124\040\122\157\157\164\040\103\101 +\040\063\040\062\060\061\063 +END +CKA_SERIAL_NUMBER MULTILINE_OCTAL +\002\003\017\335\254 +END +CKA_TRUST_SERVER_AUTH CK_TRUST CKT_NSS_MUST_VERIFY_TRUST +CKA_TRUST_EMAIL_PROTECTION CK_TRUST CKT_NSS_TRUSTED_DELEGATOR +CKA_TRUST_CODE_SIGNING CK_TRUST CKT_NSS_MUST_VERIFY_TRUST +CKA_TRUST_STEP_UP_APPROVED CK_BBOOL CK_FALSE + +# +# Certificate "TUBITAK Kamu SM SSL Kok Sertifikasi - Surum 1" +# +# Issuer: CN=TUBITAK Kamu SM SSL Kok Sertifikasi - Surum 1,OU=Kamu Sertifikasyon Merkezi - Kamu SM,O=Turkiye Bilimsel ve Teknolojik Arastirma Kurumu - TUBITAK,L=Gebze - Kocaeli,C=TR +# Serial Number: 1 (0x1) +# Subject: CN=TUBITAK Kamu SM SSL Kok Sertifikasi - Surum 1,OU=Kamu Sertifikasyon Merkezi - Kamu SM,O=Turkiye Bilimsel ve Teknolojik Arastirma Kurumu - TUBITAK,L=Gebze - Kocaeli,C=TR +# Not Valid Before: Mon Nov 25 08:25:55 2013 +# Not Valid After : Sun Oct 25 08:25:55 2043 +# Fingerprint (SHA-256): 46:ED:C3:68:90:46:D5:3A:45:3F:B3:10:4A:B8:0D:CA:EC:65:8B:26:60:EA:16:29:DD:7E:86:79:90:64:87:16 +# Fingerprint (SHA1): 31:43:64:9B:EC:CE:27:EC:ED:3A:3F:0B:8F:0D:E4:E8:91:DD:EE:CA +CKA_CLASS CK_OBJECT_CLASS CKO_CERTIFICATE +CKA_TOKEN CK_BBOOL CK_TRUE +CKA_PRIVATE CK_BBOOL CK_FALSE +CKA_MODIFIABLE CK_BBOOL CK_FALSE +CKA_LABEL UTF8 "TUBITAK Kamu SM SSL Kok Sertifikasi - Surum 1" +CKA_CERTIFICATE_TYPE CK_CERTIFICATE_TYPE CKC_X_509 +CKA_SUBJECT MULTILINE_OCTAL +\060\201\322\061\013\060\011\006\003\125\004\006\023\002\124\122 +\061\030\060\026\006\003\125\004\007\023\017\107\145\142\172\145 +\040\055\040\113\157\143\141\145\154\151\061\102\060\100\006\003 +\125\004\012\023\071\124\165\162\153\151\171\145\040\102\151\154 +\151\155\163\145\154\040\166\145\040\124\145\153\156\157\154\157 +\152\151\153\040\101\162\141\163\164\151\162\155\141\040\113\165 +\162\165\155\165\040\055\040\124\125\102\111\124\101\113\061\055 +\060\053\006\003\125\004\013\023\044\113\141\155\165\040\123\145 +\162\164\151\146\151\153\141\163\171\157\156\040\115\145\162\153 +\145\172\151\040\055\040\113\141\155\165\040\123\115\061\066\060 +\064\006\003\125\004\003\023\055\124\125\102\111\124\101\113\040 +\113\141\155\165\040\123\115\040\123\123\114\040\113\157\153\040 +\123\145\162\164\151\146\151\153\141\163\151\040\055\040\123\165 +\162\165\155\040\061 +END +CKA_ID UTF8 "0" +CKA_ISSUER MULTILINE_OCTAL +\060\201\322\061\013\060\011\006\003\125\004\006\023\002\124\122 +\061\030\060\026\006\003\125\004\007\023\017\107\145\142\172\145 +\040\055\040\113\157\143\141\145\154\151\061\102\060\100\006\003 +\125\004\012\023\071\124\165\162\153\151\171\145\040\102\151\154 +\151\155\163\145\154\040\166\145\040\124\145\153\156\157\154\157 +\152\151\153\040\101\162\141\163\164\151\162\155\141\040\113\165 +\162\165\155\165\040\055\040\124\125\102\111\124\101\113\061\055 +\060\053\006\003\125\004\013\023\044\113\141\155\165\040\123\145 +\162\164\151\146\151\153\141\163\171\157\156\040\115\145\162\153 +\145\172\151\040\055\040\113\141\155\165\040\123\115\061\066\060 +\064\006\003\125\004\003\023\055\124\125\102\111\124\101\113\040 +\113\141\155\165\040\123\115\040\123\123\114\040\113\157\153\040 +\123\145\162\164\151\146\151\153\141\163\151\040\055\040\123\165 +\162\165\155\040\061 +END +CKA_SERIAL_NUMBER MULTILINE_OCTAL +\002\001\001 +END +CKA_VALUE MULTILINE_OCTAL +\060\202\004\143\060\202\003\113\240\003\002\001\002\002\001\001 +\060\015\006\011\052\206\110\206\367\015\001\001\013\005\000\060 +\201\322\061\013\060\011\006\003\125\004\006\023\002\124\122\061 +\030\060\026\006\003\125\004\007\023\017\107\145\142\172\145\040 +\055\040\113\157\143\141\145\154\151\061\102\060\100\006\003\125 +\004\012\023\071\124\165\162\153\151\171\145\040\102\151\154\151 +\155\163\145\154\040\166\145\040\124\145\153\156\157\154\157\152 +\151\153\040\101\162\141\163\164\151\162\155\141\040\113\165\162 +\165\155\165\040\055\040\124\125\102\111\124\101\113\061\055\060 +\053\006\003\125\004\013\023\044\113\141\155\165\040\123\145\162 +\164\151\146\151\153\141\163\171\157\156\040\115\145\162\153\145 +\172\151\040\055\040\113\141\155\165\040\123\115\061\066\060\064 +\006\003\125\004\003\023\055\124\125\102\111\124\101\113\040\113 +\141\155\165\040\123\115\040\123\123\114\040\113\157\153\040\123 +\145\162\164\151\146\151\153\141\163\151\040\055\040\123\165\162 +\165\155\040\061\060\036\027\015\061\063\061\061\062\065\060\070 +\062\065\065\065\132\027\015\064\063\061\060\062\065\060\070\062 +\065\065\065\132\060\201\322\061\013\060\011\006\003\125\004\006 +\023\002\124\122\061\030\060\026\006\003\125\004\007\023\017\107 +\145\142\172\145\040\055\040\113\157\143\141\145\154\151\061\102 +\060\100\006\003\125\004\012\023\071\124\165\162\153\151\171\145 +\040\102\151\154\151\155\163\145\154\040\166\145\040\124\145\153 +\156\157\154\157\152\151\153\040\101\162\141\163\164\151\162\155 +\141\040\113\165\162\165\155\165\040\055\040\124\125\102\111\124 +\101\113\061\055\060\053\006\003\125\004\013\023\044\113\141\155 +\165\040\123\145\162\164\151\146\151\153\141\163\171\157\156\040 +\115\145\162\153\145\172\151\040\055\040\113\141\155\165\040\123 +\115\061\066\060\064\006\003\125\004\003\023\055\124\125\102\111 +\124\101\113\040\113\141\155\165\040\123\115\040\123\123\114\040 +\113\157\153\040\123\145\162\164\151\146\151\153\141\163\151\040 +\055\040\123\165\162\165\155\040\061\060\202\001\042\060\015\006 +\011\052\206\110\206\367\015\001\001\001\005\000\003\202\001\017 +\000\060\202\001\012\002\202\001\001\000\257\165\060\063\252\273 +\153\323\231\054\022\067\204\331\215\173\227\200\323\156\347\377 +\233\120\225\076\220\225\126\102\327\031\174\046\204\215\222\372 +\001\035\072\017\342\144\070\267\214\274\350\210\371\213\044\253 +\056\243\365\067\344\100\216\030\045\171\203\165\037\073\377\154 +\250\305\306\126\370\264\355\212\104\243\253\154\114\374\035\320 +\334\357\150\275\317\344\252\316\360\125\367\242\064\324\203\153 +\067\174\034\302\376\265\003\354\127\316\274\264\265\305\355\000 +\017\123\067\052\115\364\117\014\203\373\206\317\313\376\214\116 +\275\207\371\247\213\041\127\234\172\337\003\147\211\054\235\227 +\141\247\020\270\125\220\177\016\055\047\070\164\337\347\375\332 +\116\022\343\115\025\042\002\310\340\340\374\017\255\212\327\311 +\124\120\314\073\017\312\026\200\204\320\121\126\303\216\126\177 +\211\042\063\057\346\205\012\275\245\250\033\066\336\323\334\054 +\155\073\307\023\275\131\043\054\346\345\244\367\330\013\355\352 +\220\100\104\250\225\273\223\325\320\200\064\266\106\170\016\037 +\000\223\106\341\356\351\371\354\117\027\002\003\001\000\001\243 +\102\060\100\060\035\006\003\125\035\016\004\026\004\024\145\077 +\307\212\206\306\074\335\074\124\134\065\370\072\355\122\014\107 +\127\310\060\016\006\003\125\035\017\001\001\377\004\004\003\002 +\001\006\060\017\006\003\125\035\023\001\001\377\004\005\060\003 +\001\001\377\060\015\006\011\052\206\110\206\367\015\001\001\013 +\005\000\003\202\001\001\000\052\077\341\361\062\216\256\341\230 +\134\113\136\317\153\036\152\011\322\042\251\022\307\136\127\175 +\163\126\144\200\204\172\223\344\011\271\020\315\237\052\047\341 +\000\167\276\110\310\065\250\201\237\344\270\054\311\177\016\260 +\322\113\067\135\352\271\325\013\136\064\275\364\163\051\303\355 +\046\025\234\176\010\123\212\130\215\320\113\050\337\301\263\337 +\040\363\371\343\343\072\337\314\234\224\330\116\117\303\153\027 +\267\367\162\350\255\146\063\265\045\123\253\340\370\114\251\235 +\375\362\015\272\256\271\331\252\306\153\371\223\273\256\253\270 +\227\074\003\032\272\103\306\226\271\105\162\070\263\247\241\226 +\075\221\173\176\300\041\123\114\207\355\362\013\124\225\121\223 +\325\042\245\015\212\361\223\016\076\124\016\260\330\311\116\334 +\362\061\062\126\352\144\371\352\265\235\026\146\102\162\363\177 +\323\261\061\103\374\244\216\027\361\155\043\253\224\146\370\255 +\373\017\010\156\046\055\177\027\007\011\262\214\373\120\300\237 +\226\215\317\266\375\000\235\132\024\232\277\002\104\365\301\302 +\237\042\136\242\017\241\343 +END +CKA_NSS_MOZILLA_CA_POLICY CK_BBOOL CK_TRUE + +# Trust for "TUBITAK Kamu SM SSL Kok Sertifikasi - Surum 1" +# Issuer: CN=TUBITAK Kamu SM SSL Kok Sertifikasi - Surum 1,OU=Kamu Sertifikasyon Merkezi - Kamu SM,O=Turkiye Bilimsel ve Teknolojik Arastirma Kurumu - TUBITAK,L=Gebze - Kocaeli,C=TR +# Serial Number: 1 (0x1) +# Subject: CN=TUBITAK Kamu SM SSL Kok Sertifikasi - Surum 1,OU=Kamu Sertifikasyon Merkezi - Kamu SM,O=Turkiye Bilimsel ve Teknolojik Arastirma Kurumu - TUBITAK,L=Gebze - Kocaeli,C=TR +# Not Valid Before: Mon Nov 25 08:25:55 2013 +# Not Valid After : Sun Oct 25 08:25:55 2043 +# Fingerprint (SHA-256): 46:ED:C3:68:90:46:D5:3A:45:3F:B3:10:4A:B8:0D:CA:EC:65:8B:26:60:EA:16:29:DD:7E:86:79:90:64:87:16 +# Fingerprint (SHA1): 31:43:64:9B:EC:CE:27:EC:ED:3A:3F:0B:8F:0D:E4:E8:91:DD:EE:CA +CKA_CLASS CK_OBJECT_CLASS CKO_NSS_TRUST +CKA_TOKEN CK_BBOOL CK_TRUE +CKA_PRIVATE CK_BBOOL CK_FALSE +CKA_MODIFIABLE CK_BBOOL CK_FALSE +CKA_LABEL UTF8 "TUBITAK Kamu SM SSL Kok Sertifikasi - Surum 1" +CKA_CERT_SHA1_HASH MULTILINE_OCTAL +\061\103\144\233\354\316\047\354\355\072\077\013\217\015\344\350 +\221\335\356\312 +END +CKA_CERT_MD5_HASH MULTILINE_OCTAL +\334\000\201\334\151\057\076\057\260\073\366\075\132\221\216\111 +END +CKA_ISSUER MULTILINE_OCTAL +\060\201\322\061\013\060\011\006\003\125\004\006\023\002\124\122 +\061\030\060\026\006\003\125\004\007\023\017\107\145\142\172\145 +\040\055\040\113\157\143\141\145\154\151\061\102\060\100\006\003 +\125\004\012\023\071\124\165\162\153\151\171\145\040\102\151\154 +\151\155\163\145\154\040\166\145\040\124\145\153\156\157\154\157 +\152\151\153\040\101\162\141\163\164\151\162\155\141\040\113\165 +\162\165\155\165\040\055\040\124\125\102\111\124\101\113\061\055 +\060\053\006\003\125\004\013\023\044\113\141\155\165\040\123\145 +\162\164\151\146\151\153\141\163\171\157\156\040\115\145\162\153 +\145\172\151\040\055\040\113\141\155\165\040\123\115\061\066\060 +\064\006\003\125\004\003\023\055\124\125\102\111\124\101\113\040 +\113\141\155\165\040\123\115\040\123\123\114\040\113\157\153\040 +\123\145\162\164\151\146\151\153\141\163\151\040\055\040\123\165 +\162\165\155\040\061 +END +CKA_SERIAL_NUMBER MULTILINE_OCTAL +\002\001\001 +END +CKA_TRUST_SERVER_AUTH CK_TRUST CKT_NSS_TRUSTED_DELEGATOR +CKA_TRUST_EMAIL_PROTECTION CK_TRUST CKT_NSS_MUST_VERIFY_TRUST +CKA_TRUST_CODE_SIGNING CK_TRUST CKT_NSS_MUST_VERIFY_TRUST +CKA_TRUST_STEP_UP_APPROVED CK_BBOOL CK_FALSE diff -Nru firefox-54.0~b1+build1/security/nss/lib/ckfw/builtins/nssckbi.h firefox-54.0~b2+build1/security/nss/lib/ckfw/builtins/nssckbi.h --- firefox-54.0~b1+build1/security/nss/lib/ckfw/builtins/nssckbi.h 2017-04-20 12:54:19.000000000 +0000 +++ firefox-54.0~b2+build1/security/nss/lib/ckfw/builtins/nssckbi.h 2017-04-25 05:28:31.000000000 +0000 @@ -22,31 +22,32 @@ * to the list of trusted certificates. * * The NSS_BUILTINS_LIBRARY_VERSION_MINOR macro needs to be bumped - * for each NSS minor release AND whenever we change the list of - * trusted certificates. 10 minor versions are allocated for each - * NSS 3.x branch as follows, allowing us to change the list of - * trusted certificates up to 9 times on each branch. - * - NSS 3.5 branch: 3-9 - * - NSS 3.6 branch: 10-19 - * - NSS 3.7 branch: 20-29 - * - NSS 3.8 branch: 30-39 - * - NSS 3.9 branch: 40-49 - * - NSS 3.10 branch: 50-59 - * - NSS 3.11 branch: 60-69 - * ... - * - NSS 3.12 branch: 70-89 - * - NSS 3.13 branch: 90-99 - * - NSS 3.14 branch: 100-109 - * ... - * - NSS 3.29 branch: 250-255 + * whenever we change the list of trusted certificates. + * + * Please use the following rules when increasing the version number: + * + * - starting with version 2.14, NSS_BUILTINS_LIBRARY_VERSION_MINOR + * must always be an EVEN number (e.g. 16, 18, 20 etc.) + * + * - whenever possible, if older branches require a modification to the + * list, these changes should be made on the main line of development (trunk), + * and the older branches should update to the most recent list. + * + * - ODD minor version numbers are reserved to indicate a snapshot that has + * deviated from the main line of development, e.g. if it was necessary + * to modify the list on a stable branch. + * Once the version has been changed to an odd number (e.g. 2.13) on a branch, + * it should remain unchanged on that branch, even if further changes are + * made on that branch. * * NSS_BUILTINS_LIBRARY_VERSION_MINOR is a CK_BYTE. It's not clear * whether we may use its full range (0-255) or only 0-99 because * of the comment in the CK_VERSION type definition. + * It's recommend to switch back to 0 after having reached version 98/99. */ #define NSS_BUILTINS_LIBRARY_VERSION_MAJOR 2 -#define NSS_BUILTINS_LIBRARY_VERSION_MINOR 11 -#define NSS_BUILTINS_LIBRARY_VERSION "2.11" +#define NSS_BUILTINS_LIBRARY_VERSION_MINOR 14 +#define NSS_BUILTINS_LIBRARY_VERSION "2.14" /* These version numbers detail the semantic changes to the ckfw engine. */ #define NSS_BUILTINS_HARDWARE_VERSION_MAJOR 1 diff -Nru firefox-54.0~b1+build1/security/nss/lib/nss/nss.h firefox-54.0~b2+build1/security/nss/lib/nss/nss.h --- firefox-54.0~b1+build1/security/nss/lib/nss/nss.h 2017-04-20 12:54:19.000000000 +0000 +++ firefox-54.0~b2+build1/security/nss/lib/nss/nss.h 2017-04-25 05:28:30.000000000 +0000 @@ -22,10 +22,10 @@ * The format of the version string should be * ".[.[.]][ ][ ]" */ -#define NSS_VERSION "3.30.1" _NSS_CUSTOMIZED +#define NSS_VERSION "3.30.2" _NSS_CUSTOMIZED #define NSS_VMAJOR 3 #define NSS_VMINOR 30 -#define NSS_VPATCH 1 +#define NSS_VPATCH 2 #define NSS_VBUILD 0 #define NSS_BETA PR_FALSE diff -Nru firefox-54.0~b1+build1/security/nss/lib/softoken/softkver.h firefox-54.0~b2+build1/security/nss/lib/softoken/softkver.h --- firefox-54.0~b1+build1/security/nss/lib/softoken/softkver.h 2017-04-20 12:54:19.000000000 +0000 +++ firefox-54.0~b2+build1/security/nss/lib/softoken/softkver.h 2017-04-25 05:28:30.000000000 +0000 @@ -21,10 +21,10 @@ * The format of the version string should be * ".[.[.]][ ][ ]" */ -#define SOFTOKEN_VERSION "3.30.1" SOFTOKEN_ECC_STRING +#define SOFTOKEN_VERSION "3.30.2" SOFTOKEN_ECC_STRING #define SOFTOKEN_VMAJOR 3 #define SOFTOKEN_VMINOR 30 -#define SOFTOKEN_VPATCH 1 +#define SOFTOKEN_VPATCH 2 #define SOFTOKEN_VBUILD 0 #define SOFTOKEN_BETA PR_FALSE diff -Nru firefox-54.0~b1+build1/security/nss/lib/util/nssutil.h firefox-54.0~b2+build1/security/nss/lib/util/nssutil.h --- firefox-54.0~b1+build1/security/nss/lib/util/nssutil.h 2017-04-20 12:54:19.000000000 +0000 +++ firefox-54.0~b2+build1/security/nss/lib/util/nssutil.h 2017-04-25 05:28:31.000000000 +0000 @@ -19,10 +19,10 @@ * The format of the version string should be * ".[.[.]][ ]" */ -#define NSSUTIL_VERSION "3.30.1" +#define NSSUTIL_VERSION "3.30.2" #define NSSUTIL_VMAJOR 3 #define NSSUTIL_VMINOR 30 -#define NSSUTIL_VPATCH 1 +#define NSSUTIL_VPATCH 2 #define NSSUTIL_VBUILD 0 #define NSSUTIL_BETA PR_FALSE diff -Nru firefox-54.0~b1+build1/security/nss/TAG-INFO firefox-54.0~b2+build1/security/nss/TAG-INFO --- firefox-54.0~b1+build1/security/nss/TAG-INFO 2017-04-20 12:54:19.000000000 +0000 +++ firefox-54.0~b2+build1/security/nss/TAG-INFO 2017-04-25 05:28:30.000000000 +0000 @@ -1 +1 @@ -NSS_3_30_1_RTM +NSS_3_30_2_RTM diff -Nru firefox-54.0~b1+build1/SOURCE_CHANGESET firefox-54.0~b2+build1/SOURCE_CHANGESET --- firefox-54.0~b1+build1/SOURCE_CHANGESET 2017-04-20 12:54:32.000000000 +0000 +++ firefox-54.0~b2+build1/SOURCE_CHANGESET 2017-04-25 05:28:38.000000000 +0000 @@ -1 +1 @@ -cf76e00dcd6f142acf5b49f8beeb0ac95b2afa31 \ No newline at end of file +ca3c6131b6eadf753445b3cd7a54e29b41ab11aa \ No newline at end of file diff -Nru firefox-54.0~b1+build1/taskcluster/docker/firefox-snap/snapcraft.yaml.in firefox-54.0~b2+build1/taskcluster/docker/firefox-snap/snapcraft.yaml.in --- firefox-54.0~b1+build1/taskcluster/docker/firefox-snap/snapcraft.yaml.in 2017-04-20 12:54:20.000000000 +0000 +++ firefox-54.0~b2+build1/taskcluster/docker/firefox-snap/snapcraft.yaml.in 2017-04-25 05:28:31.000000000 +0000 @@ -34,4 +34,5 @@ - libpulse0 - libgl1-mesa-dri - libgl1-mesa-glx + - libmirclient9 after: [desktop-gtk3] diff -Nru firefox-54.0~b1+build1/taskcluster/taskgraph/transforms/task.py firefox-54.0~b2+build1/taskcluster/taskgraph/transforms/task.py --- firefox-54.0~b1+build1/taskcluster/taskgraph/transforms/task.py 2017-04-20 12:54:21.000000000 +0000 +++ firefox-54.0~b2+build1/taskcluster/taskgraph/transforms/task.py 2017-04-25 05:28:31.000000000 +0000 @@ -355,7 +355,7 @@ }], # "Invalid" is a noop for try and other non-supported branches - Required('google-play-track'): Any('production', 'beta', 'alpha', 'invalid'), + Required('google-play-track'): Any('production', 'beta', 'alpha', 'rollout', 'invalid'), Required('dry-run', default=True): bool, Optional('rollout-percentage'): int, }), diff -Nru firefox-54.0~b1+build1/taskcluster/taskgraph/util/scriptworker.py firefox-54.0~b2+build1/taskcluster/taskgraph/util/scriptworker.py --- firefox-54.0~b1+build1/taskcluster/taskgraph/util/scriptworker.py 2017-04-20 12:54:20.000000000 +0000 +++ firefox-54.0~b2+build1/taskcluster/taskgraph/util/scriptworker.py 2017-04-25 05:28:31.000000000 +0000 @@ -214,7 +214,7 @@ PUSH_APK_GOOGLE_PLAY_TRACT = { 'aurora': 'beta', 'beta': 'production', - 'release': 'production', + 'release': 'rollout', 'default': 'invalid', } @@ -228,11 +228,13 @@ PUSH_APK_DRY_RUN_OPTION = { 'aurora': False, 'beta': False, - 'release': True, + 'release': False, 'default': True, } PUSH_APK_ROLLOUT_PERCENTAGE = { + # XXX Please make sure to change PUSH_APK_GOOGLE_PLAY_TRACT to 'rollout' if you add a new + # supported project 'release': 10, 'default': None, } diff -Nru firefox-54.0~b1+build1/testing/crashtest/autophone-crashtest-webrtc.list firefox-54.0~b2+build1/testing/crashtest/autophone-crashtest-webrtc.list --- firefox-54.0~b1+build1/testing/crashtest/autophone-crashtest-webrtc.list 2017-04-20 12:54:20.000000000 +0000 +++ firefox-54.0~b2+build1/testing/crashtest/autophone-crashtest-webrtc.list 1970-01-01 00:00:00.000000000 +0000 @@ -1,4 +0,0 @@ -# Add your lines including crashtest manifests below here. -# DO NOT ADD CRASHTESTS INDIVIDUALLY HERE! - -include ../../dom/media/tests/crashtests/crashtests.list diff -Nru firefox-54.0~b1+build1/testing/firefox-ui/harness/firefox_ui_harness/testcases.py firefox-54.0~b2+build1/testing/firefox-ui/harness/firefox_ui_harness/testcases.py --- firefox-54.0~b1+build1/testing/firefox-ui/harness/firefox_ui_harness/testcases.py 2017-04-20 12:54:21.000000000 +0000 +++ firefox-54.0~b2+build1/testing/firefox-ui/harness/firefox_ui_harness/testcases.py 2017-04-25 05:28:31.000000000 +0000 @@ -312,7 +312,7 @@ self.software_update.force_fallback() # Restart Firefox to apply the downloaded update - self.restart() + self.restart(callback=lambda: about_window.deck.apply.button.click()) def download_and_apply_forced_update(self): self.check_update_not_applied() @@ -341,9 +341,13 @@ self.wait_for_update_applied(about_window) finally: - if about_window: - self.update_status['patch'] = self.patch_info + self.update_status['patch'] = self.patch_info + + # Restart Firefox to apply the downloaded fallback update + self.assertIsNotNone(about_window) + self.restart(callback=lambda: about_window.deck.apply.button.click()) + # For a broken partial update, the software update window is used else: try: self.assertEqual(dialog.wizard.selected_panel, @@ -355,8 +359,8 @@ finally: self.update_status['patch'] = self.patch_info - # Restart Firefox to apply the update - self.restart() + # Restart Firefox to apply the downloaded fallback update + self.restart(callback=lambda: dialog.wizard.finish_button.click()) def read_update_log(self): """Read the content of the update log file for the last update attempt.""" diff -Nru firefox-54.0~b1+build1/testing/marionette/client/marionette_driver/geckoinstance.py firefox-54.0~b2+build1/testing/marionette/client/marionette_driver/geckoinstance.py --- firefox-54.0~b1+build1/testing/marionette/client/marionette_driver/geckoinstance.py 2017-04-20 12:54:21.000000000 +0000 +++ firefox-54.0~b2+build1/testing/marionette/client/marionette_driver/geckoinstance.py 2017-04-25 05:28:31.000000000 +0000 @@ -74,6 +74,8 @@ # Enable Marionette component "marionette.enabled": True, + # Deprecated, and can be removed in Firefox 60.0 + "marionette.defaultPrefs.enabled": True, # Disable recommended automation prefs in CI "marionette.prefs.recommended": False, diff -Nru firefox-54.0~b1+build1/testing/marionette/puppeteer/firefox/firefox_puppeteer/mixins.py firefox-54.0~b2+build1/testing/marionette/puppeteer/firefox/firefox_puppeteer/mixins.py --- firefox-54.0~b1+build1/testing/marionette/puppeteer/firefox/firefox_puppeteer/mixins.py 2017-04-20 12:54:21.000000000 +0000 +++ firefox-54.0~b2+build1/testing/marionette/puppeteer/firefox/firefox_puppeteer/mixins.py 2017-04-25 05:28:31.000000000 +0000 @@ -60,15 +60,16 @@ self.browser.tabbar.close_all_tabs([self.browser.tabbar.tabs[0]]) self.browser.tabbar.tabs[0].switch_to() - def restart(self, **kwargs): + def restart(self, *args, **kwargs): """Restart Firefox and re-initialize data. :param flags: Specific restart flags for Firefox """ - if kwargs.get('clean'): - self.marionette.restart(clean=True) - else: - self.marionette.restart(in_app=True) + # If no clean restart is requested, always use an in_app one + if not kwargs.get('clean'): + kwargs.update({"in_app": True}) + + self.marionette.restart(*args, **kwargs) # Ensure that we always have a valid browser instance available self.browser = self.puppeteer.windows.switch_to(lambda win: type(win) is BrowserWindow) diff -Nru firefox-54.0~b1+build1/testing/mochitest/manifests/autophone-media.ini firefox-54.0~b2+build1/testing/mochitest/manifests/autophone-media.ini --- firefox-54.0~b1+build1/testing/mochitest/manifests/autophone-media.ini 2017-04-20 12:54:21.000000000 +0000 +++ firefox-54.0~b2+build1/testing/mochitest/manifests/autophone-media.ini 1970-01-01 00:00:00.000000000 +0000 @@ -1,14 +0,0 @@ -[DEFAULT] -subsuite = media - -[../tests/dom/media/test/test_can_play_type.html] -skip-if = (android_version == '23' && debug) || (android_version == '25' && debug) # android(bug 1232305) -[../tests/dom/media/test/test_can_play_type_mpeg.html] -skip-if = (android_version == '15') || (android_version == '23' && debug) || (android_version == '25' && debug) # android(bug 1232305) -[../tests/dom/media/test/test_audio1.html] -[../tests/dom/media/test/test_decode_error.html] -[../tests/dom/media/test/test_imagecapture.html] -[../tests/dom/media/test/test_played.html] -skip-if = toolkit == 'android' # bug 1110922, android(bug 1153860, bug 1232305) -[../tests/dom/media/test/test_playback.html] -skip-if = toolkit == 'android' # bug 1316177 diff -Nru firefox-54.0~b1+build1/testing/mochitest/manifests/autophone-webrtc.ini firefox-54.0~b2+build1/testing/mochitest/manifests/autophone-webrtc.ini --- firefox-54.0~b1+build1/testing/mochitest/manifests/autophone-webrtc.ini 2017-04-20 12:54:21.000000000 +0000 +++ firefox-54.0~b2+build1/testing/mochitest/manifests/autophone-webrtc.ini 1970-01-01 00:00:00.000000000 +0000 @@ -1,157 +0,0 @@ -[DEFAULT] -subsuite = media - -[../tests/dom/media/tests/mochitest/test_dataChannel_basicAudio.html] -[../tests/dom/media/tests/mochitest/test_dataChannel_basicAudioVideoCombined.html] -skip-if = true # Bug 1189784 -[../tests/dom/media/tests/mochitest/test_dataChannel_basicAudioVideo.html] -[../tests/dom/media/tests/mochitest/test_dataChannel_basicAudioVideoNoBundle.html] -[../tests/dom/media/tests/mochitest/test_dataChannel_basicDataOnly.html] -[../tests/dom/media/tests/mochitest/test_dataChannel_basicVideo.html] -[../tests/dom/media/tests/mochitest/test_dataChannel_bug1013809.html] -[../tests/dom/media/tests/mochitest/test_dataChannel_noOffer.html] -[../tests/dom/media/tests/mochitest/test_enumerateDevices.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_addTrackRemoveTrack.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_audioCapture.html] -skip-if = true # timeouts, see Bug 1264333 -[../tests/dom/media/tests/mochitest/test_getUserMedia_basicAudio.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_basicScreenshare.html] -skip-if = true # OverConstrained error, no screenshare on Android -[../tests/dom/media/tests/mochitest/test_getUserMedia_basicTabshare.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_basicVideoAudio.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_basicVideo.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_basicVideo_playAfterLoadedmetadata.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_basicWindowshare.html] -skip-if = true # OverConstrained error, no windowshare on Android -[../tests/dom/media/tests/mochitest/test_getUserMedia_bug1223696.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_callbacks.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_constraints.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_gumWithinGum.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_loadedmetadata.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_mediaStreamConstructors.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_peerIdentity.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_playAudioTwice.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_playVideoAudioTwice.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_playVideoTwice.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_spinEventLoop.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_stopAudioStream.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_stopAudioStreamWithFollowupAudio.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_stopVideoAudioStream.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_stopVideoAudioStreamWithFollowupVideoAudio.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_stopVideoStream.html] -[../tests/dom/media/tests/mochitest/test_getUserMedia_stopVideoStreamWithFollowupVideo.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_addDataChannel.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_addDataChannelNoBundle.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_addIceCandidate.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_addSecondAudioStream.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_addSecondAudioStreamNoBundle.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_addSecondVideoStream.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_addSecondVideoStreamNoBundle.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_answererAddSecondAudioStream.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_basicAudioDynamicPtMissingRtpmap.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_basicAudio.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_basicAudioPcmaPcmuOnly.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_basicAudioRequireEOC.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_basicAudioVideoCombined.html] -skip-if = true # Bug 1189784 -[../tests/dom/media/tests/mochitest/test_peerConnection_basicAudioVideo.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_basicAudioVideoNoBundle.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_basicAudioVideoNoBundleNoRtcpMux.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_basicAudioVideoNoRtcpMux.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_basicH264Video.html] -skip-if = true # Bug 1149374 -[../tests/dom/media/tests/mochitest/test_peerConnection_basicScreenshare.html] -skip-if = true # No screenshare on Android -[../tests/dom/media/tests/mochitest/test_peerConnection_basicVideo.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_basicWindowshare.html] -skip-if = true # No windowshare on Android -[../tests/dom/media/tests/mochitest/test_peerConnection_bug1013809.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_bug1042791.html] -skip-if = true # Bug 1149374 -[../tests/dom/media/tests/mochitest/test_peerConnection_bug1064223.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_bug1227781.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_bug822674.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_bug825703.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_bug827843.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_bug834153.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_callbacks.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_capturedVideo.html] -skip-if = true # Bug 1264340 -[../tests/dom/media/tests/mochitest/test_peerConnection_captureStream_canvas_2d.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_captureStream_canvas_webgl.html] -skip-if = android_version == '17' # bug 1346630 -[../tests/dom/media/tests/mochitest/test_peerConnection_certificates.html] -skip-if = true # Bug 1180968 -[../tests/dom/media/tests/mochitest/test_peerConnection_closeDuringIce.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_close.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_errorCallbacks.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_forwarding_basicAudioVideoCombined.html] -skip-if = true # Bug 1189784 -[../tests/dom/media/tests/mochitest/test_peerConnection_iceFailure.html] -skip-if = true # Bug 1180388 -[../tests/dom/media/tests/mochitest/test_peerConnection_localReofferRollback.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_localRollback.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_multiple_captureStream_canvas_2d.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_noTrickleAnswer.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_noTrickleOfferAnswer.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_noTrickleOffer.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_offerRequiresReceiveAudio.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_offerRequiresReceiveVideoAudio.html] -skip-if = true # Bug 1189784 -[../tests/dom/media/tests/mochitest/test_peerConnection_offerRequiresReceiveVideo.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_promiseSendOnly.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_relayOnly.html] -skip-if = true # Bug 1222983 -[../tests/dom/media/tests/mochitest/test_peerConnection_remoteReofferRollback.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_remoteRollback.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_removeAudioTrack.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_removeThenAddAudioTrack.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_removeThenAddAudioTrackNoBundle.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_removeThenAddVideoTrack.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_removeThenAddVideoTrackNoBundle.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_removeVideoTrack.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_replaceTrack.html] -skip-if = true # Bug 1189784 -[../tests/dom/media/tests/mochitest/test_peerConnection_replaceVideoThenRenegotiate.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_scaleResolution.html] -skip-if = true # Bug 1264343 -[../tests/dom/media/tests/mochitest/test_peerConnection_setLocalAnswerInHaveLocalOffer.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_setLocalAnswerInStable.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_setLocalOfferInHaveRemoteOffer.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_setParameters.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_setRemoteAnswerInHaveRemoteOffer.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_setRemoteAnswerInStable.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_setRemoteOfferInHaveLocalOffer.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_simulcastOffer.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_syncSetDescription.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_throwInCallbacks.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_toJSON.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_trackDisabling.html] -skip-if = true # Bug 1265878 -[../tests/dom/media/tests/mochitest/test_peerConnection_twoAudioStreams.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_twoAudioTracksInOneStream.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_twoAudioVideoStreamsCombined.html] -skip-if = true # Bug 1189784 -[../tests/dom/media/tests/mochitest/test_peerConnection_twoAudioVideoStreams.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_twoVideoStreams.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_twoVideoTracksInOneStream.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_verifyAudioAfterRenegotiation.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_verifyVideoAfterRenegotiation.html] -[../tests/dom/media/tests/mochitest/test_peerConnection_webAudio.html] -[../tests/dom/media/tests/mochitest/test_selftest.html] -[../tests/dom/media/tests/mochitest/identity/test_fingerprints.html] -skip-if = true # Bug 1200411 -[../tests/dom/media/tests/mochitest/identity/test_getIdentityAssertion.html] -skip-if = true # Bug 1200411 -[../tests/dom/media/tests/mochitest/identity/test_idpproxy.html] -skip-if = true # Bug 1200411 -[../tests/dom/media/tests/mochitest/identity/test_loginNeeded.html] -skip-if = true # Bug 1200411 -[../tests/dom/media/tests/mochitest/identity/test_peerConnection_asymmetricIsolation.html] -skip-if = true # Bug 1200411 -[../tests/dom/media/tests/mochitest/identity/test_peerConnection_peerIdentity.html] -skip-if = true # Bug 1200411 -[../tests/dom/media/tests/mochitest/identity/test_setIdentityProvider.html] -skip-if = true # Bug 1200411 -[../tests/dom/media/tests/mochitest/identity/test_setIdentityProviderWithErrors.html] -skip-if = true # Bug 1200411 diff -Nru firefox-54.0~b1+build1/testing/mochitest/manifests/moz.build firefox-54.0~b2+build1/testing/mochitest/manifests/moz.build --- firefox-54.0~b1+build1/testing/mochitest/manifests/moz.build 2017-04-20 12:54:21.000000000 +0000 +++ firefox-54.0~b2+build1/testing/mochitest/manifests/moz.build 2017-04-25 05:28:31.000000000 +0000 @@ -5,7 +5,5 @@ # file, You can obtain one at http://mozilla.org/MPL/2.0/. TEST_HARNESS_FILES.testing.mochitest.manifests += [ - 'autophone-media.ini', - 'autophone-webrtc.ini', 'emulator-jb.ini', ] diff -Nru firefox-54.0~b1+build1/testing/moz.build firefox-54.0~b2+build1/testing/moz.build --- firefox-54.0~b1+build1/testing/moz.build 2017-04-20 12:54:21.000000000 +0000 +++ firefox-54.0~b2+build1/testing/moz.build 2017-04-25 05:28:31.000000000 +0000 @@ -64,9 +64,6 @@ with Files("crashtest/**"): BUG_COMPONENT = ("Testing", "Reftest") -with Files("crashtest/autophone-crashtest-webrtc.list"): - BUG_COMPONENT = ("Testing", "Autophone") - with Files("config/marionette*"): BUG_COMPONENT = ("Testing", "Marionette") diff -Nru firefox-54.0~b1+build1/testing/profiles/prefs_general.js firefox-54.0~b2+build1/testing/profiles/prefs_general.js --- firefox-54.0~b1+build1/testing/profiles/prefs_general.js 2017-04-20 12:54:21.000000000 +0000 +++ firefox-54.0~b2+build1/testing/profiles/prefs_general.js 2017-04-25 05:28:31.000000000 +0000 @@ -368,3 +368,6 @@ // The prefs recommended by Marionette are typically geared towards // consumer automation; not vendor testing. user_pref("marionette.prefs.recommended", false); + +// Disable Screenshots by default for now +user_pref("extensions.screenshots.system-disabled", true); diff -Nru firefox-54.0~b1+build1/testing/talos/talos/xtalos/xperf_whitelist.json firefox-54.0~b2+build1/testing/talos/talos/xtalos/xperf_whitelist.json --- firefox-54.0~b1+build1/testing/talos/talos/xtalos/xperf_whitelist.json 2017-04-20 12:54:22.000000000 +0000 +++ firefox-54.0~b2+build1/testing/talos/talos/xtalos/xperf_whitelist.json 2017-04-25 05:28:31.000000000 +0000 @@ -16,6 +16,8 @@ "{firefox}\\browser\\features\\webcompat@mozilla.org.xpi": {"mincount": 0, "maxcount": 100, "minbytes": 0, "maxbytes": 10000000}, "{firefox}\\browser\\features\\webcompat-reporter@mozilla.org.xpi": {"mincount": 0, "maxcount": 100, "minbytes": 0, "maxbytes": 10000000}, "{firefox}\\browser\\features\\shield-recipe-client@mozilla.org.xpi": {"mincount": 0, "maxcount": 100, "minbytes": 0, "maxbytes": 10000000}, + "{firefox}\\browser\\features\\activity-stream@mozilla.org.xpi": {"mincount": 0, "maxcount": 100, "minbytes": 0, "maxbytes": 10000000}, + "{firefox}\\browser\\features\\screenshots@mozilla.org.xpi": {"mincount": 0, "maxcount": 100, "minbytes": 0, "maxbytes": 10000000}, "{talos}\\talos\\tests\\tp5n\\tp5n.manifest": {"mincount": 0, "maxcount": 8, "minbytes": 0, "maxbytes": 32786}, "{talos}\\talos\\tests\\tp5n\\tp5n.manifest.develop": {"mincount": 0, "maxcount": 8, "minbytes": 0, "maxbytes": 32786}, "{profile}\\localstore.rdf": {"mincount": 2, "maxcount": 2, "minbytes": 8192, "maxbytes": 8192}, diff -Nru firefox-54.0~b1+build1/toolkit/components/crashes/CrashManager.jsm firefox-54.0~b2+build1/toolkit/components/crashes/CrashManager.jsm --- firefox-54.0~b1+build1/toolkit/components/crashes/CrashManager.jsm 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/toolkit/components/crashes/CrashManager.jsm 2017-04-25 05:28:34.000000000 +0000 @@ -455,8 +455,9 @@ deferred.resolve(); } - // Send a telemetry ping for each content process crash - if (processType === this.PROCESS_TYPE_CONTENT) { + // Send a telemetry ping for each non-main process crash + if (processType === this.PROCESS_TYPE_CONTENT || + processType === this.PROCESS_TYPE_GPU) { this._sendCrashPing(id, processType, date, metadata); } }.bind(this)); diff -Nru firefox-54.0~b1+build1/toolkit/components/crashes/tests/xpcshell/test_crash_manager.js firefox-54.0~b2+build1/toolkit/components/crashes/tests/xpcshell/test_crash_manager.js --- firefox-54.0~b1+build1/toolkit/components/crashes/tests/xpcshell/test_crash_manager.js 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/toolkit/components/crashes/tests/xpcshell/test_crash_manager.js 2017-04-25 05:28:33.000000000 +0000 @@ -458,26 +458,59 @@ Assert.ok(crash.isOfType(m.PROCESS_TYPE_CONTENT, m.CRASH_TYPE_HANG)); }); -add_task(function* test_content_crash_ping() { +add_task(function* test_child_process_crash_ping() { + let m = yield getManager(); + const EXPECTED_PROCESSES = [ + m.PROCESS_TYPE_CONTENT, + m.PROCESS_TYPE_GPU, + ]; + + const UNEXPECTED_PROCESSES = [ + m.PROCESS_TYPE_PLUGIN, + m.PROCESS_TYPE_GMPLUGIN, + null, + 12, // non-string process type + ]; + let ac = new TelemetryArchiveTesting.Checker(); yield ac.promiseInit(); - let m = yield getManager(); - let id = yield m.createDummyDump(); - yield m.addCrash(m.PROCESS_TYPE_CONTENT, m.CRASH_TYPE_CRASH, id, DUMMY_DATE, { - StackTraces: stackTraces, - ThisShouldNot: "end-up-in-the-ping" - }); - yield m._pingPromise; - - let found = yield ac.promiseFindPing("crash", [ - [["payload", "crashId"], id], - [["payload", "processType"], m.PROCESS_TYPE_CONTENT], - [["payload", "stackTraces", "status"], "OK"], - ]); - Assert.ok(found, "Telemetry ping submitted for content crash"); - Assert.equal(found.payload.metadata.ThisShouldNot, undefined, - "Non-whitelisted fields should be filtered out"); + // Add a child-process crash for each allowed process type. + for (let p of EXPECTED_PROCESSES) { + // Generate a ping. + let id = yield m.createDummyDump(); + yield m.addCrash(p, m.CRASH_TYPE_CRASH, id, DUMMY_DATE, { + StackTraces: stackTraces, + ThisShouldNot: "end-up-in-the-ping" + }); + yield m._pingPromise; + + let found = yield ac.promiseFindPing("crash", [ + [["payload", "crashId"], id], + [["payload", "processType"], p], + [["payload", "stackTraces", "status"], "OK"], + ]); + Assert.ok(found, "Telemetry ping submitted for " + p + " crash"); + Assert.equal(found.payload.metadata.ThisShouldNot, undefined, + "Non-whitelisted fields should be filtered out"); + } + + // Check that we don't generate a crash ping for invalid/unexpected process + // types. + for (let p of UNEXPECTED_PROCESSES) { + let id = yield m.createDummyDump(); + yield m.addCrash(p, m.CRASH_TYPE_CRASH, id, DUMMY_DATE, { + StackTraces: stackTraces, + ThisShouldNot: "end-up-in-the-ping" + }); + yield m._pingPromise; + + // Check that we didn't receive any new ping. + let found = yield ac.promiseFindPing("crash", [ + [["payload", "crashId"], id], + ]); + Assert.ok(!found, "No telemetry ping must be submitted for invalid process types"); + } }); add_task(function* test_generateSubmissionID() { diff -Nru firefox-54.0~b1+build1/toolkit/components/places/tests/unit/test_telemetry.js firefox-54.0~b2+build1/toolkit/components/places/tests/unit/test_telemetry.js --- firefox-54.0~b1+build1/toolkit/components/places/tests/unit/test_telemetry.js 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/toolkit/components/places/tests/unit/test_telemetry.js 2017-04-25 05:28:34.000000000 +0000 @@ -17,7 +17,7 @@ PLACES_DATABASE_SIZE_PER_PAGE_B: val => do_check_true(val > 0), PLACES_EXPIRATION_STEPS_TO_CLEAN2: val => do_check_true(val > 1), // PLACES_AUTOCOMPLETE_1ST_RESULT_TIME_MS: val => do_check_true(val > 1), - PLACES_IDLE_FRECENCY_DECAY_TIME_MS: val => do_check_true(val > 0), + PLACES_IDLE_FRECENCY_DECAY_TIME_MS: val => do_check_true(val >= 0), PLACES_IDLE_MAINTENANCE_TIME_MS: val => do_check_true(val > 0), // One from the `setItemAnnotation` call; the other from the mobile root. // This can be removed along with the anno in bug 1306445. diff -Nru firefox-54.0~b1+build1/toolkit/components/telemetry/docs/data/crash-ping.rst firefox-54.0~b2+build1/toolkit/components/telemetry/docs/data/crash-ping.rst --- firefox-54.0~b1+build1/toolkit/components/telemetry/docs/data/crash-ping.rst 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/toolkit/components/telemetry/docs/data/crash-ping.rst 2017-04-25 05:28:34.000000000 +0000 @@ -2,13 +2,13 @@ "crash" ping ============ -This ping is captured after the main Firefox process crashes or after a content +This ping is captured after the main Firefox process crashes or after a child process process crashes, whether or not the crash report is submitted to crash-stats.mozilla.org. It includes non-identifying metadata about the crash. This ping is sent either by the ```CrashManager``` or by the crash reporter client. The ```CrashManager``` is responsible for sending crash pings for the -content process crashes, which are sent right after the crash is detected, +child processes crashes, which are sent right after the crash is detected, as well as for main process crashes, which are sent after Firefox restarts successfully. The crash reporter client sends crash pings only for main process crashes whether or not the user also reports the crash. The crash reporter @@ -87,6 +87,8 @@ +---------------+---------------------------------------------------+ | content | Content process | +---------------+---------------------------------------------------+ +| gpu | GPU process | ++---------------+---------------------------------------------------+ Stack Traces ------------ diff -Nru firefox-54.0~b1+build1/toolkit/components/telemetry/docs/data/environment.rst firefox-54.0~b2+build1/toolkit/components/telemetry/docs/data/environment.rst --- firefox-54.0~b1+build1/toolkit/components/telemetry/docs/data/environment.rst 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/toolkit/components/telemetry/docs/data/environment.rst 2017-04-25 05:28:34.000000000 +0000 @@ -213,6 +213,7 @@ updateDay: , // days since UNIX epoch, 0 on failure signedState: , // whether the add-on is signed by AMO, only present for extensions isSystem: , // true if this is a System Add-on + isWebExtension: , // true if this is a WebExtension }, ... }, diff -Nru firefox-54.0~b1+build1/toolkit/components/telemetry/TelemetryEnvironment.jsm firefox-54.0~b2+build1/toolkit/components/telemetry/TelemetryEnvironment.jsm --- firefox-54.0~b1+build1/toolkit/components/telemetry/TelemetryEnvironment.jsm 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/toolkit/components/telemetry/TelemetryEnvironment.jsm 2017-04-25 05:28:34.000000000 +0000 @@ -198,6 +198,8 @@ ["extensions.update.enabled", {what: RECORD_PREF_VALUE}], ["extensions.update.url", {what: RECORD_PREF_VALUE}], ["extensions.update.background.url", {what: RECORD_PREF_VALUE}], + ["extensions.screenshots.disabled", {what: RECORD_PREF_VALUE}], + ["extensions.screenshots.system-disabled", {what: RECORD_PREF_VALUE}], ["general.smoothScroll", {what: RECORD_PREF_VALUE}], ["gfx.direct2d.disabled", {what: RECORD_PREF_VALUE}], ["gfx.direct2d.force-enabled", {what: RECORD_PREF_VALUE}], @@ -625,6 +627,7 @@ updateDay: Utils.millisecondsToDays(updateDate.getTime()), signedState: addon.signedState, isSystem: addon.isSystem, + isWebExtension: addon.isWebExtension, }; if (addon.signedState !== undefined) diff -Nru firefox-54.0~b1+build1/toolkit/components/telemetry/tests/unit/test_TelemetryEnvironment.js firefox-54.0~b2+build1/toolkit/components/telemetry/tests/unit/test_TelemetryEnvironment.js --- firefox-54.0~b1+build1/toolkit/components/telemetry/tests/unit/test_TelemetryEnvironment.js 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/toolkit/components/telemetry/tests/unit/test_TelemetryEnvironment.js 2017-04-25 05:28:34.000000000 +0000 @@ -22,6 +22,9 @@ XPCOMUtils.defineLazyModuleGetter(this, "ProfileAge", "resource://gre/modules/ProfileAge.jsm"); +XPCOMUtils.defineLazyModuleGetter(this, "ExtensionTestUtils", + "resource://testing-common/ExtensionXPCShellUtils.jsm"); + // The webserver hosting the addons. var gHttpServer = null; // The URL of the webserver root. @@ -673,6 +676,7 @@ updateDay: "number", signedState, isSystem: "boolean", + isWebExtension: "boolean", }; for (let f in EXPECTED_ADDON_FIELDS_TYPES) { @@ -1111,6 +1115,7 @@ updateDay: ADDON_INSTALL_DATE, signedState: mozinfo.addon_signing ? AddonManager.SIGNEDSTATE_SIGNED : AddonManager.SIGNEDSTATE_NOT_REQUIRED, isSystem: false, + isWebExtension: false, }; const SYSTEM_ADDON_ID = "tel-system-xpi@tests.mozilla.org"; const EXPECTED_SYSTEM_ADDON_DATA = { @@ -1128,6 +1133,27 @@ updateDay: truncateToDays(SYSTEM_ADDON_INSTALL_DATE), signedState: undefined, isSystem: true, + isWebExtension: false, + }; + + const WEBEXTENSION_ADDON_ID = "tel-webextension-xpi@tests.mozilla.org"; + const WEBEXTENSION_ADDON_INSTALL_DATE = truncateToDays(Date.now()); + const EXPECTED_WEBEXTENSION_ADDON_DATA = { + blocklisted: false, + description: "A webextension addon.", + name: "XPI Telemetry WebExtension Add-on Test", + userDisabled: false, + appDisabled: false, + version: "1.0", + scope: 1, + type: "extension", + foreignInstall: false, + hasBinaryComponents: false, + installDay: WEBEXTENSION_ADDON_INSTALL_DATE, + updateDay: WEBEXTENSION_ADDON_INSTALL_DATE, + signedState: mozinfo.addon_signing ? AddonManager.SIGNEDSTATE_SIGNED : AddonManager.SIGNEDSTATE_NOT_REQUIRED, + isSystem: false, + isWebExtension: true, }; const EXPECTED_PLUGIN_DATA = { @@ -1139,9 +1165,38 @@ clicktoplay: true, }; - // Install an addon so we have some data. + let deferred = PromiseUtils.defer(); + TelemetryEnvironment.registerChangeListener("test_WebExtension", + (reason, data) => { + Assert.equal(reason, "addons-changed"); + deferred.resolve(); + } + ); + + // Install an add-on so we have some data. yield AddonManagerTesting.installXPIFromURL(ADDON_INSTALL_URL); + // Install a webextension as well. + ExtensionTestUtils.init(this); + + let webextension = ExtensionTestUtils.loadExtension({ + useAddonManager: "permanent", + manifest: { + "name": "XPI Telemetry WebExtension Add-on Test", + "description": "A webextension addon.", + "version": "1.0", + "applications": { + "gecko": { + "id": WEBEXTENSION_ADDON_ID, + }, + }, + }, + }); + + yield webextension.startup(); + yield deferred.promise; + TelemetryEnvironment.unregisterChangeListener("test_WebExtension"); + let data = TelemetryEnvironment.currentEnvironment; checkEnvironmentData(data); @@ -1159,6 +1214,15 @@ Assert.equal(targetSystemAddon[f], EXPECTED_SYSTEM_ADDON_DATA[f], f + " must have the correct value."); } + // Check webextension add-on data. + Assert.ok(WEBEXTENSION_ADDON_ID in data.addons.activeAddons, "We must have one active webextension addon."); + let targetWebExtensionAddon = data.addons.activeAddons[WEBEXTENSION_ADDON_ID]; + for (let f in EXPECTED_WEBEXTENSION_ADDON_DATA) { + Assert.equal(targetWebExtensionAddon[f], EXPECTED_WEBEXTENSION_ADDON_DATA[f], f + " must have the correct value."); + } + + yield webextension.unload(); + // Check theme data. let theme = data.addons.theme; Assert.equal(theme.id, (PERSONA_ID + PERSONA_ID_SUFFIX)); diff -Nru firefox-54.0~b1+build1/toolkit/content/license.html firefox-54.0~b2+build1/toolkit/content/license.html --- firefox-54.0~b1+build1/toolkit/content/license.html 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/toolkit/content/license.html 2017-04-25 05:28:34.000000000 +0000 @@ -145,6 +145,7 @@
  • praton and inet_ntop License
  • qcms License
  • QR Code Generator License
  • +
  • Raven.js License
  • React License
  • React-Redux License
  • React Virtualized License
  • @@ -4903,6 +4904,37 @@ THE SOFTWARE. +
    + +

    Raven.js License

    + +

    This license applies to the file + browser/extensions/screenshots/webextension/build/raven.js.

    +
    +Copyright (c) 2014 Matt Robenolt and other contributors
    +All rights reserved.
    +
    +Redistribution and use in source and binary forms, with or without modification,
    +are permitted provided that the following conditions are met:
    +
    +* Redistributions of source code must retain the above copyright notice, this
    +  list of conditions and the following disclaimer.
    +
    +* Redistributions in binary form must reproduce the above copyright notice, this
    +  list of conditions and the following disclaimer in the documentation and/or
    +  other materials provided with the distribution.
    +
    +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
    +ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
    +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
    +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR
    +ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
    +(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
    +LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON
    +ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
    +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
    +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
    +

    diff -Nru firefox-54.0~b1+build1/toolkit/content/minimal-xul.css firefox-54.0~b2+build1/toolkit/content/minimal-xul.css --- firefox-54.0~b1+build1/toolkit/content/minimal-xul.css 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/toolkit/content/minimal-xul.css 2017-04-25 05:28:34.000000000 +0000 @@ -22,6 +22,7 @@ @namespace html url("http://www.w3.org/1999/xhtml"); /* namespace for HTML elements */ * { + appearance: auto; /* make -moz-appearance work on all XUL elements */ -moz-user-focus: ignore; -moz-user-select: none; display: -moz-box; diff -Nru firefox-54.0~b1+build1/toolkit/mozapps/extensions/test/browser/browser-common.ini firefox-54.0~b2+build1/toolkit/mozapps/extensions/test/browser/browser-common.ini --- firefox-54.0~b1+build1/toolkit/mozapps/extensions/test/browser/browser-common.ini 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/toolkit/mozapps/extensions/test/browser/browser-common.ini 2017-04-25 05:28:34.000000000 +0000 @@ -57,6 +57,7 @@ [browser_types.js] [browser_inlinesettings.js] [browser_inlinesettings_browser.js] +skip-if = os == 'win' # Disabled on Windows due to highly frequent intermittent failures (bug 1355998) [browser_inlinesettings_custom.js] [browser_inlinesettings_info.js] [browser_tabsettings.js] diff -Nru firefox-54.0~b1+build1/uriloader/exthandler/nsExternalHelperAppService.cpp firefox-54.0~b2+build1/uriloader/exthandler/nsExternalHelperAppService.cpp --- firefox-54.0~b1+build1/uriloader/exthandler/nsExternalHelperAppService.cpp 2017-04-20 12:54:26.000000000 +0000 +++ firefox-54.0~b2+build1/uriloader/exthandler/nsExternalHelperAppService.cpp 2017-04-25 05:28:34.000000000 +0000 @@ -2720,14 +2720,12 @@ } // Ask OS. - bool found = false; - nsCOMPtr mi = GetMIMEInfoFromOS(EmptyCString(), aFileExt, &found); - if (mi && found) { - return mi->GetMIMEType(aContentType); + if (GetMIMETypeFromOSForExtension(aFileExt, aContentType)) { + return NS_OK; } // Check extras array. - found = GetTypeFromExtras(aFileExt, aContentType); + bool found = GetTypeFromExtras(aFileExt, aContentType); if (found) { return NS_OK; } @@ -2926,3 +2924,11 @@ return false; } + +bool +nsExternalHelperAppService::GetMIMETypeFromOSForExtension(const nsACString& aExtension, nsACString& aMIMEType) +{ + bool found = false; + nsCOMPtr mimeInfo = GetMIMEInfoFromOS(EmptyCString(), aExtension, &found); + return found && mimeInfo && NS_SUCCEEDED(mimeInfo->GetMIMEType(aMIMEType)); +} diff -Nru firefox-54.0~b1+build1/uriloader/exthandler/nsExternalHelperAppService.h firefox-54.0~b2+build1/uriloader/exthandler/nsExternalHelperAppService.h --- firefox-54.0~b1+build1/uriloader/exthandler/nsExternalHelperAppService.h 2017-04-20 12:54:26.000000000 +0000 +++ firefox-54.0~b2+build1/uriloader/exthandler/nsExternalHelperAppService.h 2017-04-25 05:28:34.000000000 +0000 @@ -108,6 +108,15 @@ virtual nsresult OSProtocolHandlerExists(const char *aScheme, bool *aExists) = 0; + /** + * Given an extension, get a MIME type string. If not overridden by + * the OS-specific nsOSHelperAppService, will call into GetMIMEInfoFromOS + * with an empty mimetype. + * @return true if we successfully found a mimetype. + */ + virtual bool GetMIMETypeFromOSForExtension(const nsACString& aExtension, + nsACString& aMIMEType); + protected: virtual ~nsExternalHelperAppService(); diff -Nru firefox-54.0~b1+build1/uriloader/exthandler/win/nsOSHelperAppService.cpp firefox-54.0~b2+build1/uriloader/exthandler/win/nsOSHelperAppService.cpp --- firefox-54.0~b1+build1/uriloader/exthandler/win/nsOSHelperAppService.cpp 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/uriloader/exthandler/win/nsOSHelperAppService.cpp 2017-04-25 05:28:34.000000000 +0000 @@ -395,43 +395,25 @@ if (aFileExt.IsEmpty()) return nullptr; - // windows registry assumes your file extension is going to include the '.'. - // so make sure it's there... - nsAutoString fileExtToUse; - if (aFileExt.First() != char16_t('.')) - fileExtToUse = char16_t('.'); - - fileExtToUse.Append(aFileExt); - - // Try to get an entry from the windows registry. - nsCOMPtr regKey = - do_CreateInstance("@mozilla.org/windows-registry-key;1"); - if (!regKey) - return nullptr; - - nsresult rv = regKey->Open(nsIWindowsRegKey::ROOT_KEY_CLASSES_ROOT, - fileExtToUse, - nsIWindowsRegKey::ACCESS_QUERY_VALUE); - if (NS_FAILED(rv)) - return nullptr; - + // Determine the mime type. nsAutoCString typeToUse; if (aTypeHint && *aTypeHint) { typeToUse.Assign(aTypeHint); - } - else { - nsAutoString temp; - if (NS_FAILED(regKey->ReadStringValue(NS_LITERAL_STRING("Content Type"), - temp)) || temp.IsEmpty()) { - return nullptr; - } - // Content-Type is always in ASCII - LossyAppendUTF16toASCII(temp, typeToUse); + } else if (!GetMIMETypeFromOSForExtension(NS_ConvertUTF16toUTF8(aFileExt), typeToUse)) { + return nullptr; } RefPtr mimeInfo = new nsMIMEInfoWin(typeToUse); - // don't append the '.' + // windows registry assumes your file extension is going to include the '.', + // but our APIs expect it to not be there, so make sure we normalize that bit. + nsAutoString fileExtToUse; + if (aFileExt.First() != char16_t('.')) + fileExtToUse = char16_t('.'); + + fileExtToUse.Append(aFileExt); + + // don't append the '.' for our APIs. mimeInfo->AppendExtension(NS_ConvertUTF16toUTF8(Substring(fileExtToUse, 1))); mimeInfo->SetPreferredAction(nsIMIMEInfo::useSystemDefault); @@ -458,8 +440,17 @@ } else { - found = NS_SUCCEEDED(regKey->ReadStringValue(EmptyString(), - appInfo)); + nsCOMPtr regKey = + do_CreateInstance("@mozilla.org/windows-registry-key;1"); + if (!regKey) + return nullptr; + nsresult rv = regKey->Open(nsIWindowsRegKey::ROOT_KEY_CLASSES_ROOT, + fileExtToUse, + nsIWindowsRegKey::ACCESS_QUERY_VALUE); + if (NS_SUCCEEDED(rv)) { + found = NS_SUCCEEDED(regKey->ReadStringValue(EmptyString(), + appInfo)); + } } // Bug 358297 - ignore the default handler, force the user to choose app @@ -596,3 +587,40 @@ return NS_OK; } +bool +nsOSHelperAppService::GetMIMETypeFromOSForExtension(const nsACString& aExtension, + nsACString& aMIMEType) +{ + if (aExtension.IsEmpty()) + return false; + + // windows registry assumes your file extension is going to include the '.'. + // so make sure it's there... + nsAutoString fileExtToUse; + if (aExtension.First() != '.') + fileExtToUse = char16_t('.'); + + AppendUTF8toUTF16(aExtension, fileExtToUse); + + // Try to get an entry from the windows registry. + nsCOMPtr regKey = + do_CreateInstance("@mozilla.org/windows-registry-key;1"); + if (!regKey) + return false; + + nsresult rv = regKey->Open(nsIWindowsRegKey::ROOT_KEY_CLASSES_ROOT, + fileExtToUse, + nsIWindowsRegKey::ACCESS_QUERY_VALUE); + if (NS_FAILED(rv)) + return false; + + nsAutoString mimeType; + if (NS_FAILED(regKey->ReadStringValue(NS_LITERAL_STRING("Content Type"), + mimeType)) || mimeType.IsEmpty()) { + return false; + } + // Content-Type is always in ASCII + aMIMEType.Truncate(); + LossyAppendUTF16toASCII(mimeType, aMIMEType); + return true; +} diff -Nru firefox-54.0~b1+build1/uriloader/exthandler/win/nsOSHelperAppService.h firefox-54.0~b2+build1/uriloader/exthandler/win/nsOSHelperAppService.h --- firefox-54.0~b1+build1/uriloader/exthandler/win/nsOSHelperAppService.h 2017-04-20 12:54:26.000000000 +0000 +++ firefox-54.0~b2+build1/uriloader/exthandler/win/nsOSHelperAppService.h 2017-04-25 05:28:34.000000000 +0000 @@ -40,6 +40,8 @@ NS_IMETHOD GetProtocolHandlerInfoFromOS(const nsACString &aScheme, bool *found, nsIHandlerInfo **_retval); + virtual bool GetMIMETypeFromOSForExtension(const nsACString& aExtension, + nsACString& aMIMEType) override; /** Get the string value of a registry value and store it in result. * @return true on success, false on failure diff -Nru firefox-54.0~b1+build1/widget/android/nsAppShell.cpp firefox-54.0~b2+build1/widget/android/nsAppShell.cpp --- firefox-54.0~b1+build1/widget/android/nsAppShell.cpp 2017-04-20 12:54:26.000000000 +0000 +++ firefox-54.0~b2+build1/widget/android/nsAppShell.cpp 2017-04-25 05:28:34.000000000 +0000 @@ -599,8 +599,8 @@ java::GeckoThread::State::PROFILE_READY(), java::GeckoThread::State::RUNNING()); } + removeObserver = true; } - removeObserver = true; } else if (!strcmp(aTopic, "quit-application-granted")) { if (jni::IsAvailable()) { diff -Nru firefox-54.0~b1+build1/widget/reftests/507947.html firefox-54.0~b2+build1/widget/reftests/507947.html --- firefox-54.0~b1+build1/widget/reftests/507947.html 2017-04-20 12:54:26.000000000 +0000 +++ firefox-54.0~b2+build1/widget/reftests/507947.html 2017-04-25 05:28:34.000000000 +0000 @@ -1,2 +1,2 @@ -
    +
    diff -Nru firefox-54.0~b1+build1/widget/reftests/664925.xhtml firefox-54.0~b2+build1/widget/reftests/664925.xhtml --- firefox-54.0~b1+build1/widget/reftests/664925.xhtml 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/widget/reftests/664925.xhtml 2017-04-25 05:28:35.000000000 +0000 @@ -1 +1 @@ -
    +
    diff -Nru firefox-54.0~b1+build1/widget/reftests/reftest.list firefox-54.0~b2+build1/widget/reftests/reftest.list --- firefox-54.0~b1+build1/widget/reftests/reftest.list 2017-04-20 12:54:26.000000000 +0000 +++ firefox-54.0~b2+build1/widget/reftests/reftest.list 2017-04-25 05:28:35.000000000 +0000 @@ -1,6 +1,6 @@ -pref(layout.css.moz-appearance.enabled,true) skip-if(!cocoaWidget) != 507947.html about:blank +pref(layout.css.moz-appearance.enabled,true) pref(layout.css.appearance.enabled,true) skip-if(!cocoaWidget) != 507947.html about:blank pref(layout.css.moz-appearance.enabled,true) == progressbar-fallback-default-style.html progressbar-fallback-default-style-ref.html fuzzy-if(Android,17,1120) == meter-native-style.html meter-native-style-ref.html skip-if(!cocoaWidget) == meter-vertical-native-style.html meter-vertical-native-style-ref.html # dithering pref(layout.css.moz-appearance.enabled,true) == meter-fallback-default-style.html meter-fallback-default-style-ref.html -pref(layout.css.moz-appearance.enabled,true) load 664925.xhtml +pref(layout.css.moz-appearance.enabled,true) pref(layout.css.appearance.enabled,true) load 664925.xhtml diff -Nru firefox-54.0~b1+build1/widget/windows/nsWindow.cpp firefox-54.0~b2+build1/widget/windows/nsWindow.cpp --- firefox-54.0~b1+build1/widget/windows/nsWindow.cpp 2017-04-20 12:54:25.000000000 +0000 +++ firefox-54.0~b2+build1/widget/windows/nsWindow.cpp 2017-04-25 05:28:35.000000000 +0000 @@ -3044,6 +3044,7 @@ } if (nsWindowType::eWindowType_toplevel == window->mWindowType && + mTransparencyMode != aMode && !nsUXThemeData::CheckForCompositor()) { NS_WARNING("Cannot set transparency mode on top-level windows."); return;